FGFS-4.1/phpvms
4
0
Fork 0
Code Issues Pull Requests Packages Projects Releases Wiki Activity
a1a8c6f141
phpvms/public/assets/admin/js/app.js
Nabeel Shahzad a1a8c6f141 strip unnecessary imports from js app files
2018-03-27 18:18:25 -05:00

821 lines
1.6 MiB
Raw Blame History

This file contains ambiguous Unicode characters

This file contains Unicode characters that might be confused with other characters. If you think that this is intentional, you can safely ignore this warning. Use the Escape button to reveal them.

/******/ (function(modules) { // webpackBootstrap
/******/ // The module cache
/******/ var installedModules = {};
/******/
/******/ // The require function
/******/ function __webpack_require__(moduleId) {
/******/
/******/ // Check if module is in cache
/******/ if(installedModules[moduleId]) {
/******/ return installedModules[moduleId].exports;
/******/ }
/******/ // Create a new module (and put it into the cache)
/******/ var module = installedModules[moduleId] = {
/******/ i: moduleId,
/******/ l: false,
/******/ exports: {}
/******/ };
/******/
/******/ // Execute the module function
/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
/******/
/******/ // Flag the module as loaded
/******/ module.l = true;
/******/
/******/ // Return the exports of the module
/******/ return module.exports;
/******/ }
/******/
/******/
/******/ // expose the modules object (__webpack_modules__)
/******/ __webpack_require__.m = modules;
/******/
/******/ // expose the module cache
/******/ __webpack_require__.c = installedModules;
/******/
/******/ // define getter function for harmony exports
/******/ __webpack_require__.d = function(exports, name, getter) {
/******/ if(!__webpack_require__.o(exports, name)) {
/******/ Object.defineProperty(exports, name, {
/******/ configurable: false,
/******/ enumerable: true,
/******/ get: getter
/******/ });
/******/ }
/******/ };
/******/
/******/ // define __esModule on exports
/******/ __webpack_require__.r = function(exports) {
/******/ Object.defineProperty(exports, '__esModule', { value: true });
/******/ };
/******/
/******/ // getDefaultExport function for compatibility with non-harmony modules
/******/ __webpack_require__.n = function(module) {
/******/ var getter = module && module.__esModule ?
/******/ function getDefault() { return module['default']; } :
/******/ function getModuleExports() { return module; };
/******/ __webpack_require__.d(getter, 'a', getter);
/******/ return getter;
/******/ };
/******/
/******/ // Object.prototype.hasOwnProperty.call
/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
/******/
/******/ // __webpack_public_path__
/******/ __webpack_require__.p = "";
/******/
/******/
/******/ // Load entry module and return exports
/******/ return __webpack_require__(__webpack_require__.s = "./resources/js/admin/app.js");
/******/ })
/************************************************************************/
/******/ ({
/***/ "../../../../../usr/local/lib/node_modules/webpack/buildin/global.js":
/*!***********************************!*\
!*** (webpack)/buildin/global.js ***!
\***********************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("var g;\r\n\r\n// This works in non-strict mode\r\ng = (function() {\r\n\treturn this;\r\n})();\r\n\r\ntry {\r\n\t// This works if eval is allowed (see CSP)\r\n\tg = g || Function(\"return this\")() || (1, eval)(\"this\");\r\n} catch (e) {\r\n\t// This works if the window reference is available\r\n\tif (typeof window === \"object\") g = window;\r\n}\r\n\r\n// g can still be undefined, but nothing to do about it...\r\n// We return undefined, instead of nothing here, so it's\r\n// easier to handle this case. if(!global) { ...}\r\n\r\nmodule.exports = g;\r\n\n\n//# sourceURL=webpack:///(webpack)/buildin/global.js?");
/***/ }),
/***/ "../../../../../usr/local/lib/node_modules/webpack/buildin/module.js":
/*!***********************************!*\
!*** (webpack)/buildin/module.js ***!
\***********************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("module.exports = function(module) {\r\n\tif (!module.webpackPolyfill) {\r\n\t\tmodule.deprecate = function() {};\r\n\t\tmodule.paths = [];\r\n\t\t// module.parent = undefined by default\r\n\t\tif (!module.children) module.children = [];\r\n\t\tObject.defineProperty(module, \"loaded\", {\r\n\t\t\tenumerable: true,\r\n\t\t\tget: function() {\r\n\t\t\t\treturn module.l;\r\n\t\t\t}\r\n\t\t});\r\n\t\tObject.defineProperty(module, \"id\", {\r\n\t\t\tenumerable: true,\r\n\t\t\tget: function() {\r\n\t\t\t\treturn module.i;\r\n\t\t\t}\r\n\t\t});\r\n\t\tmodule.webpackPolyfill = 1;\r\n\t}\r\n\treturn module;\r\n};\r\n\n\n//# sourceURL=webpack:///(webpack)/buildin/module.js?");
/***/ }),
/***/ "../../../../../usr/local/lib/node_modules/webpack/node_modules/process/browser.js":
/*!*************************************************!*\
!*** (webpack)/node_modules/process/browser.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("// shim for using process in browser\nvar process = module.exports = {};\n\n// cached from whatever global is present so that test runners that stub it\n// don't break things. But we need to wrap it in a try catch in case it is\n// wrapped in strict mode code which doesn't define any globals. It's inside a\n// function because try/catches deoptimize in certain engines.\n\nvar cachedSetTimeout;\nvar cachedClearTimeout;\n\nfunction defaultSetTimout() {\n throw new Error('setTimeout has not been defined');\n}\nfunction defaultClearTimeout () {\n throw new Error('clearTimeout has not been defined');\n}\n(function () {\n try {\n if (typeof setTimeout === 'function') {\n cachedSetTimeout = setTimeout;\n } else {\n cachedSetTimeout = defaultSetTimout;\n }\n } catch (e) {\n cachedSetTimeout = defaultSetTimout;\n }\n try {\n if (typeof clearTimeout === 'function') {\n cachedClearTimeout = clearTimeout;\n } else {\n cachedClearTimeout = defaultClearTimeout;\n }\n } catch (e) {\n cachedClearTimeout = defaultClearTimeout;\n }\n} ())\nfunction runTimeout(fun) {\n if (cachedSetTimeout === setTimeout) {\n //normal enviroments in sane situations\n return setTimeout(fun, 0);\n }\n // if setTimeout wasn't available but was latter defined\n if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {\n cachedSetTimeout = setTimeout;\n return setTimeout(fun, 0);\n }\n try {\n // when when somebody has screwed with setTimeout but no I.E. maddness\n return cachedSetTimeout(fun, 0);\n } catch(e){\n try {\n // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally\n return cachedSetTimeout.call(null, fun, 0);\n } catch(e){\n // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error\n return cachedSetTimeout.call(this, fun, 0);\n }\n }\n\n\n}\nfunction runClearTimeout(marker) {\n if (cachedClearTimeout === clearTimeout) {\n //normal enviroments in sane situations\n return clearTimeout(marker);\n }\n // if clearTimeout wasn't available but was latter defined\n if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {\n cachedClearTimeout = clearTimeout;\n return clearTimeout(marker);\n }\n try {\n // when when somebody has screwed with setTimeout but no I.E. maddness\n return cachedClearTimeout(marker);\n } catch (e){\n try {\n // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally\n return cachedClearTimeout.call(null, marker);\n } catch (e){\n // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.\n // Some versions of I.E. have different rules for clearTimeout vs setTimeout\n return cachedClearTimeout.call(this, marker);\n }\n }\n\n\n\n}\nvar queue = [];\nvar draining = false;\nvar currentQueue;\nvar queueIndex = -1;\n\nfunction cleanUpNextTick() {\n if (!draining || !currentQueue) {\n return;\n }\n draining = false;\n if (currentQueue.length) {\n queue = currentQueue.concat(queue);\n } else {\n queueIndex = -1;\n }\n if (queue.length) {\n drainQueue();\n }\n}\n\nfunction drainQueue() {\n if (draining) {\n return;\n }\n var timeout = runTimeout(cleanUpNextTick);\n draining = true;\n\n var len = queue.length;\n while(len) {\n currentQueue = queue;\n queue = [];\n while (++queueIndex < len) {\n if (currentQueue) {\n currentQueue[queueIndex].run();\n }\n }\n queueIndex = -1;\n len = queue.length;\n }\n currentQueue = null;\n draining = false;\n runClearTimeout(timeout);\n}\n\nprocess.nextTick = function (fun) {\n var args = new Array(arguments.length - 1);\n if (arguments.length > 1) {\n for (var i = 1; i < arguments.length; i++) {\n args[i - 1] = arguments[i];\n }\n }\n queue.push(new Item(fun, args));\n if (queue.length === 1 && !draining) {\n runTimeout(drainQueue);\n }\n};\n\n// v8 likes predictible objects\nfunction Item(fun, array) {\n this.fun = fun;\n this.array = array;\n}\nItem.prototype.run = function () {\n this.fun.apply(null, this.array);\n};\nprocess.title = 'browser';\nprocess.browser = true;\nprocess.env = {};\nprocess.argv = [];\nprocess.version = ''; // empty string to avoid regexp issues\nprocess.versions = {};\n\nfunction noop() {}\n\nprocess.on = noop;\nprocess.addListener = noop;\nprocess.once = noop;\nprocess.off = noop;\nprocess.removeListener = noop;\nprocess.removeAllListeners = noop;\nprocess.emit = noop;\nprocess.prependListener = noop;\nprocess.prependOnceListener = noop;\n\nprocess.listeners = function (name) { return [] }\n\nprocess.binding = function (name) {\n throw new Error('process.binding is not supported');\n};\n\nprocess.cwd = function () { return '/' };\nprocess.chdir = function (dir) {\n throw new Error('process.chdir is not supported');\n};\nprocess.umask = function() { return 0; };\n\n\n//# sourceURL=webpack:///(webpack)/node_modules/process/browser.js?");
/***/ }),
/***/ "./node_modules/Leaflet.Geodesic/Leaflet.Geodesic.js":
/*!***********************************************************!*\
!*** ./node_modules/Leaflet.Geodesic/Leaflet.Geodesic.js ***!
\***********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\n// This file is part of Leaflet.Geodesic.\n// Copyright (C) 2017 Henry Thasler\n// based on code by Chris Veness Copyright (C) 2014 https://github.com/chrisveness/geodesy\n//\n// Leaflet.Geodesic is free software: you can redistribute it and/or modify\n// it under the terms of the GNU General Public License as published by\n// the Free Software Foundation, either version 3 of the License, or\n// (at your option) any later version.\n//\n// Leaflet.Geodesic is distributed in the hope that it will be useful,\n// but WITHOUT ANY WARRANTY; without even the implied warranty of\n// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n// GNU General Public License for more details.\n//\n// You should have received a copy of the GNU General Public License\n// along with Leaflet.Geodesic. If not, see <http://www.gnu.org/licenses/>.\n\n\n/** Extend Number object with method to convert numeric degrees to radians */\nif (typeof Number.prototype.toRadians === \"undefined\") {\n Number.prototype.toRadians = function() {\n return this * Math.PI / 180;\n };\n}\n\n/** Extend Number object with method to convert radians to numeric (signed) degrees */\nif (typeof Number.prototype.toDegrees === \"undefined\") {\n Number.prototype.toDegrees = function() {\n return this * 180 / Math.PI;\n };\n}\n\nvar INTERSECT_LNG = 179.999; // Lng used for intersection and wrap around on map edges\n\nL.Geodesic = L.Polyline.extend({\n options: {\n color: \"blue\",\n steps: 10,\n dash: 1,\n wrap: true\n },\n\n initialize: function(latlngs, options) {\n this.options = this._merge_options(this.options, options);\n this.options.dash = Math.max(1e-3, Math.min(1, parseFloat(this.options.dash) || 1));\n this.datum = {};\n this.datum.ellipsoid = {\n a: 6378137,\n b: 6356752.3142,\n f: 1 / 298.257223563\n }; // WGS-84\n this._latlngs = this._generate_Geodesic(latlngs);\n L.Polyline.prototype.initialize.call(this, this._latlngs, this.options);\n },\n\n setLatLngs: function(latlngs) {\n this._latlngs = this._generate_Geodesic(latlngs);\n L.Polyline.prototype.setLatLngs.call(this, this._latlngs);\n },\n\n /**\n * Calculates some statistic values of current geodesic multipolyline\n * @returns (Object} Object with several properties (e.g. overall distance)\n */\n getStats: function() {\n let obj = {\n distance: 0,\n points: 0,\n polygons: this._latlngs.length\n }, poly, points;\n\n for (poly = 0; poly < this._latlngs.length; poly++) {\n obj.points += this._latlngs[poly].length;\n for (points = 0; points < (this._latlngs[poly].length - 1); points++) {\n obj.distance += this._vincenty_inverse(this._latlngs[poly][points],\n this._latlngs[poly][points + 1]).distance;\n }\n }\n return obj;\n },\n\n\n /**\n * Creates geodesic lines from geoJson. Replaces all current features of this instance.\n * Supports LineString, MultiLineString and Polygon\n * @param {Object} geojson - geosjon as object.\n */\n geoJson: function(geojson) {\n\n let normalized = L.GeoJSON.asFeature(geojson);\n let features = normalized.type === \"FeatureCollection\" ? normalized.features : [\n normalized\n ];\n this._latlngs = [];\n for (let feature of features) {\n let geometry = feature.type === \"Feature\" ? feature.geometry :\n feature,\n coords = geometry.coordinates;\n\n switch (geometry.type) {\n case \"LineString\":\n this._latlngs.push(this._generate_Geodesic([L.GeoJSON.coordsToLatLngs(\n coords, 0)]));\n break;\n case \"MultiLineString\":\n case \"Polygon\":\n this._latlngs.push(this._generate_Geodesic(L.GeoJSON.coordsToLatLngs(\n coords, 1)));\n break;\n case \"Point\":\n case \"MultiPoint\":\n console.log(\"Dude, points can't be drawn as geodesic lines...\");\n break;\n default:\n console.log(\"Drawing \" + geometry.type +\n \" as a geodesic is not supported. Skipping...\");\n }\n }\n L.Polyline.prototype.setLatLngs.call(this, this._latlngs);\n },\n\n /**\n * Creates a great circle. Replaces all current lines.\n * @param {Object} center - geographic position\n * @param {number} radius - radius of the circle in metres\n */\n createCircle: function(center, radius) {\n let polylineIndex = 0;\n let prev = {\n lat: 0,\n lng: 0,\n brg: 0\n };\n let step;\n\n this._latlngs = [];\n this._latlngs[polylineIndex] = [];\n\n let direct = this._vincenty_direct(L.latLng(center), 0, radius, this.options\n .wrap);\n prev = L.latLng(direct.lat, direct.lng);\n this._latlngs[polylineIndex].push(prev);\n for (step = 1; step <= this.options.steps;) {\n direct = this._vincenty_direct(L.latLng(center), 360 / this.options\n .steps * step, radius, this.options.wrap);\n let gp = L.latLng(direct.lat, direct.lng);\n if (Math.abs(gp.lng - prev.lng) > 180) {\n let inverse = this._vincenty_inverse(prev, gp);\n let sec = this._intersection(prev, inverse.initialBearing, {\n lat: -89,\n lng: ((gp.lng - prev.lng) > 0) ? -INTERSECT_LNG : INTERSECT_LNG\n }, 0);\n if (sec) {\n this._latlngs[polylineIndex].push(L.latLng(sec.lat, sec.lng));\n polylineIndex++;\n this._latlngs[polylineIndex] = [];\n prev = L.latLng(sec.lat, -sec.lng);\n this._latlngs[polylineIndex].push(prev);\n } else {\n polylineIndex++;\n this._latlngs[polylineIndex] = [];\n this._latlngs[polylineIndex].push(gp);\n prev = gp;\n step++;\n }\n } else {\n this._latlngs[polylineIndex].push(gp);\n prev = gp;\n step++;\n }\n }\n\n L.Polyline.prototype.setLatLngs.call(this, this._latlngs);\n },\n\n /**\n * Creates a geodesic Polyline from given coordinates\n * Note: dashed lines are under work\n * @param {Object} latlngs - One or more polylines as an array. See Leaflet doc about Polyline\n * @returns (Object} An array of arrays of geographical points.\n */\n _generate_Geodesic: function(latlngs) {\n let _geo = [], _geocnt = 0;\n\n for (let poly = 0; poly < latlngs.length; poly++) {\n _geo[_geocnt] = [];\n let prev = L.latLng(latlngs[poly][0]);\n for (let points = 0; points < (latlngs[poly].length - 1); points++) {\n // use prev, so that wrapping behaves correctly\n let pointA = prev;\n let pointB = L.latLng(latlngs[poly][points + 1]);\n if (pointA.equals(pointB)) {\n continue;\n }\n let inverse = this._vincenty_inverse(pointA, pointB);\n _geo[_geocnt].push(prev);\n for (let s = 1; s <= this.options.steps;) {\n let distance = inverse.distance / this.options.steps;\n // dashed lines don't go the full distance between the points\n let dist_mult = s - 1 + this.options.dash;\n let direct = this._vincenty_direct(pointA, inverse.initialBearing, distance*dist_mult, this.options.wrap);\n let gp = L.latLng(direct.lat, direct.lng);\n if (Math.abs(gp.lng - prev.lng) > 180) {\n let sec = this._intersection(pointA, inverse.initialBearing, {\n lat: -89,\n lng: ((gp.lng - prev.lng) > 0) ? -INTERSECT_LNG : INTERSECT_LNG\n }, 0);\n if (sec) {\n _geo[_geocnt].push(L.latLng(sec.lat, sec.lng));\n _geocnt++;\n _geo[_geocnt] = [];\n prev = L.latLng(sec.lat, -sec.lng);\n _geo[_geocnt].push(prev);\n } else {\n _geocnt++;\n _geo[_geocnt] = [];\n _geo[_geocnt].push(gp);\n prev = gp;\n s++;\n } \n } else {\n _geo[_geocnt].push(gp);\n // Dashed lines start a new line\n if (this.options.dash < 1){\n _geocnt++;\n // go full distance this time, to get starting point for next line\n let direct_full = this._vincenty_direct(pointA, inverse.initialBearing, distance*s, this.options.wrap);\n _geo[_geocnt] = [];\n prev = L.latLng(direct_full.lat, direct_full.lng);\n _geo[_geocnt].push(prev);\n }\n else prev = gp;\n s++;\n }\n }\n }\n _geocnt++;\n }\n return _geo;\n },\n\n /**\n * Vincenty direct calculation.\n * based on the work of Chris Veness (https://github.com/chrisveness/geodesy)\n *\n * @private\n * @param {number} initialBearing - Initial bearing in degrees from north.\n * @param {number} distance - Distance along bearing in metres.\n * @returns (Object} Object including point (destination point), finalBearing.\n */\n\n _vincenty_direct: function(p1, initialBearing, distance, wrap) {\n var φ1 = p1.lat.toRadians(),\n λ1 = p1.lng.toRadians();\n var α1 = initialBearing.toRadians();\n var s = distance;\n\n var a = this.datum.ellipsoid.a,\n b = this.datum.ellipsoid.b,\n f = this.datum.ellipsoid.f;\n\n var sinα1 = Math.sin(α1);\n var cosα1 = Math.cos(α1);\n\n var tanU1 = (1 - f) * Math.tan(φ1),\n cosU1 = 1 / Math.sqrt((1 + tanU1 * tanU1)),\n sinU1 = tanU1 * cosU1;\n var σ1 = Math.atan2(tanU1, cosα1);\n var sinα = cosU1 * sinα1;\n var cosSqα = 1 - sinα * sinα;\n var uSq = cosSqα * (a * a - b * b) / (b * b);\n var A = 1 + uSq / 16384 * (4096 + uSq * (-768 + uSq * (320 - 175 *\n uSq)));\n var B = uSq / 1024 * (256 + uSq * (-128 + uSq * (74 - 47 * uSq)));\n\n var σ = s / (b * A),\n σʹ, iterations = 0;\n var sinσ, cosσ;\n var cos2σM;\n do {\n cos2σM = Math.cos(2 * σ1 + σ);\n sinσ = Math.sin(σ);\n cosσ = Math.cos(σ);\n var Δσ = B * sinσ * (cos2σM + B / 4 * (cosσ * (-1 + 2 * cos2σM *\n cos2σM) -\n B / 6 * cos2σM * (-3 + 4 * sinσ * sinσ) * (-3 + 4 * cos2σM *\n cos2σM)));\n σʹ = σ;\n σ = s / (b * A) + Δσ;\n } while (Math.abs(σ - σʹ) > 1e-12 && ++iterations);\n\n var x = sinU1 * sinσ - cosU1 * cosσ * cosα1;\n var φ2 = Math.atan2(sinU1 * cosσ + cosU1 * sinσ * cosα1, (1 - f) *\n Math.sqrt(sinα * sinα + x * x));\n var λ = Math.atan2(sinσ * sinα1, cosU1 * cosσ - sinU1 * sinσ * cosα1);\n var C = f / 16 * cosSqα * (4 + f * (4 - 3 * cosSqα));\n var L = λ - (1 - C) * f * sinα *\n (σ + C * sinσ * (cos2σM + C * cosσ * (-1 + 2 * cos2σM * cos2σM)));\n\n var λ2;\n if (wrap) {\n λ2 = (λ1 + L + 3 * Math.PI) % (2 * Math.PI) - Math.PI; // normalise to -180...+180\n } else {\n λ2 = (λ1 + L); // do not normalize\n }\n\n var revAz = Math.atan2(sinα, -x);\n\n return {\n lat: φ2.toDegrees(),\n lng: λ2.toDegrees(),\n finalBearing: revAz.toDegrees()\n };\n },\n\n /**\n * Vincenty inverse calculation.\n * based on the work of Chris Veness (https://github.com/chrisveness/geodesy)\n *\n * @private\n * @param {LatLng} p1 - Latitude/longitude of start point.\n * @param {LatLng} p2 - Latitude/longitude of destination point.\n * @returns {Object} Object including distance, initialBearing, finalBearing.\n * @throws {Error} If formula failed to converge.\n */\n _vincenty_inverse: function(p1, p2) {\n var φ1 = p1.lat.toRadians(),\n λ1 = p1.lng.toRadians();\n var φ2 = p2.lat.toRadians(),\n λ2 = p2.lng.toRadians();\n\n var a = this.datum.ellipsoid.a,\n b = this.datum.ellipsoid.b,\n f = this.datum.ellipsoid.f;\n\n var L = λ2 - λ1;\n var tanU1 = (1 - f) * Math.tan(φ1),\n cosU1 = 1 / Math.sqrt((1 + tanU1 * tanU1)),\n sinU1 = tanU1 * cosU1;\n var tanU2 = (1 - f) * Math.tan(φ2),\n cosU2 = 1 / Math.sqrt((1 + tanU2 * tanU2)),\n sinU2 = tanU2 * cosU2;\n\n var λ = L,\n λʹ, iterations = 0;\n var cosSqα, sinσ, cos2σM, cosσ, σ, sinλ, cosλ;\n do {\n sinλ = Math.sin(λ);\n cosλ = Math.cos(λ);\n var sinSqσ = (cosU2 * sinλ) * (cosU2 * sinλ) + (cosU1 * sinU2 -\n sinU1 * cosU2 * cosλ) * (cosU1 * sinU2 - sinU1 * cosU2 * cosλ);\n sinσ = Math.sqrt(sinSqσ);\n if (sinσ == 0) return 0; // co-incident points\n cosσ = sinU1 * sinU2 + cosU1 * cosU2 * cosλ;\n σ = Math.atan2(sinσ, cosσ);\n var sinα = cosU1 * cosU2 * sinλ / sinσ;\n cosSqα = 1 - sinα * sinα;\n cos2σM = cosσ - 2 * sinU1 * sinU2 / cosSqα;\n if (isNaN(cos2σM)) cos2σM = 0; // equatorial line: cosSqα=0 (§6)\n var C = f / 16 * cosSqα * (4 + f * (4 - 3 * cosSqα));\n λʹ = λ;\n λ = L + (1 - C) * f * sinα * (σ + C * sinσ * (cos2σM + C * cosσ * (-\n 1 + 2 * cos2σM * cos2σM)));\n } while (Math.abs(λ - λʹ) > 1e-12 && ++iterations < 100);\n if (iterations >= 100) {\n console.log(\"Formula failed to converge. Altering target position.\");\n return this._vincenty_inverse(p1, {\n lat: p2.lat,\n lng: p2.lng - 0.01\n });\n // throw new Error('Formula failed to converge');\n }\n\n var uSq = cosSqα * (a * a - b * b) / (b * b);\n var A = 1 + uSq / 16384 * (4096 + uSq * (-768 + uSq * (320 - 175 *\n uSq)));\n var B = uSq / 1024 * (256 + uSq * (-128 + uSq * (74 - 47 * uSq)));\n var Δσ = B * sinσ * (cos2σM + B / 4 * (cosσ * (-1 + 2 * cos2σM *\n cos2σM) -\n B / 6 * cos2σM * (-3 + 4 * sinσ * sinσ) * (-3 + 4 * cos2σM *\n cos2σM)));\n\n var s = b * A * (σ - Δσ);\n\n var fwdAz = Math.atan2(cosU2 * sinλ, cosU1 * sinU2 - sinU1 * cosU2 *\n cosλ);\n var revAz = Math.atan2(cosU1 * sinλ, -sinU1 * cosU2 + cosU1 * sinU2 *\n cosλ);\n\n s = Number(s.toFixed(3)); // round to 1mm precision\n return {\n distance: s,\n initialBearing: fwdAz.toDegrees(),\n finalBearing: revAz.toDegrees()\n };\n },\n\n\n /**\n * Returns the point of intersection of two paths defined by point and bearing.\n * based on the work of Chris Veness (https://github.com/chrisveness/geodesy)\n *\n * @param {LatLon} p1 - First point.\n * @param {number} brng1 - Initial bearing from first point.\n * @param {LatLon} p2 - Second point.\n * @param {number} brng2 - Initial bearing from second point.\n * @returns {Object} containing lat/lng information of intersection.\n *\n * @example\n * var p1 = LatLon(51.8853, 0.2545), brng1 = 108.55;\n * var p2 = LatLon(49.0034, 2.5735), brng2 = 32.44;\n * var pInt = LatLon.intersection(p1, brng1, p2, brng2); // pInt.toString(): 50.9078°N, 4.5084°E\n */\n _intersection: function(p1, brng1, p2, brng2) {\n // see http://williams.best.vwh.net/avform.htm#Intersection\n\n var φ1 = p1.lat.toRadians(),\n λ1 = p1.lng.toRadians();\n var φ2 = p2.lat.toRadians(),\n λ2 = p2.lng.toRadians();\n var θ13 = Number(brng1).toRadians(),\n θ23 = Number(brng2).toRadians();\n var Δφ = φ2 - φ1,\n Δλ = λ2 - λ1;\n\n var δ12 = 2 * Math.asin(Math.sqrt(Math.sin(Δφ / 2) * Math.sin(Δφ / 2) +\n Math.cos(φ1) * Math.cos(φ2) * Math.sin(Δλ / 2) * Math.sin(Δλ /\n 2)));\n if (δ12 == 0) return null;\n\n // initial/final bearings between points\n var θ1 = Math.acos((Math.sin(φ2) - Math.sin(φ1) * Math.cos(δ12)) /\n (Math.sin(δ12) * Math.cos(φ1)));\n if (isNaN(θ1)) θ1 = 0; // protect against rounding\n var θ2 = Math.acos((Math.sin(φ1) - Math.sin(φ2) * Math.cos(δ12)) /\n (Math.sin(δ12) * Math.cos(φ2)));\n var θ12, θ21;\n if (Math.sin(λ2 - λ1) > 0) {\n θ12 = θ1;\n θ21 = 2 * Math.PI - θ2;\n } else {\n θ12 = 2 * Math.PI - θ1;\n θ21 = θ2;\n }\n\n var α1 = (θ13 - θ12 + Math.PI) % (2 * Math.PI) - Math.PI; // angle 2-1-3\n var α2 = (θ21 - θ23 + Math.PI) % (2 * Math.PI) - Math.PI; // angle 1-2-3\n\n if (Math.sin(α1) == 0 && Math.sin(α2) == 0) return null; // infinite intersections\n if (Math.sin(α1) * Math.sin(α2) < 0) return null; // ambiguous intersection\n\n //α1 = Math.abs(α1);\n //α2 = Math.abs(α2);\n // ... Ed Williams takes abs of α1/α2, but seems to break calculation?\n\n var α3 = Math.acos(-Math.cos(α1) * Math.cos(α2) +\n Math.sin(α1) * Math.sin(α2) * Math.cos(δ12));\n var δ13 = Math.atan2(Math.sin(δ12) * Math.sin(α1) * Math.sin(α2),\n Math.cos(α2) + Math.cos(α1) * Math.cos(α3));\n var φ3 = Math.asin(Math.sin(φ1) * Math.cos(δ13) +\n Math.cos(φ1) * Math.sin(δ13) * Math.cos(θ13));\n var Δλ13 = Math.atan2(Math.sin(θ13) * Math.sin(δ13) * Math.cos(φ1),\n Math.cos(δ13) - Math.sin(φ1) * Math.sin(φ3));\n var λ3 = λ1 + Δλ13;\n λ3 = (λ3 + 3 * Math.PI) % (2 * Math.PI) - Math.PI; // normalise to -180..+180º\n\n return {\n lat: φ3.toDegrees(),\n lng: λ3.toDegrees()\n };\n },\n\n /**\n * Overwrites obj1's values with obj2's and adds obj2's if non existent in obj1\n * @param obj1\n * @param obj2\n * @returns obj3 a new object based on obj1 and obj2\n */\n _merge_options: function(obj1, obj2) {\n let obj3 = {};\n for (let attrname in obj1) {\n obj3[attrname] = obj1[attrname];\n }\n for (let attrname in obj2) {\n obj3[attrname] = obj2[attrname];\n }\n return obj3;\n }\n});\n\nL.geodesic = function(latlngs, options) {\n return new L.Geodesic(latlngs, options);\n};\n\n\n//# sourceURL=webpack:///./node_modules/Leaflet.Geodesic/Leaflet.Geodesic.js?");
/***/ }),
/***/ "./node_modules/axios/index.js":
/*!*************************************!*\
!*** ./node_modules/axios/index.js ***!
\*************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("module.exports = __webpack_require__(/*! ./lib/axios */ \"./node_modules/axios/lib/axios.js\");\n\n//# sourceURL=webpack:///./node_modules/axios/index.js?");
/***/ }),
/***/ "./node_modules/axios/lib/adapters/xhr.js":
/*!************************************************!*\
!*** ./node_modules/axios/lib/adapters/xhr.js ***!
\************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar utils = __webpack_require__(/*! ./../utils */ \"./node_modules/axios/lib/utils.js\");\nvar settle = __webpack_require__(/*! ./../core/settle */ \"./node_modules/axios/lib/core/settle.js\");\nvar buildURL = __webpack_require__(/*! ./../helpers/buildURL */ \"./node_modules/axios/lib/helpers/buildURL.js\");\nvar parseHeaders = __webpack_require__(/*! ./../helpers/parseHeaders */ \"./node_modules/axios/lib/helpers/parseHeaders.js\");\nvar isURLSameOrigin = __webpack_require__(/*! ./../helpers/isURLSameOrigin */ \"./node_modules/axios/lib/helpers/isURLSameOrigin.js\");\nvar createError = __webpack_require__(/*! ../core/createError */ \"./node_modules/axios/lib/core/createError.js\");\nvar btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || __webpack_require__(/*! ./../helpers/btoa */ \"./node_modules/axios/lib/helpers/btoa.js\");\n\nmodule.exports = function xhrAdapter(config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n var requestData = config.data;\n var requestHeaders = config.headers;\n\n if (utils.isFormData(requestData)) {\n delete requestHeaders['Content-Type']; // Let the browser set it\n }\n\n var request = new XMLHttpRequest();\n var loadEvent = 'onreadystatechange';\n var xDomain = false;\n\n // For IE 8/9 CORS support\n // Only supports POST and GET calls and doesn't returns the response headers.\n // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest.\n if (\"development\" !== 'test' &&\n typeof window !== 'undefined' &&\n window.XDomainRequest && !('withCredentials' in request) &&\n !isURLSameOrigin(config.url)) {\n request = new window.XDomainRequest();\n loadEvent = 'onload';\n xDomain = true;\n request.onprogress = function handleProgress() {};\n request.ontimeout = function handleTimeout() {};\n }\n\n // HTTP basic authentication\n if (config.auth) {\n var username = config.auth.username || '';\n var password = config.auth.password || '';\n requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);\n }\n\n request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);\n\n // Set the request timeout in MS\n request.timeout = config.timeout;\n\n // Listen for ready state\n request[loadEvent] = function handleLoad() {\n if (!request || (request.readyState !== 4 && !xDomain)) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n\n // Prepare the response\n var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;\n var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;\n var response = {\n data: responseData,\n // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201)\n status: request.status === 1223 ? 204 : request.status,\n statusText: request.status === 1223 ? 'No Content' : request.statusText,\n headers: responseHeaders,\n config: config,\n request: request\n };\n\n settle(resolve, reject, response);\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(createError('Network Error', config, null, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',\n request));\n\n // Clean up request\n request = null;\n };\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n if (utils.isStandardBrowserEnv()) {\n var cookies = __webpack_require__(/*! ./../helpers/cookies */ \"./node_modules/axios/lib/helpers/cookies.js\");\n\n // Add xsrf header\n var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?\n cookies.read(config.xsrfCookieName) :\n undefined;\n\n if (xsrfValue) {\n requestHeaders[config.xsrfHeaderName] = xsrfValue;\n }\n }\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders, function setRequestHeader(val, key) {\n if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {\n // Remove Content-Type if data is undefined\n delete requestHeaders[key];\n } else {\n // Otherwise add header to the request\n request.setRequestHeader(key, val);\n }\n });\n }\n\n // Add withCredentials to request if needed\n if (config.withCredentials) {\n request.withCredentials = true;\n }\n\n // Add responseType to request if needed\n if (config.responseType) {\n try {\n request.responseType = config.responseType;\n } catch (e) {\n // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.\n // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.\n if (config.responseType !== 'json') {\n throw e;\n }\n }\n }\n\n // Handle progress if needed\n if (typeof config.onDownloadProgress === 'function') {\n request.addEventListener('progress', config.onDownloadProgress);\n }\n\n // Not all browsers support upload events\n if (typeof config.onUploadProgress === 'function' && request.upload) {\n request.upload.addEventListener('progress', config.onUploadProgress);\n }\n\n if (config.cancelToken) {\n // Handle cancellation\n config.cancelToken.promise.then(function onCanceled(cancel) {\n if (!request) {\n return;\n }\n\n request.abort();\n reject(cancel);\n // Clean up request\n request = null;\n });\n }\n\n if (requestData === undefined) {\n requestData = null;\n }\n\n // Send the request\n request.send(requestData);\n });\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/adapters/xhr.js?");
/***/ }),
/***/ "./node_modules/axios/lib/axios.js":
/*!*****************************************!*\
!*** ./node_modules/axios/lib/axios.js ***!
\*****************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar utils = __webpack_require__(/*! ./utils */ \"./node_modules/axios/lib/utils.js\");\nvar bind = __webpack_require__(/*! ./helpers/bind */ \"./node_modules/axios/lib/helpers/bind.js\");\nvar Axios = __webpack_require__(/*! ./core/Axios */ \"./node_modules/axios/lib/core/Axios.js\");\nvar defaults = __webpack_require__(/*! ./defaults */ \"./node_modules/axios/lib/defaults.js\");\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n * @return {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n var context = new Axios(defaultConfig);\n var instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context);\n\n // Copy context to instance\n utils.extend(instance, context);\n\n return instance;\n}\n\n// Create the default instance to be exported\nvar axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Factory for creating new instances\naxios.create = function create(instanceConfig) {\n return createInstance(utils.merge(defaults, instanceConfig));\n};\n\n// Expose Cancel & CancelToken\naxios.Cancel = __webpack_require__(/*! ./cancel/Cancel */ \"./node_modules/axios/lib/cancel/Cancel.js\");\naxios.CancelToken = __webpack_require__(/*! ./cancel/CancelToken */ \"./node_modules/axios/lib/cancel/CancelToken.js\");\naxios.isCancel = __webpack_require__(/*! ./cancel/isCancel */ \"./node_modules/axios/lib/cancel/isCancel.js\");\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\naxios.spread = __webpack_require__(/*! ./helpers/spread */ \"./node_modules/axios/lib/helpers/spread.js\");\n\nmodule.exports = axios;\n\n// Allow use of default import syntax in TypeScript\nmodule.exports.default = axios;\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/axios.js?");
/***/ }),
/***/ "./node_modules/axios/lib/cancel/Cancel.js":
/*!*************************************************!*\
!*** ./node_modules/axios/lib/cancel/Cancel.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\n/**\n * A `Cancel` is an object that is thrown when an operation is canceled.\n *\n * @class\n * @param {string=} message The message.\n */\nfunction Cancel(message) {\n this.message = message;\n}\n\nCancel.prototype.toString = function toString() {\n return 'Cancel' + (this.message ? ': ' + this.message : '');\n};\n\nCancel.prototype.__CANCEL__ = true;\n\nmodule.exports = Cancel;\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/cancel/Cancel.js?");
/***/ }),
/***/ "./node_modules/axios/lib/cancel/CancelToken.js":
/*!******************************************************!*\
!*** ./node_modules/axios/lib/cancel/CancelToken.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar Cancel = __webpack_require__(/*! ./Cancel */ \"./node_modules/axios/lib/cancel/Cancel.js\");\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @class\n * @param {Function} executor The executor function.\n */\nfunction CancelToken(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n var resolvePromise;\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n var token = this;\n executor(function cancel(message) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new Cancel(message);\n resolvePromise(token.reason);\n });\n}\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nCancelToken.prototype.throwIfRequested = function throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n};\n\n/**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\nCancelToken.source = function source() {\n var cancel;\n var token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token: token,\n cancel: cancel\n };\n};\n\nmodule.exports = CancelToken;\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/cancel/CancelToken.js?");
/***/ }),
/***/ "./node_modules/axios/lib/cancel/isCancel.js":
/*!***************************************************!*\
!*** ./node_modules/axios/lib/cancel/isCancel.js ***!
\***************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nmodule.exports = function isCancel(value) {\n return !!(value && value.__CANCEL__);\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/cancel/isCancel.js?");
/***/ }),
/***/ "./node_modules/axios/lib/core/Axios.js":
/*!**********************************************!*\
!*** ./node_modules/axios/lib/core/Axios.js ***!
\**********************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar defaults = __webpack_require__(/*! ./../defaults */ \"./node_modules/axios/lib/defaults.js\");\nvar utils = __webpack_require__(/*! ./../utils */ \"./node_modules/axios/lib/utils.js\");\nvar InterceptorManager = __webpack_require__(/*! ./InterceptorManager */ \"./node_modules/axios/lib/core/InterceptorManager.js\");\nvar dispatchRequest = __webpack_require__(/*! ./dispatchRequest */ \"./node_modules/axios/lib/core/dispatchRequest.js\");\n\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n */\nfunction Axios(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n}\n\n/**\n * Dispatch a request\n *\n * @param {Object} config The config specific for this request (merged with this.defaults)\n */\nAxios.prototype.request = function request(config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof config === 'string') {\n config = utils.merge({\n url: arguments[0]\n }, arguments[1]);\n }\n\n config = utils.merge(defaults, this.defaults, { method: 'get' }, config);\n config.method = config.method.toLowerCase();\n\n // Hook up interceptors middleware\n var chain = [dispatchRequest, undefined];\n var promise = Promise.resolve(config);\n\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n chain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n chain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n while (chain.length) {\n promise = promise.then(chain.shift(), chain.shift());\n }\n\n return promise;\n};\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, data, config) {\n return this.request(utils.merge(config || {}, {\n method: method,\n url: url,\n data: data\n }));\n };\n});\n\nmodule.exports = Axios;\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/core/Axios.js?");
/***/ }),
/***/ "./node_modules/axios/lib/core/InterceptorManager.js":
/*!***********************************************************!*\
!*** ./node_modules/axios/lib/core/InterceptorManager.js ***!
\***********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar utils = __webpack_require__(/*! ./../utils */ \"./node_modules/axios/lib/utils.js\");\n\nfunction InterceptorManager() {\n this.handlers = [];\n}\n\n/**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\nInterceptorManager.prototype.use = function use(fulfilled, rejected) {\n this.handlers.push({\n fulfilled: fulfilled,\n rejected: rejected\n });\n return this.handlers.length - 1;\n};\n\n/**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n */\nInterceptorManager.prototype.eject = function eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n};\n\n/**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n */\nInterceptorManager.prototype.forEach = function forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n};\n\nmodule.exports = InterceptorManager;\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/core/InterceptorManager.js?");
/***/ }),
/***/ "./node_modules/axios/lib/core/createError.js":
/*!****************************************************!*\
!*** ./node_modules/axios/lib/core/createError.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar enhanceError = __webpack_require__(/*! ./enhanceError */ \"./node_modules/axios/lib/core/enhanceError.js\");\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The created error.\n */\nmodule.exports = function createError(message, config, code, request, response) {\n var error = new Error(message);\n return enhanceError(error, config, code, request, response);\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/core/createError.js?");
/***/ }),
/***/ "./node_modules/axios/lib/core/dispatchRequest.js":
/*!********************************************************!*\
!*** ./node_modules/axios/lib/core/dispatchRequest.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar utils = __webpack_require__(/*! ./../utils */ \"./node_modules/axios/lib/utils.js\");\nvar transformData = __webpack_require__(/*! ./transformData */ \"./node_modules/axios/lib/core/transformData.js\");\nvar isCancel = __webpack_require__(/*! ../cancel/isCancel */ \"./node_modules/axios/lib/cancel/isCancel.js\");\nvar defaults = __webpack_require__(/*! ../defaults */ \"./node_modules/axios/lib/defaults.js\");\nvar isAbsoluteURL = __webpack_require__(/*! ./../helpers/isAbsoluteURL */ \"./node_modules/axios/lib/helpers/isAbsoluteURL.js\");\nvar combineURLs = __webpack_require__(/*! ./../helpers/combineURLs */ \"./node_modules/axios/lib/helpers/combineURLs.js\");\n\n/**\n * Throws a `Cancel` if cancellation has been requested.\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n * @returns {Promise} The Promise to be fulfilled\n */\nmodule.exports = function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n // Support baseURL config\n if (config.baseURL && !isAbsoluteURL(config.url)) {\n config.url = combineURLs(config.baseURL, config.url);\n }\n\n // Ensure headers exist\n config.headers = config.headers || {};\n\n // Transform request data\n config.data = transformData(\n config.data,\n config.headers,\n config.transformRequest\n );\n\n // Flatten headers\n config.headers = utils.merge(\n config.headers.common || {},\n config.headers[config.method] || {},\n config.headers || {}\n );\n\n utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n function cleanHeaderConfig(method) {\n delete config.headers[method];\n }\n );\n\n var adapter = config.adapter || defaults.adapter;\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData(\n response.data,\n response.headers,\n config.transformResponse\n );\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData(\n reason.response.data,\n reason.response.headers,\n config.transformResponse\n );\n }\n }\n\n return Promise.reject(reason);\n });\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/core/dispatchRequest.js?");
/***/ }),
/***/ "./node_modules/axios/lib/core/enhanceError.js":
/*!*****************************************************!*\
!*** ./node_modules/axios/lib/core/enhanceError.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\n/**\n * Update an Error with the specified config, error code, and response.\n *\n * @param {Error} error The error to update.\n * @param {Object} config The config.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n * @returns {Error} The error.\n */\nmodule.exports = function enhanceError(error, config, code, request, response) {\n error.config = config;\n if (code) {\n error.code = code;\n }\n error.request = request;\n error.response = response;\n return error;\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/core/enhanceError.js?");
/***/ }),
/***/ "./node_modules/axios/lib/core/settle.js":
/*!***********************************************!*\
!*** ./node_modules/axios/lib/core/settle.js ***!
\***********************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar createError = __webpack_require__(/*! ./createError */ \"./node_modules/axios/lib/core/createError.js\");\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n */\nmodule.exports = function settle(resolve, reject, response) {\n var validateStatus = response.config.validateStatus;\n // Note: status is not exposed by XDomainRequest\n if (!response.status || !validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(createError(\n 'Request failed with status code ' + response.status,\n response.config,\n null,\n response.request,\n response\n ));\n }\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/core/settle.js?");
/***/ }),
/***/ "./node_modules/axios/lib/core/transformData.js":
/*!******************************************************!*\
!*** ./node_modules/axios/lib/core/transformData.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar utils = __webpack_require__(/*! ./../utils */ \"./node_modules/axios/lib/utils.js\");\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Object|String} data The data to be transformed\n * @param {Array} headers The headers for the request or response\n * @param {Array|Function} fns A single function or Array of functions\n * @returns {*} The resulting transformed data\n */\nmodule.exports = function transformData(data, headers, fns) {\n /*eslint no-param-reassign:0*/\n utils.forEach(fns, function transform(fn) {\n data = fn(data, headers);\n });\n\n return data;\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/core/transformData.js?");
/***/ }),
/***/ "./node_modules/axios/lib/defaults.js":
/*!********************************************!*\
!*** ./node_modules/axios/lib/defaults.js ***!
\********************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("/* WEBPACK VAR INJECTION */(function(process) {\n\nvar utils = __webpack_require__(/*! ./utils */ \"./node_modules/axios/lib/utils.js\");\nvar normalizeHeaderName = __webpack_require__(/*! ./helpers/normalizeHeaderName */ \"./node_modules/axios/lib/helpers/normalizeHeaderName.js\");\n\nvar DEFAULT_CONTENT_TYPE = {\n 'Content-Type': 'application/x-www-form-urlencoded'\n};\n\nfunction setContentTypeIfUnset(headers, value) {\n if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {\n headers['Content-Type'] = value;\n }\n}\n\nfunction getDefaultAdapter() {\n var adapter;\n if (typeof XMLHttpRequest !== 'undefined') {\n // For browsers use XHR adapter\n adapter = __webpack_require__(/*! ./adapters/xhr */ \"./node_modules/axios/lib/adapters/xhr.js\");\n } else if (typeof process !== 'undefined') {\n // For node use HTTP adapter\n adapter = __webpack_require__(/*! ./adapters/http */ \"./node_modules/axios/lib/adapters/xhr.js\");\n }\n return adapter;\n}\n\nvar defaults = {\n adapter: getDefaultAdapter(),\n\n transformRequest: [function transformRequest(data, headers) {\n normalizeHeaderName(headers, 'Content-Type');\n if (utils.isFormData(data) ||\n utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');\n return data.toString();\n }\n if (utils.isObject(data)) {\n setContentTypeIfUnset(headers, 'application/json;charset=utf-8');\n return JSON.stringify(data);\n }\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n /*eslint no-param-reassign:0*/\n if (typeof data === 'string') {\n try {\n data = JSON.parse(data);\n } catch (e) { /* Ignore */ }\n }\n return data;\n }],\n\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n }\n};\n\ndefaults.headers = {\n common: {\n 'Accept': 'application/json, text/plain, */*'\n }\n};\n\nutils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {\n defaults.headers[method] = {};\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);\n});\n\nmodule.exports = defaults;\n\n/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(/*! ./../../../../../../../../usr/local/lib/node_modules/webpack/node_modules/process/browser.js */ \"../../../../../usr/local/lib/node_modules/webpack/node_modules/process/browser.js\")))\n\n//# sourceURL=webpack:///./node_modules/axios/lib/defaults.js?");
/***/ }),
/***/ "./node_modules/axios/lib/helpers/bind.js":
/*!************************************************!*\
!*** ./node_modules/axios/lib/helpers/bind.js ***!
\************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nmodule.exports = function bind(fn, thisArg) {\n return function wrap() {\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i];\n }\n return fn.apply(thisArg, args);\n };\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/helpers/bind.js?");
/***/ }),
/***/ "./node_modules/axios/lib/helpers/btoa.js":
/*!************************************************!*\
!*** ./node_modules/axios/lib/helpers/btoa.js ***!
\************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\n// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js\n\nvar chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';\n\nfunction E() {\n this.message = 'String contains an invalid character';\n}\nE.prototype = new Error;\nE.prototype.code = 5;\nE.prototype.name = 'InvalidCharacterError';\n\nfunction btoa(input) {\n var str = String(input);\n var output = '';\n for (\n // initialize result and counter\n var block, charCode, idx = 0, map = chars;\n // if the next str index does not exist:\n // change the mapping table to \"=\"\n // check if d has no fractional digits\n str.charAt(idx | 0) || (map = '=', idx % 1);\n // \"8 - idx % 1 * 8\" generates the sequence 2, 4, 6, 8\n output += map.charAt(63 & block >> 8 - idx % 1 * 8)\n ) {\n charCode = str.charCodeAt(idx += 3 / 4);\n if (charCode > 0xFF) {\n throw new E();\n }\n block = block << 8 | charCode;\n }\n return output;\n}\n\nmodule.exports = btoa;\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/helpers/btoa.js?");
/***/ }),
/***/ "./node_modules/axios/lib/helpers/buildURL.js":
/*!****************************************************!*\
!*** ./node_modules/axios/lib/helpers/buildURL.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar utils = __webpack_require__(/*! ./../utils */ \"./node_modules/axios/lib/utils.js\");\n\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%40/gi, '@').\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @returns {string} The formatted url\n */\nmodule.exports = function buildURL(url, params, paramsSerializer) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n\n var serializedParams;\n if (paramsSerializer) {\n serializedParams = paramsSerializer(params);\n } else if (utils.isURLSearchParams(params)) {\n serializedParams = params.toString();\n } else {\n var parts = [];\n\n utils.forEach(params, function serialize(val, key) {\n if (val === null || typeof val === 'undefined') {\n return;\n }\n\n if (utils.isArray(val)) {\n key = key + '[]';\n }\n\n if (!utils.isArray(val)) {\n val = [val];\n }\n\n utils.forEach(val, function parseValue(v) {\n if (utils.isDate(v)) {\n v = v.toISOString();\n } else if (utils.isObject(v)) {\n v = JSON.stringify(v);\n }\n parts.push(encode(key) + '=' + encode(v));\n });\n });\n\n serializedParams = parts.join('&');\n }\n\n if (serializedParams) {\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/helpers/buildURL.js?");
/***/ }),
/***/ "./node_modules/axios/lib/helpers/combineURLs.js":
/*!*******************************************************!*\
!*** ./node_modules/axios/lib/helpers/combineURLs.js ***!
\*******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n * @returns {string} The combined URL\n */\nmodule.exports = function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/+$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/helpers/combineURLs.js?");
/***/ }),
/***/ "./node_modules/axios/lib/helpers/cookies.js":
/*!***************************************************!*\
!*** ./node_modules/axios/lib/helpers/cookies.js ***!
\***************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar utils = __webpack_require__(/*! ./../utils */ \"./node_modules/axios/lib/utils.js\");\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs support document.cookie\n (function standardBrowserEnv() {\n return {\n write: function write(name, value, expires, path, domain, secure) {\n var cookie = [];\n cookie.push(name + '=' + encodeURIComponent(value));\n\n if (utils.isNumber(expires)) {\n cookie.push('expires=' + new Date(expires).toGMTString());\n }\n\n if (utils.isString(path)) {\n cookie.push('path=' + path);\n }\n\n if (utils.isString(domain)) {\n cookie.push('domain=' + domain);\n }\n\n if (secure === true) {\n cookie.push('secure');\n }\n\n document.cookie = cookie.join('; ');\n },\n\n read: function read(name) {\n var match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove: function remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n };\n })() :\n\n // Non standard browser env (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return {\n write: function write() {},\n read: function read() { return null; },\n remove: function remove() {}\n };\n })()\n);\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/helpers/cookies.js?");
/***/ }),
/***/ "./node_modules/axios/lib/helpers/isAbsoluteURL.js":
/*!*********************************************************!*\
!*** ./node_modules/axios/lib/helpers/isAbsoluteURL.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nmodule.exports = function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"<scheme>://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d\\+\\-\\.]*:)?\\/\\//i.test(url);\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/helpers/isAbsoluteURL.js?");
/***/ }),
/***/ "./node_modules/axios/lib/helpers/isURLSameOrigin.js":
/*!***********************************************************!*\
!*** ./node_modules/axios/lib/helpers/isURLSameOrigin.js ***!
\***********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar utils = __webpack_require__(/*! ./../utils */ \"./node_modules/axios/lib/utils.js\");\n\nmodule.exports = (\n utils.isStandardBrowserEnv() ?\n\n // Standard browser envs have full support of the APIs needed to test\n // whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n var msie = /(msie|trident)/i.test(navigator.userAgent);\n var urlParsingNode = document.createElement('a');\n var originURL;\n\n /**\n * Parse a URL to discover it's components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n var href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })()\n);\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/helpers/isURLSameOrigin.js?");
/***/ }),
/***/ "./node_modules/axios/lib/helpers/normalizeHeaderName.js":
/*!***************************************************************!*\
!*** ./node_modules/axios/lib/helpers/normalizeHeaderName.js ***!
\***************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar utils = __webpack_require__(/*! ../utils */ \"./node_modules/axios/lib/utils.js\");\n\nmodule.exports = function normalizeHeaderName(headers, normalizedName) {\n utils.forEach(headers, function processHeader(value, name) {\n if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {\n headers[normalizedName] = value;\n delete headers[name];\n }\n });\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/helpers/normalizeHeaderName.js?");
/***/ }),
/***/ "./node_modules/axios/lib/helpers/parseHeaders.js":
/*!********************************************************!*\
!*** ./node_modules/axios/lib/helpers/parseHeaders.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar utils = __webpack_require__(/*! ./../utils */ \"./node_modules/axios/lib/utils.js\");\n\n// Headers whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nvar ignoreDuplicateOf = [\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n];\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} headers Headers needing to be parsed\n * @returns {Object} Headers parsed into an object\n */\nmodule.exports = function parseHeaders(headers) {\n var parsed = {};\n var key;\n var val;\n var i;\n\n if (!headers) { return parsed; }\n\n utils.forEach(headers.split('\\n'), function parser(line) {\n i = line.indexOf(':');\n key = utils.trim(line.substr(0, i)).toLowerCase();\n val = utils.trim(line.substr(i + 1));\n\n if (key) {\n if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {\n return;\n }\n if (key === 'set-cookie') {\n parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n }\n });\n\n return parsed;\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/helpers/parseHeaders.js?");
/***/ }),
/***/ "./node_modules/axios/lib/helpers/spread.js":
/*!**************************************************!*\
!*** ./node_modules/axios/lib/helpers/spread.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n * @returns {Function}\n */\nmodule.exports = function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/helpers/spread.js?");
/***/ }),
/***/ "./node_modules/axios/lib/utils.js":
/*!*****************************************!*\
!*** ./node_modules/axios/lib/utils.js ***!
\*****************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
"use strict";
eval("\n\nvar bind = __webpack_require__(/*! ./helpers/bind */ \"./node_modules/axios/lib/helpers/bind.js\");\nvar isBuffer = __webpack_require__(/*! is-buffer */ \"./node_modules/is-buffer/index.js\");\n\n/*global toString:true*/\n\n// utils is a library of generic helper functions non-specific to axios\n\nvar toString = Object.prototype.toString;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Array, otherwise false\n */\nfunction isArray(val) {\n return toString.call(val) === '[object Array]';\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nfunction isArrayBuffer(val) {\n return toString.call(val) === '[object ArrayBuffer]';\n}\n\n/**\n * Determine if a value is a FormData\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nfunction isFormData(val) {\n return (typeof FormData !== 'undefined') && (val instanceof FormData);\n}\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n var result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a String, otherwise false\n */\nfunction isString(val) {\n return typeof val === 'string';\n}\n\n/**\n * Determine if a value is a Number\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Number, otherwise false\n */\nfunction isNumber(val) {\n return typeof val === 'number';\n}\n\n/**\n * Determine if a value is undefined\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nfunction isUndefined(val) {\n return typeof val === 'undefined';\n}\n\n/**\n * Determine if a value is an Object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is an Object, otherwise false\n */\nfunction isObject(val) {\n return val !== null && typeof val === 'object';\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Date, otherwise false\n */\nfunction isDate(val) {\n return toString.call(val) === '[object Date]';\n}\n\n/**\n * Determine if a value is a File\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a File, otherwise false\n */\nfunction isFile(val) {\n return toString.call(val) === '[object File]';\n}\n\n/**\n * Determine if a value is a Blob\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nfunction isBlob(val) {\n return toString.call(val) === '[object Blob]';\n}\n\n/**\n * Determine if a value is a Function\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nfunction isFunction(val) {\n return toString.call(val) === '[object Function]';\n}\n\n/**\n * Determine if a value is a Stream\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nfunction isStream(val) {\n return isObject(val) && isFunction(val.pipe);\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {Object} val The value to test\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nfunction isURLSearchParams(val) {\n return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;\n}\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n * @returns {String} The String freed of excess whitespace\n */\nfunction trim(str) {\n return str.replace(/^\\s*/, '').replace(/\\s*$/, '');\n}\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n */\nfunction isStandardBrowserEnv() {\n if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') {\n return false;\n }\n return (\n typeof window !== 'undefined' &&\n typeof document !== 'undefined'\n );\n}\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n */\nfunction forEach(obj, fn) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (var i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n for (var key in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, key)) {\n fn.call(null, obj[key], key, obj);\n }\n }\n }\n}\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n var result = {};\n function assignValue(val, key) {\n if (typeof result[key] === 'object' && typeof val === 'object') {\n result[key] = merge(result[key], val);\n } else {\n result[key] = val;\n }\n }\n\n for (var i = 0, l = arguments.length; i < l; i++) {\n forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n * @return {Object} The resulting value of object a\n */\nfunction extend(a, b, thisArg) {\n forEach(b, function assignValue(val, key) {\n if (thisArg && typeof val === 'function') {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n });\n return a;\n}\n\nmodule.exports = {\n isArray: isArray,\n isArrayBuffer: isArrayBuffer,\n isBuffer: isBuffer,\n isFormData: isFormData,\n isArrayBufferView: isArrayBufferView,\n isString: isString,\n isNumber: isNumber,\n isObject: isObject,\n isUndefined: isUndefined,\n isDate: isDate,\n isFile: isFile,\n isBlob: isBlob,\n isFunction: isFunction,\n isStream: isStream,\n isURLSearchParams: isURLSearchParams,\n isStandardBrowserEnv: isStandardBrowserEnv,\n forEach: forEach,\n merge: merge,\n extend: extend,\n trim: trim\n};\n\n\n//# sourceURL=webpack:///./node_modules/axios/lib/utils.js?");
/***/ }),
/***/ "./node_modules/is-buffer/index.js":
/*!*****************************************!*\
!*** ./node_modules/is-buffer/index.js ***!
\*****************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("/*!\n * Determine if an object is a Buffer\n *\n * @author Feross Aboukhadijeh <https://feross.org>\n * @license MIT\n */\n\n// The _isBuffer check is for Safari 5-7 support, because it's missing\n// Object.prototype.constructor. Remove this eventually\nmodule.exports = function (obj) {\n return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer)\n}\n\nfunction isBuffer (obj) {\n return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)\n}\n\n// For Node v0.10 support. Remove this eventually.\nfunction isSlowBuffer (obj) {\n return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0))\n}\n\n\n//# sourceURL=webpack:///./node_modules/is-buffer/index.js?");
/***/ }),
/***/ "./node_modules/jquery/dist/jquery.js":
/*!********************************************!*\
!*** ./node_modules/jquery/dist/jquery.js ***!
\********************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!\n * jQuery JavaScript Library v3.3.1\n * https://jquery.com/\n *\n * Includes Sizzle.js\n * https://sizzlejs.com/\n *\n * Copyright JS Foundation and other contributors\n * Released under the MIT license\n * https://jquery.org/license\n *\n * Date: 2018-01-20T17:24Z\n */\n( function( global, factory ) {\n\n\t\"use strict\";\n\n\tif ( typeof module === \"object\" && typeof module.exports === \"object\" ) {\n\n\t\t// For CommonJS and CommonJS-like environments where a proper `window`\n\t\t// is present, execute the factory and get jQuery.\n\t\t// For environments that do not have a `window` with a `document`\n\t\t// (such as Node.js), expose a factory as module.exports.\n\t\t// This accentuates the need for the creation of a real `window`.\n\t\t// e.g. var jQuery = require(\"jquery\")(window);\n\t\t// See ticket #14549 for more info.\n\t\tmodule.exports = global.document ?\n\t\t\tfactory( global, true ) :\n\t\t\tfunction( w ) {\n\t\t\t\tif ( !w.document ) {\n\t\t\t\t\tthrow new Error( \"jQuery requires a window with a document\" );\n\t\t\t\t}\n\t\t\t\treturn factory( w );\n\t\t\t};\n\t} else {\n\t\tfactory( global );\n\t}\n\n// Pass this if window is not defined yet\n} )( typeof window !== \"undefined\" ? window : this, function( window, noGlobal ) {\n\n// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1\n// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode\n// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common\n// enough that all such attempts are guarded in a try block.\n\"use strict\";\n\nvar arr = [];\n\nvar document = window.document;\n\nvar getProto = Object.getPrototypeOf;\n\nvar slice = arr.slice;\n\nvar concat = arr.concat;\n\nvar push = arr.push;\n\nvar indexOf = arr.indexOf;\n\nvar class2type = {};\n\nvar toString = class2type.toString;\n\nvar hasOwn = class2type.hasOwnProperty;\n\nvar fnToString = hasOwn.toString;\n\nvar ObjectFunctionString = fnToString.call( Object );\n\nvar support = {};\n\nvar isFunction = function isFunction( obj ) {\n\n // Support: Chrome <=57, Firefox <=52\n // In some browsers, typeof returns \"function\" for HTML <object> elements\n // (i.e., `typeof document.createElement( \"object\" ) === \"function\"`).\n // We don't want to classify *any* DOM node as a function.\n return typeof obj === \"function\" && typeof obj.nodeType !== \"number\";\n };\n\n\nvar isWindow = function isWindow( obj ) {\n\t\treturn obj != null && obj === obj.window;\n\t};\n\n\n\n\n\tvar preservedScriptAttributes = {\n\t\ttype: true,\n\t\tsrc: true,\n\t\tnoModule: true\n\t};\n\n\tfunction DOMEval( code, doc, node ) {\n\t\tdoc = doc || document;\n\n\t\tvar i,\n\t\t\tscript = doc.createElement( \"script\" );\n\n\t\tscript.text = code;\n\t\tif ( node ) {\n\t\t\tfor ( i in preservedScriptAttributes ) {\n\t\t\t\tif ( node[ i ] ) {\n\t\t\t\t\tscript[ i ] = node[ i ];\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\tdoc.head.appendChild( script ).parentNode.removeChild( script );\n\t}\n\n\nfunction toType( obj ) {\n\tif ( obj == null ) {\n\t\treturn obj + \"\";\n\t}\n\n\t// Support: Android <=2.3 only (functionish RegExp)\n\treturn typeof obj === \"object\" || typeof obj === \"function\" ?\n\t\tclass2type[ toString.call( obj ) ] || \"object\" :\n\t\ttypeof obj;\n}\n/* global Symbol */\n// Defining this global in .eslintrc.json would create a danger of using the global\n// unguarded in another place, it seems safer to define global only for this module\n\n\n\nvar\n\tversion = \"3.3.1\",\n\n\t// Define a local copy of jQuery\n\tjQuery = function( selector, context ) {\n\n\t\t// The jQuery object is actually just the init constructor 'enhanced'\n\t\t// Need init if jQuery is called (just allow error to be thrown if not included)\n\t\treturn new jQuery.fn.init( selector, context );\n\t},\n\n\t// Support: Android <=4.0 only\n\t// Make sure we trim BOM and NBSP\n\trtrim = /^[\\s\\uFEFF\\xA0]+|[\\s\\uFEFF\\xA0]+$/g;\n\njQuery.fn = jQuery.prototype = {\n\n\t// The current version of jQuery being used\n\tjquery: version,\n\n\tconstructor: jQuery,\n\n\t// The default length of a jQuery object is 0\n\tlength: 0,\n\n\ttoArray: function() {\n\t\treturn slice.call( this );\n\t},\n\n\t// Get the Nth element in the matched element set OR\n\t// Get the whole matched element set as a clean array\n\tget: function( num ) {\n\n\t\t// Return all the elements in a clean array\n\t\tif ( num == null ) {\n\t\t\treturn slice.call( this );\n\t\t}\n\n\t\t// Return just the one element from the set\n\t\treturn num < 0 ? this[ num + this.length ] : this[ num ];\n\t},\n\n\t// Take an array of elements and push it onto the stack\n\t// (returning the new matched element set)\n\tpushStack: function( elems ) {\n\n\t\t// Build a new jQuery matched element set\n\t\tvar ret = jQuery.merge( this.constructor(), elems );\n\n\t\t// Add the old object onto the stack (as a reference)\n\t\tret.prevObject = this;\n\n\t\t// Return the newly-formed element set\n\t\treturn ret;\n\t},\n\n\t// Execute a callback for every element in the matched set.\n\teach: function( callback ) {\n\t\treturn jQuery.each( this, callback );\n\t},\n\n\tmap: function( callback ) {\n\t\treturn this.pushStack( jQuery.map( this, function( elem, i ) {\n\t\t\treturn callback.call( elem, i, elem );\n\t\t} ) );\n\t},\n\n\tslice: function() {\n\t\treturn this.pushStack( slice.apply( this, arguments ) );\n\t},\n\n\tfirst: function() {\n\t\treturn this.eq( 0 );\n\t},\n\n\tlast: function() {\n\t\treturn this.eq( -1 );\n\t},\n\n\teq: function( i ) {\n\t\tvar len = this.length,\n\t\t\tj = +i + ( i < 0 ? len : 0 );\n\t\treturn this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] );\n\t},\n\n\tend: function() {\n\t\treturn this.prevObject || this.constructor();\n\t},\n\n\t// For internal use only.\n\t// Behaves like an Array's method, not like a jQuery method.\n\tpush: push,\n\tsort: arr.sort,\n\tsplice: arr.splice\n};\n\njQuery.extend = jQuery.fn.extend = function() {\n\tvar options, name, src, copy, copyIsArray, clone,\n\t\ttarget = arguments[ 0 ] || {},\n\t\ti = 1,\n\t\tlength = arguments.length,\n\t\tdeep = false;\n\n\t// Handle a deep copy situation\n\tif ( typeof target === \"boolean\" ) {\n\t\tdeep = target;\n\n\t\t// Skip the boolean and the target\n\t\ttarget = arguments[ i ] || {};\n\t\ti++;\n\t}\n\n\t// Handle case when target is a string or something (possible in deep copy)\n\tif ( typeof target !== \"object\" && !isFunction( target ) ) {\n\t\ttarget = {};\n\t}\n\n\t// Extend jQuery itself if only one argument is passed\n\tif ( i === length ) {\n\t\ttarget = this;\n\t\ti--;\n\t}\n\n\tfor ( ; i < length; i++ ) {\n\n\t\t// Only deal with non-null/undefined values\n\t\tif ( ( options = arguments[ i ] ) != null ) {\n\n\t\t\t// Extend the base object\n\t\t\tfor ( name in options ) {\n\t\t\t\tsrc = target[ name ];\n\t\t\t\tcopy = options[ name ];\n\n\t\t\t\t// Prevent never-ending loop\n\t\t\t\tif ( target === copy ) {\n\t\t\t\t\tcontinue;\n\t\t\t\t}\n\n\t\t\t\t// Recurse if we're merging plain objects or arrays\n\t\t\t\tif ( deep && copy && ( jQuery.isPlainObject( copy ) ||\n\t\t\t\t\t( copyIsArray = Array.isArray( copy ) ) ) ) {\n\n\t\t\t\t\tif ( copyIsArray ) {\n\t\t\t\t\t\tcopyIsArray = false;\n\t\t\t\t\t\tclone = src && Array.isArray( src ) ? src : [];\n\n\t\t\t\t\t} else {\n\t\t\t\t\t\tclone = src && jQuery.isPlainObject( src ) ? src : {};\n\t\t\t\t\t}\n\n\t\t\t\t\t// Never move original objects, clone them\n\t\t\t\t\ttarget[ name ] = jQuery.extend( deep, clone, copy );\n\n\t\t\t\t// Don't bring in undefined values\n\t\t\t\t} else if ( copy !== undefined ) {\n\t\t\t\t\ttarget[ name ] = copy;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// Return the modified object\n\treturn target;\n};\n\njQuery.extend( {\n\n\t// Unique for each copy of jQuery on the page\n\texpando: \"jQuery\" + ( version + Math.random() ).replace( /\\D/g, \"\" ),\n\n\t// Assume jQuery is ready without the ready module\n\tisReady: true,\n\n\terror: function( msg ) {\n\t\tthrow new Error( msg );\n\t},\n\n\tnoop: function() {},\n\n\tisPlainObject: function( obj ) {\n\t\tvar proto, Ctor;\n\n\t\t// Detect obvious negatives\n\t\t// Use toString instead of jQuery.type to catch host objects\n\t\tif ( !obj || toString.call( obj ) !== \"[object Object]\" ) {\n\t\t\treturn false;\n\t\t}\n\n\t\tproto = getProto( obj );\n\n\t\t// Objects with no prototype (e.g., `Object.create( null )`) are plain\n\t\tif ( !proto ) {\n\t\t\treturn true;\n\t\t}\n\n\t\t// Objects with prototype are plain iff they were constructed by a global Object function\n\t\tCtor = hasOwn.call( proto, \"constructor\" ) && proto.constructor;\n\t\treturn typeof Ctor === \"function\" && fnToString.call( Ctor ) === ObjectFunctionString;\n\t},\n\n\tisEmptyObject: function( obj ) {\n\n\t\t/* eslint-disable no-unused-vars */\n\t\t// See https://github.com/eslint/eslint/issues/6125\n\t\tvar name;\n\n\t\tfor ( name in obj ) {\n\t\t\treturn false;\n\t\t}\n\t\treturn true;\n\t},\n\n\t// Evaluates a script in a global context\n\tglobalEval: function( code ) {\n\t\tDOMEval( code );\n\t},\n\n\teach: function( obj, callback ) {\n\t\tvar length, i = 0;\n\n\t\tif ( isArrayLike( obj ) ) {\n\t\t\tlength = obj.length;\n\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\tif ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t} else {\n\t\t\tfor ( i in obj ) {\n\t\t\t\tif ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn obj;\n\t},\n\n\t// Support: Android <=4.0 only\n\ttrim: function( text ) {\n\t\treturn text == null ?\n\t\t\t\"\" :\n\t\t\t( text + \"\" ).replace( rtrim, \"\" );\n\t},\n\n\t// results is for internal usage only\n\tmakeArray: function( arr, results ) {\n\t\tvar ret = results || [];\n\n\t\tif ( arr != null ) {\n\t\t\tif ( isArrayLike( Object( arr ) ) ) {\n\t\t\t\tjQuery.merge( ret,\n\t\t\t\t\ttypeof arr === \"string\" ?\n\t\t\t\t\t[ arr ] : arr\n\t\t\t\t);\n\t\t\t} else {\n\t\t\t\tpush.call( ret, arr );\n\t\t\t}\n\t\t}\n\n\t\treturn ret;\n\t},\n\n\tinArray: function( elem, arr, i ) {\n\t\treturn arr == null ? -1 : indexOf.call( arr, elem, i );\n\t},\n\n\t// Support: Android <=4.0 only, PhantomJS 1 only\n\t// push.apply(_, arraylike) throws on ancient WebKit\n\tmerge: function( first, second ) {\n\t\tvar len = +second.length,\n\t\t\tj = 0,\n\t\t\ti = first.length;\n\n\t\tfor ( ; j < len; j++ ) {\n\t\t\tfirst[ i++ ] = second[ j ];\n\t\t}\n\n\t\tfirst.length = i;\n\n\t\treturn first;\n\t},\n\n\tgrep: function( elems, callback, invert ) {\n\t\tvar callbackInverse,\n\t\t\tmatches = [],\n\t\t\ti = 0,\n\t\t\tlength = elems.length,\n\t\t\tcallbackExpect = !invert;\n\n\t\t// Go through the array, only saving the items\n\t\t// that pass the validator function\n\t\tfor ( ; i < length; i++ ) {\n\t\t\tcallbackInverse = !callback( elems[ i ], i );\n\t\t\tif ( callbackInverse !== callbackExpect ) {\n\t\t\t\tmatches.push( elems[ i ] );\n\t\t\t}\n\t\t}\n\n\t\treturn matches;\n\t},\n\n\t// arg is for internal usage only\n\tmap: function( elems, callback, arg ) {\n\t\tvar length, value,\n\t\t\ti = 0,\n\t\t\tret = [];\n\n\t\t// Go through the array, translating each of the items to their new values\n\t\tif ( isArrayLike( elems ) ) {\n\t\t\tlength = elems.length;\n\t\t\tfor ( ; i < length; i++ ) {\n\t\t\t\tvalue = callback( elems[ i ], i, arg );\n\n\t\t\t\tif ( value != null ) {\n\t\t\t\t\tret.push( value );\n\t\t\t\t}\n\t\t\t}\n\n\t\t// Go through every key on the object,\n\t\t} else {\n\t\t\tfor ( i in elems ) {\n\t\t\t\tvalue = callback( elems[ i ], i, arg );\n\n\t\t\t\tif ( value != null ) {\n\t\t\t\t\tret.push( value );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// Flatten any nested arrays\n\t\treturn concat.apply( [], ret );\n\t},\n\n\t// A global GUID counter for objects\n\tguid: 1,\n\n\t// jQuery.support is not used in Core but other projects attach their\n\t// properties to it so it needs to exist.\n\tsupport: support\n} );\n\nif ( typeof Symbol === \"function\" ) {\n\tjQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ];\n}\n\n// Populate the class2type map\njQuery.each( \"Boolean Number String Function Array Date RegExp Object Error Symbol\".split( \" \" ),\nfunction( i, name ) {\n\tclass2type[ \"[object \" + name + \"]\" ] = name.toLowerCase();\n} );\n\nfunction isArrayLike( obj ) {\n\n\t// Support: real iOS 8.2 only (not reproducible in simulator)\n\t// `in` check used to prevent JIT error (gh-2145)\n\t// hasOwn isn't used here due to false negatives\n\t// regarding Nodelist length in IE\n\tvar length = !!obj && \"length\" in obj && obj.length,\n\t\ttype = toType( obj );\n\n\tif ( isFunction( obj ) || isWindow( obj ) ) {\n\t\treturn false;\n\t}\n\n\treturn type === \"array\" || length === 0 ||\n\t\ttypeof length === \"number\" && length > 0 && ( length - 1 ) in obj;\n}\nvar Sizzle =\n/*!\n * Sizzle CSS Selector Engine v2.3.3\n * https://sizzlejs.com/\n *\n * Copyright jQuery Foundation and other contributors\n * Released under the MIT license\n * http://jquery.org/license\n *\n * Date: 2016-08-08\n */\n(function( window ) {\n\nvar i,\n\tsupport,\n\tExpr,\n\tgetText,\n\tisXML,\n\ttokenize,\n\tcompile,\n\tselect,\n\toutermostContext,\n\tsortInput,\n\thasDuplicate,\n\n\t// Local document vars\n\tsetDocument,\n\tdocument,\n\tdocElem,\n\tdocumentIsHTML,\n\trbuggyQSA,\n\trbuggyMatches,\n\tmatches,\n\tcontains,\n\n\t// Instance-specific data\n\texpando = \"sizzle\" + 1 * new Date(),\n\tpreferredDoc = window.document,\n\tdirruns = 0,\n\tdone = 0,\n\tclassCache = createCache(),\n\ttokenCache = createCache(),\n\tcompilerCache = createCache(),\n\tsortOrder = function( a, b ) {\n\t\tif ( a === b ) {\n\t\t\thasDuplicate = true;\n\t\t}\n\t\treturn 0;\n\t},\n\n\t// Instance methods\n\thasOwn = ({}).hasOwnProperty,\n\tarr = [],\n\tpop = arr.pop,\n\tpush_native = arr.push,\n\tpush = arr.push,\n\tslice = arr.slice,\n\t// Use a stripped-down indexOf as it's faster than native\n\t// https://jsperf.com/thor-indexof-vs-for/5\n\tindexOf = function( list, elem ) {\n\t\tvar i = 0,\n\t\t\tlen = list.length;\n\t\tfor ( ; i < len; i++ ) {\n\t\t\tif ( list[i] === elem ) {\n\t\t\t\treturn i;\n\t\t\t}\n\t\t}\n\t\treturn -1;\n\t},\n\n\tbooleans = \"checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped\",\n\n\t// Regular expressions\n\n\t// http://www.w3.org/TR/css3-selectors/#whitespace\n\twhitespace = \"[\\\\x20\\\\t\\\\r\\\\n\\\\f]\",\n\n\t// http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier\n\tidentifier = \"(?:\\\\\\\\.|[\\\\w-]|[^\\0-\\\\xa0])+\",\n\n\t// Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors\n\tattributes = \"\\\\[\" + whitespace + \"*(\" + identifier + \")(?:\" + whitespace +\n\t\t// Operator (capture 2)\n\t\t\"*([*^$|!~]?=)\" + whitespace +\n\t\t// \"Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]\"\n\t\t\"*(?:'((?:\\\\\\\\.|[^\\\\\\\\'])*)'|\\\"((?:\\\\\\\\.|[^\\\\\\\\\\\"])*)\\\"|(\" + identifier + \"))|)\" + whitespace +\n\t\t\"*\\\\]\",\n\n\tpseudos = \":(\" + identifier + \")(?:\\\\((\" +\n\t\t// To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:\n\t\t// 1. quoted (capture 3; capture 4 or capture 5)\n\t\t\"('((?:\\\\\\\\.|[^\\\\\\\\'])*)'|\\\"((?:\\\\\\\\.|[^\\\\\\\\\\\"])*)\\\")|\" +\n\t\t// 2. simple (capture 6)\n\t\t\"((?:\\\\\\\\.|[^\\\\\\\\()[\\\\]]|\" + attributes + \")*)|\" +\n\t\t// 3. anything else (capture 2)\n\t\t\".*\" +\n\t\t\")\\\\)|)\",\n\n\t// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter\n\trwhitespace = new RegExp( whitespace + \"+\", \"g\" ),\n\trtrim = new RegExp( \"^\" + whitespace + \"+|((?:^|[^\\\\\\\\])(?:\\\\\\\\.)*)\" + whitespace + \"+$\", \"g\" ),\n\n\trcomma = new RegExp( \"^\" + whitespace + \"*,\" + whitespace + \"*\" ),\n\trcombinators = new RegExp( \"^\" + whitespace + \"*([>+~]|\" + whitespace + \")\" + whitespace + \"*\" ),\n\n\trattributeQuotes = new RegExp( \"=\" + whitespace + \"*([^\\\\]'\\\"]*?)\" + whitespace + \"*\\\\]\", \"g\" ),\n\n\trpseudo = new RegExp( pseudos ),\n\tridentifier = new RegExp( \"^\" + identifier + \"$\" ),\n\n\tmatchExpr = {\n\t\t\"ID\": new RegExp( \"^#(\" + identifier + \")\" ),\n\t\t\"CLASS\": new RegExp( \"^\\\\.(\" + identifier + \")\" ),\n\t\t\"TAG\": new RegExp( \"^(\" + identifier + \"|[*])\" ),\n\t\t\"ATTR\": new RegExp( \"^\" + attributes ),\n\t\t\"PSEUDO\": new RegExp( \"^\" + pseudos ),\n\t\t\"CHILD\": new RegExp( \"^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\\\(\" + whitespace +\n\t\t\t\"*(even|odd|(([+-]|)(\\\\d*)n|)\" + whitespace + \"*(?:([+-]|)\" + whitespace +\n\t\t\t\"*(\\\\d+)|))\" + whitespace + \"*\\\\)|)\", \"i\" ),\n\t\t\"bool\": new RegExp( \"^(?:\" + booleans + \")$\", \"i\" ),\n\t\t// For use in libraries implementing .is()\n\t\t// We use this for POS matching in `select`\n\t\t\"needsContext\": new RegExp( \"^\" + whitespace + \"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\\\(\" +\n\t\t\twhitespace + \"*((?:-\\\\d)?\\\\d*)\" + whitespace + \"*\\\\)|)(?=[^-]|$)\", \"i\" )\n\t},\n\n\trinputs = /^(?:input|select|textarea|button)$/i,\n\trheader = /^h\\d$/i,\n\n\trnative = /^[^{]+\\{\\s*\\[native \\w/,\n\n\t// Easily-parseable/retrievable ID or TAG or CLASS selectors\n\trquickExpr = /^(?:#([\\w-]+)|(\\w+)|\\.([\\w-]+))$/,\n\n\trsibling = /[+~]/,\n\n\t// CSS escapes\n\t// http://www.w3.org/TR/CSS21/syndata.html#escaped-characters\n\trunescape = new RegExp( \"\\\\\\\\([\\\\da-f]{1,6}\" + whitespace + \"?|(\" + whitespace + \")|.)\", \"ig\" ),\n\tfunescape = function( _, escaped, escapedWhitespace ) {\n\t\tvar high = \"0x\" + escaped - 0x10000;\n\t\t// NaN means non-codepoint\n\t\t// Support: Firefox<24\n\t\t// Workaround erroneous numeric interpretation of +\"0x\"\n\t\treturn high !== high || escapedWhitespace ?\n\t\t\tescaped :\n\t\t\thigh < 0 ?\n\t\t\t\t// BMP codepoint\n\t\t\t\tString.fromCharCode( high + 0x10000 ) :\n\t\t\t\t// Supplemental Plane codepoint (surrogate pair)\n\t\t\t\tString.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );\n\t},\n\n\t// CSS string/identifier serialization\n\t// https://drafts.csswg.org/cssom/#common-serializing-idioms\n\trcssescape = /([\\0-\\x1f\\x7f]|^-?\\d)|^-$|[^\\0-\\x1f\\x7f-\\uFFFF\\w-]/g,\n\tfcssescape = function( ch, asCodePoint ) {\n\t\tif ( asCodePoint ) {\n\n\t\t\t// U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER\n\t\t\tif ( ch === \"\\0\" ) {\n\t\t\t\treturn \"\\uFFFD\";\n\t\t\t}\n\n\t\t\t// Control characters and (dependent upon position) numbers get escaped as code points\n\t\t\treturn ch.slice( 0, -1 ) + \"\\\\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + \" \";\n\t\t}\n\n\t\t// Other potentially-special ASCII characters get backslash-escaped\n\t\treturn \"\\\\\" + ch;\n\t},\n\n\t// Used for iframes\n\t// See setDocument()\n\t// Removing the function wrapper causes a \"Permission Denied\"\n\t// error in IE\n\tunloadHandler = function() {\n\t\tsetDocument();\n\t},\n\n\tdisabledAncestor = addCombinator(\n\t\tfunction( elem ) {\n\t\t\treturn elem.disabled === true && (\"form\" in elem || \"label\" in elem);\n\t\t},\n\t\t{ dir: \"parentNode\", next: \"legend\" }\n\t);\n\n// Optimize for push.apply( _, NodeList )\ntry {\n\tpush.apply(\n\t\t(arr = slice.call( preferredDoc.childNodes )),\n\t\tpreferredDoc.childNodes\n\t);\n\t// Support: Android<4.0\n\t// Detect silently failing push.apply\n\tarr[ preferredDoc.childNodes.length ].nodeType;\n} catch ( e ) {\n\tpush = { apply: arr.length ?\n\n\t\t// Leverage slice if possible\n\t\tfunction( target, els ) {\n\t\t\tpush_native.apply( target, slice.call(els) );\n\t\t} :\n\n\t\t// Support: IE<9\n\t\t// Otherwise append directly\n\t\tfunction( target, els ) {\n\t\t\tvar j = target.length,\n\t\t\t\ti = 0;\n\t\t\t// Can't trust NodeList.length\n\t\t\twhile ( (target[j++] = els[i++]) ) {}\n\t\t\ttarget.length = j - 1;\n\t\t}\n\t};\n}\n\nfunction Sizzle( selector, context, results, seed ) {\n\tvar m, i, elem, nid, match, groups, newSelector,\n\t\tnewContext = context && context.ownerDocument,\n\n\t\t// nodeType defaults to 9, since context defaults to document\n\t\tnodeType = context ? context.nodeType : 9;\n\n\tresults = results || [];\n\n\t// Return early from calls with invalid selector or context\n\tif ( typeof selector !== \"string\" || !selector ||\n\t\tnodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {\n\n\t\treturn results;\n\t}\n\n\t// Try to shortcut find operations (as opposed to filters) in HTML documents\n\tif ( !seed ) {\n\n\t\tif ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) {\n\t\t\tsetDocument( context );\n\t\t}\n\t\tcontext = context || document;\n\n\t\tif ( documentIsHTML ) {\n\n\t\t\t// If the selector is sufficiently simple, try using a \"get*By*\" DOM method\n\t\t\t// (excepting DocumentFragment context, where the methods don't exist)\n\t\t\tif ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) {\n\n\t\t\t\t// ID selector\n\t\t\t\tif ( (m = match[1]) ) {\n\n\t\t\t\t\t// Document context\n\t\t\t\t\tif ( nodeType === 9 ) {\n\t\t\t\t\t\tif ( (elem = context.getElementById( m )) ) {\n\n\t\t\t\t\t\t\t// Support: IE, Opera, Webkit\n\t\t\t\t\t\t\t// TODO: identify versions\n\t\t\t\t\t\t\t// getElementById can match elements by name instead of ID\n\t\t\t\t\t\t\tif ( elem.id === m ) {\n\t\t\t\t\t\t\t\tresults.push( elem );\n\t\t\t\t\t\t\t\treturn results;\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\treturn results;\n\t\t\t\t\t\t}\n\n\t\t\t\t\t// Element context\n\t\t\t\t\t} else {\n\n\t\t\t\t\t\t// Support: IE, Opera, Webkit\n\t\t\t\t\t\t// TODO: identify versions\n\t\t\t\t\t\t// getElementById can match elements by name instead of ID\n\t\t\t\t\t\tif ( newContext && (elem = newContext.getElementById( m )) &&\n\t\t\t\t\t\t\tcontains( context, elem ) &&\n\t\t\t\t\t\t\telem.id === m ) {\n\n\t\t\t\t\t\t\tresults.push( elem );\n\t\t\t\t\t\t\treturn results;\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t// Type selector\n\t\t\t\t} else if ( match[2] ) {\n\t\t\t\t\tpush.apply( results, context.getElementsByTagName( selector ) );\n\t\t\t\t\treturn results;\n\n\t\t\t\t// Class selector\n\t\t\t\t} else if ( (m = match[3]) && support.getElementsByClassName &&\n\t\t\t\t\tcontext.getElementsByClassName ) {\n\n\t\t\t\t\tpush.apply( results, context.getElementsByClassName( m ) );\n\t\t\t\t\treturn results;\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Take advantage of querySelectorAll\n\t\t\tif ( support.qsa &&\n\t\t\t\t!compilerCache[ selector + \" \" ] &&\n\t\t\t\t(!rbuggyQSA || !rbuggyQSA.test( selector )) ) {\n\n\t\t\t\tif ( nodeType !== 1 ) {\n\t\t\t\t\tnewContext = context;\n\t\t\t\t\tnewSelector = selector;\n\n\t\t\t\t// qSA looks outside Element context, which is not what we want\n\t\t\t\t// Thanks to Andrew Dupont for this workaround technique\n\t\t\t\t// Support: IE <=8\n\t\t\t\t// Exclude object elements\n\t\t\t\t} else if ( context.nodeName.toLowerCase() !== \"object\" ) {\n\n\t\t\t\t\t// Capture the context ID, setting it first if necessary\n\t\t\t\t\tif ( (nid = context.getAttribute( \"id\" )) ) {\n\t\t\t\t\t\tnid = nid.replace( rcssescape, fcssescape );\n\t\t\t\t\t} else {\n\t\t\t\t\t\tcontext.setAttribute( \"id\", (nid = expando) );\n\t\t\t\t\t}\n\n\t\t\t\t\t// Prefix every selector in the list\n\t\t\t\t\tgroups = tokenize( selector );\n\t\t\t\t\ti = groups.length;\n\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\tgroups[i] = \"#\" + nid + \" \" + toSelector( groups[i] );\n\t\t\t\t\t}\n\t\t\t\t\tnewSelector = groups.join( \",\" );\n\n\t\t\t\t\t// Expand context for sibling selectors\n\t\t\t\t\tnewContext = rsibling.test( selector ) && testContext( context.parentNode ) ||\n\t\t\t\t\t\tcontext;\n\t\t\t\t}\n\n\t\t\t\tif ( newSelector ) {\n\t\t\t\t\ttry {\n\t\t\t\t\t\tpush.apply( results,\n\t\t\t\t\t\t\tnewContext.querySelectorAll( newSelector )\n\t\t\t\t\t\t);\n\t\t\t\t\t\treturn results;\n\t\t\t\t\t} catch ( qsaError ) {\n\t\t\t\t\t} finally {\n\t\t\t\t\t\tif ( nid === expando ) {\n\t\t\t\t\t\t\tcontext.removeAttribute( \"id\" );\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// All others\n\treturn select( selector.replace( rtrim, \"$1\" ), context, results, seed );\n}\n\n/**\n * Create key-value caches of limited size\n * @returns {function(string, object)} Returns the Object data after storing it on itself with\n *\tproperty name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)\n *\tdeleting the oldest entry\n */\nfunction createCache() {\n\tvar keys = [];\n\n\tfunction cache( key, value ) {\n\t\t// Use (key + \" \") to avoid collision with native prototype properties (see Issue #157)\n\t\tif ( keys.push( key + \" \" ) > Expr.cacheLength ) {\n\t\t\t// Only keep the most recent entries\n\t\t\tdelete cache[ keys.shift() ];\n\t\t}\n\t\treturn (cache[ key + \" \" ] = value);\n\t}\n\treturn cache;\n}\n\n/**\n * Mark a function for special use by Sizzle\n * @param {Function} fn The function to mark\n */\nfunction markFunction( fn ) {\n\tfn[ expando ] = true;\n\treturn fn;\n}\n\n/**\n * Support testing using an element\n * @param {Function} fn Passed the created element and returns a boolean result\n */\nfunction assert( fn ) {\n\tvar el = document.createElement(\"fieldset\");\n\n\ttry {\n\t\treturn !!fn( el );\n\t} catch (e) {\n\t\treturn false;\n\t} finally {\n\t\t// Remove from its parent by default\n\t\tif ( el.parentNode ) {\n\t\t\tel.parentNode.removeChild( el );\n\t\t}\n\t\t// release memory in IE\n\t\tel = null;\n\t}\n}\n\n/**\n * Adds the same handler for all of the specified attrs\n * @param {String} attrs Pipe-separated list of attributes\n * @param {Function} handler The method that will be applied\n */\nfunction addHandle( attrs, handler ) {\n\tvar arr = attrs.split(\"|\"),\n\t\ti = arr.length;\n\n\twhile ( i-- ) {\n\t\tExpr.attrHandle[ arr[i] ] = handler;\n\t}\n}\n\n/**\n * Checks document order of two siblings\n * @param {Element} a\n * @param {Element} b\n * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b\n */\nfunction siblingCheck( a, b ) {\n\tvar cur = b && a,\n\t\tdiff = cur && a.nodeType === 1 && b.nodeType === 1 &&\n\t\t\ta.sourceIndex - b.sourceIndex;\n\n\t// Use IE sourceIndex if available on both nodes\n\tif ( diff ) {\n\t\treturn diff;\n\t}\n\n\t// Check if b follows a\n\tif ( cur ) {\n\t\twhile ( (cur = cur.nextSibling) ) {\n\t\t\tif ( cur === b ) {\n\t\t\t\treturn -1;\n\t\t\t}\n\t\t}\n\t}\n\n\treturn a ? 1 : -1;\n}\n\n/**\n * Returns a function to use in pseudos for input types\n * @param {String} type\n */\nfunction createInputPseudo( type ) {\n\treturn function( elem ) {\n\t\tvar name = elem.nodeName.toLowerCase();\n\t\treturn name === \"input\" && elem.type === type;\n\t};\n}\n\n/**\n * Returns a function to use in pseudos for buttons\n * @param {String} type\n */\nfunction createButtonPseudo( type ) {\n\treturn function( elem ) {\n\t\tvar name = elem.nodeName.toLowerCase();\n\t\treturn (name === \"input\" || name === \"button\") && elem.type === type;\n\t};\n}\n\n/**\n * Returns a function to use in pseudos for :enabled/:disabled\n * @param {Boolean} disabled true for :disabled; false for :enabled\n */\nfunction createDisabledPseudo( disabled ) {\n\n\t// Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable\n\treturn function( elem ) {\n\n\t\t// Only certain elements can match :enabled or :disabled\n\t\t// https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled\n\t\t// https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled\n\t\tif ( \"form\" in elem ) {\n\n\t\t\t// Check for inherited disabledness on relevant non-disabled elements:\n\t\t\t// * listed form-associated elements in a disabled fieldset\n\t\t\t// https://html.spec.whatwg.org/multipage/forms.html#category-listed\n\t\t\t// https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled\n\t\t\t// * option elements in a disabled optgroup\n\t\t\t// https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled\n\t\t\t// All such elements have a \"form\" property.\n\t\t\tif ( elem.parentNode && elem.disabled === false ) {\n\n\t\t\t\t// Option elements defer to a parent optgroup if present\n\t\t\t\tif ( \"label\" in elem ) {\n\t\t\t\t\tif ( \"label\" in elem.parentNode ) {\n\t\t\t\t\t\treturn elem.parentNode.disabled === disabled;\n\t\t\t\t\t} else {\n\t\t\t\t\t\treturn elem.disabled === disabled;\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\t// Support: IE 6 - 11\n\t\t\t\t// Use the isDisabled shortcut property to check for disabled fieldset ancestors\n\t\t\t\treturn elem.isDisabled === disabled ||\n\n\t\t\t\t\t// Where there is no isDisabled, check manually\n\t\t\t\t\t/* jshint -W018 */\n\t\t\t\t\telem.isDisabled !== !disabled &&\n\t\t\t\t\t\tdisabledAncestor( elem ) === disabled;\n\t\t\t}\n\n\t\t\treturn elem.disabled === disabled;\n\n\t\t// Try to winnow out elements that can't be disabled before trusting the disabled property.\n\t\t// Some victims get caught in our net (label, legend, menu, track), but it shouldn't\n\t\t// even exist on them, let alone have a boolean value.\n\t\t} else if ( \"label\" in elem ) {\n\t\t\treturn elem.disabled === disabled;\n\t\t}\n\n\t\t// Remaining elements are neither :enabled nor :disabled\n\t\treturn false;\n\t};\n}\n\n/**\n * Returns a function to use in pseudos for positionals\n * @param {Function} fn\n */\nfunction createPositionalPseudo( fn ) {\n\treturn markFunction(function( argument ) {\n\t\targument = +argument;\n\t\treturn markFunction(function( seed, matches ) {\n\t\t\tvar j,\n\t\t\t\tmatchIndexes = fn( [], seed.length, argument ),\n\t\t\t\ti = matchIndexes.length;\n\n\t\t\t// Match elements found at the specified indexes\n\t\t\twhile ( i-- ) {\n\t\t\t\tif ( seed[ (j = matchIndexes[i]) ] ) {\n\t\t\t\t\tseed[j] = !(matches[j] = seed[j]);\n\t\t\t\t}\n\t\t\t}\n\t\t});\n\t});\n}\n\n/**\n * Checks a node for validity as a Sizzle context\n * @param {Element|Object=} context\n * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value\n */\nfunction testContext( context ) {\n\treturn context && typeof context.getElementsByTagName !== \"undefined\" && context;\n}\n\n// Expose support vars for convenience\nsupport = Sizzle.support = {};\n\n/**\n * Detects XML nodes\n * @param {Element|Object} elem An element or a document\n * @returns {Boolean} True iff elem is a non-HTML XML node\n */\nisXML = Sizzle.isXML = function( elem ) {\n\t// documentElement is verified for cases where it doesn't yet exist\n\t// (such as loading iframes in IE - #4833)\n\tvar documentElement = elem && (elem.ownerDocument || elem).documentElement;\n\treturn documentElement ? documentElement.nodeName !== \"HTML\" : false;\n};\n\n/**\n * Sets document-related variables once based on the current document\n * @param {Element|Object} [doc] An element or document object to use to set the document\n * @returns {Object} Returns the current document\n */\nsetDocument = Sizzle.setDocument = function( node ) {\n\tvar hasCompare, subWindow,\n\t\tdoc = node ? node.ownerDocument || node : preferredDoc;\n\n\t// Return early if doc is invalid or already selected\n\tif ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) {\n\t\treturn document;\n\t}\n\n\t// Update global variables\n\tdocument = doc;\n\tdocElem = document.documentElement;\n\tdocumentIsHTML = !isXML( document );\n\n\t// Support: IE 9-11, Edge\n\t// Accessing iframe documents after unload throws \"permission denied\" errors (jQuery #13936)\n\tif ( preferredDoc !== document &&\n\t\t(subWindow = document.defaultView) && subWindow.top !== subWindow ) {\n\n\t\t// Support: IE 11, Edge\n\t\tif ( subWindow.addEventListener ) {\n\t\t\tsubWindow.addEventListener( \"unload\", unloadHandler, false );\n\n\t\t// Support: IE 9 - 10 only\n\t\t} else if ( subWindow.attachEvent ) {\n\t\t\tsubWindow.attachEvent( \"onunload\", unloadHandler );\n\t\t}\n\t}\n\n\t/* Attributes\n\t---------------------------------------------------------------------- */\n\n\t// Support: IE<8\n\t// Verify that getAttribute really returns attributes and not properties\n\t// (excepting IE8 booleans)\n\tsupport.attributes = assert(function( el ) {\n\t\tel.className = \"i\";\n\t\treturn !el.getAttribute(\"className\");\n\t});\n\n\t/* getElement(s)By*\n\t---------------------------------------------------------------------- */\n\n\t// Check if getElementsByTagName(\"*\") returns only elements\n\tsupport.getElementsByTagName = assert(function( el ) {\n\t\tel.appendChild( document.createComment(\"\") );\n\t\treturn !el.getElementsByTagName(\"*\").length;\n\t});\n\n\t// Support: IE<9\n\tsupport.getElementsByClassName = rnative.test( document.getElementsByClassName );\n\n\t// Support: IE<10\n\t// Check if getElementById returns elements by name\n\t// The broken getElementById methods don't pick up programmatically-set names,\n\t// so use a roundabout getElementsByName test\n\tsupport.getById = assert(function( el ) {\n\t\tdocElem.appendChild( el ).id = expando;\n\t\treturn !document.getElementsByName || !document.getElementsByName( expando ).length;\n\t});\n\n\t// ID filter and find\n\tif ( support.getById ) {\n\t\tExpr.filter[\"ID\"] = function( id ) {\n\t\t\tvar attrId = id.replace( runescape, funescape );\n\t\t\treturn function( elem ) {\n\t\t\t\treturn elem.getAttribute(\"id\") === attrId;\n\t\t\t};\n\t\t};\n\t\tExpr.find[\"ID\"] = function( id, context ) {\n\t\t\tif ( typeof context.getElementById !== \"undefined\" && documentIsHTML ) {\n\t\t\t\tvar elem = context.getElementById( id );\n\t\t\t\treturn elem ? [ elem ] : [];\n\t\t\t}\n\t\t};\n\t} else {\n\t\tExpr.filter[\"ID\"] = function( id ) {\n\t\t\tvar attrId = id.replace( runescape, funescape );\n\t\t\treturn function( elem ) {\n\t\t\t\tvar node = typeof elem.getAttributeNode !== \"undefined\" &&\n\t\t\t\t\telem.getAttributeNode(\"id\");\n\t\t\t\treturn node && node.value === attrId;\n\t\t\t};\n\t\t};\n\n\t\t// Support: IE 6 - 7 only\n\t\t// getElementById is not reliable as a find shortcut\n\t\tExpr.find[\"ID\"] = function( id, context ) {\n\t\t\tif ( typeof context.getElementById !== \"undefined\" && documentIsHTML ) {\n\t\t\t\tvar node, i, elems,\n\t\t\t\t\telem = context.getElementById( id );\n\n\t\t\t\tif ( elem ) {\n\n\t\t\t\t\t// Verify the id attribute\n\t\t\t\t\tnode = elem.getAttributeNode(\"id\");\n\t\t\t\t\tif ( node && node.value === id ) {\n\t\t\t\t\t\treturn [ elem ];\n\t\t\t\t\t}\n\n\t\t\t\t\t// Fall back on getElementsByName\n\t\t\t\t\telems = context.getElementsByName( id );\n\t\t\t\t\ti = 0;\n\t\t\t\t\twhile ( (elem = elems[i++]) ) {\n\t\t\t\t\t\tnode = elem.getAttributeNode(\"id\");\n\t\t\t\t\t\tif ( node && node.value === id ) {\n\t\t\t\t\t\t\treturn [ elem ];\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\treturn [];\n\t\t\t}\n\t\t};\n\t}\n\n\t// Tag\n\tExpr.find[\"TAG\"] = support.getElementsByTagName ?\n\t\tfunction( tag, context ) {\n\t\t\tif ( typeof context.getElementsByTagName !== \"undefined\" ) {\n\t\t\t\treturn context.getElementsByTagName( tag );\n\n\t\t\t// DocumentFragment nodes don't have gEBTN\n\t\t\t} else if ( support.qsa ) {\n\t\t\t\treturn context.querySelectorAll( tag );\n\t\t\t}\n\t\t} :\n\n\t\tfunction( tag, context ) {\n\t\t\tvar elem,\n\t\t\t\ttmp = [],\n\t\t\t\ti = 0,\n\t\t\t\t// By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too\n\t\t\t\tresults = context.getElementsByTagName( tag );\n\n\t\t\t// Filter out possible comments\n\t\t\tif ( tag === \"*\" ) {\n\t\t\t\twhile ( (elem = results[i++]) ) {\n\t\t\t\t\tif ( elem.nodeType === 1 ) {\n\t\t\t\t\t\ttmp.push( elem );\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\treturn tmp;\n\t\t\t}\n\t\t\treturn results;\n\t\t};\n\n\t// Class\n\tExpr.find[\"CLASS\"] = support.getElementsByClassName && function( className, context ) {\n\t\tif ( typeof context.getElementsByClassName !== \"undefined\" && documentIsHTML ) {\n\t\t\treturn context.getElementsByClassName( className );\n\t\t}\n\t};\n\n\t/* QSA/matchesSelector\n\t---------------------------------------------------------------------- */\n\n\t// QSA and matchesSelector support\n\n\t// matchesSelector(:active) reports false when true (IE9/Opera 11.5)\n\trbuggyMatches = [];\n\n\t// qSa(:focus) reports false when true (Chrome 21)\n\t// We allow this because of a bug in IE8/9 that throws an error\n\t// whenever `document.activeElement` is accessed on an iframe\n\t// So, we allow :focus to pass through QSA all the time to avoid the IE error\n\t// See https://bugs.jquery.com/ticket/13378\n\trbuggyQSA = [];\n\n\tif ( (support.qsa = rnative.test( document.querySelectorAll )) ) {\n\t\t// Build QSA regex\n\t\t// Regex strategy adopted from Diego Perini\n\t\tassert(function( el ) {\n\t\t\t// Select is set to empty string on purpose\n\t\t\t// This is to test IE's treatment of not explicitly\n\t\t\t// setting a boolean content attribute,\n\t\t\t// since its presence should be enough\n\t\t\t// https://bugs.jquery.com/ticket/12359\n\t\t\tdocElem.appendChild( el ).innerHTML = \"<a id='\" + expando + \"'></a>\" +\n\t\t\t\t\"<select id='\" + expando + \"-\\r\\\\' msallowcapture=''>\" +\n\t\t\t\t\"<option selected=''></option></select>\";\n\n\t\t\t// Support: IE8, Opera 11-12.16\n\t\t\t// Nothing should be selected when empty strings follow ^= or $= or *=\n\t\t\t// The test attribute must be unknown in Opera but \"safe\" for WinRT\n\t\t\t// https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section\n\t\t\tif ( el.querySelectorAll(\"[msallowcapture^='']\").length ) {\n\t\t\t\trbuggyQSA.push( \"[*^$]=\" + whitespace + \"*(?:''|\\\"\\\")\" );\n\t\t\t}\n\n\t\t\t// Support: IE8\n\t\t\t// Boolean attributes and \"value\" are not treated correctly\n\t\t\tif ( !el.querySelectorAll(\"[selected]\").length ) {\n\t\t\t\trbuggyQSA.push( \"\\\\[\" + whitespace + \"*(?:value|\" + booleans + \")\" );\n\t\t\t}\n\n\t\t\t// Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+\n\t\t\tif ( !el.querySelectorAll( \"[id~=\" + expando + \"-]\" ).length ) {\n\t\t\t\trbuggyQSA.push(\"~=\");\n\t\t\t}\n\n\t\t\t// Webkit/Opera - :checked should return selected option elements\n\t\t\t// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked\n\t\t\t// IE8 throws error here and will not see later tests\n\t\t\tif ( !el.querySelectorAll(\":checked\").length ) {\n\t\t\t\trbuggyQSA.push(\":checked\");\n\t\t\t}\n\n\t\t\t// Support: Safari 8+, iOS 8+\n\t\t\t// https://bugs.webkit.org/show_bug.cgi?id=136851\n\t\t\t// In-page `selector#id sibling-combinator selector` fails\n\t\t\tif ( !el.querySelectorAll( \"a#\" + expando + \"+*\" ).length ) {\n\t\t\t\trbuggyQSA.push(\".#.+[+~]\");\n\t\t\t}\n\t\t});\n\n\t\tassert(function( el ) {\n\t\t\tel.innerHTML = \"<a href='' disabled='disabled'></a>\" +\n\t\t\t\t\"<select disabled='disabled'><option/></select>\";\n\n\t\t\t// Support: Windows 8 Native Apps\n\t\t\t// The type and name attributes are restricted during .innerHTML assignment\n\t\t\tvar input = document.createElement(\"input\");\n\t\t\tinput.setAttribute( \"type\", \"hidden\" );\n\t\t\tel.appendChild( input ).setAttribute( \"name\", \"D\" );\n\n\t\t\t// Support: IE8\n\t\t\t// Enforce case-sensitivity of name attribute\n\t\t\tif ( el.querySelectorAll(\"[name=d]\").length ) {\n\t\t\t\trbuggyQSA.push( \"name\" + whitespace + \"*[*^$|!~]?=\" );\n\t\t\t}\n\n\t\t\t// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)\n\t\t\t// IE8 throws error here and will not see later tests\n\t\t\tif ( el.querySelectorAll(\":enabled\").length !== 2 ) {\n\t\t\t\trbuggyQSA.push( \":enabled\", \":disabled\" );\n\t\t\t}\n\n\t\t\t// Support: IE9-11+\n\t\t\t// IE's :disabled selector does not pick up the children of disabled fieldsets\n\t\t\tdocElem.appendChild( el ).disabled = true;\n\t\t\tif ( el.querySelectorAll(\":disabled\").length !== 2 ) {\n\t\t\t\trbuggyQSA.push( \":enabled\", \":disabled\" );\n\t\t\t}\n\n\t\t\t// Opera 10-11 does not throw on post-comma invalid pseudos\n\t\t\tel.querySelectorAll(\"*,:x\");\n\t\t\trbuggyQSA.push(\",.*:\");\n\t\t});\n\t}\n\n\tif ( (support.matchesSelector = rnative.test( (matches = docElem.matches ||\n\t\tdocElem.webkitMatchesSelector ||\n\t\tdocElem.mozMatchesSelector ||\n\t\tdocElem.oMatchesSelector ||\n\t\tdocElem.msMatchesSelector) )) ) {\n\n\t\tassert(function( el ) {\n\t\t\t// Check to see if it's possible to do matchesSelector\n\t\t\t// on a disconnected node (IE 9)\n\t\t\tsupport.disconnectedMatch = matches.call( el, \"*\" );\n\n\t\t\t// This should fail with an exception\n\t\t\t// Gecko does not error, returns false instead\n\t\t\tmatches.call( el, \"[s!='']:x\" );\n\t\t\trbuggyMatches.push( \"!=\", pseudos );\n\t\t});\n\t}\n\n\trbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join(\"|\") );\n\trbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join(\"|\") );\n\n\t/* Contains\n\t---------------------------------------------------------------------- */\n\thasCompare = rnative.test( docElem.compareDocumentPosition );\n\n\t// Element contains another\n\t// Purposefully self-exclusive\n\t// As in, an element does not contain itself\n\tcontains = hasCompare || rnative.test( docElem.contains ) ?\n\t\tfunction( a, b ) {\n\t\t\tvar adown = a.nodeType === 9 ? a.documentElement : a,\n\t\t\t\tbup = b && b.parentNode;\n\t\t\treturn a === bup || !!( bup && bup.nodeType === 1 && (\n\t\t\t\tadown.contains ?\n\t\t\t\t\tadown.contains( bup ) :\n\t\t\t\t\ta.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16\n\t\t\t));\n\t\t} :\n\t\tfunction( a, b ) {\n\t\t\tif ( b ) {\n\t\t\t\twhile ( (b = b.parentNode) ) {\n\t\t\t\t\tif ( b === a ) {\n\t\t\t\t\t\treturn true;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn false;\n\t\t};\n\n\t/* Sorting\n\t---------------------------------------------------------------------- */\n\n\t// Document order sorting\n\tsortOrder = hasCompare ?\n\tfunction( a, b ) {\n\n\t\t// Flag for duplicate removal\n\t\tif ( a === b ) {\n\t\t\thasDuplicate = true;\n\t\t\treturn 0;\n\t\t}\n\n\t\t// Sort on method existence if only one input has compareDocumentPosition\n\t\tvar compare = !a.compareDocumentPosition - !b.compareDocumentPosition;\n\t\tif ( compare ) {\n\t\t\treturn compare;\n\t\t}\n\n\t\t// Calculate position if both inputs belong to the same document\n\t\tcompare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ?\n\t\t\ta.compareDocumentPosition( b ) :\n\n\t\t\t// Otherwise we know they are disconnected\n\t\t\t1;\n\n\t\t// Disconnected nodes\n\t\tif ( compare & 1 ||\n\t\t\t(!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) {\n\n\t\t\t// Choose the first element that is related to our preferred document\n\t\t\tif ( a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) {\n\t\t\t\treturn -1;\n\t\t\t}\n\t\t\tif ( b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) {\n\t\t\t\treturn 1;\n\t\t\t}\n\n\t\t\t// Maintain original order\n\t\t\treturn sortInput ?\n\t\t\t\t( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :\n\t\t\t\t0;\n\t\t}\n\n\t\treturn compare & 4 ? -1 : 1;\n\t} :\n\tfunction( a, b ) {\n\t\t// Exit early if the nodes are identical\n\t\tif ( a === b ) {\n\t\t\thasDuplicate = true;\n\t\t\treturn 0;\n\t\t}\n\n\t\tvar cur,\n\t\t\ti = 0,\n\t\t\taup = a.parentNode,\n\t\t\tbup = b.parentNode,\n\t\t\tap = [ a ],\n\t\t\tbp = [ b ];\n\n\t\t// Parentless nodes are either documents or disconnected\n\t\tif ( !aup || !bup ) {\n\t\t\treturn a === document ? -1 :\n\t\t\t\tb === document ? 1 :\n\t\t\t\taup ? -1 :\n\t\t\t\tbup ? 1 :\n\t\t\t\tsortInput ?\n\t\t\t\t( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :\n\t\t\t\t0;\n\n\t\t// If the nodes are siblings, we can do a quick check\n\t\t} else if ( aup === bup ) {\n\t\t\treturn siblingCheck( a, b );\n\t\t}\n\n\t\t// Otherwise we need full lists of their ancestors for comparison\n\t\tcur = a;\n\t\twhile ( (cur = cur.parentNode) ) {\n\t\t\tap.unshift( cur );\n\t\t}\n\t\tcur = b;\n\t\twhile ( (cur = cur.parentNode) ) {\n\t\t\tbp.unshift( cur );\n\t\t}\n\n\t\t// Walk down the tree looking for a discrepancy\n\t\twhile ( ap[i] === bp[i] ) {\n\t\t\ti++;\n\t\t}\n\n\t\treturn i ?\n\t\t\t// Do a sibling check if the nodes have a common ancestor\n\t\t\tsiblingCheck( ap[i], bp[i] ) :\n\n\t\t\t// Otherwise nodes in our document sort first\n\t\t\tap[i] === preferredDoc ? -1 :\n\t\t\tbp[i] === preferredDoc ? 1 :\n\t\t\t0;\n\t};\n\n\treturn document;\n};\n\nSizzle.matches = function( expr, elements ) {\n\treturn Sizzle( expr, null, null, elements );\n};\n\nSizzle.matchesSelector = function( elem, expr ) {\n\t// Set document vars if needed\n\tif ( ( elem.ownerDocument || elem ) !== document ) {\n\t\tsetDocument( elem );\n\t}\n\n\t// Make sure that attribute selectors are quoted\n\texpr = expr.replace( rattributeQuotes, \"='$1']\" );\n\n\tif ( support.matchesSelector && documentIsHTML &&\n\t\t!compilerCache[ expr + \" \" ] &&\n\t\t( !rbuggyMatches || !rbuggyMatches.test( expr ) ) &&\n\t\t( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) {\n\n\t\ttry {\n\t\t\tvar ret = matches.call( elem, expr );\n\n\t\t\t// IE 9's matchesSelector returns false on disconnected nodes\n\t\t\tif ( ret || support.disconnectedMatch ||\n\t\t\t\t\t// As well, disconnected nodes are said to be in a document\n\t\t\t\t\t// fragment in IE 9\n\t\t\t\t\telem.document && elem.document.nodeType !== 11 ) {\n\t\t\t\treturn ret;\n\t\t\t}\n\t\t} catch (e) {}\n\t}\n\n\treturn Sizzle( expr, document, null, [ elem ] ).length > 0;\n};\n\nSizzle.contains = function( context, elem ) {\n\t// Set document vars if needed\n\tif ( ( context.ownerDocument || context ) !== document ) {\n\t\tsetDocument( context );\n\t}\n\treturn contains( context, elem );\n};\n\nSizzle.attr = function( elem, name ) {\n\t// Set document vars if needed\n\tif ( ( elem.ownerDocument || elem ) !== document ) {\n\t\tsetDocument( elem );\n\t}\n\n\tvar fn = Expr.attrHandle[ name.toLowerCase() ],\n\t\t// Don't get fooled by Object.prototype properties (jQuery #13807)\n\t\tval = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?\n\t\t\tfn( elem, name, !documentIsHTML ) :\n\t\t\tundefined;\n\n\treturn val !== undefined ?\n\t\tval :\n\t\tsupport.attributes || !documentIsHTML ?\n\t\t\telem.getAttribute( name ) :\n\t\t\t(val = elem.getAttributeNode(name)) && val.specified ?\n\t\t\t\tval.value :\n\t\t\t\tnull;\n};\n\nSizzle.escape = function( sel ) {\n\treturn (sel + \"\").replace( rcssescape, fcssescape );\n};\n\nSizzle.error = function( msg ) {\n\tthrow new Error( \"Syntax error, unrecognized expression: \" + msg );\n};\n\n/**\n * Document sorting and removing duplicates\n * @param {ArrayLike} results\n */\nSizzle.uniqueSort = function( results ) {\n\tvar elem,\n\t\tduplicates = [],\n\t\tj = 0,\n\t\ti = 0;\n\n\t// Unless we *know* we can detect duplicates, assume their presence\n\thasDuplicate = !support.detectDuplicates;\n\tsortInput = !support.sortStable && results.slice( 0 );\n\tresults.sort( sortOrder );\n\n\tif ( hasDuplicate ) {\n\t\twhile ( (elem = results[i++]) ) {\n\t\t\tif ( elem === results[ i ] ) {\n\t\t\t\tj = duplicates.push( i );\n\t\t\t}\n\t\t}\n\t\twhile ( j-- ) {\n\t\t\tresults.splice( duplicates[ j ], 1 );\n\t\t}\n\t}\n\n\t// Clear input after sorting to release objects\n\t// See https://github.com/jquery/sizzle/pull/225\n\tsortInput = null;\n\n\treturn results;\n};\n\n/**\n * Utility function for retrieving the text value of an array of DOM nodes\n * @param {Array|Element} elem\n */\ngetText = Sizzle.getText = function( elem ) {\n\tvar node,\n\t\tret = \"\",\n\t\ti = 0,\n\t\tnodeType = elem.nodeType;\n\n\tif ( !nodeType ) {\n\t\t// If no nodeType, this is expected to be an array\n\t\twhile ( (node = elem[i++]) ) {\n\t\t\t// Do not traverse comment nodes\n\t\t\tret += getText( node );\n\t\t}\n\t} else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {\n\t\t// Use textContent for elements\n\t\t// innerText usage removed for consistency of new lines (jQuery #11153)\n\t\tif ( typeof elem.textContent === \"string\" ) {\n\t\t\treturn elem.textContent;\n\t\t} else {\n\t\t\t// Traverse its children\n\t\t\tfor ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {\n\t\t\t\tret += getText( elem );\n\t\t\t}\n\t\t}\n\t} else if ( nodeType === 3 || nodeType === 4 ) {\n\t\treturn elem.nodeValue;\n\t}\n\t// Do not include comment or processing instruction nodes\n\n\treturn ret;\n};\n\nExpr = Sizzle.selectors = {\n\n\t// Can be adjusted by the user\n\tcacheLength: 50,\n\n\tcreatePseudo: markFunction,\n\n\tmatch: matchExpr,\n\n\tattrHandle: {},\n\n\tfind: {},\n\n\trelative: {\n\t\t\">\": { dir: \"parentNode\", first: true },\n\t\t\" \": { dir: \"parentNode\" },\n\t\t\"+\": { dir: \"previousSibling\", first: true },\n\t\t\"~\": { dir: \"previousSibling\" }\n\t},\n\n\tpreFilter: {\n\t\t\"ATTR\": function( match ) {\n\t\t\tmatch[1] = match[1].replace( runescape, funescape );\n\n\t\t\t// Move the given value to match[3] whether quoted or unquoted\n\t\t\tmatch[3] = ( match[3] || match[4] || match[5] || \"\" ).replace( runescape, funescape );\n\n\t\t\tif ( match[2] === \"~=\" ) {\n\t\t\t\tmatch[3] = \" \" + match[3] + \" \";\n\t\t\t}\n\n\t\t\treturn match.slice( 0, 4 );\n\t\t},\n\n\t\t\"CHILD\": function( match ) {\n\t\t\t/* matches from matchExpr[\"CHILD\"]\n\t\t\t\t1 type (only|nth|...)\n\t\t\t\t2 what (child|of-type)\n\t\t\t\t3 argument (even|odd|\\d*|\\d*n([+-]\\d+)?|...)\n\t\t\t\t4 xn-component of xn+y argument ([+-]?\\d*n|)\n\t\t\t\t5 sign of xn-component\n\t\t\t\t6 x of xn-component\n\t\t\t\t7 sign of y-component\n\t\t\t\t8 y of y-component\n\t\t\t*/\n\t\t\tmatch[1] = match[1].toLowerCase();\n\n\t\t\tif ( match[1].slice( 0, 3 ) === \"nth\" ) {\n\t\t\t\t// nth-* requires argument\n\t\t\t\tif ( !match[3] ) {\n\t\t\t\t\tSizzle.error( match[0] );\n\t\t\t\t}\n\n\t\t\t\t// numeric x and y parameters for Expr.filter.CHILD\n\t\t\t\t// remember that false/true cast respectively to 0/1\n\t\t\t\tmatch[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === \"even\" || match[3] === \"odd\" ) );\n\t\t\t\tmatch[5] = +( ( match[7] + match[8] ) || match[3] === \"odd\" );\n\n\t\t\t// other types prohibit arguments\n\t\t\t} else if ( match[3] ) {\n\t\t\t\tSizzle.error( match[0] );\n\t\t\t}\n\n\t\t\treturn match;\n\t\t},\n\n\t\t\"PSEUDO\": function( match ) {\n\t\t\tvar excess,\n\t\t\t\tunquoted = !match[6] && match[2];\n\n\t\t\tif ( matchExpr[\"CHILD\"].test( match[0] ) ) {\n\t\t\t\treturn null;\n\t\t\t}\n\n\t\t\t// Accept quoted arguments as-is\n\t\t\tif ( match[3] ) {\n\t\t\t\tmatch[2] = match[4] || match[5] || \"\";\n\n\t\t\t// Strip excess characters from unquoted arguments\n\t\t\t} else if ( unquoted && rpseudo.test( unquoted ) &&\n\t\t\t\t// Get excess from tokenize (recursively)\n\t\t\t\t(excess = tokenize( unquoted, true )) &&\n\t\t\t\t// advance to the next closing parenthesis\n\t\t\t\t(excess = unquoted.indexOf( \")\", unquoted.length - excess ) - unquoted.length) ) {\n\n\t\t\t\t// excess is a negative index\n\t\t\t\tmatch[0] = match[0].slice( 0, excess );\n\t\t\t\tmatch[2] = unquoted.slice( 0, excess );\n\t\t\t}\n\n\t\t\t// Return only captures needed by the pseudo filter method (type and argument)\n\t\t\treturn match.slice( 0, 3 );\n\t\t}\n\t},\n\n\tfilter: {\n\n\t\t\"TAG\": function( nodeNameSelector ) {\n\t\t\tvar nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();\n\t\t\treturn nodeNameSelector === \"*\" ?\n\t\t\t\tfunction() { return true; } :\n\t\t\t\tfunction( elem ) {\n\t\t\t\t\treturn elem.nodeName && elem.nodeName.toLowerCase() === nodeName;\n\t\t\t\t};\n\t\t},\n\n\t\t\"CLASS\": function( className ) {\n\t\t\tvar pattern = classCache[ className + \" \" ];\n\n\t\t\treturn pattern ||\n\t\t\t\t(pattern = new RegExp( \"(^|\" + whitespace + \")\" + className + \"(\" + whitespace + \"|$)\" )) &&\n\t\t\t\tclassCache( className, function( elem ) {\n\t\t\t\t\treturn pattern.test( typeof elem.className === \"string\" && elem.className || typeof elem.getAttribute !== \"undefined\" && elem.getAttribute(\"class\") || \"\" );\n\t\t\t\t});\n\t\t},\n\n\t\t\"ATTR\": function( name, operator, check ) {\n\t\t\treturn function( elem ) {\n\t\t\t\tvar result = Sizzle.attr( elem, name );\n\n\t\t\t\tif ( result == null ) {\n\t\t\t\t\treturn operator === \"!=\";\n\t\t\t\t}\n\t\t\t\tif ( !operator ) {\n\t\t\t\t\treturn true;\n\t\t\t\t}\n\n\t\t\t\tresult += \"\";\n\n\t\t\t\treturn operator === \"=\" ? result === check :\n\t\t\t\t\toperator === \"!=\" ? result !== check :\n\t\t\t\t\toperator === \"^=\" ? check && result.indexOf( check ) === 0 :\n\t\t\t\t\toperator === \"*=\" ? check && result.indexOf( check ) > -1 :\n\t\t\t\t\toperator === \"$=\" ? check && result.slice( -check.length ) === check :\n\t\t\t\t\toperator === \"~=\" ? ( \" \" + result.replace( rwhitespace, \" \" ) + \" \" ).indexOf( check ) > -1 :\n\t\t\t\t\toperator === \"|=\" ? result === check || result.slice( 0, check.length + 1 ) === check + \"-\" :\n\t\t\t\t\tfalse;\n\t\t\t};\n\t\t},\n\n\t\t\"CHILD\": function( type, what, argument, first, last ) {\n\t\t\tvar simple = type.slice( 0, 3 ) !== \"nth\",\n\t\t\t\tforward = type.slice( -4 ) !== \"last\",\n\t\t\t\tofType = what === \"of-type\";\n\n\t\t\treturn first === 1 && last === 0 ?\n\n\t\t\t\t// Shortcut for :nth-*(n)\n\t\t\t\tfunction( elem ) {\n\t\t\t\t\treturn !!elem.parentNode;\n\t\t\t\t} :\n\n\t\t\t\tfunction( elem, context, xml ) {\n\t\t\t\t\tvar cache, uniqueCache, outerCache, node, nodeIndex, start,\n\t\t\t\t\t\tdir = simple !== forward ? \"nextSibling\" : \"previousSibling\",\n\t\t\t\t\t\tparent = elem.parentNode,\n\t\t\t\t\t\tname = ofType && elem.nodeName.toLowerCase(),\n\t\t\t\t\t\tuseCache = !xml && !ofType,\n\t\t\t\t\t\tdiff = false;\n\n\t\t\t\t\tif ( parent ) {\n\n\t\t\t\t\t\t// :(first|last|only)-(child|of-type)\n\t\t\t\t\t\tif ( simple ) {\n\t\t\t\t\t\t\twhile ( dir ) {\n\t\t\t\t\t\t\t\tnode = elem;\n\t\t\t\t\t\t\t\twhile ( (node = node[ dir ]) ) {\n\t\t\t\t\t\t\t\t\tif ( ofType ?\n\t\t\t\t\t\t\t\t\t\tnode.nodeName.toLowerCase() === name :\n\t\t\t\t\t\t\t\t\t\tnode.nodeType === 1 ) {\n\n\t\t\t\t\t\t\t\t\t\treturn false;\n\t\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t// Reverse direction for :only-* (if we haven't yet done so)\n\t\t\t\t\t\t\t\tstart = dir = type === \"only\" && !start && \"nextSibling\";\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\treturn true;\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\tstart = [ forward ? parent.firstChild : parent.lastChild ];\n\n\t\t\t\t\t\t// non-xml :nth-child(...) stores cache data on `parent`\n\t\t\t\t\t\tif ( forward && useCache ) {\n\n\t\t\t\t\t\t\t// Seek `elem` from a previously-cached index\n\n\t\t\t\t\t\t\t// ...in a gzip-friendly way\n\t\t\t\t\t\t\tnode = parent;\n\t\t\t\t\t\t\touterCache = node[ expando ] || (node[ expando ] = {});\n\n\t\t\t\t\t\t\t// Support: IE <9 only\n\t\t\t\t\t\t\t// Defend against cloned attroperties (jQuery gh-1709)\n\t\t\t\t\t\t\tuniqueCache = outerCache[ node.uniqueID ] ||\n\t\t\t\t\t\t\t\t(outerCache[ node.uniqueID ] = {});\n\n\t\t\t\t\t\t\tcache = uniqueCache[ type ] || [];\n\t\t\t\t\t\t\tnodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];\n\t\t\t\t\t\t\tdiff = nodeIndex && cache[ 2 ];\n\t\t\t\t\t\t\tnode = nodeIndex && parent.childNodes[ nodeIndex ];\n\n\t\t\t\t\t\t\twhile ( (node = ++nodeIndex && node && node[ dir ] ||\n\n\t\t\t\t\t\t\t\t// Fallback to seeking `elem` from the start\n\t\t\t\t\t\t\t\t(diff = nodeIndex = 0) || start.pop()) ) {\n\n\t\t\t\t\t\t\t\t// When found, cache indexes on `parent` and break\n\t\t\t\t\t\t\t\tif ( node.nodeType === 1 && ++diff && node === elem ) {\n\t\t\t\t\t\t\t\t\tuniqueCache[ type ] = [ dirruns, nodeIndex, diff ];\n\t\t\t\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t// Use previously-cached element index if available\n\t\t\t\t\t\t\tif ( useCache ) {\n\t\t\t\t\t\t\t\t// ...in a gzip-friendly way\n\t\t\t\t\t\t\t\tnode = elem;\n\t\t\t\t\t\t\t\touterCache = node[ expando ] || (node[ expando ] = {});\n\n\t\t\t\t\t\t\t\t// Support: IE <9 only\n\t\t\t\t\t\t\t\t// Defend against cloned attroperties (jQuery gh-1709)\n\t\t\t\t\t\t\t\tuniqueCache = outerCache[ node.uniqueID ] ||\n\t\t\t\t\t\t\t\t\t(outerCache[ node.uniqueID ] = {});\n\n\t\t\t\t\t\t\t\tcache = uniqueCache[ type ] || [];\n\t\t\t\t\t\t\t\tnodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];\n\t\t\t\t\t\t\t\tdiff = nodeIndex;\n\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t\t// xml :nth-child(...)\n\t\t\t\t\t\t\t// or :nth-last-child(...) or :nth(-last)?-of-type(...)\n\t\t\t\t\t\t\tif ( diff === false ) {\n\t\t\t\t\t\t\t\t// Use the same loop as above to seek `elem` from the start\n\t\t\t\t\t\t\t\twhile ( (node = ++nodeIndex && node && node[ dir ] ||\n\t\t\t\t\t\t\t\t\t(diff = nodeIndex = 0) || start.pop()) ) {\n\n\t\t\t\t\t\t\t\t\tif ( ( ofType ?\n\t\t\t\t\t\t\t\t\t\tnode.nodeName.toLowerCase() === name :\n\t\t\t\t\t\t\t\t\t\tnode.nodeType === 1 ) &&\n\t\t\t\t\t\t\t\t\t\t++diff ) {\n\n\t\t\t\t\t\t\t\t\t\t// Cache the index of each encountered element\n\t\t\t\t\t\t\t\t\t\tif ( useCache ) {\n\t\t\t\t\t\t\t\t\t\t\touterCache = node[ expando ] || (node[ expando ] = {});\n\n\t\t\t\t\t\t\t\t\t\t\t// Support: IE <9 only\n\t\t\t\t\t\t\t\t\t\t\t// Defend against cloned attroperties (jQuery gh-1709)\n\t\t\t\t\t\t\t\t\t\t\tuniqueCache = outerCache[ node.uniqueID ] ||\n\t\t\t\t\t\t\t\t\t\t\t\t(outerCache[ node.uniqueID ] = {});\n\n\t\t\t\t\t\t\t\t\t\t\tuniqueCache[ type ] = [ dirruns, diff ];\n\t\t\t\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t\t\t\t\tif ( node === elem ) {\n\t\t\t\t\t\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\t// Incorporate the offset, then check against cycle size\n\t\t\t\t\t\tdiff -= last;\n\t\t\t\t\t\treturn diff === first || ( diff % first === 0 && diff / first >= 0 );\n\t\t\t\t\t}\n\t\t\t\t};\n\t\t},\n\n\t\t\"PSEUDO\": function( pseudo, argument ) {\n\t\t\t// pseudo-class names are case-insensitive\n\t\t\t// http://www.w3.org/TR/selectors/#pseudo-classes\n\t\t\t// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters\n\t\t\t// Remember that setFilters inherits from pseudos\n\t\t\tvar args,\n\t\t\t\tfn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||\n\t\t\t\t\tSizzle.error( \"unsupported pseudo: \" + pseudo );\n\n\t\t\t// The user may use createPseudo to indicate that\n\t\t\t// arguments are needed to create the filter function\n\t\t\t// just as Sizzle does\n\t\t\tif ( fn[ expando ] ) {\n\t\t\t\treturn fn( argument );\n\t\t\t}\n\n\t\t\t// But maintain support for old signatures\n\t\t\tif ( fn.length > 1 ) {\n\t\t\t\targs = [ pseudo, pseudo, \"\", argument ];\n\t\t\t\treturn Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?\n\t\t\t\t\tmarkFunction(function( seed, matches ) {\n\t\t\t\t\t\tvar idx,\n\t\t\t\t\t\t\tmatched = fn( seed, argument ),\n\t\t\t\t\t\t\ti = matched.length;\n\t\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\t\tidx = indexOf( seed, matched[i] );\n\t\t\t\t\t\t\tseed[ idx ] = !( matches[ idx ] = matched[i] );\n\t\t\t\t\t\t}\n\t\t\t\t\t}) :\n\t\t\t\t\tfunction( elem ) {\n\t\t\t\t\t\treturn fn( elem, 0, args );\n\t\t\t\t\t};\n\t\t\t}\n\n\t\t\treturn fn;\n\t\t}\n\t},\n\n\tpseudos: {\n\t\t// Potentially complex pseudos\n\t\t\"not\": markFunction(function( selector ) {\n\t\t\t// Trim the selector passed to compile\n\t\t\t// to avoid treating leading and trailing\n\t\t\t// spaces as combinators\n\t\t\tvar input = [],\n\t\t\t\tresults = [],\n\t\t\t\tmatcher = compile( selector.replace( rtrim, \"$1\" ) );\n\n\t\t\treturn matcher[ expando ] ?\n\t\t\t\tmarkFunction(function( seed, matches, context, xml ) {\n\t\t\t\t\tvar elem,\n\t\t\t\t\t\tunmatched = matcher( seed, null, xml, [] ),\n\t\t\t\t\t\ti = seed.length;\n\n\t\t\t\t\t// Match elements unmatched by `matcher`\n\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\tif ( (elem = unmatched[i]) ) {\n\t\t\t\t\t\t\tseed[i] = !(matches[i] = elem);\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}) :\n\t\t\t\tfunction( elem, context, xml ) {\n\t\t\t\t\tinput[0] = elem;\n\t\t\t\t\tmatcher( input, null, xml, results );\n\t\t\t\t\t// Don't keep the element (issue #299)\n\t\t\t\t\tinput[0] = null;\n\t\t\t\t\treturn !results.pop();\n\t\t\t\t};\n\t\t}),\n\n\t\t\"has\": markFunction(function( selector ) {\n\t\t\treturn function( elem ) {\n\t\t\t\treturn Sizzle( selector, elem ).length > 0;\n\t\t\t};\n\t\t}),\n\n\t\t\"contains\": markFunction(function( text ) {\n\t\t\ttext = text.replace( runescape, funescape );\n\t\t\treturn function( elem ) {\n\t\t\t\treturn ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;\n\t\t\t};\n\t\t}),\n\n\t\t// \"Whether an element is represented by a :lang() selector\n\t\t// is based solely on the element's language value\n\t\t// being equal to the identifier C,\n\t\t// or beginning with the identifier C immediately followed by \"-\".\n\t\t// The matching of C against the element's language value is performed case-insensitively.\n\t\t// The identifier C does not have to be a valid language name.\"\n\t\t// http://www.w3.org/TR/selectors/#lang-pseudo\n\t\t\"lang\": markFunction( function( lang ) {\n\t\t\t// lang value must be a valid identifier\n\t\t\tif ( !ridentifier.test(lang || \"\") ) {\n\t\t\t\tSizzle.error( \"unsupported lang: \" + lang );\n\t\t\t}\n\t\t\tlang = lang.replace( runescape, funescape ).toLowerCase();\n\t\t\treturn function( elem ) {\n\t\t\t\tvar elemLang;\n\t\t\t\tdo {\n\t\t\t\t\tif ( (elemLang = documentIsHTML ?\n\t\t\t\t\t\telem.lang :\n\t\t\t\t\t\telem.getAttribute(\"xml:lang\") || elem.getAttribute(\"lang\")) ) {\n\n\t\t\t\t\t\telemLang = elemLang.toLowerCase();\n\t\t\t\t\t\treturn elemLang === lang || elemLang.indexOf( lang + \"-\" ) === 0;\n\t\t\t\t\t}\n\t\t\t\t} while ( (elem = elem.parentNode) && elem.nodeType === 1 );\n\t\t\t\treturn false;\n\t\t\t};\n\t\t}),\n\n\t\t// Miscellaneous\n\t\t\"target\": function( elem ) {\n\t\t\tvar hash = window.location && window.location.hash;\n\t\t\treturn hash && hash.slice( 1 ) === elem.id;\n\t\t},\n\n\t\t\"root\": function( elem ) {\n\t\t\treturn elem === docElem;\n\t\t},\n\n\t\t\"focus\": function( elem ) {\n\t\t\treturn elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);\n\t\t},\n\n\t\t// Boolean properties\n\t\t\"enabled\": createDisabledPseudo( false ),\n\t\t\"disabled\": createDisabledPseudo( true ),\n\n\t\t\"checked\": function( elem ) {\n\t\t\t// In CSS3, :checked should return both checked and selected elements\n\t\t\t// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked\n\t\t\tvar nodeName = elem.nodeName.toLowerCase();\n\t\t\treturn (nodeName === \"input\" && !!elem.checked) || (nodeName === \"option\" && !!elem.selected);\n\t\t},\n\n\t\t\"selected\": function( elem ) {\n\t\t\t// Accessing this property makes selected-by-default\n\t\t\t// options in Safari work properly\n\t\t\tif ( elem.parentNode ) {\n\t\t\t\telem.parentNode.selectedIndex;\n\t\t\t}\n\n\t\t\treturn elem.selected === true;\n\t\t},\n\n\t\t// Contents\n\t\t\"empty\": function( elem ) {\n\t\t\t// http://www.w3.org/TR/selectors/#empty-pseudo\n\t\t\t// :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),\n\t\t\t// but not by others (comment: 8; processing instruction: 7; etc.)\n\t\t\t// nodeType < 6 works because attributes (2) do not appear as children\n\t\t\tfor ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {\n\t\t\t\tif ( elem.nodeType < 6 ) {\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn true;\n\t\t},\n\n\t\t\"parent\": function( elem ) {\n\t\t\treturn !Expr.pseudos[\"empty\"]( elem );\n\t\t},\n\n\t\t// Element/input types\n\t\t\"header\": function( elem ) {\n\t\t\treturn rheader.test( elem.nodeName );\n\t\t},\n\n\t\t\"input\": function( elem ) {\n\t\t\treturn rinputs.test( elem.nodeName );\n\t\t},\n\n\t\t\"button\": function( elem ) {\n\t\t\tvar name = elem.nodeName.toLowerCase();\n\t\t\treturn name === \"input\" && elem.type === \"button\" || name === \"button\";\n\t\t},\n\n\t\t\"text\": function( elem ) {\n\t\t\tvar attr;\n\t\t\treturn elem.nodeName.toLowerCase() === \"input\" &&\n\t\t\t\telem.type === \"text\" &&\n\n\t\t\t\t// Support: IE<8\n\t\t\t\t// New HTML5 attribute values (e.g., \"search\") appear with elem.type === \"text\"\n\t\t\t\t( (attr = elem.getAttribute(\"type\")) == null || attr.toLowerCase() === \"text\" );\n\t\t},\n\n\t\t// Position-in-collection\n\t\t\"first\": createPositionalPseudo(function() {\n\t\t\treturn [ 0 ];\n\t\t}),\n\n\t\t\"last\": createPositionalPseudo(function( matchIndexes, length ) {\n\t\t\treturn [ length - 1 ];\n\t\t}),\n\n\t\t\"eq\": createPositionalPseudo(function( matchIndexes, length, argument ) {\n\t\t\treturn [ argument < 0 ? argument + length : argument ];\n\t\t}),\n\n\t\t\"even\": createPositionalPseudo(function( matchIndexes, length ) {\n\t\t\tvar i = 0;\n\t\t\tfor ( ; i < length; i += 2 ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t}),\n\n\t\t\"odd\": createPositionalPseudo(function( matchIndexes, length ) {\n\t\t\tvar i = 1;\n\t\t\tfor ( ; i < length; i += 2 ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t}),\n\n\t\t\"lt\": createPositionalPseudo(function( matchIndexes, length, argument ) {\n\t\t\tvar i = argument < 0 ? argument + length : argument;\n\t\t\tfor ( ; --i >= 0; ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t}),\n\n\t\t\"gt\": createPositionalPseudo(function( matchIndexes, length, argument ) {\n\t\t\tvar i = argument < 0 ? argument + length : argument;\n\t\t\tfor ( ; ++i < length; ) {\n\t\t\t\tmatchIndexes.push( i );\n\t\t\t}\n\t\t\treturn matchIndexes;\n\t\t})\n\t}\n};\n\nExpr.pseudos[\"nth\"] = Expr.pseudos[\"eq\"];\n\n// Add button/input type pseudos\nfor ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {\n\tExpr.pseudos[ i ] = createInputPseudo( i );\n}\nfor ( i in { submit: true, reset: true } ) {\n\tExpr.pseudos[ i ] = createButtonPseudo( i );\n}\n\n// Easy API for creating new setFilters\nfunction setFilters() {}\nsetFilters.prototype = Expr.filters = Expr.pseudos;\nExpr.setFilters = new setFilters();\n\ntokenize = Sizzle.tokenize = function( selector, parseOnly ) {\n\tvar matched, match, tokens, type,\n\t\tsoFar, groups, preFilters,\n\t\tcached = tokenCache[ selector + \" \" ];\n\n\tif ( cached ) {\n\t\treturn parseOnly ? 0 : cached.slice( 0 );\n\t}\n\n\tsoFar = selector;\n\tgroups = [];\n\tpreFilters = Expr.preFilter;\n\n\twhile ( soFar ) {\n\n\t\t// Comma and first run\n\t\tif ( !matched || (match = rcomma.exec( soFar )) ) {\n\t\t\tif ( match ) {\n\t\t\t\t// Don't consume trailing commas as valid\n\t\t\t\tsoFar = soFar.slice( match[0].length ) || soFar;\n\t\t\t}\n\t\t\tgroups.push( (tokens = []) );\n\t\t}\n\n\t\tmatched = false;\n\n\t\t// Combinators\n\t\tif ( (match = rcombinators.exec( soFar )) ) {\n\t\t\tmatched = match.shift();\n\t\t\ttokens.push({\n\t\t\t\tvalue: matched,\n\t\t\t\t// Cast descendant combinators to space\n\t\t\t\ttype: match[0].replace( rtrim, \" \" )\n\t\t\t});\n\t\t\tsoFar = soFar.slice( matched.length );\n\t\t}\n\n\t\t// Filters\n\t\tfor ( type in Expr.filter ) {\n\t\t\tif ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||\n\t\t\t\t(match = preFilters[ type ]( match ))) ) {\n\t\t\t\tmatched = match.shift();\n\t\t\t\ttokens.push({\n\t\t\t\t\tvalue: matched,\n\t\t\t\t\ttype: type,\n\t\t\t\t\tmatches: match\n\t\t\t\t});\n\t\t\t\tsoFar = soFar.slice( matched.length );\n\t\t\t}\n\t\t}\n\n\t\tif ( !matched ) {\n\t\t\tbreak;\n\t\t}\n\t}\n\n\t// Return the length of the invalid excess\n\t// if we're just parsing\n\t// Otherwise, throw an error or return tokens\n\treturn parseOnly ?\n\t\tsoFar.length :\n\t\tsoFar ?\n\t\t\tSizzle.error( selector ) :\n\t\t\t// Cache the tokens\n\t\t\ttokenCache( selector, groups ).slice( 0 );\n};\n\nfunction toSelector( tokens ) {\n\tvar i = 0,\n\t\tlen = tokens.length,\n\t\tselector = \"\";\n\tfor ( ; i < len; i++ ) {\n\t\tselector += tokens[i].value;\n\t}\n\treturn selector;\n}\n\nfunction addCombinator( matcher, combinator, base ) {\n\tvar dir = combinator.dir,\n\t\tskip = combinator.next,\n\t\tkey = skip || dir,\n\t\tcheckNonElements = base && key === \"parentNode\",\n\t\tdoneName = done++;\n\n\treturn combinator.first ?\n\t\t// Check against closest ancestor/preceding element\n\t\tfunction( elem, context, xml ) {\n\t\t\twhile ( (elem = elem[ dir ]) ) {\n\t\t\t\tif ( elem.nodeType === 1 || checkNonElements ) {\n\t\t\t\t\treturn matcher( elem, context, xml );\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn false;\n\t\t} :\n\n\t\t// Check against all ancestor/preceding elements\n\t\tfunction( elem, context, xml ) {\n\t\t\tvar oldCache, uniqueCache, outerCache,\n\t\t\t\tnewCache = [ dirruns, doneName ];\n\n\t\t\t// We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching\n\t\t\tif ( xml ) {\n\t\t\t\twhile ( (elem = elem[ dir ]) ) {\n\t\t\t\t\tif ( elem.nodeType === 1 || checkNonElements ) {\n\t\t\t\t\t\tif ( matcher( elem, context, xml ) ) {\n\t\t\t\t\t\t\treturn true;\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\twhile ( (elem = elem[ dir ]) ) {\n\t\t\t\t\tif ( elem.nodeType === 1 || checkNonElements ) {\n\t\t\t\t\t\touterCache = elem[ expando ] || (elem[ expando ] = {});\n\n\t\t\t\t\t\t// Support: IE <9 only\n\t\t\t\t\t\t// Defend against cloned attroperties (jQuery gh-1709)\n\t\t\t\t\t\tuniqueCache = outerCache[ elem.uniqueID ] || (outerCache[ elem.uniqueID ] = {});\n\n\t\t\t\t\t\tif ( skip && skip === elem.nodeName.toLowerCase() ) {\n\t\t\t\t\t\t\telem = elem[ dir ] || elem;\n\t\t\t\t\t\t} else if ( (oldCache = uniqueCache[ key ]) &&\n\t\t\t\t\t\t\toldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {\n\n\t\t\t\t\t\t\t// Assign to newCache so results back-propagate to previous elements\n\t\t\t\t\t\t\treturn (newCache[ 2 ] = oldCache[ 2 ]);\n\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t// Reuse newcache so results back-propagate to previous elements\n\t\t\t\t\t\t\tuniqueCache[ key ] = newCache;\n\n\t\t\t\t\t\t\t// A match means we're done; a fail means we have to keep checking\n\t\t\t\t\t\t\tif ( (newCache[ 2 ] = matcher( elem, context, xml )) ) {\n\t\t\t\t\t\t\t\treturn true;\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn false;\n\t\t};\n}\n\nfunction elementMatcher( matchers ) {\n\treturn matchers.length > 1 ?\n\t\tfunction( elem, context, xml ) {\n\t\t\tvar i = matchers.length;\n\t\t\twhile ( i-- ) {\n\t\t\t\tif ( !matchers[i]( elem, context, xml ) ) {\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn true;\n\t\t} :\n\t\tmatchers[0];\n}\n\nfunction multipleContexts( selector, contexts, results ) {\n\tvar i = 0,\n\t\tlen = contexts.length;\n\tfor ( ; i < len; i++ ) {\n\t\tSizzle( selector, contexts[i], results );\n\t}\n\treturn results;\n}\n\nfunction condense( unmatched, map, filter, context, xml ) {\n\tvar elem,\n\t\tnewUnmatched = [],\n\t\ti = 0,\n\t\tlen = unmatched.length,\n\t\tmapped = map != null;\n\n\tfor ( ; i < len; i++ ) {\n\t\tif ( (elem = unmatched[i]) ) {\n\t\t\tif ( !filter || filter( elem, context, xml ) ) {\n\t\t\t\tnewUnmatched.push( elem );\n\t\t\t\tif ( mapped ) {\n\t\t\t\t\tmap.push( i );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\treturn newUnmatched;\n}\n\nfunction setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {\n\tif ( postFilter && !postFilter[ expando ] ) {\n\t\tpostFilter = setMatcher( postFilter );\n\t}\n\tif ( postFinder && !postFinder[ expando ] ) {\n\t\tpostFinder = setMatcher( postFinder, postSelector );\n\t}\n\treturn markFunction(function( seed, results, context, xml ) {\n\t\tvar temp, i, elem,\n\t\t\tpreMap = [],\n\t\t\tpostMap = [],\n\t\t\tpreexisting = results.length,\n\n\t\t\t// Get initial elements from seed or context\n\t\t\telems = seed || multipleContexts( selector || \"*\", context.nodeType ? [ context ] : context, [] ),\n\n\t\t\t// Prefilter to get matcher input, preserving a map for seed-results synchronization\n\t\t\tmatcherIn = preFilter && ( seed || !selector ) ?\n\t\t\t\tcondense( elems, preMap, preFilter, context, xml ) :\n\t\t\t\telems,\n\n\t\t\tmatcherOut = matcher ?\n\t\t\t\t// If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,\n\t\t\t\tpostFinder || ( seed ? preFilter : preexisting || postFilter ) ?\n\n\t\t\t\t\t// ...intermediate processing is necessary\n\t\t\t\t\t[] :\n\n\t\t\t\t\t// ...otherwise use results directly\n\t\t\t\t\tresults :\n\t\t\t\tmatcherIn;\n\n\t\t// Find primary matches\n\t\tif ( matcher ) {\n\t\t\tmatcher( matcherIn, matcherOut, context, xml );\n\t\t}\n\n\t\t// Apply postFilter\n\t\tif ( postFilter ) {\n\t\t\ttemp = condense( matcherOut, postMap );\n\t\t\tpostFilter( temp, [], context, xml );\n\n\t\t\t// Un-match failing elements by moving them back to matcherIn\n\t\t\ti = temp.length;\n\t\t\twhile ( i-- ) {\n\t\t\t\tif ( (elem = temp[i]) ) {\n\t\t\t\t\tmatcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\tif ( seed ) {\n\t\t\tif ( postFinder || preFilter ) {\n\t\t\t\tif ( postFinder ) {\n\t\t\t\t\t// Get the final matcherOut by condensing this intermediate into postFinder contexts\n\t\t\t\t\ttemp = [];\n\t\t\t\t\ti = matcherOut.length;\n\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\tif ( (elem = matcherOut[i]) ) {\n\t\t\t\t\t\t\t// Restore matcherIn since elem is not yet a final match\n\t\t\t\t\t\t\ttemp.push( (matcherIn[i] = elem) );\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tpostFinder( null, (matcherOut = []), temp, xml );\n\t\t\t\t}\n\n\t\t\t\t// Move matched elements from seed to results to keep them synchronized\n\t\t\t\ti = matcherOut.length;\n\t\t\t\twhile ( i-- ) {\n\t\t\t\t\tif ( (elem = matcherOut[i]) &&\n\t\t\t\t\t\t(temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) {\n\n\t\t\t\t\t\tseed[temp] = !(results[temp] = elem);\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t// Add elements to results, through postFinder if defined\n\t\t} else {\n\t\t\tmatcherOut = condense(\n\t\t\t\tmatcherOut === results ?\n\t\t\t\t\tmatcherOut.splice( preexisting, matcherOut.length ) :\n\t\t\t\t\tmatcherOut\n\t\t\t);\n\t\t\tif ( postFinder ) {\n\t\t\t\tpostFinder( null, results, matcherOut, xml );\n\t\t\t} else {\n\t\t\t\tpush.apply( results, matcherOut );\n\t\t\t}\n\t\t}\n\t});\n}\n\nfunction matcherFromTokens( tokens ) {\n\tvar checkContext, matcher, j,\n\t\tlen = tokens.length,\n\t\tleadingRelative = Expr.relative[ tokens[0].type ],\n\t\timplicitRelative = leadingRelative || Expr.relative[\" \"],\n\t\ti = leadingRelative ? 1 : 0,\n\n\t\t// The foundational matcher ensures that elements are reachable from top-level context(s)\n\t\tmatchContext = addCombinator( function( elem ) {\n\t\t\treturn elem === checkContext;\n\t\t}, implicitRelative, true ),\n\t\tmatchAnyContext = addCombinator( function( elem ) {\n\t\t\treturn indexOf( checkContext, elem ) > -1;\n\t\t}, implicitRelative, true ),\n\t\tmatchers = [ function( elem, context, xml ) {\n\t\t\tvar ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || (\n\t\t\t\t(checkContext = context).nodeType ?\n\t\t\t\t\tmatchContext( elem, context, xml ) :\n\t\t\t\t\tmatchAnyContext( elem, context, xml ) );\n\t\t\t// Avoid hanging onto element (issue #299)\n\t\t\tcheckContext = null;\n\t\t\treturn ret;\n\t\t} ];\n\n\tfor ( ; i < len; i++ ) {\n\t\tif ( (matcher = Expr.relative[ tokens[i].type ]) ) {\n\t\t\tmatchers = [ addCombinator(elementMatcher( matchers ), matcher) ];\n\t\t} else {\n\t\t\tmatcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );\n\n\t\t\t// Return special upon seeing a positional matcher\n\t\t\tif ( matcher[ expando ] ) {\n\t\t\t\t// Find the next relative operator (if any) for proper handling\n\t\t\t\tj = ++i;\n\t\t\t\tfor ( ; j < len; j++ ) {\n\t\t\t\t\tif ( Expr.relative[ tokens[j].type ] ) {\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t\treturn setMatcher(\n\t\t\t\t\ti > 1 && elementMatcher( matchers ),\n\t\t\t\t\ti > 1 && toSelector(\n\t\t\t\t\t\t// If the preceding token was a descendant combinator, insert an implicit any-element `*`\n\t\t\t\t\t\ttokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === \" \" ? \"*\" : \"\" })\n\t\t\t\t\t).replace( rtrim, \"$1\" ),\n\t\t\t\t\tmatcher,\n\t\t\t\t\ti < j && matcherFromTokens( tokens.slice( i, j ) ),\n\t\t\t\t\tj < len && matcherFromTokens( (tokens = tokens.slice( j )) ),\n\t\t\t\t\tj < len && toSelector( tokens )\n\t\t\t\t);\n\t\t\t}\n\t\t\tmatchers.push( matcher );\n\t\t}\n\t}\n\n\treturn elementMatcher( matchers );\n}\n\nfunction matcherFromGroupMatchers( elementMatchers, setMatchers ) {\n\tvar bySet = setMatchers.length > 0,\n\t\tbyElement = elementMatchers.length > 0,\n\t\tsuperMatcher = function( seed, context, xml, results, outermost ) {\n\t\t\tvar elem, j, matcher,\n\t\t\t\tmatchedCount = 0,\n\t\t\t\ti = \"0\",\n\t\t\t\tunmatched = seed && [],\n\t\t\t\tsetMatched = [],\n\t\t\t\tcontextBackup = outermostContext,\n\t\t\t\t// We must always have either seed elements or outermost context\n\t\t\t\telems = seed || byElement && Expr.find[\"TAG\"]( \"*\", outermost ),\n\t\t\t\t// Use integer dirruns iff this is the outermost matcher\n\t\t\t\tdirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1),\n\t\t\t\tlen = elems.length;\n\n\t\t\tif ( outermost ) {\n\t\t\t\toutermostContext = context === document || context || outermost;\n\t\t\t}\n\n\t\t\t// Add elements passing elementMatchers directly to results\n\t\t\t// Support: IE<9, Safari\n\t\t\t// Tolerate NodeList properties (IE: \"length\"; Safari: <number>) matching elements by id\n\t\t\tfor ( ; i !== len && (elem = elems[i]) != null; i++ ) {\n\t\t\t\tif ( byElement && elem ) {\n\t\t\t\t\tj = 0;\n\t\t\t\t\tif ( !context && elem.ownerDocument !== document ) {\n\t\t\t\t\t\tsetDocument( elem );\n\t\t\t\t\t\txml = !documentIsHTML;\n\t\t\t\t\t}\n\t\t\t\t\twhile ( (matcher = elementMatchers[j++]) ) {\n\t\t\t\t\t\tif ( matcher( elem, context || document, xml) ) {\n\t\t\t\t\t\t\tresults.push( elem );\n\t\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tif ( outermost ) {\n\t\t\t\t\t\tdirruns = dirrunsUnique;\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\t// Track unmatched elements for set filters\n\t\t\t\tif ( bySet ) {\n\t\t\t\t\t// They will have gone through all possible matchers\n\t\t\t\t\tif ( (elem = !matcher && elem) ) {\n\t\t\t\t\t\tmatchedCount--;\n\t\t\t\t\t}\n\n\t\t\t\t\t// Lengthen the array for every element, matched or not\n\t\t\t\t\tif ( seed ) {\n\t\t\t\t\t\tunmatched.push( elem );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// `i` is now the count of elements visited above, and adding it to `matchedCount`\n\t\t\t// makes the latter nonnegative.\n\t\t\tmatchedCount += i;\n\n\t\t\t// Apply set filters to unmatched elements\n\t\t\t// NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`\n\t\t\t// equals `i`), unless we didn't visit _any_ elements in the above loop because we have\n\t\t\t// no element matchers and no seed.\n\t\t\t// Incrementing an initially-string \"0\" `i` allows `i` to remain a string only in that\n\t\t\t// case, which will result in a \"00\" `matchedCount` that differs from `i` but is also\n\t\t\t// numerically zero.\n\t\t\tif ( bySet && i !== matchedCount ) {\n\t\t\t\tj = 0;\n\t\t\t\twhile ( (matcher = setMatchers[j++]) ) {\n\t\t\t\t\tmatcher( unmatched, setMatched, context, xml );\n\t\t\t\t}\n\n\t\t\t\tif ( seed ) {\n\t\t\t\t\t// Reintegrate element matches to eliminate the need for sorting\n\t\t\t\t\tif ( matchedCount > 0 ) {\n\t\t\t\t\t\twhile ( i-- ) {\n\t\t\t\t\t\t\tif ( !(unmatched[i] || setMatched[i]) ) {\n\t\t\t\t\t\t\t\tsetMatched[i] = pop.call( results );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\t// Discard index placeholder values to get only actual matches\n\t\t\t\t\tsetMatched = condense( setMatched );\n\t\t\t\t}\n\n\t\t\t\t// Add matches to results\n\t\t\t\tpush.apply( results, setMatched );\n\n\t\t\t\t// Seedless set matches succeeding multiple successful matchers stipulate sorting\n\t\t\t\tif ( outermost && !seed && setMatched.length > 0 &&\n\t\t\t\t\t( matchedCount + setMatchers.length ) > 1 ) {\n\n\t\t\t\t\tSizzle.uniqueSort( results );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Override manipulation of globals by nested matchers\n\t\t\tif ( outermost ) {\n\t\t\t\tdirruns = dirrunsUnique;\n\t\t\t\toutermostContext = contextBackup;\n\t\t\t}\n\n\t\t\treturn unmatched;\n\t\t};\n\n\treturn bySet ?\n\t\tmarkFunction( superMatcher ) :\n\t\tsuperMatcher;\n}\n\ncompile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) {\n\tvar i,\n\t\tsetMatchers = [],\n\t\telementMatchers = [],\n\t\tcached = compilerCache[ selector + \" \" ];\n\n\tif ( !cached ) {\n\t\t// Generate a function of recursive functions that can be used to check each element\n\t\tif ( !match ) {\n\t\t\tmatch = tokenize( selector );\n\t\t}\n\t\ti = match.length;\n\t\twhile ( i-- ) {\n\t\t\tcached = matcherFromTokens( match[i] );\n\t\t\tif ( cached[ expando ] ) {\n\t\t\t\tsetMatchers.push( cached );\n\t\t\t} else {\n\t\t\t\telementMatchers.push( cached );\n\t\t\t}\n\t\t}\n\n\t\t// Cache the compiled function\n\t\tcached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );\n\n\t\t// Save selector and tokenization\n\t\tcached.selector = selector;\n\t}\n\treturn cached;\n};\n\n/**\n * A low-level selection function that works with Sizzle's compiled\n * selector functions\n * @param {String|Function} selector A selector or a pre-compiled\n * selector function built with Sizzle.compile\n * @param {Element} context\n * @param {Array} [results]\n * @param {Array} [seed] A set of elements to match against\n */\nselect = Sizzle.select = function( selector, context, results, seed ) {\n\tvar i, tokens, token, type, find,\n\t\tcompiled = typeof selector === \"function\" && selector,\n\t\tmatch = !seed && tokenize( (selector = compiled.selector || selector) );\n\n\tresults = results || [];\n\n\t// Try to minimize operations if there is only one selector in the list and no seed\n\t// (the latter of which guarantees us context)\n\tif ( match.length === 1 ) {\n\n\t\t// Reduce context if the leading compound selector is an ID\n\t\ttokens = match[0] = match[0].slice( 0 );\n\t\tif ( tokens.length > 2 && (token = tokens[0]).type === \"ID\" &&\n\t\t\t\tcontext.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[1].type ] ) {\n\n\t\t\tcontext = ( Expr.find[\"ID\"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0];\n\t\t\tif ( !context ) {\n\t\t\t\treturn results;\n\n\t\t\t// Precompiled matchers will still verify ancestry, so step up a level\n\t\t\t} else if ( compiled ) {\n\t\t\t\tcontext = context.parentNode;\n\t\t\t}\n\n\t\t\tselector = selector.slice( tokens.shift().value.length );\n\t\t}\n\n\t\t// Fetch a seed set for right-to-left matching\n\t\ti = matchExpr[\"needsContext\"].test( selector ) ? 0 : tokens.length;\n\t\twhile ( i-- ) {\n\t\t\ttoken = tokens[i];\n\n\t\t\t// Abort if we hit a combinator\n\t\t\tif ( Expr.relative[ (type = token.type) ] ) {\n\t\t\t\tbreak;\n\t\t\t}\n\t\t\tif ( (find = Expr.find[ type ]) ) {\n\t\t\t\t// Search, expanding context for leading sibling combinators\n\t\t\t\tif ( (seed = find(\n\t\t\t\t\ttoken.matches[0].replace( runescape, funescape ),\n\t\t\t\t\trsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context\n\t\t\t\t)) ) {\n\n\t\t\t\t\t// If seed is empty or no tokens remain, we can return early\n\t\t\t\t\ttokens.splice( i, 1 );\n\t\t\t\t\tselector = seed.length && toSelector( tokens );\n\t\t\t\t\tif ( !selector ) {\n\t\t\t\t\t\tpush.apply( results, seed );\n\t\t\t\t\t\treturn results;\n\t\t\t\t\t}\n\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// Compile and execute a filtering function if one is not provided\n\t// Provide `match` to avoid retokenization if we modified the selector above\n\t( compiled || compile( selector, match ) )(\n\t\tseed,\n\t\tcontext,\n\t\t!documentIsHTML,\n\t\tresults,\n\t\t!context || rsibling.test( selector ) && testContext( context.parentNode ) || context\n\t);\n\treturn results;\n};\n\n// One-time assignments\n\n// Sort stability\nsupport.sortStable = expando.split(\"\").sort( sortOrder ).join(\"\") === expando;\n\n// Support: Chrome 14-35+\n// Always assume duplicates if they aren't passed to the comparison function\nsupport.detectDuplicates = !!hasDuplicate;\n\n// Initialize against the default document\nsetDocument();\n\n// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)\n// Detached nodes confoundingly follow *each other*\nsupport.sortDetached = assert(function( el ) {\n\t// Should return 1, but returns 4 (following)\n\treturn el.compareDocumentPosition( document.createElement(\"fieldset\") ) & 1;\n});\n\n// Support: IE<8\n// Prevent attribute/property \"interpolation\"\n// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx\nif ( !assert(function( el ) {\n\tel.innerHTML = \"<a href='#'></a>\";\n\treturn el.firstChild.getAttribute(\"href\") === \"#\" ;\n}) ) {\n\taddHandle( \"type|href|height|width\", function( elem, name, isXML ) {\n\t\tif ( !isXML ) {\n\t\t\treturn elem.getAttribute( name, name.toLowerCase() === \"type\" ? 1 : 2 );\n\t\t}\n\t});\n}\n\n// Support: IE<9\n// Use defaultValue in place of getAttribute(\"value\")\nif ( !support.attributes || !assert(function( el ) {\n\tel.innerHTML = \"<input/>\";\n\tel.firstChild.setAttribute( \"value\", \"\" );\n\treturn el.firstChild.getAttribute( \"value\" ) === \"\";\n}) ) {\n\taddHandle( \"value\", function( elem, name, isXML ) {\n\t\tif ( !isXML && elem.nodeName.toLowerCase() === \"input\" ) {\n\t\t\treturn elem.defaultValue;\n\t\t}\n\t});\n}\n\n// Support: IE<9\n// Use getAttributeNode to fetch booleans when getAttribute lies\nif ( !assert(function( el ) {\n\treturn el.getAttribute(\"disabled\") == null;\n}) ) {\n\taddHandle( booleans, function( elem, name, isXML ) {\n\t\tvar val;\n\t\tif ( !isXML ) {\n\t\t\treturn elem[ name ] === true ? name.toLowerCase() :\n\t\t\t\t\t(val = elem.getAttributeNode( name )) && val.specified ?\n\t\t\t\t\tval.value :\n\t\t\t\tnull;\n\t\t}\n\t});\n}\n\nreturn Sizzle;\n\n})( window );\n\n\n\njQuery.find = Sizzle;\njQuery.expr = Sizzle.selectors;\n\n// Deprecated\njQuery.expr[ \":\" ] = jQuery.expr.pseudos;\njQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort;\njQuery.text = Sizzle.getText;\njQuery.isXMLDoc = Sizzle.isXML;\njQuery.contains = Sizzle.contains;\njQuery.escapeSelector = Sizzle.escape;\n\n\n\n\nvar dir = function( elem, dir, until ) {\n\tvar matched = [],\n\t\ttruncate = until !== undefined;\n\n\twhile ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) {\n\t\tif ( elem.nodeType === 1 ) {\n\t\t\tif ( truncate && jQuery( elem ).is( until ) ) {\n\t\t\t\tbreak;\n\t\t\t}\n\t\t\tmatched.push( elem );\n\t\t}\n\t}\n\treturn matched;\n};\n\n\nvar siblings = function( n, elem ) {\n\tvar matched = [];\n\n\tfor ( ; n; n = n.nextSibling ) {\n\t\tif ( n.nodeType === 1 && n !== elem ) {\n\t\t\tmatched.push( n );\n\t\t}\n\t}\n\n\treturn matched;\n};\n\n\nvar rneedsContext = jQuery.expr.match.needsContext;\n\n\n\nfunction nodeName( elem, name ) {\n\n return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();\n\n};\nvar rsingleTag = ( /^<([a-z][^\\/\\0>:\\x20\\t\\r\\n\\f]*)[\\x20\\t\\r\\n\\f]*\\/?>(?:<\\/\\1>|)$/i );\n\n\n\n// Implement the identical functionality for filter and not\nfunction winnow( elements, qualifier, not ) {\n\tif ( isFunction( qualifier ) ) {\n\t\treturn jQuery.grep( elements, function( elem, i ) {\n\t\t\treturn !!qualifier.call( elem, i, elem ) !== not;\n\t\t} );\n\t}\n\n\t// Single element\n\tif ( qualifier.nodeType ) {\n\t\treturn jQuery.grep( elements, function( elem ) {\n\t\t\treturn ( elem === qualifier ) !== not;\n\t\t} );\n\t}\n\n\t// Arraylike of elements (jQuery, arguments, Array)\n\tif ( typeof qualifier !== \"string\" ) {\n\t\treturn jQuery.grep( elements, function( elem ) {\n\t\t\treturn ( indexOf.call( qualifier, elem ) > -1 ) !== not;\n\t\t} );\n\t}\n\n\t// Filtered directly for both simple and complex selectors\n\treturn jQuery.filter( qualifier, elements, not );\n}\n\njQuery.filter = function( expr, elems, not ) {\n\tvar elem = elems[ 0 ];\n\n\tif ( not ) {\n\t\texpr = \":not(\" + expr + \")\";\n\t}\n\n\tif ( elems.length === 1 && elem.nodeType === 1 ) {\n\t\treturn jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [];\n\t}\n\n\treturn jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {\n\t\treturn elem.nodeType === 1;\n\t} ) );\n};\n\njQuery.fn.extend( {\n\tfind: function( selector ) {\n\t\tvar i, ret,\n\t\t\tlen = this.length,\n\t\t\tself = this;\n\n\t\tif ( typeof selector !== \"string\" ) {\n\t\t\treturn this.pushStack( jQuery( selector ).filter( function() {\n\t\t\t\tfor ( i = 0; i < len; i++ ) {\n\t\t\t\t\tif ( jQuery.contains( self[ i ], this ) ) {\n\t\t\t\t\t\treturn true;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t} ) );\n\t\t}\n\n\t\tret = this.pushStack( [] );\n\n\t\tfor ( i = 0; i < len; i++ ) {\n\t\t\tjQuery.find( selector, self[ i ], ret );\n\t\t}\n\n\t\treturn len > 1 ? jQuery.uniqueSort( ret ) : ret;\n\t},\n\tfilter: function( selector ) {\n\t\treturn this.pushStack( winnow( this, selector || [], false ) );\n\t},\n\tnot: function( selector ) {\n\t\treturn this.pushStack( winnow( this, selector || [], true ) );\n\t},\n\tis: function( selector ) {\n\t\treturn !!winnow(\n\t\t\tthis,\n\n\t\t\t// If this is a positional/relative selector, check membership in the returned set\n\t\t\t// so $(\"p:first\").is(\"p:last\") won't return true for a doc with two \"p\".\n\t\t\ttypeof selector === \"string\" && rneedsContext.test( selector ) ?\n\t\t\t\tjQuery( selector ) :\n\t\t\t\tselector || [],\n\t\t\tfalse\n\t\t).length;\n\t}\n} );\n\n\n// Initialize a jQuery object\n\n\n// A central reference to the root jQuery(document)\nvar rootjQuery,\n\n\t// A simple way to check for HTML strings\n\t// Prioritize #id over <tag> to avoid XSS via location.hash (#9521)\n\t// Strict HTML recognition (#11290: must start with <)\n\t// Shortcut simple #id case for speed\n\trquickExpr = /^(?:\\s*(<[\\w\\W]+>)[^>]*|#([\\w-]+))$/,\n\n\tinit = jQuery.fn.init = function( selector, context, root ) {\n\t\tvar match, elem;\n\n\t\t// HANDLE: $(\"\"), $(null), $(undefined), $(false)\n\t\tif ( !selector ) {\n\t\t\treturn this;\n\t\t}\n\n\t\t// Method init() accepts an alternate rootjQuery\n\t\t// so migrate can support jQuery.sub (gh-2101)\n\t\troot = root || rootjQuery;\n\n\t\t// Handle HTML strings\n\t\tif ( typeof selector === \"string\" ) {\n\t\t\tif ( selector[ 0 ] === \"<\" &&\n\t\t\t\tselector[ selector.length - 1 ] === \">\" &&\n\t\t\t\tselector.length >= 3 ) {\n\n\t\t\t\t// Assume that strings that start and end with <> are HTML and skip the regex check\n\t\t\t\tmatch = [ null, selector, null ];\n\n\t\t\t} else {\n\t\t\t\tmatch = rquickExpr.exec( selector );\n\t\t\t}\n\n\t\t\t// Match html or make sure no context is specified for #id\n\t\t\tif ( match && ( match[ 1 ] || !context ) ) {\n\n\t\t\t\t// HANDLE: $(html) -> $(array)\n\t\t\t\tif ( match[ 1 ] ) {\n\t\t\t\t\tcontext = context instanceof jQuery ? context[ 0 ] : context;\n\n\t\t\t\t\t// Option to run scripts is true for back-compat\n\t\t\t\t\t// Intentionally let the error be thrown if parseHTML is not present\n\t\t\t\t\tjQuery.merge( this, jQuery.parseHTML(\n\t\t\t\t\t\tmatch[ 1 ],\n\t\t\t\t\t\tcontext && context.nodeType ? context.ownerDocument || context : document,\n\t\t\t\t\t\ttrue\n\t\t\t\t\t) );\n\n\t\t\t\t\t// HANDLE: $(html, props)\n\t\t\t\t\tif ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) {\n\t\t\t\t\t\tfor ( match in context ) {\n\n\t\t\t\t\t\t\t// Properties of context are called as methods if possible\n\t\t\t\t\t\t\tif ( isFunction( this[ match ] ) ) {\n\t\t\t\t\t\t\t\tthis[ match ]( context[ match ] );\n\n\t\t\t\t\t\t\t// ...and otherwise set as attributes\n\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\tthis.attr( match, context[ match ] );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\treturn this;\n\n\t\t\t\t// HANDLE: $(#id)\n\t\t\t\t} else {\n\t\t\t\t\telem = document.getElementById( match[ 2 ] );\n\n\t\t\t\t\tif ( elem ) {\n\n\t\t\t\t\t\t// Inject the element directly into the jQuery object\n\t\t\t\t\t\tthis[ 0 ] = elem;\n\t\t\t\t\t\tthis.length = 1;\n\t\t\t\t\t}\n\t\t\t\t\treturn this;\n\t\t\t\t}\n\n\t\t\t// HANDLE: $(expr, $(...))\n\t\t\t} else if ( !context || context.jquery ) {\n\t\t\t\treturn ( context || root ).find( selector );\n\n\t\t\t// HANDLE: $(expr, context)\n\t\t\t// (which is just equivalent to: $(context).find(expr)\n\t\t\t} else {\n\t\t\t\treturn this.constructor( context ).find( selector );\n\t\t\t}\n\n\t\t// HANDLE: $(DOMElement)\n\t\t} else if ( selector.nodeType ) {\n\t\t\tthis[ 0 ] = selector;\n\t\t\tthis.length = 1;\n\t\t\treturn this;\n\n\t\t// HANDLE: $(function)\n\t\t// Shortcut for document ready\n\t\t} else if ( isFunction( selector ) ) {\n\t\t\treturn root.ready !== undefined ?\n\t\t\t\troot.ready( selector ) :\n\n\t\t\t\t// Execute immediately if ready is not present\n\t\t\t\tselector( jQuery );\n\t\t}\n\n\t\treturn jQuery.makeArray( selector, this );\n\t};\n\n// Give the init function the jQuery prototype for later instantiation\ninit.prototype = jQuery.fn;\n\n// Initialize central reference\nrootjQuery = jQuery( document );\n\n\nvar rparentsprev = /^(?:parents|prev(?:Until|All))/,\n\n\t// Methods guaranteed to produce a unique set when starting from a unique set\n\tguaranteedUnique = {\n\t\tchildren: true,\n\t\tcontents: true,\n\t\tnext: true,\n\t\tprev: true\n\t};\n\njQuery.fn.extend( {\n\thas: function( target ) {\n\t\tvar targets = jQuery( target, this ),\n\t\t\tl = targets.length;\n\n\t\treturn this.filter( function() {\n\t\t\tvar i = 0;\n\t\t\tfor ( ; i < l; i++ ) {\n\t\t\t\tif ( jQuery.contains( this, targets[ i ] ) ) {\n\t\t\t\t\treturn true;\n\t\t\t\t}\n\t\t\t}\n\t\t} );\n\t},\n\n\tclosest: function( selectors, context ) {\n\t\tvar cur,\n\t\t\ti = 0,\n\t\t\tl = this.length,\n\t\t\tmatched = [],\n\t\t\ttargets = typeof selectors !== \"string\" && jQuery( selectors );\n\n\t\t// Positional selectors never match, since there's no _selection_ context\n\t\tif ( !rneedsContext.test( selectors ) ) {\n\t\t\tfor ( ; i < l; i++ ) {\n\t\t\t\tfor ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) {\n\n\t\t\t\t\t// Always skip document fragments\n\t\t\t\t\tif ( cur.nodeType < 11 && ( targets ?\n\t\t\t\t\t\ttargets.index( cur ) > -1 :\n\n\t\t\t\t\t\t// Don't pass non-elements to Sizzle\n\t\t\t\t\t\tcur.nodeType === 1 &&\n\t\t\t\t\t\t\tjQuery.find.matchesSelector( cur, selectors ) ) ) {\n\n\t\t\t\t\t\tmatched.push( cur );\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched );\n\t},\n\n\t// Determine the position of an element within the set\n\tindex: function( elem ) {\n\n\t\t// No argument, return index in parent\n\t\tif ( !elem ) {\n\t\t\treturn ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;\n\t\t}\n\n\t\t// Index in selector\n\t\tif ( typeof elem === \"string\" ) {\n\t\t\treturn indexOf.call( jQuery( elem ), this[ 0 ] );\n\t\t}\n\n\t\t// Locate the position of the desired element\n\t\treturn indexOf.call( this,\n\n\t\t\t// If it receives a jQuery object, the first element is used\n\t\t\telem.jquery ? elem[ 0 ] : elem\n\t\t);\n\t},\n\n\tadd: function( selector, context ) {\n\t\treturn this.pushStack(\n\t\t\tjQuery.uniqueSort(\n\t\t\t\tjQuery.merge( this.get(), jQuery( selector, context ) )\n\t\t\t)\n\t\t);\n\t},\n\n\taddBack: function( selector ) {\n\t\treturn this.add( selector == null ?\n\t\t\tthis.prevObject : this.prevObject.filter( selector )\n\t\t);\n\t}\n} );\n\nfunction sibling( cur, dir ) {\n\twhile ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {}\n\treturn cur;\n}\n\njQuery.each( {\n\tparent: function( elem ) {\n\t\tvar parent = elem.parentNode;\n\t\treturn parent && parent.nodeType !== 11 ? parent : null;\n\t},\n\tparents: function( elem ) {\n\t\treturn dir( elem, \"parentNode\" );\n\t},\n\tparentsUntil: function( elem, i, until ) {\n\t\treturn dir( elem, \"parentNode\", until );\n\t},\n\tnext: function( elem ) {\n\t\treturn sibling( elem, \"nextSibling\" );\n\t},\n\tprev: function( elem ) {\n\t\treturn sibling( elem, \"previousSibling\" );\n\t},\n\tnextAll: function( elem ) {\n\t\treturn dir( elem, \"nextSibling\" );\n\t},\n\tprevAll: function( elem ) {\n\t\treturn dir( elem, \"previousSibling\" );\n\t},\n\tnextUntil: function( elem, i, until ) {\n\t\treturn dir( elem, \"nextSibling\", until );\n\t},\n\tprevUntil: function( elem, i, until ) {\n\t\treturn dir( elem, \"previousSibling\", until );\n\t},\n\tsiblings: function( elem ) {\n\t\treturn siblings( ( elem.parentNode || {} ).firstChild, elem );\n\t},\n\tchildren: function( elem ) {\n\t\treturn siblings( elem.firstChild );\n\t},\n\tcontents: function( elem ) {\n if ( nodeName( elem, \"iframe\" ) ) {\n return elem.contentDocument;\n }\n\n // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only\n // Treat the template element as a regular one in browsers that\n // don't support it.\n if ( nodeName( elem, \"template\" ) ) {\n elem = elem.content || elem;\n }\n\n return jQuery.merge( [], elem.childNodes );\n\t}\n}, function( name, fn ) {\n\tjQuery.fn[ name ] = function( until, selector ) {\n\t\tvar matched = jQuery.map( this, fn, until );\n\n\t\tif ( name.slice( -5 ) !== \"Until\" ) {\n\t\t\tselector = until;\n\t\t}\n\n\t\tif ( selector && typeof selector === \"string\" ) {\n\t\t\tmatched = jQuery.filter( selector, matched );\n\t\t}\n\n\t\tif ( this.length > 1 ) {\n\n\t\t\t// Remove duplicates\n\t\t\tif ( !guaranteedUnique[ name ] ) {\n\t\t\t\tjQuery.uniqueSort( matched );\n\t\t\t}\n\n\t\t\t// Reverse order for parents* and prev-derivatives\n\t\t\tif ( rparentsprev.test( name ) ) {\n\t\t\t\tmatched.reverse();\n\t\t\t}\n\t\t}\n\n\t\treturn this.pushStack( matched );\n\t};\n} );\nvar rnothtmlwhite = ( /[^\\x20\\t\\r\\n\\f]+/g );\n\n\n\n// Convert String-formatted options into Object-formatted ones\nfunction createOptions( options ) {\n\tvar object = {};\n\tjQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) {\n\t\tobject[ flag ] = true;\n\t} );\n\treturn object;\n}\n\n/*\n * Create a callback list using the following parameters:\n *\n *\toptions: an optional list of space-separated options that will change how\n *\t\t\tthe callback list behaves or a more traditional option object\n *\n * By default a callback list will act like an event callback list and can be\n * \"fired\" multiple times.\n *\n * Possible options:\n *\n *\tonce:\t\t\twill ensure the callback list can only be fired once (like a Deferred)\n *\n *\tmemory:\t\t\twill keep track of previous values and will call any callback added\n *\t\t\t\t\tafter the list has been fired right away with the latest \"memorized\"\n *\t\t\t\t\tvalues (like a Deferred)\n *\n *\tunique:\t\t\twill ensure a callback can only be added once (no duplicate in the list)\n *\n *\tstopOnFalse:\tinterrupt callings when a callback returns false\n *\n */\njQuery.Callbacks = function( options ) {\n\n\t// Convert options from String-formatted to Object-formatted if needed\n\t// (we check in cache first)\n\toptions = typeof options === \"string\" ?\n\t\tcreateOptions( options ) :\n\t\tjQuery.extend( {}, options );\n\n\tvar // Flag to know if list is currently firing\n\t\tfiring,\n\n\t\t// Last fire value for non-forgettable lists\n\t\tmemory,\n\n\t\t// Flag to know if list was already fired\n\t\tfired,\n\n\t\t// Flag to prevent firing\n\t\tlocked,\n\n\t\t// Actual callback list\n\t\tlist = [],\n\n\t\t// Queue of execution data for repeatable lists\n\t\tqueue = [],\n\n\t\t// Index of currently firing callback (modified by add/remove as needed)\n\t\tfiringIndex = -1,\n\n\t\t// Fire callbacks\n\t\tfire = function() {\n\n\t\t\t// Enforce single-firing\n\t\t\tlocked = locked || options.once;\n\n\t\t\t// Execute callbacks for all pending executions,\n\t\t\t// respecting firingIndex overrides and runtime changes\n\t\t\tfired = firing = true;\n\t\t\tfor ( ; queue.length; firingIndex = -1 ) {\n\t\t\t\tmemory = queue.shift();\n\t\t\t\twhile ( ++firingIndex < list.length ) {\n\n\t\t\t\t\t// Run callback and check for early termination\n\t\t\t\t\tif ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false &&\n\t\t\t\t\t\toptions.stopOnFalse ) {\n\n\t\t\t\t\t\t// Jump to end and forget the data so .add doesn't re-fire\n\t\t\t\t\t\tfiringIndex = list.length;\n\t\t\t\t\t\tmemory = false;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Forget the data if we're done with it\n\t\t\tif ( !options.memory ) {\n\t\t\t\tmemory = false;\n\t\t\t}\n\n\t\t\tfiring = false;\n\n\t\t\t// Clean up if we're done firing for good\n\t\t\tif ( locked ) {\n\n\t\t\t\t// Keep an empty list if we have data for future add calls\n\t\t\t\tif ( memory ) {\n\t\t\t\t\tlist = [];\n\n\t\t\t\t// Otherwise, this object is spent\n\t\t\t\t} else {\n\t\t\t\t\tlist = \"\";\n\t\t\t\t}\n\t\t\t}\n\t\t},\n\n\t\t// Actual Callbacks object\n\t\tself = {\n\n\t\t\t// Add a callback or a collection of callbacks to the list\n\t\t\tadd: function() {\n\t\t\t\tif ( list ) {\n\n\t\t\t\t\t// If we have memory from a past run, we should fire after adding\n\t\t\t\t\tif ( memory && !firing ) {\n\t\t\t\t\t\tfiringIndex = list.length - 1;\n\t\t\t\t\t\tqueue.push( memory );\n\t\t\t\t\t}\n\n\t\t\t\t\t( function add( args ) {\n\t\t\t\t\t\tjQuery.each( args, function( _, arg ) {\n\t\t\t\t\t\t\tif ( isFunction( arg ) ) {\n\t\t\t\t\t\t\t\tif ( !options.unique || !self.has( arg ) ) {\n\t\t\t\t\t\t\t\t\tlist.push( arg );\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t} else if ( arg && arg.length && toType( arg ) !== \"string\" ) {\n\n\t\t\t\t\t\t\t\t// Inspect recursively\n\t\t\t\t\t\t\t\tadd( arg );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t} );\n\t\t\t\t\t} )( arguments );\n\n\t\t\t\t\tif ( memory && !firing ) {\n\t\t\t\t\t\tfire();\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\n\t\t\t// Remove a callback from the list\n\t\t\tremove: function() {\n\t\t\t\tjQuery.each( arguments, function( _, arg ) {\n\t\t\t\t\tvar index;\n\t\t\t\t\twhile ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {\n\t\t\t\t\t\tlist.splice( index, 1 );\n\n\t\t\t\t\t\t// Handle firing indexes\n\t\t\t\t\t\tif ( index <= firingIndex ) {\n\t\t\t\t\t\t\tfiringIndex--;\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t} );\n\t\t\t\treturn this;\n\t\t\t},\n\n\t\t\t// Check if a given callback is in the list.\n\t\t\t// If no argument is given, return whether or not list has callbacks attached.\n\t\t\thas: function( fn ) {\n\t\t\t\treturn fn ?\n\t\t\t\t\tjQuery.inArray( fn, list ) > -1 :\n\t\t\t\t\tlist.length > 0;\n\t\t\t},\n\n\t\t\t// Remove all callbacks from the list\n\t\t\tempty: function() {\n\t\t\t\tif ( list ) {\n\t\t\t\t\tlist = [];\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\n\t\t\t// Disable .fire and .add\n\t\t\t// Abort any current/pending executions\n\t\t\t// Clear all callbacks and values\n\t\t\tdisable: function() {\n\t\t\t\tlocked = queue = [];\n\t\t\t\tlist = memory = \"\";\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\tdisabled: function() {\n\t\t\t\treturn !list;\n\t\t\t},\n\n\t\t\t// Disable .fire\n\t\t\t// Also disable .add unless we have memory (since it would have no effect)\n\t\t\t// Abort any pending executions\n\t\t\tlock: function() {\n\t\t\t\tlocked = queue = [];\n\t\t\t\tif ( !memory && !firing ) {\n\t\t\t\t\tlist = memory = \"\";\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\t\t\tlocked: function() {\n\t\t\t\treturn !!locked;\n\t\t\t},\n\n\t\t\t// Call all callbacks with the given context and arguments\n\t\t\tfireWith: function( context, args ) {\n\t\t\t\tif ( !locked ) {\n\t\t\t\t\targs = args || [];\n\t\t\t\t\targs = [ context, args.slice ? args.slice() : args ];\n\t\t\t\t\tqueue.push( args );\n\t\t\t\t\tif ( !firing ) {\n\t\t\t\t\t\tfire();\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t},\n\n\t\t\t// Call all the callbacks with the given arguments\n\t\t\tfire: function() {\n\t\t\t\tself.fireWith( this, arguments );\n\t\t\t\treturn this;\n\t\t\t},\n\n\t\t\t// To know if the callbacks have already been called at least once\n\t\t\tfired: function() {\n\t\t\t\treturn !!fired;\n\t\t\t}\n\t\t};\n\n\treturn self;\n};\n\n\nfunction Identity( v ) {\n\treturn v;\n}\nfunction Thrower( ex ) {\n\tthrow ex;\n}\n\nfunction adoptValue( value, resolve, reject, noValue ) {\n\tvar method;\n\n\ttry {\n\n\t\t// Check for promise aspect first to privilege synchronous behavior\n\t\tif ( value && isFunction( ( method = value.promise ) ) ) {\n\t\t\tmethod.call( value ).done( resolve ).fail( reject );\n\n\t\t// Other thenables\n\t\t} else if ( value && isFunction( ( method = value.then ) ) ) {\n\t\t\tmethod.call( value, resolve, reject );\n\n\t\t// Other non-thenables\n\t\t} else {\n\n\t\t\t// Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer:\n\t\t\t// * false: [ value ].slice( 0 ) => resolve( value )\n\t\t\t// * true: [ value ].slice( 1 ) => resolve()\n\t\t\tresolve.apply( undefined, [ value ].slice( noValue ) );\n\t\t}\n\n\t// For Promises/A+, convert exceptions into rejections\n\t// Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in\n\t// Deferred#then to conditionally suppress rejection.\n\t} catch ( value ) {\n\n\t\t// Support: Android 4.0 only\n\t\t// Strict mode functions invoked without .call/.apply get global-object context\n\t\treject.apply( undefined, [ value ] );\n\t}\n}\n\njQuery.extend( {\n\n\tDeferred: function( func ) {\n\t\tvar tuples = [\n\n\t\t\t\t// action, add listener, callbacks,\n\t\t\t\t// ... .then handlers, argument index, [final state]\n\t\t\t\t[ \"notify\", \"progress\", jQuery.Callbacks( \"memory\" ),\n\t\t\t\t\tjQuery.Callbacks( \"memory\" ), 2 ],\n\t\t\t\t[ \"resolve\", \"done\", jQuery.Callbacks( \"once memory\" ),\n\t\t\t\t\tjQuery.Callbacks( \"once memory\" ), 0, \"resolved\" ],\n\t\t\t\t[ \"reject\", \"fail\", jQuery.Callbacks( \"once memory\" ),\n\t\t\t\t\tjQuery.Callbacks( \"once memory\" ), 1, \"rejected\" ]\n\t\t\t],\n\t\t\tstate = \"pending\",\n\t\t\tpromise = {\n\t\t\t\tstate: function() {\n\t\t\t\t\treturn state;\n\t\t\t\t},\n\t\t\t\talways: function() {\n\t\t\t\t\tdeferred.done( arguments ).fail( arguments );\n\t\t\t\t\treturn this;\n\t\t\t\t},\n\t\t\t\t\"catch\": function( fn ) {\n\t\t\t\t\treturn promise.then( null, fn );\n\t\t\t\t},\n\n\t\t\t\t// Keep pipe for back-compat\n\t\t\t\tpipe: function( /* fnDone, fnFail, fnProgress */ ) {\n\t\t\t\t\tvar fns = arguments;\n\n\t\t\t\t\treturn jQuery.Deferred( function( newDefer ) {\n\t\t\t\t\t\tjQuery.each( tuples, function( i, tuple ) {\n\n\t\t\t\t\t\t\t// Map tuples (progress, done, fail) to arguments (done, fail, progress)\n\t\t\t\t\t\t\tvar fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ];\n\n\t\t\t\t\t\t\t// deferred.progress(function() { bind to newDefer or newDefer.notify })\n\t\t\t\t\t\t\t// deferred.done(function() { bind to newDefer or newDefer.resolve })\n\t\t\t\t\t\t\t// deferred.fail(function() { bind to newDefer or newDefer.reject })\n\t\t\t\t\t\t\tdeferred[ tuple[ 1 ] ]( function() {\n\t\t\t\t\t\t\t\tvar returned = fn && fn.apply( this, arguments );\n\t\t\t\t\t\t\t\tif ( returned && isFunction( returned.promise ) ) {\n\t\t\t\t\t\t\t\t\treturned.promise()\n\t\t\t\t\t\t\t\t\t\t.progress( newDefer.notify )\n\t\t\t\t\t\t\t\t\t\t.done( newDefer.resolve )\n\t\t\t\t\t\t\t\t\t\t.fail( newDefer.reject );\n\t\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\t\tnewDefer[ tuple[ 0 ] + \"With\" ](\n\t\t\t\t\t\t\t\t\t\tthis,\n\t\t\t\t\t\t\t\t\t\tfn ? [ returned ] : arguments\n\t\t\t\t\t\t\t\t\t);\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t} );\n\t\t\t\t\t\t} );\n\t\t\t\t\t\tfns = null;\n\t\t\t\t\t} ).promise();\n\t\t\t\t},\n\t\t\t\tthen: function( onFulfilled, onRejected, onProgress ) {\n\t\t\t\t\tvar maxDepth = 0;\n\t\t\t\t\tfunction resolve( depth, deferred, handler, special ) {\n\t\t\t\t\t\treturn function() {\n\t\t\t\t\t\t\tvar that = this,\n\t\t\t\t\t\t\t\targs = arguments,\n\t\t\t\t\t\t\t\tmightThrow = function() {\n\t\t\t\t\t\t\t\t\tvar returned, then;\n\n\t\t\t\t\t\t\t\t\t// Support: Promises/A+ section 2.3.3.3.3\n\t\t\t\t\t\t\t\t\t// https://promisesaplus.com/#point-59\n\t\t\t\t\t\t\t\t\t// Ignore double-resolution attempts\n\t\t\t\t\t\t\t\t\tif ( depth < maxDepth ) {\n\t\t\t\t\t\t\t\t\t\treturn;\n\t\t\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t\t\t\treturned = handler.apply( that, args );\n\n\t\t\t\t\t\t\t\t\t// Support: Promises/A+ section 2.3.1\n\t\t\t\t\t\t\t\t\t// https://promisesaplus.com/#point-48\n\t\t\t\t\t\t\t\t\tif ( returned === deferred.promise() ) {\n\t\t\t\t\t\t\t\t\t\tthrow new TypeError( \"Thenable self-resolution\" );\n\t\t\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t\t\t\t// Support: Promises/A+ sections 2.3.3.1, 3.5\n\t\t\t\t\t\t\t\t\t// https://promisesaplus.com/#point-54\n\t\t\t\t\t\t\t\t\t// https://promisesaplus.com/#point-75\n\t\t\t\t\t\t\t\t\t// Retrieve `then` only once\n\t\t\t\t\t\t\t\t\tthen = returned &&\n\n\t\t\t\t\t\t\t\t\t\t// Support: Promises/A+ section 2.3.4\n\t\t\t\t\t\t\t\t\t\t// https://promisesaplus.com/#point-64\n\t\t\t\t\t\t\t\t\t\t// Only check objects and functions for thenability\n\t\t\t\t\t\t\t\t\t\t( typeof returned === \"object\" ||\n\t\t\t\t\t\t\t\t\t\t\ttypeof returned === \"function\" ) &&\n\t\t\t\t\t\t\t\t\t\treturned.then;\n\n\t\t\t\t\t\t\t\t\t// Handle a returned thenable\n\t\t\t\t\t\t\t\t\tif ( isFunction( then ) ) {\n\n\t\t\t\t\t\t\t\t\t\t// Special processors (notify) just wait for resolution\n\t\t\t\t\t\t\t\t\t\tif ( special ) {\n\t\t\t\t\t\t\t\t\t\t\tthen.call(\n\t\t\t\t\t\t\t\t\t\t\t\treturned,\n\t\t\t\t\t\t\t\t\t\t\t\tresolve( maxDepth, deferred, Identity, special ),\n\t\t\t\t\t\t\t\t\t\t\t\tresolve( maxDepth, deferred, Thrower, special )\n\t\t\t\t\t\t\t\t\t\t\t);\n\n\t\t\t\t\t\t\t\t\t\t// Normal processors (resolve) also hook into progress\n\t\t\t\t\t\t\t\t\t\t} else {\n\n\t\t\t\t\t\t\t\t\t\t\t// ...and disregard older resolution values\n\t\t\t\t\t\t\t\t\t\t\tmaxDepth++;\n\n\t\t\t\t\t\t\t\t\t\t\tthen.call(\n\t\t\t\t\t\t\t\t\t\t\t\treturned,\n\t\t\t\t\t\t\t\t\t\t\t\tresolve( maxDepth, deferred, Identity, special ),\n\t\t\t\t\t\t\t\t\t\t\t\tresolve( maxDepth, deferred, Thrower, special ),\n\t\t\t\t\t\t\t\t\t\t\t\tresolve( maxDepth, deferred, Identity,\n\t\t\t\t\t\t\t\t\t\t\t\t\tdeferred.notifyWith )\n\t\t\t\t\t\t\t\t\t\t\t);\n\t\t\t\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t\t\t\t// Handle all other returned values\n\t\t\t\t\t\t\t\t\t} else {\n\n\t\t\t\t\t\t\t\t\t\t// Only substitute handlers pass on context\n\t\t\t\t\t\t\t\t\t\t// and multiple values (non-spec behavior)\n\t\t\t\t\t\t\t\t\t\tif ( handler !== Identity ) {\n\t\t\t\t\t\t\t\t\t\t\tthat = undefined;\n\t\t\t\t\t\t\t\t\t\t\targs = [ returned ];\n\t\t\t\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t\t\t\t\t// Process the value(s)\n\t\t\t\t\t\t\t\t\t\t// Default process is resolve\n\t\t\t\t\t\t\t\t\t\t( special || deferred.resolveWith )( that, args );\n\t\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t},\n\n\t\t\t\t\t\t\t\t// Only normal processors (resolve) catch and reject exceptions\n\t\t\t\t\t\t\t\tprocess = special ?\n\t\t\t\t\t\t\t\t\tmightThrow :\n\t\t\t\t\t\t\t\t\tfunction() {\n\t\t\t\t\t\t\t\t\t\ttry {\n\t\t\t\t\t\t\t\t\t\t\tmightThrow();\n\t\t\t\t\t\t\t\t\t\t} catch ( e ) {\n\n\t\t\t\t\t\t\t\t\t\t\tif ( jQuery.Deferred.exceptionHook ) {\n\t\t\t\t\t\t\t\t\t\t\t\tjQuery.Deferred.exceptionHook( e,\n\t\t\t\t\t\t\t\t\t\t\t\t\tprocess.stackTrace );\n\t\t\t\t\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t\t\t\t\t\t// Support: Promises/A+ section 2.3.3.3.4.1\n\t\t\t\t\t\t\t\t\t\t\t// https://promisesaplus.com/#point-61\n\t\t\t\t\t\t\t\t\t\t\t// Ignore post-resolution exceptions\n\t\t\t\t\t\t\t\t\t\t\tif ( depth + 1 >= maxDepth ) {\n\n\t\t\t\t\t\t\t\t\t\t\t\t// Only substitute handlers pass on context\n\t\t\t\t\t\t\t\t\t\t\t\t// and multiple values (non-spec behavior)\n\t\t\t\t\t\t\t\t\t\t\t\tif ( handler !== Thrower ) {\n\t\t\t\t\t\t\t\t\t\t\t\t\tthat = undefined;\n\t\t\t\t\t\t\t\t\t\t\t\t\targs = [ e ];\n\t\t\t\t\t\t\t\t\t\t\t\t}\n\n\t\t\t\t\t\t\t\t\t\t\t\tdeferred.rejectWith( that, args );\n\t\t\t\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\t\t};\n\n\t\t\t\t\t\t\t// Support: Promises/A+ section 2.3.3.3.1\n\t\t\t\t\t\t\t// https://promisesaplus.com/#point-57\n\t\t\t\t\t\t\t// Re-resolve promises immediately to dodge false rejection from\n\t\t\t\t\t\t\t// subsequent errors\n\t\t\t\t\t\t\tif ( depth ) {\n\t\t\t\t\t\t\t\tprocess();\n\t\t\t\t\t\t\t} else {\n\n\t\t\t\t\t\t\t\t// Call an optional hook to record the stack, in case of exception\n\t\t\t\t\t\t\t\t// since it's otherwise lost when execution goes async\n\t\t\t\t\t\t\t\tif ( jQuery.Deferred.getStackHook ) {\n\t\t\t\t\t\t\t\t\tprocess.stackTrace = jQuery.Deferred.getStackHook();\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\twindow.setTimeout( process );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t};\n\t\t\t\t\t}\n\n\t\t\t\t\treturn jQuery.Deferred( function( newDefer ) {\n\n\t\t\t\t\t\t// progress_handlers.add( ... )\n\t\t\t\t\t\ttuples[ 0 ][ 3 ].add(\n\t\t\t\t\t\t\tresolve(\n\t\t\t\t\t\t\t\t0,\n\t\t\t\t\t\t\t\tnewDefer,\n\t\t\t\t\t\t\t\tisFunction( onProgress ) ?\n\t\t\t\t\t\t\t\t\tonProgress :\n\t\t\t\t\t\t\t\t\tIdentity,\n\t\t\t\t\t\t\t\tnewDefer.notifyWith\n\t\t\t\t\t\t\t)\n\t\t\t\t\t\t);\n\n\t\t\t\t\t\t// fulfilled_handlers.add( ... )\n\t\t\t\t\t\ttuples[ 1 ][ 3 ].add(\n\t\t\t\t\t\t\tresolve(\n\t\t\t\t\t\t\t\t0,\n\t\t\t\t\t\t\t\tnewDefer,\n\t\t\t\t\t\t\t\tisFunction( onFulfilled ) ?\n\t\t\t\t\t\t\t\t\tonFulfilled :\n\t\t\t\t\t\t\t\t\tIdentity\n\t\t\t\t\t\t\t)\n\t\t\t\t\t\t);\n\n\t\t\t\t\t\t// rejected_handlers.add( ... )\n\t\t\t\t\t\ttuples[ 2 ][ 3 ].add(\n\t\t\t\t\t\t\tresolve(\n\t\t\t\t\t\t\t\t0,\n\t\t\t\t\t\t\t\tnewDefer,\n\t\t\t\t\t\t\t\tisFunction( onRejected ) ?\n\t\t\t\t\t\t\t\t\tonRejected :\n\t\t\t\t\t\t\t\t\tThrower\n\t\t\t\t\t\t\t)\n\t\t\t\t\t\t);\n\t\t\t\t\t} ).promise();\n\t\t\t\t},\n\n\t\t\t\t// Get a promise for this deferred\n\t\t\t\t// If obj is provided, the promise aspect is added to the object\n\t\t\t\tpromise: function( obj ) {\n\t\t\t\t\treturn obj != null ? jQuery.extend( obj, promise ) : promise;\n\t\t\t\t}\n\t\t\t},\n\t\t\tdeferred = {};\n\n\t\t// Add list-specific methods\n\t\tjQuery.each( tuples, function( i, tuple ) {\n\t\t\tvar list = tuple[ 2 ],\n\t\t\t\tstateString = tuple[ 5 ];\n\n\t\t\t// promise.progress = list.add\n\t\t\t// promise.done = list.add\n\t\t\t// promise.fail = list.add\n\t\t\tpromise[ tuple[ 1 ] ] = list.add;\n\n\t\t\t// Handle state\n\t\t\tif ( stateString ) {\n\t\t\t\tlist.add(\n\t\t\t\t\tfunction() {\n\n\t\t\t\t\t\t// state = \"resolved\" (i.e., fulfilled)\n\t\t\t\t\t\t// state = \"rejected\"\n\t\t\t\t\t\tstate = stateString;\n\t\t\t\t\t},\n\n\t\t\t\t\t// rejected_callbacks.disable\n\t\t\t\t\t// fulfilled_callbacks.disable\n\t\t\t\t\ttuples[ 3 - i ][ 2 ].disable,\n\n\t\t\t\t\t// rejected_handlers.disable\n\t\t\t\t\t// fulfilled_handlers.disable\n\t\t\t\t\ttuples[ 3 - i ][ 3 ].disable,\n\n\t\t\t\t\t// progress_callbacks.lock\n\t\t\t\t\ttuples[ 0 ][ 2 ].lock,\n\n\t\t\t\t\t// progress_handlers.lock\n\t\t\t\t\ttuples[ 0 ][ 3 ].lock\n\t\t\t\t);\n\t\t\t}\n\n\t\t\t// progress_handlers.fire\n\t\t\t// fulfilled_handlers.fire\n\t\t\t// rejected_handlers.fire\n\t\t\tlist.add( tuple[ 3 ].fire );\n\n\t\t\t// deferred.notify = function() { deferred.notifyWith(...) }\n\t\t\t// deferred.resolve = function() { deferred.resolveWith(...) }\n\t\t\t// deferred.reject = function() { deferred.rejectWith(...) }\n\t\t\tdeferred[ tuple[ 0 ] ] = function() {\n\t\t\t\tdeferred[ tuple[ 0 ] + \"With\" ]( this === deferred ? undefined : this, arguments );\n\t\t\t\treturn this;\n\t\t\t};\n\n\t\t\t// deferred.notifyWith = list.fireWith\n\t\t\t// deferred.resolveWith = list.fireWith\n\t\t\t// deferred.rejectWith = list.fireWith\n\t\t\tdeferred[ tuple[ 0 ] + \"With\" ] = list.fireWith;\n\t\t} );\n\n\t\t// Make the deferred a promise\n\t\tpromise.promise( deferred );\n\n\t\t// Call given func if any\n\t\tif ( func ) {\n\t\t\tfunc.call( deferred, deferred );\n\t\t}\n\n\t\t// All done!\n\t\treturn deferred;\n\t},\n\n\t// Deferred helper\n\twhen: function( singleValue ) {\n\t\tvar\n\n\t\t\t// count of uncompleted subordinates\n\t\t\tremaining = arguments.length,\n\n\t\t\t// count of unprocessed arguments\n\t\t\ti = remaining,\n\n\t\t\t// subordinate fulfillment data\n\t\t\tresolveContexts = Array( i ),\n\t\t\tresolveValues = slice.call( arguments ),\n\n\t\t\t// the master Deferred\n\t\t\tmaster = jQuery.Deferred(),\n\n\t\t\t// subordinate callback factory\n\t\t\tupdateFunc = function( i ) {\n\t\t\t\treturn function( value ) {\n\t\t\t\t\tresolveContexts[ i ] = this;\n\t\t\t\t\tresolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;\n\t\t\t\t\tif ( !( --remaining ) ) {\n\t\t\t\t\t\tmaster.resolveWith( resolveContexts, resolveValues );\n\t\t\t\t\t}\n\t\t\t\t};\n\t\t\t};\n\n\t\t// Single- and empty arguments are adopted like Promise.resolve\n\t\tif ( remaining <= 1 ) {\n\t\t\tadoptValue( singleValue, master.done( updateFunc( i ) ).resolve, master.reject,\n\t\t\t\t!remaining );\n\n\t\t\t// Use .then() to unwrap secondary thenables (cf. gh-3000)\n\t\t\tif ( master.state() === \"pending\" ||\n\t\t\t\tisFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) {\n\n\t\t\t\treturn master.then();\n\t\t\t}\n\t\t}\n\n\t\t// Multiple arguments are aggregated like Promise.all array elements\n\t\twhile ( i-- ) {\n\t\t\tadoptValue( resolveValues[ i ], updateFunc( i ), master.reject );\n\t\t}\n\n\t\treturn master.promise();\n\t}\n} );\n\n\n// These usually indicate a programmer mistake during development,\n// warn about them ASAP rather than swallowing them by default.\nvar rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;\n\njQuery.Deferred.exceptionHook = function( error, stack ) {\n\n\t// Support: IE 8 - 9 only\n\t// Console exists when dev tools are open, which can happen at any time\n\tif ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) {\n\t\twindow.console.warn( \"jQuery.Deferred exception: \" + error.message, error.stack, stack );\n\t}\n};\n\n\n\n\njQuery.readyException = function( error ) {\n\twindow.setTimeout( function() {\n\t\tthrow error;\n\t} );\n};\n\n\n\n\n// The deferred used on DOM ready\nvar readyList = jQuery.Deferred();\n\njQuery.fn.ready = function( fn ) {\n\n\treadyList\n\t\t.then( fn )\n\n\t\t// Wrap jQuery.readyException in a function so that the lookup\n\t\t// happens at the time of error handling instead of callback\n\t\t// registration.\n\t\t.catch( function( error ) {\n\t\t\tjQuery.readyException( error );\n\t\t} );\n\n\treturn this;\n};\n\njQuery.extend( {\n\n\t// Is the DOM ready to be used? Set to true once it occurs.\n\tisReady: false,\n\n\t// A counter to track how many items to wait for before\n\t// the ready event fires. See #6781\n\treadyWait: 1,\n\n\t// Handle when the DOM is ready\n\tready: function( wait ) {\n\n\t\t// Abort if there are pending holds or we're already ready\n\t\tif ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Remember that the DOM is ready\n\t\tjQuery.isReady = true;\n\n\t\t// If a normal DOM Ready event fired, decrement, and wait if need be\n\t\tif ( wait !== true && --jQuery.readyWait > 0 ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// If there are functions bound, to execute\n\t\treadyList.resolveWith( document, [ jQuery ] );\n\t}\n} );\n\njQuery.ready.then = readyList.then;\n\n// The ready event handler and self cleanup method\nfunction completed() {\n\tdocument.removeEventListener( \"DOMContentLoaded\", completed );\n\twindow.removeEventListener( \"load\", completed );\n\tjQuery.ready();\n}\n\n// Catch cases where $(document).ready() is called\n// after the browser event has already occurred.\n// Support: IE <=9 - 10 only\n// Older IE sometimes signals \"interactive\" too soon\nif ( document.readyState === \"complete\" ||\n\t( document.readyState !== \"loading\" && !document.documentElement.doScroll ) ) {\n\n\t// Handle it asynchronously to allow scripts the opportunity to delay ready\n\twindow.setTimeout( jQuery.ready );\n\n} else {\n\n\t// Use the handy event callback\n\tdocument.addEventListener( \"DOMContentLoaded\", completed );\n\n\t// A fallback to window.onload, that will always work\n\twindow.addEventListener( \"load\", completed );\n}\n\n\n\n\n// Multifunctional method to get and set values of a collection\n// The value/s can optionally be executed if it's a function\nvar access = function( elems, fn, key, value, chainable, emptyGet, raw ) {\n\tvar i = 0,\n\t\tlen = elems.length,\n\t\tbulk = key == null;\n\n\t// Sets many values\n\tif ( toType( key ) === \"object\" ) {\n\t\tchainable = true;\n\t\tfor ( i in key ) {\n\t\t\taccess( elems, fn, i, key[ i ], true, emptyGet, raw );\n\t\t}\n\n\t// Sets one value\n\t} else if ( value !== undefined ) {\n\t\tchainable = true;\n\n\t\tif ( !isFunction( value ) ) {\n\t\t\traw = true;\n\t\t}\n\n\t\tif ( bulk ) {\n\n\t\t\t// Bulk operations run against the entire set\n\t\t\tif ( raw ) {\n\t\t\t\tfn.call( elems, value );\n\t\t\t\tfn = null;\n\n\t\t\t// ...except when executing function values\n\t\t\t} else {\n\t\t\t\tbulk = fn;\n\t\t\t\tfn = function( elem, key, value ) {\n\t\t\t\t\treturn bulk.call( jQuery( elem ), value );\n\t\t\t\t};\n\t\t\t}\n\t\t}\n\n\t\tif ( fn ) {\n\t\t\tfor ( ; i < len; i++ ) {\n\t\t\t\tfn(\n\t\t\t\t\telems[ i ], key, raw ?\n\t\t\t\t\tvalue :\n\t\t\t\t\tvalue.call( elems[ i ], i, fn( elems[ i ], key ) )\n\t\t\t\t);\n\t\t\t}\n\t\t}\n\t}\n\n\tif ( chainable ) {\n\t\treturn elems;\n\t}\n\n\t// Gets\n\tif ( bulk ) {\n\t\treturn fn.call( elems );\n\t}\n\n\treturn len ? fn( elems[ 0 ], key ) : emptyGet;\n};\n\n\n// Matches dashed string for camelizing\nvar rmsPrefix = /^-ms-/,\n\trdashAlpha = /-([a-z])/g;\n\n// Used by camelCase as callback to replace()\nfunction fcamelCase( all, letter ) {\n\treturn letter.toUpperCase();\n}\n\n// Convert dashed to camelCase; used by the css and data modules\n// Support: IE <=9 - 11, Edge 12 - 15\n// Microsoft forgot to hump their vendor prefix (#9572)\nfunction camelCase( string ) {\n\treturn string.replace( rmsPrefix, \"ms-\" ).replace( rdashAlpha, fcamelCase );\n}\nvar acceptData = function( owner ) {\n\n\t// Accepts only:\n\t// - Node\n\t// - Node.ELEMENT_NODE\n\t// - Node.DOCUMENT_NODE\n\t// - Object\n\t// - Any\n\treturn owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType );\n};\n\n\n\n\nfunction Data() {\n\tthis.expando = jQuery.expando + Data.uid++;\n}\n\nData.uid = 1;\n\nData.prototype = {\n\n\tcache: function( owner ) {\n\n\t\t// Check if the owner object already has a cache\n\t\tvar value = owner[ this.expando ];\n\n\t\t// If not, create one\n\t\tif ( !value ) {\n\t\t\tvalue = {};\n\n\t\t\t// We can accept data for non-element nodes in modern browsers,\n\t\t\t// but we should not, see #8335.\n\t\t\t// Always return an empty object.\n\t\t\tif ( acceptData( owner ) ) {\n\n\t\t\t\t// If it is a node unlikely to be stringify-ed or looped over\n\t\t\t\t// use plain assignment\n\t\t\t\tif ( owner.nodeType ) {\n\t\t\t\t\towner[ this.expando ] = value;\n\n\t\t\t\t// Otherwise secure it in a non-enumerable property\n\t\t\t\t// configurable must be true to allow the property to be\n\t\t\t\t// deleted when data is removed\n\t\t\t\t} else {\n\t\t\t\t\tObject.defineProperty( owner, this.expando, {\n\t\t\t\t\t\tvalue: value,\n\t\t\t\t\t\tconfigurable: true\n\t\t\t\t\t} );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn value;\n\t},\n\tset: function( owner, data, value ) {\n\t\tvar prop,\n\t\t\tcache = this.cache( owner );\n\n\t\t// Handle: [ owner, key, value ] args\n\t\t// Always use camelCase key (gh-2257)\n\t\tif ( typeof data === \"string\" ) {\n\t\t\tcache[ camelCase( data ) ] = value;\n\n\t\t// Handle: [ owner, { properties } ] args\n\t\t} else {\n\n\t\t\t// Copy the properties one-by-one to the cache object\n\t\t\tfor ( prop in data ) {\n\t\t\t\tcache[ camelCase( prop ) ] = data[ prop ];\n\t\t\t}\n\t\t}\n\t\treturn cache;\n\t},\n\tget: function( owner, key ) {\n\t\treturn key === undefined ?\n\t\t\tthis.cache( owner ) :\n\n\t\t\t// Always use camelCase key (gh-2257)\n\t\t\towner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ];\n\t},\n\taccess: function( owner, key, value ) {\n\n\t\t// In cases where either:\n\t\t//\n\t\t// 1. No key was specified\n\t\t// 2. A string key was specified, but no value provided\n\t\t//\n\t\t// Take the \"read\" path and allow the get method to determine\n\t\t// which value to return, respectively either:\n\t\t//\n\t\t// 1. The entire cache object\n\t\t// 2. The data stored at the key\n\t\t//\n\t\tif ( key === undefined ||\n\t\t\t\t( ( key && typeof key === \"string\" ) && value === undefined ) ) {\n\n\t\t\treturn this.get( owner, key );\n\t\t}\n\n\t\t// When the key is not a string, or both a key and value\n\t\t// are specified, set or extend (existing objects) with either:\n\t\t//\n\t\t// 1. An object of properties\n\t\t// 2. A key and value\n\t\t//\n\t\tthis.set( owner, key, value );\n\n\t\t// Since the \"set\" path can have two possible entry points\n\t\t// return the expected data based on which path was taken[*]\n\t\treturn value !== undefined ? value : key;\n\t},\n\tremove: function( owner, key ) {\n\t\tvar i,\n\t\t\tcache = owner[ this.expando ];\n\n\t\tif ( cache === undefined ) {\n\t\t\treturn;\n\t\t}\n\n\t\tif ( key !== undefined ) {\n\n\t\t\t// Support array or space separated string of keys\n\t\t\tif ( Array.isArray( key ) ) {\n\n\t\t\t\t// If key is an array of keys...\n\t\t\t\t// We always set camelCase keys, so remove that.\n\t\t\t\tkey = key.map( camelCase );\n\t\t\t} else {\n\t\t\t\tkey = camelCase( key );\n\n\t\t\t\t// If a key with the spaces exists, use it.\n\t\t\t\t// Otherwise, create an array by matching non-whitespace\n\t\t\t\tkey = key in cache ?\n\t\t\t\t\t[ key ] :\n\t\t\t\t\t( key.match( rnothtmlwhite ) || [] );\n\t\t\t}\n\n\t\t\ti = key.length;\n\n\t\t\twhile ( i-- ) {\n\t\t\t\tdelete cache[ key[ i ] ];\n\t\t\t}\n\t\t}\n\n\t\t// Remove the expando if there's no more data\n\t\tif ( key === undefined || jQuery.isEmptyObject( cache ) ) {\n\n\t\t\t// Support: Chrome <=35 - 45\n\t\t\t// Webkit & Blink performance suffers when deleting properties\n\t\t\t// from DOM nodes, so set to undefined instead\n\t\t\t// https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted)\n\t\t\tif ( owner.nodeType ) {\n\t\t\t\towner[ this.expando ] = undefined;\n\t\t\t} else {\n\t\t\t\tdelete owner[ this.expando ];\n\t\t\t}\n\t\t}\n\t},\n\thasData: function( owner ) {\n\t\tvar cache = owner[ this.expando ];\n\t\treturn cache !== undefined && !jQuery.isEmptyObject( cache );\n\t}\n};\nvar dataPriv = new Data();\n\nvar dataUser = new Data();\n\n\n\n//\tImplementation Summary\n//\n//\t1. Enforce API surface and semantic compatibility with 1.9.x branch\n//\t2. Improve the module's maintainability by reducing the storage\n//\t\tpaths to a single mechanism.\n//\t3. Use the same single mechanism to support \"private\" and \"user\" data.\n//\t4. _Never_ expose \"private\" data to user code (TODO: Drop _data, _removeData)\n//\t5. Avoid exposing implementation details on user objects (eg. expando properties)\n//\t6. Provide a clear path for implementation upgrade to WeakMap in 2014\n\nvar rbrace = /^(?:\\{[\\w\\W]*\\}|\\[[\\w\\W]*\\])$/,\n\trmultiDash = /[A-Z]/g;\n\nfunction getData( data ) {\n\tif ( data === \"true\" ) {\n\t\treturn true;\n\t}\n\n\tif ( data === \"false\" ) {\n\t\treturn false;\n\t}\n\n\tif ( data === \"null\" ) {\n\t\treturn null;\n\t}\n\n\t// Only convert to a number if it doesn't change the string\n\tif ( data === +data + \"\" ) {\n\t\treturn +data;\n\t}\n\n\tif ( rbrace.test( data ) ) {\n\t\treturn JSON.parse( data );\n\t}\n\n\treturn data;\n}\n\nfunction dataAttr( elem, key, data ) {\n\tvar name;\n\n\t// If nothing was found internally, try to fetch any\n\t// data from the HTML5 data-* attribute\n\tif ( data === undefined && elem.nodeType === 1 ) {\n\t\tname = \"data-\" + key.replace( rmultiDash, \"-$&\" ).toLowerCase();\n\t\tdata = elem.getAttribute( name );\n\n\t\tif ( typeof data === \"string\" ) {\n\t\t\ttry {\n\t\t\t\tdata = getData( data );\n\t\t\t} catch ( e ) {}\n\n\t\t\t// Make sure we set the data so it isn't changed later\n\t\t\tdataUser.set( elem, key, data );\n\t\t} else {\n\t\t\tdata = undefined;\n\t\t}\n\t}\n\treturn data;\n}\n\njQuery.extend( {\n\thasData: function( elem ) {\n\t\treturn dataUser.hasData( elem ) || dataPriv.hasData( elem );\n\t},\n\n\tdata: function( elem, name, data ) {\n\t\treturn dataUser.access( elem, name, data );\n\t},\n\n\tremoveData: function( elem, name ) {\n\t\tdataUser.remove( elem, name );\n\t},\n\n\t// TODO: Now that all calls to _data and _removeData have been replaced\n\t// with direct calls to dataPriv methods, these can be deprecated.\n\t_data: function( elem, name, data ) {\n\t\treturn dataPriv.access( elem, name, data );\n\t},\n\n\t_removeData: function( elem, name ) {\n\t\tdataPriv.remove( elem, name );\n\t}\n} );\n\njQuery.fn.extend( {\n\tdata: function( key, value ) {\n\t\tvar i, name, data,\n\t\t\telem = this[ 0 ],\n\t\t\tattrs = elem && elem.attributes;\n\n\t\t// Gets all values\n\t\tif ( key === undefined ) {\n\t\t\tif ( this.length ) {\n\t\t\t\tdata = dataUser.get( elem );\n\n\t\t\t\tif ( elem.nodeType === 1 && !dataPriv.get( elem, \"hasDataAttrs\" ) ) {\n\t\t\t\t\ti = attrs.length;\n\t\t\t\t\twhile ( i-- ) {\n\n\t\t\t\t\t\t// Support: IE 11 only\n\t\t\t\t\t\t// The attrs elements can be null (#14894)\n\t\t\t\t\t\tif ( attrs[ i ] ) {\n\t\t\t\t\t\t\tname = attrs[ i ].name;\n\t\t\t\t\t\t\tif ( name.indexOf( \"data-\" ) === 0 ) {\n\t\t\t\t\t\t\t\tname = camelCase( name.slice( 5 ) );\n\t\t\t\t\t\t\t\tdataAttr( elem, name, data[ name ] );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tdataPriv.set( elem, \"hasDataAttrs\", true );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\treturn data;\n\t\t}\n\n\t\t// Sets multiple values\n\t\tif ( typeof key === \"object\" ) {\n\t\t\treturn this.each( function() {\n\t\t\t\tdataUser.set( this, key );\n\t\t\t} );\n\t\t}\n\n\t\treturn access( this, function( value ) {\n\t\t\tvar data;\n\n\t\t\t// The calling jQuery object (element matches) is not empty\n\t\t\t// (and therefore has an element appears at this[ 0 ]) and the\n\t\t\t// `value` parameter was not undefined. An empty jQuery object\n\t\t\t// will result in `undefined` for elem = this[ 0 ] which will\n\t\t\t// throw an exception if an attempt to read a data cache is made.\n\t\t\tif ( elem && value === undefined ) {\n\n\t\t\t\t// Attempt to get data from the cache\n\t\t\t\t// The key will always be camelCased in Data\n\t\t\t\tdata = dataUser.get( elem, key );\n\t\t\t\tif ( data !== undefined ) {\n\t\t\t\t\treturn data;\n\t\t\t\t}\n\n\t\t\t\t// Attempt to \"discover\" the data in\n\t\t\t\t// HTML5 custom data-* attrs\n\t\t\t\tdata = dataAttr( elem, key );\n\t\t\t\tif ( data !== undefined ) {\n\t\t\t\t\treturn data;\n\t\t\t\t}\n\n\t\t\t\t// We tried really hard, but the data doesn't exist.\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\t// Set the data...\n\t\t\tthis.each( function() {\n\n\t\t\t\t// We always store the camelCased key\n\t\t\t\tdataUser.set( this, key, value );\n\t\t\t} );\n\t\t}, null, value, arguments.length > 1, null, true );\n\t},\n\n\tremoveData: function( key ) {\n\t\treturn this.each( function() {\n\t\t\tdataUser.remove( this, key );\n\t\t} );\n\t}\n} );\n\n\njQuery.extend( {\n\tqueue: function( elem, type, data ) {\n\t\tvar queue;\n\n\t\tif ( elem ) {\n\t\t\ttype = ( type || \"fx\" ) + \"queue\";\n\t\t\tqueue = dataPriv.get( elem, type );\n\n\t\t\t// Speed up dequeue by getting out quickly if this is just a lookup\n\t\t\tif ( data ) {\n\t\t\t\tif ( !queue || Array.isArray( data ) ) {\n\t\t\t\t\tqueue = dataPriv.access( elem, type, jQuery.makeArray( data ) );\n\t\t\t\t} else {\n\t\t\t\t\tqueue.push( data );\n\t\t\t\t}\n\t\t\t}\n\t\t\treturn queue || [];\n\t\t}\n\t},\n\n\tdequeue: function( elem, type ) {\n\t\ttype = type || \"fx\";\n\n\t\tvar queue = jQuery.queue( elem, type ),\n\t\t\tstartLength = queue.length,\n\t\t\tfn = queue.shift(),\n\t\t\thooks = jQuery._queueHooks( elem, type ),\n\t\t\tnext = function() {\n\t\t\t\tjQuery.dequeue( elem, type );\n\t\t\t};\n\n\t\t// If the fx queue is dequeued, always remove the progress sentinel\n\t\tif ( fn === \"inprogress\" ) {\n\t\t\tfn = queue.shift();\n\t\t\tstartLength--;\n\t\t}\n\n\t\tif ( fn ) {\n\n\t\t\t// Add a progress sentinel to prevent the fx queue from being\n\t\t\t// automatically dequeued\n\t\t\tif ( type === \"fx\" ) {\n\t\t\t\tqueue.unshift( \"inprogress\" );\n\t\t\t}\n\n\t\t\t// Clear up the last queue stop function\n\t\t\tdelete hooks.stop;\n\t\t\tfn.call( elem, next, hooks );\n\t\t}\n\n\t\tif ( !startLength && hooks ) {\n\t\t\thooks.empty.fire();\n\t\t}\n\t},\n\n\t// Not public - generate a queueHooks object, or return the current one\n\t_queueHooks: function( elem, type ) {\n\t\tvar key = type + \"queueHooks\";\n\t\treturn dataPriv.get( elem, key ) || dataPriv.access( elem, key, {\n\t\t\tempty: jQuery.Callbacks( \"once memory\" ).add( function() {\n\t\t\t\tdataPriv.remove( elem, [ type + \"queue\", key ] );\n\t\t\t} )\n\t\t} );\n\t}\n} );\n\njQuery.fn.extend( {\n\tqueue: function( type, data ) {\n\t\tvar setter = 2;\n\n\t\tif ( typeof type !== \"string\" ) {\n\t\t\tdata = type;\n\t\t\ttype = \"fx\";\n\t\t\tsetter--;\n\t\t}\n\n\t\tif ( arguments.length < setter ) {\n\t\t\treturn jQuery.queue( this[ 0 ], type );\n\t\t}\n\n\t\treturn data === undefined ?\n\t\t\tthis :\n\t\t\tthis.each( function() {\n\t\t\t\tvar queue = jQuery.queue( this, type, data );\n\n\t\t\t\t// Ensure a hooks for this queue\n\t\t\t\tjQuery._queueHooks( this, type );\n\n\t\t\t\tif ( type === \"fx\" && queue[ 0 ] !== \"inprogress\" ) {\n\t\t\t\t\tjQuery.dequeue( this, type );\n\t\t\t\t}\n\t\t\t} );\n\t},\n\tdequeue: function( type ) {\n\t\treturn this.each( function() {\n\t\t\tjQuery.dequeue( this, type );\n\t\t} );\n\t},\n\tclearQueue: function( type ) {\n\t\treturn this.queue( type || \"fx\", [] );\n\t},\n\n\t// Get a promise resolved when queues of a certain type\n\t// are emptied (fx is the type by default)\n\tpromise: function( type, obj ) {\n\t\tvar tmp,\n\t\t\tcount = 1,\n\t\t\tdefer = jQuery.Deferred(),\n\t\t\telements = this,\n\t\t\ti = this.length,\n\t\t\tresolve = function() {\n\t\t\t\tif ( !( --count ) ) {\n\t\t\t\t\tdefer.resolveWith( elements, [ elements ] );\n\t\t\t\t}\n\t\t\t};\n\n\t\tif ( typeof type !== \"string\" ) {\n\t\t\tobj = type;\n\t\t\ttype = undefined;\n\t\t}\n\t\ttype = type || \"fx\";\n\n\t\twhile ( i-- ) {\n\t\t\ttmp = dataPriv.get( elements[ i ], type + \"queueHooks\" );\n\t\t\tif ( tmp && tmp.empty ) {\n\t\t\t\tcount++;\n\t\t\t\ttmp.empty.add( resolve );\n\t\t\t}\n\t\t}\n\t\tresolve();\n\t\treturn defer.promise( obj );\n\t}\n} );\nvar pnum = ( /[+-]?(?:\\d*\\.|)\\d+(?:[eE][+-]?\\d+|)/ ).source;\n\nvar rcssNum = new RegExp( \"^(?:([+-])=|)(\" + pnum + \")([a-z%]*)$\", \"i\" );\n\n\nvar cssExpand = [ \"Top\", \"Right\", \"Bottom\", \"Left\" ];\n\nvar isHiddenWithinTree = function( elem, el ) {\n\n\t\t// isHiddenWithinTree might be called from jQuery#filter function;\n\t\t// in that case, element will be second argument\n\t\telem = el || elem;\n\n\t\t// Inline style trumps all\n\t\treturn elem.style.display === \"none\" ||\n\t\t\telem.style.display === \"\" &&\n\n\t\t\t// Otherwise, check computed style\n\t\t\t// Support: Firefox <=43 - 45\n\t\t\t// Disconnected elements can have computed display: none, so first confirm that elem is\n\t\t\t// in the document.\n\t\t\tjQuery.contains( elem.ownerDocument, elem ) &&\n\n\t\t\tjQuery.css( elem, \"display\" ) === \"none\";\n\t};\n\nvar swap = function( elem, options, callback, args ) {\n\tvar ret, name,\n\t\told = {};\n\n\t// Remember the old values, and insert the new ones\n\tfor ( name in options ) {\n\t\told[ name ] = elem.style[ name ];\n\t\telem.style[ name ] = options[ name ];\n\t}\n\n\tret = callback.apply( elem, args || [] );\n\n\t// Revert the old values\n\tfor ( name in options ) {\n\t\telem.style[ name ] = old[ name ];\n\t}\n\n\treturn ret;\n};\n\n\n\n\nfunction adjustCSS( elem, prop, valueParts, tween ) {\n\tvar adjusted, scale,\n\t\tmaxIterations = 20,\n\t\tcurrentValue = tween ?\n\t\t\tfunction() {\n\t\t\t\treturn tween.cur();\n\t\t\t} :\n\t\t\tfunction() {\n\t\t\t\treturn jQuery.css( elem, prop, \"\" );\n\t\t\t},\n\t\tinitial = currentValue(),\n\t\tunit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? \"\" : \"px\" ),\n\n\t\t// Starting value computation is required for potential unit mismatches\n\t\tinitialInUnit = ( jQuery.cssNumber[ prop ] || unit !== \"px\" && +initial ) &&\n\t\t\trcssNum.exec( jQuery.css( elem, prop ) );\n\n\tif ( initialInUnit && initialInUnit[ 3 ] !== unit ) {\n\n\t\t// Support: Firefox <=54\n\t\t// Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144)\n\t\tinitial = initial / 2;\n\n\t\t// Trust units reported by jQuery.css\n\t\tunit = unit || initialInUnit[ 3 ];\n\n\t\t// Iteratively approximate from a nonzero starting point\n\t\tinitialInUnit = +initial || 1;\n\n\t\twhile ( maxIterations-- ) {\n\n\t\t\t// Evaluate and update our best guess (doubling guesses that zero out).\n\t\t\t// Finish if the scale equals or crosses 1 (making the old*new product non-positive).\n\t\t\tjQuery.style( elem, prop, initialInUnit + unit );\n\t\t\tif ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) {\n\t\t\t\tmaxIterations = 0;\n\t\t\t}\n\t\t\tinitialInUnit = initialInUnit / scale;\n\n\t\t}\n\n\t\tinitialInUnit = initialInUnit * 2;\n\t\tjQuery.style( elem, prop, initialInUnit + unit );\n\n\t\t// Make sure we update the tween properties later on\n\t\tvalueParts = valueParts || [];\n\t}\n\n\tif ( valueParts ) {\n\t\tinitialInUnit = +initialInUnit || +initial || 0;\n\n\t\t// Apply relative offset (+=/-=) if specified\n\t\tadjusted = valueParts[ 1 ] ?\n\t\t\tinitialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] :\n\t\t\t+valueParts[ 2 ];\n\t\tif ( tween ) {\n\t\t\ttween.unit = unit;\n\t\t\ttween.start = initialInUnit;\n\t\t\ttween.end = adjusted;\n\t\t}\n\t}\n\treturn adjusted;\n}\n\n\nvar defaultDisplayMap = {};\n\nfunction getDefaultDisplay( elem ) {\n\tvar temp,\n\t\tdoc = elem.ownerDocument,\n\t\tnodeName = elem.nodeName,\n\t\tdisplay = defaultDisplayMap[ nodeName ];\n\n\tif ( display ) {\n\t\treturn display;\n\t}\n\n\ttemp = doc.body.appendChild( doc.createElement( nodeName ) );\n\tdisplay = jQuery.css( temp, \"display\" );\n\n\ttemp.parentNode.removeChild( temp );\n\n\tif ( display === \"none\" ) {\n\t\tdisplay = \"block\";\n\t}\n\tdefaultDisplayMap[ nodeName ] = display;\n\n\treturn display;\n}\n\nfunction showHide( elements, show ) {\n\tvar display, elem,\n\t\tvalues = [],\n\t\tindex = 0,\n\t\tlength = elements.length;\n\n\t// Determine new display value for elements that need to change\n\tfor ( ; index < length; index++ ) {\n\t\telem = elements[ index ];\n\t\tif ( !elem.style ) {\n\t\t\tcontinue;\n\t\t}\n\n\t\tdisplay = elem.style.display;\n\t\tif ( show ) {\n\n\t\t\t// Since we force visibility upon cascade-hidden elements, an immediate (and slow)\n\t\t\t// check is required in this first loop unless we have a nonempty display value (either\n\t\t\t// inline or about-to-be-restored)\n\t\t\tif ( display === \"none\" ) {\n\t\t\t\tvalues[ index ] = dataPriv.get( elem, \"display\" ) || null;\n\t\t\t\tif ( !values[ index ] ) {\n\t\t\t\t\telem.style.display = \"\";\n\t\t\t\t}\n\t\t\t}\n\t\t\tif ( elem.style.display === \"\" && isHiddenWithinTree( elem ) ) {\n\t\t\t\tvalues[ index ] = getDefaultDisplay( elem );\n\t\t\t}\n\t\t} else {\n\t\t\tif ( display !== \"none\" ) {\n\t\t\t\tvalues[ index ] = \"none\";\n\n\t\t\t\t// Remember what we're overwriting\n\t\t\t\tdataPriv.set( elem, \"display\", display );\n\t\t\t}\n\t\t}\n\t}\n\n\t// Set the display of the elements in a second loop to avoid constant reflow\n\tfor ( index = 0; index < length; index++ ) {\n\t\tif ( values[ index ] != null ) {\n\t\t\telements[ index ].style.display = values[ index ];\n\t\t}\n\t}\n\n\treturn elements;\n}\n\njQuery.fn.extend( {\n\tshow: function() {\n\t\treturn showHide( this, true );\n\t},\n\thide: function() {\n\t\treturn showHide( this );\n\t},\n\ttoggle: function( state ) {\n\t\tif ( typeof state === \"boolean\" ) {\n\t\t\treturn state ? this.show() : this.hide();\n\t\t}\n\n\t\treturn this.each( function() {\n\t\t\tif ( isHiddenWithinTree( this ) ) {\n\t\t\t\tjQuery( this ).show();\n\t\t\t} else {\n\t\t\t\tjQuery( this ).hide();\n\t\t\t}\n\t\t} );\n\t}\n} );\nvar rcheckableType = ( /^(?:checkbox|radio)$/i );\n\nvar rtagName = ( /<([a-z][^\\/\\0>\\x20\\t\\r\\n\\f]+)/i );\n\nvar rscriptType = ( /^$|^module$|\\/(?:java|ecma)script/i );\n\n\n\n// We have to close these tags to support XHTML (#13200)\nvar wrapMap = {\n\n\t// Support: IE <=9 only\n\toption: [ 1, \"<select multiple='multiple'>\", \"</select>\" ],\n\n\t// XHTML parsers do not magically insert elements in the\n\t// same way that tag soup parsers do. So we cannot shorten\n\t// this by omitting <tbody> or other required elements.\n\tthead: [ 1, \"<table>\", \"</table>\" ],\n\tcol: [ 2, \"<table><colgroup>\", \"</colgroup></table>\" ],\n\ttr: [ 2, \"<table><tbody>\", \"</tbody></table>\" ],\n\ttd: [ 3, \"<table><tbody><tr>\", \"</tr></tbody></table>\" ],\n\n\t_default: [ 0, \"\", \"\" ]\n};\n\n// Support: IE <=9 only\nwrapMap.optgroup = wrapMap.option;\n\nwrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;\nwrapMap.th = wrapMap.td;\n\n\nfunction getAll( context, tag ) {\n\n\t// Support: IE <=9 - 11 only\n\t// Use typeof to avoid zero-argument method invocation on host objects (#15151)\n\tvar ret;\n\n\tif ( typeof context.getElementsByTagName !== \"undefined\" ) {\n\t\tret = context.getElementsByTagName( tag || \"*\" );\n\n\t} else if ( typeof context.querySelectorAll !== \"undefined\" ) {\n\t\tret = context.querySelectorAll( tag || \"*\" );\n\n\t} else {\n\t\tret = [];\n\t}\n\n\tif ( tag === undefined || tag && nodeName( context, tag ) ) {\n\t\treturn jQuery.merge( [ context ], ret );\n\t}\n\n\treturn ret;\n}\n\n\n// Mark scripts as having already been evaluated\nfunction setGlobalEval( elems, refElements ) {\n\tvar i = 0,\n\t\tl = elems.length;\n\n\tfor ( ; i < l; i++ ) {\n\t\tdataPriv.set(\n\t\t\telems[ i ],\n\t\t\t\"globalEval\",\n\t\t\t!refElements || dataPriv.get( refElements[ i ], \"globalEval\" )\n\t\t);\n\t}\n}\n\n\nvar rhtml = /<|&#?\\w+;/;\n\nfunction buildFragment( elems, context, scripts, selection, ignored ) {\n\tvar elem, tmp, tag, wrap, contains, j,\n\t\tfragment = context.createDocumentFragment(),\n\t\tnodes = [],\n\t\ti = 0,\n\t\tl = elems.length;\n\n\tfor ( ; i < l; i++ ) {\n\t\telem = elems[ i ];\n\n\t\tif ( elem || elem === 0 ) {\n\n\t\t\t// Add nodes directly\n\t\t\tif ( toType( elem ) === \"object\" ) {\n\n\t\t\t\t// Support: Android <=4.0 only, PhantomJS 1 only\n\t\t\t\t// push.apply(_, arraylike) throws on ancient WebKit\n\t\t\t\tjQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );\n\n\t\t\t// Convert non-html into a text node\n\t\t\t} else if ( !rhtml.test( elem ) ) {\n\t\t\t\tnodes.push( context.createTextNode( elem ) );\n\n\t\t\t// Convert html into DOM nodes\n\t\t\t} else {\n\t\t\t\ttmp = tmp || fragment.appendChild( context.createElement( \"div\" ) );\n\n\t\t\t\t// Deserialize a standard representation\n\t\t\t\ttag = ( rtagName.exec( elem ) || [ \"\", \"\" ] )[ 1 ].toLowerCase();\n\t\t\t\twrap = wrapMap[ tag ] || wrapMap._default;\n\t\t\t\ttmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ];\n\n\t\t\t\t// Descend through wrappers to the right content\n\t\t\t\tj = wrap[ 0 ];\n\t\t\t\twhile ( j-- ) {\n\t\t\t\t\ttmp = tmp.lastChild;\n\t\t\t\t}\n\n\t\t\t\t// Support: Android <=4.0 only, PhantomJS 1 only\n\t\t\t\t// push.apply(_, arraylike) throws on ancient WebKit\n\t\t\t\tjQuery.merge( nodes, tmp.childNodes );\n\n\t\t\t\t// Remember the top-level container\n\t\t\t\ttmp = fragment.firstChild;\n\n\t\t\t\t// Ensure the created nodes are orphaned (#12392)\n\t\t\t\ttmp.textContent = \"\";\n\t\t\t}\n\t\t}\n\t}\n\n\t// Remove wrapper from fragment\n\tfragment.textContent = \"\";\n\n\ti = 0;\n\twhile ( ( elem = nodes[ i++ ] ) ) {\n\n\t\t// Skip elements already in the context collection (trac-4087)\n\t\tif ( selection && jQuery.inArray( elem, selection ) > -1 ) {\n\t\t\tif ( ignored ) {\n\t\t\t\tignored.push( elem );\n\t\t\t}\n\t\t\tcontinue;\n\t\t}\n\n\t\tcontains = jQuery.contains( elem.ownerDocument, elem );\n\n\t\t// Append to fragment\n\t\ttmp = getAll( fragment.appendChild( elem ), \"script\" );\n\n\t\t// Preserve script evaluation history\n\t\tif ( contains ) {\n\t\t\tsetGlobalEval( tmp );\n\t\t}\n\n\t\t// Capture executables\n\t\tif ( scripts ) {\n\t\t\tj = 0;\n\t\t\twhile ( ( elem = tmp[ j++ ] ) ) {\n\t\t\t\tif ( rscriptType.test( elem.type || \"\" ) ) {\n\t\t\t\t\tscripts.push( elem );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\treturn fragment;\n}\n\n\n( function() {\n\tvar fragment = document.createDocumentFragment(),\n\t\tdiv = fragment.appendChild( document.createElement( \"div\" ) ),\n\t\tinput = document.createElement( \"input\" );\n\n\t// Support: Android 4.0 - 4.3 only\n\t// Check state lost if the name is set (#11217)\n\t// Support: Windows Web Apps (WWA)\n\t// `name` and `type` must use .setAttribute for WWA (#14901)\n\tinput.setAttribute( \"type\", \"radio\" );\n\tinput.setAttribute( \"checked\", \"checked\" );\n\tinput.setAttribute( \"name\", \"t\" );\n\n\tdiv.appendChild( input );\n\n\t// Support: Android <=4.1 only\n\t// Older WebKit doesn't clone checked state correctly in fragments\n\tsupport.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;\n\n\t// Support: IE <=11 only\n\t// Make sure textarea (and checkbox) defaultValue is properly cloned\n\tdiv.innerHTML = \"<textarea>x</textarea>\";\n\tsupport.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;\n} )();\nvar documentElement = document.documentElement;\n\n\n\nvar\n\trkeyEvent = /^key/,\n\trmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/,\n\trtypenamespace = /^([^.]*)(?:\\.(.+)|)/;\n\nfunction returnTrue() {\n\treturn true;\n}\n\nfunction returnFalse() {\n\treturn false;\n}\n\n// Support: IE <=9 only\n// See #13393 for more info\nfunction safeActiveElement() {\n\ttry {\n\t\treturn document.activeElement;\n\t} catch ( err ) { }\n}\n\nfunction on( elem, types, selector, data, fn, one ) {\n\tvar origFn, type;\n\n\t// Types can be a map of types/handlers\n\tif ( typeof types === \"object\" ) {\n\n\t\t// ( types-Object, selector, data )\n\t\tif ( typeof selector !== \"string\" ) {\n\n\t\t\t// ( types-Object, data )\n\t\t\tdata = data || selector;\n\t\t\tselector = undefined;\n\t\t}\n\t\tfor ( type in types ) {\n\t\t\ton( elem, type, selector, data, types[ type ], one );\n\t\t}\n\t\treturn elem;\n\t}\n\n\tif ( data == null && fn == null ) {\n\n\t\t// ( types, fn )\n\t\tfn = selector;\n\t\tdata = selector = undefined;\n\t} else if ( fn == null ) {\n\t\tif ( typeof selector === \"string\" ) {\n\n\t\t\t// ( types, selector, fn )\n\t\t\tfn = data;\n\t\t\tdata = undefined;\n\t\t} else {\n\n\t\t\t// ( types, data, fn )\n\t\t\tfn = data;\n\t\t\tdata = selector;\n\t\t\tselector = undefined;\n\t\t}\n\t}\n\tif ( fn === false ) {\n\t\tfn = returnFalse;\n\t} else if ( !fn ) {\n\t\treturn elem;\n\t}\n\n\tif ( one === 1 ) {\n\t\torigFn = fn;\n\t\tfn = function( event ) {\n\n\t\t\t// Can use an empty set, since event contains the info\n\t\t\tjQuery().off( event );\n\t\t\treturn origFn.apply( this, arguments );\n\t\t};\n\n\t\t// Use same guid so caller can remove using origFn\n\t\tfn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );\n\t}\n\treturn elem.each( function() {\n\t\tjQuery.event.add( this, types, fn, data, selector );\n\t} );\n}\n\n/*\n * Helper functions for managing events -- not part of the public interface.\n * Props to Dean Edwards' addEvent library for many of the ideas.\n */\njQuery.event = {\n\n\tglobal: {},\n\n\tadd: function( elem, types, handler, data, selector ) {\n\n\t\tvar handleObjIn, eventHandle, tmp,\n\t\t\tevents, t, handleObj,\n\t\t\tspecial, handlers, type, namespaces, origType,\n\t\t\telemData = dataPriv.get( elem );\n\n\t\t// Don't attach events to noData or text/comment nodes (but allow plain objects)\n\t\tif ( !elemData ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Caller can pass in an object of custom data in lieu of the handler\n\t\tif ( handler.handler ) {\n\t\t\thandleObjIn = handler;\n\t\t\thandler = handleObjIn.handler;\n\t\t\tselector = handleObjIn.selector;\n\t\t}\n\n\t\t// Ensure that invalid selectors throw exceptions at attach time\n\t\t// Evaluate against documentElement in case elem is a non-element node (e.g., document)\n\t\tif ( selector ) {\n\t\t\tjQuery.find.matchesSelector( documentElement, selector );\n\t\t}\n\n\t\t// Make sure that the handler has a unique ID, used to find/remove it later\n\t\tif ( !handler.guid ) {\n\t\t\thandler.guid = jQuery.guid++;\n\t\t}\n\n\t\t// Init the element's event structure and main handler, if this is the first\n\t\tif ( !( events = elemData.events ) ) {\n\t\t\tevents = elemData.events = {};\n\t\t}\n\t\tif ( !( eventHandle = elemData.handle ) ) {\n\t\t\teventHandle = elemData.handle = function( e ) {\n\n\t\t\t\t// Discard the second event of a jQuery.event.trigger() and\n\t\t\t\t// when an event is called after a page has unloaded\n\t\t\t\treturn typeof jQuery !== \"undefined\" && jQuery.event.triggered !== e.type ?\n\t\t\t\t\tjQuery.event.dispatch.apply( elem, arguments ) : undefined;\n\t\t\t};\n\t\t}\n\n\t\t// Handle multiple events separated by a space\n\t\ttypes = ( types || \"\" ).match( rnothtmlwhite ) || [ \"\" ];\n\t\tt = types.length;\n\t\twhile ( t-- ) {\n\t\t\ttmp = rtypenamespace.exec( types[ t ] ) || [];\n\t\t\ttype = origType = tmp[ 1 ];\n\t\t\tnamespaces = ( tmp[ 2 ] || \"\" ).split( \".\" ).sort();\n\n\t\t\t// There *must* be a type, no attaching namespace-only handlers\n\t\t\tif ( !type ) {\n\t\t\t\tcontinue;\n\t\t\t}\n\n\t\t\t// If event changes its type, use the special event handlers for the changed type\n\t\t\tspecial = jQuery.event.special[ type ] || {};\n\n\t\t\t// If selector defined, determine special event api type, otherwise given type\n\t\t\ttype = ( selector ? special.delegateType : special.bindType ) || type;\n\n\t\t\t// Update special based on newly reset type\n\t\t\tspecial = jQuery.event.special[ type ] || {};\n\n\t\t\t// handleObj is passed to all event handlers\n\t\t\thandleObj = jQuery.extend( {\n\t\t\t\ttype: type,\n\t\t\t\torigType: origType,\n\t\t\t\tdata: data,\n\t\t\t\thandler: handler,\n\t\t\t\tguid: handler.guid,\n\t\t\t\tselector: selector,\n\t\t\t\tneedsContext: selector && jQuery.expr.match.needsContext.test( selector ),\n\t\t\t\tnamespace: namespaces.join( \".\" )\n\t\t\t}, handleObjIn );\n\n\t\t\t// Init the event handler queue if we're the first\n\t\t\tif ( !( handlers = events[ type ] ) ) {\n\t\t\t\thandlers = events[ type ] = [];\n\t\t\t\thandlers.delegateCount = 0;\n\n\t\t\t\t// Only use addEventListener if the special events handler returns false\n\t\t\t\tif ( !special.setup ||\n\t\t\t\t\tspecial.setup.call( elem, data, namespaces, eventHandle ) === false ) {\n\n\t\t\t\t\tif ( elem.addEventListener ) {\n\t\t\t\t\t\telem.addEventListener( type, eventHandle );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tif ( special.add ) {\n\t\t\t\tspecial.add.call( elem, handleObj );\n\n\t\t\t\tif ( !handleObj.handler.guid ) {\n\t\t\t\t\thandleObj.handler.guid = handler.guid;\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Add to the element's handler list, delegates in front\n\t\t\tif ( selector ) {\n\t\t\t\thandlers.splice( handlers.delegateCount++, 0, handleObj );\n\t\t\t} else {\n\t\t\t\thandlers.push( handleObj );\n\t\t\t}\n\n\t\t\t// Keep track of which events have ever been used, for event optimization\n\t\t\tjQuery.event.global[ type ] = true;\n\t\t}\n\n\t},\n\n\t// Detach an event or set of events from an element\n\tremove: function( elem, types, handler, selector, mappedTypes ) {\n\n\t\tvar j, origCount, tmp,\n\t\t\tevents, t, handleObj,\n\t\t\tspecial, handlers, type, namespaces, origType,\n\t\t\telemData = dataPriv.hasData( elem ) && dataPriv.get( elem );\n\n\t\tif ( !elemData || !( events = elemData.events ) ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Once for each type.namespace in types; type may be omitted\n\t\ttypes = ( types || \"\" ).match( rnothtmlwhite ) || [ \"\" ];\n\t\tt = types.length;\n\t\twhile ( t-- ) {\n\t\t\ttmp = rtypenamespace.exec( types[ t ] ) || [];\n\t\t\ttype = origType = tmp[ 1 ];\n\t\t\tnamespaces = ( tmp[ 2 ] || \"\" ).split( \".\" ).sort();\n\n\t\t\t// Unbind all events (on this namespace, if provided) for the element\n\t\t\tif ( !type ) {\n\t\t\t\tfor ( type in events ) {\n\t\t\t\t\tjQuery.event.remove( elem, type + types[ t ], handler, selector, true );\n\t\t\t\t}\n\t\t\t\tcontinue;\n\t\t\t}\n\n\t\t\tspecial = jQuery.event.special[ type ] || {};\n\t\t\ttype = ( selector ? special.delegateType : special.bindType ) || type;\n\t\t\thandlers = events[ type ] || [];\n\t\t\ttmp = tmp[ 2 ] &&\n\t\t\t\tnew RegExp( \"(^|\\\\.)\" + namespaces.join( \"\\\\.(?:.*\\\\.|)\" ) + \"(\\\\.|$)\" );\n\n\t\t\t// Remove matching events\n\t\t\torigCount = j = handlers.length;\n\t\t\twhile ( j-- ) {\n\t\t\t\thandleObj = handlers[ j ];\n\n\t\t\t\tif ( ( mappedTypes || origType === handleObj.origType ) &&\n\t\t\t\t\t( !handler || handler.guid === handleObj.guid ) &&\n\t\t\t\t\t( !tmp || tmp.test( handleObj.namespace ) ) &&\n\t\t\t\t\t( !selector || selector === handleObj.selector ||\n\t\t\t\t\t\tselector === \"**\" && handleObj.selector ) ) {\n\t\t\t\t\thandlers.splice( j, 1 );\n\n\t\t\t\t\tif ( handleObj.selector ) {\n\t\t\t\t\t\thandlers.delegateCount--;\n\t\t\t\t\t}\n\t\t\t\t\tif ( special.remove ) {\n\t\t\t\t\t\tspecial.remove.call( elem, handleObj );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Remove generic event handler if we removed something and no more handlers exist\n\t\t\t// (avoids potential for endless recursion during removal of special event handlers)\n\t\t\tif ( origCount && !handlers.length ) {\n\t\t\t\tif ( !special.teardown ||\n\t\t\t\t\tspecial.teardown.call( elem, namespaces, elemData.handle ) === false ) {\n\n\t\t\t\t\tjQuery.removeEvent( elem, type, elemData.handle );\n\t\t\t\t}\n\n\t\t\t\tdelete events[ type ];\n\t\t\t}\n\t\t}\n\n\t\t// Remove data and the expando if it's no longer used\n\t\tif ( jQuery.isEmptyObject( events ) ) {\n\t\t\tdataPriv.remove( elem, \"handle events\" );\n\t\t}\n\t},\n\n\tdispatch: function( nativeEvent ) {\n\n\t\t// Make a writable jQuery.Event from the native event object\n\t\tvar event = jQuery.event.fix( nativeEvent );\n\n\t\tvar i, j, ret, matched, handleObj, handlerQueue,\n\t\t\targs = new Array( arguments.length ),\n\t\t\thandlers = ( dataPriv.get( this, \"events\" ) || {} )[ event.type ] || [],\n\t\t\tspecial = jQuery.event.special[ event.type ] || {};\n\n\t\t// Use the fix-ed jQuery.Event rather than the (read-only) native event\n\t\targs[ 0 ] = event;\n\n\t\tfor ( i = 1; i < arguments.length; i++ ) {\n\t\t\targs[ i ] = arguments[ i ];\n\t\t}\n\n\t\tevent.delegateTarget = this;\n\n\t\t// Call the preDispatch hook for the mapped type, and let it bail if desired\n\t\tif ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Determine handlers\n\t\thandlerQueue = jQuery.event.handlers.call( this, event, handlers );\n\n\t\t// Run delegates first; they may want to stop propagation beneath us\n\t\ti = 0;\n\t\twhile ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) {\n\t\t\tevent.currentTarget = matched.elem;\n\n\t\t\tj = 0;\n\t\t\twhile ( ( handleObj = matched.handlers[ j++ ] ) &&\n\t\t\t\t!event.isImmediatePropagationStopped() ) {\n\n\t\t\t\t// Triggered event must either 1) have no namespace, or 2) have namespace(s)\n\t\t\t\t// a subset or equal to those in the bound event (both can have no namespace).\n\t\t\t\tif ( !event.rnamespace || event.rnamespace.test( handleObj.namespace ) ) {\n\n\t\t\t\t\tevent.handleObj = handleObj;\n\t\t\t\t\tevent.data = handleObj.data;\n\n\t\t\t\t\tret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle ||\n\t\t\t\t\t\thandleObj.handler ).apply( matched.elem, args );\n\n\t\t\t\t\tif ( ret !== undefined ) {\n\t\t\t\t\t\tif ( ( event.result = ret ) === false ) {\n\t\t\t\t\t\t\tevent.preventDefault();\n\t\t\t\t\t\t\tevent.stopPropagation();\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// Call the postDispatch hook for the mapped type\n\t\tif ( special.postDispatch ) {\n\t\t\tspecial.postDispatch.call( this, event );\n\t\t}\n\n\t\treturn event.result;\n\t},\n\n\thandlers: function( event, handlers ) {\n\t\tvar i, handleObj, sel, matchedHandlers, matchedSelectors,\n\t\t\thandlerQueue = [],\n\t\t\tdelegateCount = handlers.delegateCount,\n\t\t\tcur = event.target;\n\n\t\t// Find delegate handlers\n\t\tif ( delegateCount &&\n\n\t\t\t// Support: IE <=9\n\t\t\t// Black-hole SVG <use> instance trees (trac-13180)\n\t\t\tcur.nodeType &&\n\n\t\t\t// Support: Firefox <=42\n\t\t\t// Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)\n\t\t\t// https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click\n\t\t\t// Support: IE 11 only\n\t\t\t// ...but not arrow key \"clicks\" of radio inputs, which can have `button` -1 (gh-2343)\n\t\t\t!( event.type === \"click\" && event.button >= 1 ) ) {\n\n\t\t\tfor ( ; cur !== this; cur = cur.parentNode || this ) {\n\n\t\t\t\t// Don't check non-elements (#13208)\n\t\t\t\t// Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)\n\t\t\t\tif ( cur.nodeType === 1 && !( event.type === \"click\" && cur.disabled === true ) ) {\n\t\t\t\t\tmatchedHandlers = [];\n\t\t\t\t\tmatchedSelectors = {};\n\t\t\t\t\tfor ( i = 0; i < delegateCount; i++ ) {\n\t\t\t\t\t\thandleObj = handlers[ i ];\n\n\t\t\t\t\t\t// Don't conflict with Object.prototype properties (#13203)\n\t\t\t\t\t\tsel = handleObj.selector + \" \";\n\n\t\t\t\t\t\tif ( matchedSelectors[ sel ] === undefined ) {\n\t\t\t\t\t\t\tmatchedSelectors[ sel ] = handleObj.needsContext ?\n\t\t\t\t\t\t\t\tjQuery( sel, this ).index( cur ) > -1 :\n\t\t\t\t\t\t\t\tjQuery.find( sel, this, null, [ cur ] ).length;\n\t\t\t\t\t\t}\n\t\t\t\t\t\tif ( matchedSelectors[ sel ] ) {\n\t\t\t\t\t\t\tmatchedHandlers.push( handleObj );\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\tif ( matchedHandlers.length ) {\n\t\t\t\t\t\thandlerQueue.push( { elem: cur, handlers: matchedHandlers } );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// Add the remaining (directly-bound) handlers\n\t\tcur = this;\n\t\tif ( delegateCount < handlers.length ) {\n\t\t\thandlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } );\n\t\t}\n\n\t\treturn handlerQueue;\n\t},\n\n\taddProp: function( name, hook ) {\n\t\tObject.defineProperty( jQuery.Event.prototype, name, {\n\t\t\tenumerable: true,\n\t\t\tconfigurable: true,\n\n\t\t\tget: isFunction( hook ) ?\n\t\t\t\tfunction() {\n\t\t\t\t\tif ( this.originalEvent ) {\n\t\t\t\t\t\t\treturn hook( this.originalEvent );\n\t\t\t\t\t}\n\t\t\t\t} :\n\t\t\t\tfunction() {\n\t\t\t\t\tif ( this.originalEvent ) {\n\t\t\t\t\t\t\treturn this.originalEvent[ name ];\n\t\t\t\t\t}\n\t\t\t\t},\n\n\t\t\tset: function( value ) {\n\t\t\t\tObject.defineProperty( this, name, {\n\t\t\t\t\tenumerable: true,\n\t\t\t\t\tconfigurable: true,\n\t\t\t\t\twritable: true,\n\t\t\t\t\tvalue: value\n\t\t\t\t} );\n\t\t\t}\n\t\t} );\n\t},\n\n\tfix: function( originalEvent ) {\n\t\treturn originalEvent[ jQuery.expando ] ?\n\t\t\toriginalEvent :\n\t\t\tnew jQuery.Event( originalEvent );\n\t},\n\n\tspecial: {\n\t\tload: {\n\n\t\t\t// Prevent triggered image.load events from bubbling to window.load\n\t\t\tnoBubble: true\n\t\t},\n\t\tfocus: {\n\n\t\t\t// Fire native event if possible so blur/focus sequence is correct\n\t\t\ttrigger: function() {\n\t\t\t\tif ( this !== safeActiveElement() && this.focus ) {\n\t\t\t\t\tthis.focus();\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t},\n\t\t\tdelegateType: \"focusin\"\n\t\t},\n\t\tblur: {\n\t\t\ttrigger: function() {\n\t\t\t\tif ( this === safeActiveElement() && this.blur ) {\n\t\t\t\t\tthis.blur();\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t},\n\t\t\tdelegateType: \"focusout\"\n\t\t},\n\t\tclick: {\n\n\t\t\t// For checkbox, fire native event so checked state will be right\n\t\t\ttrigger: function() {\n\t\t\t\tif ( this.type === \"checkbox\" && this.click && nodeName( this, \"input\" ) ) {\n\t\t\t\t\tthis.click();\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\t\t\t},\n\n\t\t\t// For cross-browser consistency, don't fire native .click() on links\n\t\t\t_default: function( event ) {\n\t\t\t\treturn nodeName( event.target, \"a\" );\n\t\t\t}\n\t\t},\n\n\t\tbeforeunload: {\n\t\t\tpostDispatch: function( event ) {\n\n\t\t\t\t// Support: Firefox 20+\n\t\t\t\t// Firefox doesn't alert if the returnValue field is not set.\n\t\t\t\tif ( event.result !== undefined && event.originalEvent ) {\n\t\t\t\t\tevent.originalEvent.returnValue = event.result;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n};\n\njQuery.removeEvent = function( elem, type, handle ) {\n\n\t// This \"if\" is needed for plain objects\n\tif ( elem.removeEventListener ) {\n\t\telem.removeEventListener( type, handle );\n\t}\n};\n\njQuery.Event = function( src, props ) {\n\n\t// Allow instantiation without the 'new' keyword\n\tif ( !( this instanceof jQuery.Event ) ) {\n\t\treturn new jQuery.Event( src, props );\n\t}\n\n\t// Event object\n\tif ( src && src.type ) {\n\t\tthis.originalEvent = src;\n\t\tthis.type = src.type;\n\n\t\t// Events bubbling up the document may have been marked as prevented\n\t\t// by a handler lower down the tree; reflect the correct value.\n\t\tthis.isDefaultPrevented = src.defaultPrevented ||\n\t\t\t\tsrc.defaultPrevented === undefined &&\n\n\t\t\t\t// Support: Android <=2.3 only\n\t\t\t\tsrc.returnValue === false ?\n\t\t\treturnTrue :\n\t\t\treturnFalse;\n\n\t\t// Create target properties\n\t\t// Support: Safari <=6 - 7 only\n\t\t// Target should not be a text node (#504, #13143)\n\t\tthis.target = ( src.target && src.target.nodeType === 3 ) ?\n\t\t\tsrc.target.parentNode :\n\t\t\tsrc.target;\n\n\t\tthis.currentTarget = src.currentTarget;\n\t\tthis.relatedTarget = src.relatedTarget;\n\n\t// Event type\n\t} else {\n\t\tthis.type = src;\n\t}\n\n\t// Put explicitly provided properties onto the event object\n\tif ( props ) {\n\t\tjQuery.extend( this, props );\n\t}\n\n\t// Create a timestamp if incoming event doesn't have one\n\tthis.timeStamp = src && src.timeStamp || Date.now();\n\n\t// Mark it as fixed\n\tthis[ jQuery.expando ] = true;\n};\n\n// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding\n// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html\njQuery.Event.prototype = {\n\tconstructor: jQuery.Event,\n\tisDefaultPrevented: returnFalse,\n\tisPropagationStopped: returnFalse,\n\tisImmediatePropagationStopped: returnFalse,\n\tisSimulated: false,\n\n\tpreventDefault: function() {\n\t\tvar e = this.originalEvent;\n\n\t\tthis.isDefaultPrevented = returnTrue;\n\n\t\tif ( e && !this.isSimulated ) {\n\t\t\te.preventDefault();\n\t\t}\n\t},\n\tstopPropagation: function() {\n\t\tvar e = this.originalEvent;\n\n\t\tthis.isPropagationStopped = returnTrue;\n\n\t\tif ( e && !this.isSimulated ) {\n\t\t\te.stopPropagation();\n\t\t}\n\t},\n\tstopImmediatePropagation: function() {\n\t\tvar e = this.originalEvent;\n\n\t\tthis.isImmediatePropagationStopped = returnTrue;\n\n\t\tif ( e && !this.isSimulated ) {\n\t\t\te.stopImmediatePropagation();\n\t\t}\n\n\t\tthis.stopPropagation();\n\t}\n};\n\n// Includes all common event props including KeyEvent and MouseEvent specific props\njQuery.each( {\n\taltKey: true,\n\tbubbles: true,\n\tcancelable: true,\n\tchangedTouches: true,\n\tctrlKey: true,\n\tdetail: true,\n\teventPhase: true,\n\tmetaKey: true,\n\tpageX: true,\n\tpageY: true,\n\tshiftKey: true,\n\tview: true,\n\t\"char\": true,\n\tcharCode: true,\n\tkey: true,\n\tkeyCode: true,\n\tbutton: true,\n\tbuttons: true,\n\tclientX: true,\n\tclientY: true,\n\toffsetX: true,\n\toffsetY: true,\n\tpointerId: true,\n\tpointerType: true,\n\tscreenX: true,\n\tscreenY: true,\n\ttargetTouches: true,\n\ttoElement: true,\n\ttouches: true,\n\n\twhich: function( event ) {\n\t\tvar button = event.button;\n\n\t\t// Add which for key events\n\t\tif ( event.which == null && rkeyEvent.test( event.type ) ) {\n\t\t\treturn event.charCode != null ? event.charCode : event.keyCode;\n\t\t}\n\n\t\t// Add which for click: 1 === left; 2 === middle; 3 === right\n\t\tif ( !event.which && button !== undefined && rmouseEvent.test( event.type ) ) {\n\t\t\tif ( button & 1 ) {\n\t\t\t\treturn 1;\n\t\t\t}\n\n\t\t\tif ( button & 2 ) {\n\t\t\t\treturn 3;\n\t\t\t}\n\n\t\t\tif ( button & 4 ) {\n\t\t\t\treturn 2;\n\t\t\t}\n\n\t\t\treturn 0;\n\t\t}\n\n\t\treturn event.which;\n\t}\n}, jQuery.event.addProp );\n\n// Create mouseenter/leave events using mouseover/out and event-time checks\n// so that event delegation works in jQuery.\n// Do the same for pointerenter/pointerleave and pointerover/pointerout\n//\n// Support: Safari 7 only\n// Safari sends mouseenter too often; see:\n// https://bugs.chromium.org/p/chromium/issues/detail?id=470258\n// for the description of the bug (it existed in older Chrome versions as well).\njQuery.each( {\n\tmouseenter: \"mouseover\",\n\tmouseleave: \"mouseout\",\n\tpointerenter: \"pointerover\",\n\tpointerleave: \"pointerout\"\n}, function( orig, fix ) {\n\tjQuery.event.special[ orig ] = {\n\t\tdelegateType: fix,\n\t\tbindType: fix,\n\n\t\thandle: function( event ) {\n\t\t\tvar ret,\n\t\t\t\ttarget = this,\n\t\t\t\trelated = event.relatedTarget,\n\t\t\t\thandleObj = event.handleObj;\n\n\t\t\t// For mouseenter/leave call the handler if related is outside the target.\n\t\t\t// NB: No relatedTarget if the mouse left/entered the browser window\n\t\t\tif ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) {\n\t\t\t\tevent.type = handleObj.origType;\n\t\t\t\tret = handleObj.handler.apply( this, arguments );\n\t\t\t\tevent.type = fix;\n\t\t\t}\n\t\t\treturn ret;\n\t\t}\n\t};\n} );\n\njQuery.fn.extend( {\n\n\ton: function( types, selector, data, fn ) {\n\t\treturn on( this, types, selector, data, fn );\n\t},\n\tone: function( types, selector, data, fn ) {\n\t\treturn on( this, types, selector, data, fn, 1 );\n\t},\n\toff: function( types, selector, fn ) {\n\t\tvar handleObj, type;\n\t\tif ( types && types.preventDefault && types.handleObj ) {\n\n\t\t\t// ( event ) dispatched jQuery.Event\n\t\t\thandleObj = types.handleObj;\n\t\t\tjQuery( types.delegateTarget ).off(\n\t\t\t\thandleObj.namespace ?\n\t\t\t\t\thandleObj.origType + \".\" + handleObj.namespace :\n\t\t\t\t\thandleObj.origType,\n\t\t\t\thandleObj.selector,\n\t\t\t\thandleObj.handler\n\t\t\t);\n\t\t\treturn this;\n\t\t}\n\t\tif ( typeof types === \"object\" ) {\n\n\t\t\t// ( types-object [, selector] )\n\t\t\tfor ( type in types ) {\n\t\t\t\tthis.off( type, selector, types[ type ] );\n\t\t\t}\n\t\t\treturn this;\n\t\t}\n\t\tif ( selector === false || typeof selector === \"function\" ) {\n\n\t\t\t// ( types [, fn] )\n\t\t\tfn = selector;\n\t\t\tselector = undefined;\n\t\t}\n\t\tif ( fn === false ) {\n\t\t\tfn = returnFalse;\n\t\t}\n\t\treturn this.each( function() {\n\t\t\tjQuery.event.remove( this, types, fn, selector );\n\t\t} );\n\t}\n} );\n\n\nvar\n\n\t/* eslint-disable max-len */\n\n\t// See https://github.com/eslint/eslint/issues/3229\n\trxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\\/\\0>\\x20\\t\\r\\n\\f]*)[^>]*)\\/>/gi,\n\n\t/* eslint-enable */\n\n\t// Support: IE <=10 - 11, Edge 12 - 13 only\n\t// In IE/Edge using regex groups here causes severe slowdowns.\n\t// See https://connect.microsoft.com/IE/feedback/details/1736512/\n\trnoInnerhtml = /<script|<style|<link/i,\n\n\t// checked=\"checked\" or checked\n\trchecked = /checked\\s*(?:[^=]|=\\s*.checked.)/i,\n\trcleanScript = /^\\s*<!(?:\\[CDATA\\[|--)|(?:\\]\\]|--)>\\s*$/g;\n\n// Prefer a tbody over its parent table for containing new rows\nfunction manipulationTarget( elem, content ) {\n\tif ( nodeName( elem, \"table\" ) &&\n\t\tnodeName( content.nodeType !== 11 ? content : content.firstChild, \"tr\" ) ) {\n\n\t\treturn jQuery( elem ).children( \"tbody\" )[ 0 ] || elem;\n\t}\n\n\treturn elem;\n}\n\n// Replace/restore the type attribute of script elements for safe DOM manipulation\nfunction disableScript( elem ) {\n\telem.type = ( elem.getAttribute( \"type\" ) !== null ) + \"/\" + elem.type;\n\treturn elem;\n}\nfunction restoreScript( elem ) {\n\tif ( ( elem.type || \"\" ).slice( 0, 5 ) === \"true/\" ) {\n\t\telem.type = elem.type.slice( 5 );\n\t} else {\n\t\telem.removeAttribute( \"type\" );\n\t}\n\n\treturn elem;\n}\n\nfunction cloneCopyEvent( src, dest ) {\n\tvar i, l, type, pdataOld, pdataCur, udataOld, udataCur, events;\n\n\tif ( dest.nodeType !== 1 ) {\n\t\treturn;\n\t}\n\n\t// 1. Copy private data: events, handlers, etc.\n\tif ( dataPriv.hasData( src ) ) {\n\t\tpdataOld = dataPriv.access( src );\n\t\tpdataCur = dataPriv.set( dest, pdataOld );\n\t\tevents = pdataOld.events;\n\n\t\tif ( events ) {\n\t\t\tdelete pdataCur.handle;\n\t\t\tpdataCur.events = {};\n\n\t\t\tfor ( type in events ) {\n\t\t\t\tfor ( i = 0, l = events[ type ].length; i < l; i++ ) {\n\t\t\t\t\tjQuery.event.add( dest, type, events[ type ][ i ] );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\t// 2. Copy user data\n\tif ( dataUser.hasData( src ) ) {\n\t\tudataOld = dataUser.access( src );\n\t\tudataCur = jQuery.extend( {}, udataOld );\n\n\t\tdataUser.set( dest, udataCur );\n\t}\n}\n\n// Fix IE bugs, see support tests\nfunction fixInput( src, dest ) {\n\tvar nodeName = dest.nodeName.toLowerCase();\n\n\t// Fails to persist the checked state of a cloned checkbox or radio button.\n\tif ( nodeName === \"input\" && rcheckableType.test( src.type ) ) {\n\t\tdest.checked = src.checked;\n\n\t// Fails to return the selected option to the default selected state when cloning options\n\t} else if ( nodeName === \"input\" || nodeName === \"textarea\" ) {\n\t\tdest.defaultValue = src.defaultValue;\n\t}\n}\n\nfunction domManip( collection, args, callback, ignored ) {\n\n\t// Flatten any nested arrays\n\targs = concat.apply( [], args );\n\n\tvar fragment, first, scripts, hasScripts, node, doc,\n\t\ti = 0,\n\t\tl = collection.length,\n\t\tiNoClone = l - 1,\n\t\tvalue = args[ 0 ],\n\t\tvalueIsFunction = isFunction( value );\n\n\t// We can't cloneNode fragments that contain checked, in WebKit\n\tif ( valueIsFunction ||\n\t\t\t( l > 1 && typeof value === \"string\" &&\n\t\t\t\t!support.checkClone && rchecked.test( value ) ) ) {\n\t\treturn collection.each( function( index ) {\n\t\t\tvar self = collection.eq( index );\n\t\t\tif ( valueIsFunction ) {\n\t\t\t\targs[ 0 ] = value.call( this, index, self.html() );\n\t\t\t}\n\t\t\tdomManip( self, args, callback, ignored );\n\t\t} );\n\t}\n\n\tif ( l ) {\n\t\tfragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored );\n\t\tfirst = fragment.firstChild;\n\n\t\tif ( fragment.childNodes.length === 1 ) {\n\t\t\tfragment = first;\n\t\t}\n\n\t\t// Require either new content or an interest in ignored elements to invoke the callback\n\t\tif ( first || ignored ) {\n\t\t\tscripts = jQuery.map( getAll( fragment, \"script\" ), disableScript );\n\t\t\thasScripts = scripts.length;\n\n\t\t\t// Use the original fragment for the last item\n\t\t\t// instead of the first because it can end up\n\t\t\t// being emptied incorrectly in certain situations (#8070).\n\t\t\tfor ( ; i < l; i++ ) {\n\t\t\t\tnode = fragment;\n\n\t\t\t\tif ( i !== iNoClone ) {\n\t\t\t\t\tnode = jQuery.clone( node, true, true );\n\n\t\t\t\t\t// Keep references to cloned scripts for later restoration\n\t\t\t\t\tif ( hasScripts ) {\n\n\t\t\t\t\t\t// Support: Android <=4.0 only, PhantomJS 1 only\n\t\t\t\t\t\t// push.apply(_, arraylike) throws on ancient WebKit\n\t\t\t\t\t\tjQuery.merge( scripts, getAll( node, \"script\" ) );\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\tcallback.call( collection[ i ], node, i );\n\t\t\t}\n\n\t\t\tif ( hasScripts ) {\n\t\t\t\tdoc = scripts[ scripts.length - 1 ].ownerDocument;\n\n\t\t\t\t// Reenable scripts\n\t\t\t\tjQuery.map( scripts, restoreScript );\n\n\t\t\t\t// Evaluate executable scripts on first document insertion\n\t\t\t\tfor ( i = 0; i < hasScripts; i++ ) {\n\t\t\t\t\tnode = scripts[ i ];\n\t\t\t\t\tif ( rscriptType.test( node.type || \"\" ) &&\n\t\t\t\t\t\t!dataPriv.access( node, \"globalEval\" ) &&\n\t\t\t\t\t\tjQuery.contains( doc, node ) ) {\n\n\t\t\t\t\t\tif ( node.src && ( node.type || \"\" ).toLowerCase() !== \"module\" ) {\n\n\t\t\t\t\t\t\t// Optional AJAX dependency, but won't run scripts if not present\n\t\t\t\t\t\t\tif ( jQuery._evalUrl ) {\n\t\t\t\t\t\t\t\tjQuery._evalUrl( node.src );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\tDOMEval( node.textContent.replace( rcleanScript, \"\" ), doc, node );\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\treturn collection;\n}\n\nfunction remove( elem, selector, keepData ) {\n\tvar node,\n\t\tnodes = selector ? jQuery.filter( selector, elem ) : elem,\n\t\ti = 0;\n\n\tfor ( ; ( node = nodes[ i ] ) != null; i++ ) {\n\t\tif ( !keepData && node.nodeType === 1 ) {\n\t\t\tjQuery.cleanData( getAll( node ) );\n\t\t}\n\n\t\tif ( node.parentNode ) {\n\t\t\tif ( keepData && jQuery.contains( node.ownerDocument, node ) ) {\n\t\t\t\tsetGlobalEval( getAll( node, \"script\" ) );\n\t\t\t}\n\t\t\tnode.parentNode.removeChild( node );\n\t\t}\n\t}\n\n\treturn elem;\n}\n\njQuery.extend( {\n\thtmlPrefilter: function( html ) {\n\t\treturn html.replace( rxhtmlTag, \"<$1></$2>\" );\n\t},\n\n\tclone: function( elem, dataAndEvents, deepDataAndEvents ) {\n\t\tvar i, l, srcElements, destElements,\n\t\t\tclone = elem.cloneNode( true ),\n\t\t\tinPage = jQuery.contains( elem.ownerDocument, elem );\n\n\t\t// Fix IE cloning issues\n\t\tif ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) &&\n\t\t\t\t!jQuery.isXMLDoc( elem ) ) {\n\n\t\t\t// We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2\n\t\t\tdestElements = getAll( clone );\n\t\t\tsrcElements = getAll( elem );\n\n\t\t\tfor ( i = 0, l = srcElements.length; i < l; i++ ) {\n\t\t\t\tfixInput( srcElements[ i ], destElements[ i ] );\n\t\t\t}\n\t\t}\n\n\t\t// Copy the events from the original to the clone\n\t\tif ( dataAndEvents ) {\n\t\t\tif ( deepDataAndEvents ) {\n\t\t\t\tsrcElements = srcElements || getAll( elem );\n\t\t\t\tdestElements = destElements || getAll( clone );\n\n\t\t\t\tfor ( i = 0, l = srcElements.length; i < l; i++ ) {\n\t\t\t\t\tcloneCopyEvent( srcElements[ i ], destElements[ i ] );\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tcloneCopyEvent( elem, clone );\n\t\t\t}\n\t\t}\n\n\t\t// Preserve script evaluation history\n\t\tdestElements = getAll( clone, \"script\" );\n\t\tif ( destElements.length > 0 ) {\n\t\t\tsetGlobalEval( destElements, !inPage && getAll( elem, \"script\" ) );\n\t\t}\n\n\t\t// Return the cloned set\n\t\treturn clone;\n\t},\n\n\tcleanData: function( elems ) {\n\t\tvar data, elem, type,\n\t\t\tspecial = jQuery.event.special,\n\t\t\ti = 0;\n\n\t\tfor ( ; ( elem = elems[ i ] ) !== undefined; i++ ) {\n\t\t\tif ( acceptData( elem ) ) {\n\t\t\t\tif ( ( data = elem[ dataPriv.expando ] ) ) {\n\t\t\t\t\tif ( data.events ) {\n\t\t\t\t\t\tfor ( type in data.events ) {\n\t\t\t\t\t\t\tif ( special[ type ] ) {\n\t\t\t\t\t\t\t\tjQuery.event.remove( elem, type );\n\n\t\t\t\t\t\t\t// This is a shortcut to avoid jQuery.event.remove's overhead\n\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\tjQuery.removeEvent( elem, type, data.handle );\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\t// Support: Chrome <=35 - 45+\n\t\t\t\t\t// Assign undefined instead of using delete, see Data#remove\n\t\t\t\t\telem[ dataPriv.expando ] = undefined;\n\t\t\t\t}\n\t\t\t\tif ( elem[ dataUser.expando ] ) {\n\n\t\t\t\t\t// Support: Chrome <=35 - 45+\n\t\t\t\t\t// Assign undefined instead of using delete, see Data#remove\n\t\t\t\t\telem[ dataUser.expando ] = undefined;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n} );\n\njQuery.fn.extend( {\n\tdetach: function( selector ) {\n\t\treturn remove( this, selector, true );\n\t},\n\n\tremove: function( selector ) {\n\t\treturn remove( this, selector );\n\t},\n\n\ttext: function( value ) {\n\t\treturn access( this, function( value ) {\n\t\t\treturn value === undefined ?\n\t\t\t\tjQuery.text( this ) :\n\t\t\t\tthis.empty().each( function() {\n\t\t\t\t\tif ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {\n\t\t\t\t\t\tthis.textContent = value;\n\t\t\t\t\t}\n\t\t\t\t} );\n\t\t}, null, value, arguments.length );\n\t},\n\n\tappend: function() {\n\t\treturn domManip( this, arguments, function( elem ) {\n\t\t\tif ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {\n\t\t\t\tvar target = manipulationTarget( this, elem );\n\t\t\t\ttarget.appendChild( elem );\n\t\t\t}\n\t\t} );\n\t},\n\n\tprepend: function() {\n\t\treturn domManip( this, arguments, function( elem ) {\n\t\t\tif ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {\n\t\t\t\tvar target = manipulationTarget( this, elem );\n\t\t\t\ttarget.insertBefore( elem, target.firstChild );\n\t\t\t}\n\t\t} );\n\t},\n\n\tbefore: function() {\n\t\treturn domManip( this, arguments, function( elem ) {\n\t\t\tif ( this.parentNode ) {\n\t\t\t\tthis.parentNode.insertBefore( elem, this );\n\t\t\t}\n\t\t} );\n\t},\n\n\tafter: function() {\n\t\treturn domManip( this, arguments, function( elem ) {\n\t\t\tif ( this.parentNode ) {\n\t\t\t\tthis.parentNode.insertBefore( elem, this.nextSibling );\n\t\t\t}\n\t\t} );\n\t},\n\n\tempty: function() {\n\t\tvar elem,\n\t\t\ti = 0;\n\n\t\tfor ( ; ( elem = this[ i ] ) != null; i++ ) {\n\t\t\tif ( elem.nodeType === 1 ) {\n\n\t\t\t\t// Prevent memory leaks\n\t\t\t\tjQuery.cleanData( getAll( elem, false ) );\n\n\t\t\t\t// Remove any remaining nodes\n\t\t\t\telem.textContent = \"\";\n\t\t\t}\n\t\t}\n\n\t\treturn this;\n\t},\n\n\tclone: function( dataAndEvents, deepDataAndEvents ) {\n\t\tdataAndEvents = dataAndEvents == null ? false : dataAndEvents;\n\t\tdeepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;\n\n\t\treturn this.map( function() {\n\t\t\treturn jQuery.clone( this, dataAndEvents, deepDataAndEvents );\n\t\t} );\n\t},\n\n\thtml: function( value ) {\n\t\treturn access( this, function( value ) {\n\t\t\tvar elem = this[ 0 ] || {},\n\t\t\t\ti = 0,\n\t\t\t\tl = this.length;\n\n\t\t\tif ( value === undefined && elem.nodeType === 1 ) {\n\t\t\t\treturn elem.innerHTML;\n\t\t\t}\n\n\t\t\t// See if we can take a shortcut and just use innerHTML\n\t\t\tif ( typeof value === \"string\" && !rnoInnerhtml.test( value ) &&\n\t\t\t\t!wrapMap[ ( rtagName.exec( value ) || [ \"\", \"\" ] )[ 1 ].toLowerCase() ] ) {\n\n\t\t\t\tvalue = jQuery.htmlPrefilter( value );\n\n\t\t\t\ttry {\n\t\t\t\t\tfor ( ; i < l; i++ ) {\n\t\t\t\t\t\telem = this[ i ] || {};\n\n\t\t\t\t\t\t// Remove element nodes and prevent memory leaks\n\t\t\t\t\t\tif ( elem.nodeType === 1 ) {\n\t\t\t\t\t\t\tjQuery.cleanData( getAll( elem, false ) );\n\t\t\t\t\t\t\telem.innerHTML = value;\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\telem = 0;\n\n\t\t\t\t// If using innerHTML throws an exception, use the fallback method\n\t\t\t\t} catch ( e ) {}\n\t\t\t}\n\n\t\t\tif ( elem ) {\n\t\t\t\tthis.empty().append( value );\n\t\t\t}\n\t\t}, null, value, arguments.length );\n\t},\n\n\treplaceWith: function() {\n\t\tvar ignored = [];\n\n\t\t// Make the changes, replacing each non-ignored context element with the new content\n\t\treturn domManip( this, arguments, function( elem ) {\n\t\t\tvar parent = this.parentNode;\n\n\t\t\tif ( jQuery.inArray( this, ignored ) < 0 ) {\n\t\t\t\tjQuery.cleanData( getAll( this ) );\n\t\t\t\tif ( parent ) {\n\t\t\t\t\tparent.replaceChild( elem, this );\n\t\t\t\t}\n\t\t\t}\n\n\t\t// Force callback invocation\n\t\t}, ignored );\n\t}\n} );\n\njQuery.each( {\n\tappendTo: \"append\",\n\tprependTo: \"prepend\",\n\tinsertBefore: \"before\",\n\tinsertAfter: \"after\",\n\treplaceAll: \"replaceWith\"\n}, function( name, original ) {\n\tjQuery.fn[ name ] = function( selector ) {\n\t\tvar elems,\n\t\t\tret = [],\n\t\t\tinsert = jQuery( selector ),\n\t\t\tlast = insert.length - 1,\n\t\t\ti = 0;\n\n\t\tfor ( ; i <= last; i++ ) {\n\t\t\telems = i === last ? this : this.clone( true );\n\t\t\tjQuery( insert[ i ] )[ original ]( elems );\n\n\t\t\t// Support: Android <=4.0 only, PhantomJS 1 only\n\t\t\t// .get() because push.apply(_, arraylike) throws on ancient WebKit\n\t\t\tpush.apply( ret, elems.get() );\n\t\t}\n\n\t\treturn this.pushStack( ret );\n\t};\n} );\nvar rnumnonpx = new RegExp( \"^(\" + pnum + \")(?!px)[a-z%]+$\", \"i\" );\n\nvar getStyles = function( elem ) {\n\n\t\t// Support: IE <=11 only, Firefox <=30 (#15098, #14150)\n\t\t// IE throws on elements created in popups\n\t\t// FF meanwhile throws on frame elements through \"defaultView.getComputedStyle\"\n\t\tvar view = elem.ownerDocument.defaultView;\n\n\t\tif ( !view || !view.opener ) {\n\t\t\tview = window;\n\t\t}\n\n\t\treturn view.getComputedStyle( elem );\n\t};\n\nvar rboxStyle = new RegExp( cssExpand.join( \"|\" ), \"i\" );\n\n\n\n( function() {\n\n\t// Executing both pixelPosition & boxSizingReliable tests require only one layout\n\t// so they're executed at the same time to save the second computation.\n\tfunction computeStyleTests() {\n\n\t\t// This is a singleton, we need to execute it only once\n\t\tif ( !div ) {\n\t\t\treturn;\n\t\t}\n\n\t\tcontainer.style.cssText = \"position:absolute;left:-11111px;width:60px;\" +\n\t\t\t\"margin-top:1px;padding:0;border:0\";\n\t\tdiv.style.cssText =\n\t\t\t\"position:relative;display:block;box-sizing:border-box;overflow:scroll;\" +\n\t\t\t\"margin:auto;border:1px;padding:1px;\" +\n\t\t\t\"width:60%;top:1%\";\n\t\tdocumentElement.appendChild( container ).appendChild( div );\n\n\t\tvar divStyle = window.getComputedStyle( div );\n\t\tpixelPositionVal = divStyle.top !== \"1%\";\n\n\t\t// Support: Android 4.0 - 4.3 only, Firefox <=3 - 44\n\t\treliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12;\n\n\t\t// Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3\n\t\t// Some styles come back with percentage values, even though they shouldn't\n\t\tdiv.style.right = \"60%\";\n\t\tpixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36;\n\n\t\t// Support: IE 9 - 11 only\n\t\t// Detect misreporting of content dimensions for box-sizing:border-box elements\n\t\tboxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36;\n\n\t\t// Support: IE 9 only\n\t\t// Detect overflow:scroll screwiness (gh-3699)\n\t\tdiv.style.position = \"absolute\";\n\t\tscrollboxSizeVal = div.offsetWidth === 36 || \"absolute\";\n\n\t\tdocumentElement.removeChild( container );\n\n\t\t// Nullify the div so it wouldn't be stored in the memory and\n\t\t// it will also be a sign that checks already performed\n\t\tdiv = null;\n\t}\n\n\tfunction roundPixelMeasures( measure ) {\n\t\treturn Math.round( parseFloat( measure ) );\n\t}\n\n\tvar pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal,\n\t\treliableMarginLeftVal,\n\t\tcontainer = document.createElement( \"div\" ),\n\t\tdiv = document.createElement( \"div\" );\n\n\t// Finish early in limited (non-browser) environments\n\tif ( !div.style ) {\n\t\treturn;\n\t}\n\n\t// Support: IE <=9 - 11 only\n\t// Style of cloned element affects source element cloned (#8908)\n\tdiv.style.backgroundClip = \"content-box\";\n\tdiv.cloneNode( true ).style.backgroundClip = \"\";\n\tsupport.clearCloneStyle = div.style.backgroundClip === \"content-box\";\n\n\tjQuery.extend( support, {\n\t\tboxSizingReliable: function() {\n\t\t\tcomputeStyleTests();\n\t\t\treturn boxSizingReliableVal;\n\t\t},\n\t\tpixelBoxStyles: function() {\n\t\t\tcomputeStyleTests();\n\t\t\treturn pixelBoxStylesVal;\n\t\t},\n\t\tpixelPosition: function() {\n\t\t\tcomputeStyleTests();\n\t\t\treturn pixelPositionVal;\n\t\t},\n\t\treliableMarginLeft: function() {\n\t\t\tcomputeStyleTests();\n\t\t\treturn reliableMarginLeftVal;\n\t\t},\n\t\tscrollboxSize: function() {\n\t\t\tcomputeStyleTests();\n\t\t\treturn scrollboxSizeVal;\n\t\t}\n\t} );\n} )();\n\n\nfunction curCSS( elem, name, computed ) {\n\tvar width, minWidth, maxWidth, ret,\n\n\t\t// Support: Firefox 51+\n\t\t// Retrieving style before computed somehow\n\t\t// fixes an issue with getting wrong values\n\t\t// on detached elements\n\t\tstyle = elem.style;\n\n\tcomputed = computed || getStyles( elem );\n\n\t// getPropertyValue is needed for:\n\t// .css('filter') (IE 9 only, #12537)\n\t// .css('--customProperty) (#3144)\n\tif ( computed ) {\n\t\tret = computed.getPropertyValue( name ) || computed[ name ];\n\n\t\tif ( ret === \"\" && !jQuery.contains( elem.ownerDocument, elem ) ) {\n\t\t\tret = jQuery.style( elem, name );\n\t\t}\n\n\t\t// A tribute to the \"awesome hack by Dean Edwards\"\n\t\t// Android Browser returns percentage for some values,\n\t\t// but width seems to be reliably pixels.\n\t\t// This is against the CSSOM draft spec:\n\t\t// https://drafts.csswg.org/cssom/#resolved-values\n\t\tif ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) {\n\n\t\t\t// Remember the original values\n\t\t\twidth = style.width;\n\t\t\tminWidth = style.minWidth;\n\t\t\tmaxWidth = style.maxWidth;\n\n\t\t\t// Put in the new values to get a computed value out\n\t\t\tstyle.minWidth = style.maxWidth = style.width = ret;\n\t\t\tret = computed.width;\n\n\t\t\t// Revert the changed values\n\t\t\tstyle.width = width;\n\t\t\tstyle.minWidth = minWidth;\n\t\t\tstyle.maxWidth = maxWidth;\n\t\t}\n\t}\n\n\treturn ret !== undefined ?\n\n\t\t// Support: IE <=9 - 11 only\n\t\t// IE returns zIndex value as an integer.\n\t\tret + \"\" :\n\t\tret;\n}\n\n\nfunction addGetHookIf( conditionFn, hookFn ) {\n\n\t// Define the hook, we'll check on the first run if it's really needed.\n\treturn {\n\t\tget: function() {\n\t\t\tif ( conditionFn() ) {\n\n\t\t\t\t// Hook not needed (or it's not possible to use it due\n\t\t\t\t// to missing dependency), remove it.\n\t\t\t\tdelete this.get;\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\t// Hook needed; redefine it so that the support test is not executed again.\n\t\t\treturn ( this.get = hookFn ).apply( this, arguments );\n\t\t}\n\t};\n}\n\n\nvar\n\n\t// Swappable if display is none or starts with table\n\t// except \"table\", \"table-cell\", or \"table-caption\"\n\t// See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display\n\trdisplayswap = /^(none|table(?!-c[ea]).+)/,\n\trcustomProp = /^--/,\n\tcssShow = { position: \"absolute\", visibility: \"hidden\", display: \"block\" },\n\tcssNormalTransform = {\n\t\tletterSpacing: \"0\",\n\t\tfontWeight: \"400\"\n\t},\n\n\tcssPrefixes = [ \"Webkit\", \"Moz\", \"ms\" ],\n\temptyStyle = document.createElement( \"div\" ).style;\n\n// Return a css property mapped to a potentially vendor prefixed property\nfunction vendorPropName( name ) {\n\n\t// Shortcut for names that are not vendor prefixed\n\tif ( name in emptyStyle ) {\n\t\treturn name;\n\t}\n\n\t// Check for vendor prefixed names\n\tvar capName = name[ 0 ].toUpperCase() + name.slice( 1 ),\n\t\ti = cssPrefixes.length;\n\n\twhile ( i-- ) {\n\t\tname = cssPrefixes[ i ] + capName;\n\t\tif ( name in emptyStyle ) {\n\t\t\treturn name;\n\t\t}\n\t}\n}\n\n// Return a property mapped along what jQuery.cssProps suggests or to\n// a vendor prefixed property.\nfunction finalPropName( name ) {\n\tvar ret = jQuery.cssProps[ name ];\n\tif ( !ret ) {\n\t\tret = jQuery.cssProps[ name ] = vendorPropName( name ) || name;\n\t}\n\treturn ret;\n}\n\nfunction setPositiveNumber( elem, value, subtract ) {\n\n\t// Any relative (+/-) values have already been\n\t// normalized at this point\n\tvar matches = rcssNum.exec( value );\n\treturn matches ?\n\n\t\t// Guard against undefined \"subtract\", e.g., when used as in cssHooks\n\t\tMath.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || \"px\" ) :\n\t\tvalue;\n}\n\nfunction boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) {\n\tvar i = dimension === \"width\" ? 1 : 0,\n\t\textra = 0,\n\t\tdelta = 0;\n\n\t// Adjustment may not be necessary\n\tif ( box === ( isBorderBox ? \"border\" : \"content\" ) ) {\n\t\treturn 0;\n\t}\n\n\tfor ( ; i < 4; i += 2 ) {\n\n\t\t// Both box models exclude margin\n\t\tif ( box === \"margin\" ) {\n\t\t\tdelta += jQuery.css( elem, box + cssExpand[ i ], true, styles );\n\t\t}\n\n\t\t// If we get here with a content-box, we're seeking \"padding\" or \"border\" or \"margin\"\n\t\tif ( !isBorderBox ) {\n\n\t\t\t// Add padding\n\t\t\tdelta += jQuery.css( elem, \"padding\" + cssExpand[ i ], true, styles );\n\n\t\t\t// For \"border\" or \"margin\", add border\n\t\t\tif ( box !== \"padding\" ) {\n\t\t\t\tdelta += jQuery.css( elem, \"border\" + cssExpand[ i ] + \"Width\", true, styles );\n\n\t\t\t// But still keep track of it otherwise\n\t\t\t} else {\n\t\t\t\textra += jQuery.css( elem, \"border\" + cssExpand[ i ] + \"Width\", true, styles );\n\t\t\t}\n\n\t\t// If we get here with a border-box (content + padding + border), we're seeking \"content\" or\n\t\t// \"padding\" or \"margin\"\n\t\t} else {\n\n\t\t\t// For \"content\", subtract padding\n\t\t\tif ( box === \"content\" ) {\n\t\t\t\tdelta -= jQuery.css( elem, \"padding\" + cssExpand[ i ], true, styles );\n\t\t\t}\n\n\t\t\t// For \"content\" or \"padding\", subtract border\n\t\t\tif ( box !== \"margin\" ) {\n\t\t\t\tdelta -= jQuery.css( elem, \"border\" + cssExpand[ i ] + \"Width\", true, styles );\n\t\t\t}\n\t\t}\n\t}\n\n\t// Account for positive content-box scroll gutter when requested by providing computedVal\n\tif ( !isBorderBox && computedVal >= 0 ) {\n\n\t\t// offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border\n\t\t// Assuming integer scroll gutter, subtract the rest and round down\n\t\tdelta += Math.max( 0, Math.ceil(\n\t\t\telem[ \"offset\" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] -\n\t\t\tcomputedVal -\n\t\t\tdelta -\n\t\t\textra -\n\t\t\t0.5\n\t\t) );\n\t}\n\n\treturn delta;\n}\n\nfunction getWidthOrHeight( elem, dimension, extra ) {\n\n\t// Start with computed style\n\tvar styles = getStyles( elem ),\n\t\tval = curCSS( elem, dimension, styles ),\n\t\tisBorderBox = jQuery.css( elem, \"boxSizing\", false, styles ) === \"border-box\",\n\t\tvalueIsBorderBox = isBorderBox;\n\n\t// Support: Firefox <=54\n\t// Return a confounding non-pixel value or feign ignorance, as appropriate.\n\tif ( rnumnonpx.test( val ) ) {\n\t\tif ( !extra ) {\n\t\t\treturn val;\n\t\t}\n\t\tval = \"auto\";\n\t}\n\n\t// Check for style in case a browser which returns unreliable values\n\t// for getComputedStyle silently falls back to the reliable elem.style\n\tvalueIsBorderBox = valueIsBorderBox &&\n\t\t( support.boxSizingReliable() || val === elem.style[ dimension ] );\n\n\t// Fall back to offsetWidth/offsetHeight when value is \"auto\"\n\t// This happens for inline elements with no explicit setting (gh-3571)\n\t// Support: Android <=4.1 - 4.3 only\n\t// Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602)\n\tif ( val === \"auto\" ||\n\t\t!parseFloat( val ) && jQuery.css( elem, \"display\", false, styles ) === \"inline\" ) {\n\n\t\tval = elem[ \"offset\" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ];\n\n\t\t// offsetWidth/offsetHeight provide border-box values\n\t\tvalueIsBorderBox = true;\n\t}\n\n\t// Normalize \"\" and auto\n\tval = parseFloat( val ) || 0;\n\n\t// Adjust for the element's box model\n\treturn ( val +\n\t\tboxModelAdjustment(\n\t\t\telem,\n\t\t\tdimension,\n\t\t\textra || ( isBorderBox ? \"border\" : \"content\" ),\n\t\t\tvalueIsBorderBox,\n\t\t\tstyles,\n\n\t\t\t// Provide the current computed size to request scroll gutter calculation (gh-3589)\n\t\t\tval\n\t\t)\n\t) + \"px\";\n}\n\njQuery.extend( {\n\n\t// Add in style property hooks for overriding the default\n\t// behavior of getting and setting a style property\n\tcssHooks: {\n\t\topacity: {\n\t\t\tget: function( elem, computed ) {\n\t\t\t\tif ( computed ) {\n\n\t\t\t\t\t// We should always get a number back from opacity\n\t\t\t\t\tvar ret = curCSS( elem, \"opacity\" );\n\t\t\t\t\treturn ret === \"\" ? \"1\" : ret;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t},\n\n\t// Don't automatically add \"px\" to these possibly-unitless properties\n\tcssNumber: {\n\t\t\"animationIterationCount\": true,\n\t\t\"columnCount\": true,\n\t\t\"fillOpacity\": true,\n\t\t\"flexGrow\": true,\n\t\t\"flexShrink\": true,\n\t\t\"fontWeight\": true,\n\t\t\"lineHeight\": true,\n\t\t\"opacity\": true,\n\t\t\"order\": true,\n\t\t\"orphans\": true,\n\t\t\"widows\": true,\n\t\t\"zIndex\": true,\n\t\t\"zoom\": true\n\t},\n\n\t// Add in properties whose names you wish to fix before\n\t// setting or getting the value\n\tcssProps: {},\n\n\t// Get and set the style property on a DOM Node\n\tstyle: function( elem, name, value, extra ) {\n\n\t\t// Don't set styles on text and comment nodes\n\t\tif ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Make sure that we're working with the right name\n\t\tvar ret, type, hooks,\n\t\t\torigName = camelCase( name ),\n\t\t\tisCustomProp = rcustomProp.test( name ),\n\t\t\tstyle = elem.style;\n\n\t\t// Make sure that we're working with the right name. We don't\n\t\t// want to query the value if it is a CSS custom property\n\t\t// since they are user-defined.\n\t\tif ( !isCustomProp ) {\n\t\t\tname = finalPropName( origName );\n\t\t}\n\n\t\t// Gets hook for the prefixed version, then unprefixed version\n\t\thooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];\n\n\t\t// Check if we're setting a value\n\t\tif ( value !== undefined ) {\n\t\t\ttype = typeof value;\n\n\t\t\t// Convert \"+=\" or \"-=\" to relative numbers (#7345)\n\t\t\tif ( type === \"string\" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) {\n\t\t\t\tvalue = adjustCSS( elem, name, ret );\n\n\t\t\t\t// Fixes bug #9237\n\t\t\t\ttype = \"number\";\n\t\t\t}\n\n\t\t\t// Make sure that null and NaN values aren't set (#7116)\n\t\t\tif ( value == null || value !== value ) {\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\t// If a number was passed in, add the unit (except for certain CSS properties)\n\t\t\tif ( type === \"number\" ) {\n\t\t\t\tvalue += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? \"\" : \"px\" );\n\t\t\t}\n\n\t\t\t// background-* props affect original clone's values\n\t\t\tif ( !support.clearCloneStyle && value === \"\" && name.indexOf( \"background\" ) === 0 ) {\n\t\t\t\tstyle[ name ] = \"inherit\";\n\t\t\t}\n\n\t\t\t// If a hook was provided, use that value, otherwise just set the specified value\n\t\t\tif ( !hooks || !( \"set\" in hooks ) ||\n\t\t\t\t( value = hooks.set( elem, value, extra ) ) !== undefined ) {\n\n\t\t\t\tif ( isCustomProp ) {\n\t\t\t\t\tstyle.setProperty( name, value );\n\t\t\t\t} else {\n\t\t\t\t\tstyle[ name ] = value;\n\t\t\t\t}\n\t\t\t}\n\n\t\t} else {\n\n\t\t\t// If a hook was provided get the non-computed value from there\n\t\t\tif ( hooks && \"get\" in hooks &&\n\t\t\t\t( ret = hooks.get( elem, false, extra ) ) !== undefined ) {\n\n\t\t\t\treturn ret;\n\t\t\t}\n\n\t\t\t// Otherwise just get the value from the style object\n\t\t\treturn style[ name ];\n\t\t}\n\t},\n\n\tcss: function( elem, name, extra, styles ) {\n\t\tvar val, num, hooks,\n\t\t\torigName = camelCase( name ),\n\t\t\tisCustomProp = rcustomProp.test( name );\n\n\t\t// Make sure that we're working with the right name. We don't\n\t\t// want to modify the value if it is a CSS custom property\n\t\t// since they are user-defined.\n\t\tif ( !isCustomProp ) {\n\t\t\tname = finalPropName( origName );\n\t\t}\n\n\t\t// Try prefixed name followed by the unprefixed name\n\t\thooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];\n\n\t\t// If a hook was provided get the computed value from there\n\t\tif ( hooks && \"get\" in hooks ) {\n\t\t\tval = hooks.get( elem, true, extra );\n\t\t}\n\n\t\t// Otherwise, if a way to get the computed value exists, use that\n\t\tif ( val === undefined ) {\n\t\t\tval = curCSS( elem, name, styles );\n\t\t}\n\n\t\t// Convert \"normal\" to computed value\n\t\tif ( val === \"normal\" && name in cssNormalTransform ) {\n\t\t\tval = cssNormalTransform[ name ];\n\t\t}\n\n\t\t// Make numeric if forced or a qualifier was provided and val looks numeric\n\t\tif ( extra === \"\" || extra ) {\n\t\t\tnum = parseFloat( val );\n\t\t\treturn extra === true || isFinite( num ) ? num || 0 : val;\n\t\t}\n\n\t\treturn val;\n\t}\n} );\n\njQuery.each( [ \"height\", \"width\" ], function( i, dimension ) {\n\tjQuery.cssHooks[ dimension ] = {\n\t\tget: function( elem, computed, extra ) {\n\t\t\tif ( computed ) {\n\n\t\t\t\t// Certain elements can have dimension info if we invisibly show them\n\t\t\t\t// but it must have a current display style that would benefit\n\t\t\t\treturn rdisplayswap.test( jQuery.css( elem, \"display\" ) ) &&\n\n\t\t\t\t\t// Support: Safari 8+\n\t\t\t\t\t// Table columns in Safari have non-zero offsetWidth & zero\n\t\t\t\t\t// getBoundingClientRect().width unless display is changed.\n\t\t\t\t\t// Support: IE <=11 only\n\t\t\t\t\t// Running getBoundingClientRect on a disconnected node\n\t\t\t\t\t// in IE throws an error.\n\t\t\t\t\t( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ?\n\t\t\t\t\t\tswap( elem, cssShow, function() {\n\t\t\t\t\t\t\treturn getWidthOrHeight( elem, dimension, extra );\n\t\t\t\t\t\t} ) :\n\t\t\t\t\t\tgetWidthOrHeight( elem, dimension, extra );\n\t\t\t}\n\t\t},\n\n\t\tset: function( elem, value, extra ) {\n\t\t\tvar matches,\n\t\t\t\tstyles = getStyles( elem ),\n\t\t\t\tisBorderBox = jQuery.css( elem, \"boxSizing\", false, styles ) === \"border-box\",\n\t\t\t\tsubtract = extra && boxModelAdjustment(\n\t\t\t\t\telem,\n\t\t\t\t\tdimension,\n\t\t\t\t\textra,\n\t\t\t\t\tisBorderBox,\n\t\t\t\t\tstyles\n\t\t\t\t);\n\n\t\t\t// Account for unreliable border-box dimensions by comparing offset* to computed and\n\t\t\t// faking a content-box to get border and padding (gh-3699)\n\t\t\tif ( isBorderBox && support.scrollboxSize() === styles.position ) {\n\t\t\t\tsubtract -= Math.ceil(\n\t\t\t\t\telem[ \"offset\" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] -\n\t\t\t\t\tparseFloat( styles[ dimension ] ) -\n\t\t\t\t\tboxModelAdjustment( elem, dimension, \"border\", false, styles ) -\n\t\t\t\t\t0.5\n\t\t\t\t);\n\t\t\t}\n\n\t\t\t// Convert to pixels if value adjustment is needed\n\t\t\tif ( subtract && ( matches = rcssNum.exec( value ) ) &&\n\t\t\t\t( matches[ 3 ] || \"px\" ) !== \"px\" ) {\n\n\t\t\t\telem.style[ dimension ] = value;\n\t\t\t\tvalue = jQuery.css( elem, dimension );\n\t\t\t}\n\n\t\t\treturn setPositiveNumber( elem, value, subtract );\n\t\t}\n\t};\n} );\n\njQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft,\n\tfunction( elem, computed ) {\n\t\tif ( computed ) {\n\t\t\treturn ( parseFloat( curCSS( elem, \"marginLeft\" ) ) ||\n\t\t\t\telem.getBoundingClientRect().left -\n\t\t\t\t\tswap( elem, { marginLeft: 0 }, function() {\n\t\t\t\t\t\treturn elem.getBoundingClientRect().left;\n\t\t\t\t\t} )\n\t\t\t\t) + \"px\";\n\t\t}\n\t}\n);\n\n// These hooks are used by animate to expand properties\njQuery.each( {\n\tmargin: \"\",\n\tpadding: \"\",\n\tborder: \"Width\"\n}, function( prefix, suffix ) {\n\tjQuery.cssHooks[ prefix + suffix ] = {\n\t\texpand: function( value ) {\n\t\t\tvar i = 0,\n\t\t\t\texpanded = {},\n\n\t\t\t\t// Assumes a single number if not a string\n\t\t\t\tparts = typeof value === \"string\" ? value.split( \" \" ) : [ value ];\n\n\t\t\tfor ( ; i < 4; i++ ) {\n\t\t\t\texpanded[ prefix + cssExpand[ i ] + suffix ] =\n\t\t\t\t\tparts[ i ] || parts[ i - 2 ] || parts[ 0 ];\n\t\t\t}\n\n\t\t\treturn expanded;\n\t\t}\n\t};\n\n\tif ( prefix !== \"margin\" ) {\n\t\tjQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;\n\t}\n} );\n\njQuery.fn.extend( {\n\tcss: function( name, value ) {\n\t\treturn access( this, function( elem, name, value ) {\n\t\t\tvar styles, len,\n\t\t\t\tmap = {},\n\t\t\t\ti = 0;\n\n\t\t\tif ( Array.isArray( name ) ) {\n\t\t\t\tstyles = getStyles( elem );\n\t\t\t\tlen = name.length;\n\n\t\t\t\tfor ( ; i < len; i++ ) {\n\t\t\t\t\tmap[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );\n\t\t\t\t}\n\n\t\t\t\treturn map;\n\t\t\t}\n\n\t\t\treturn value !== undefined ?\n\t\t\t\tjQuery.style( elem, name, value ) :\n\t\t\t\tjQuery.css( elem, name );\n\t\t}, name, value, arguments.length > 1 );\n\t}\n} );\n\n\nfunction Tween( elem, options, prop, end, easing ) {\n\treturn new Tween.prototype.init( elem, options, prop, end, easing );\n}\njQuery.Tween = Tween;\n\nTween.prototype = {\n\tconstructor: Tween,\n\tinit: function( elem, options, prop, end, easing, unit ) {\n\t\tthis.elem = elem;\n\t\tthis.prop = prop;\n\t\tthis.easing = easing || jQuery.easing._default;\n\t\tthis.options = options;\n\t\tthis.start = this.now = this.cur();\n\t\tthis.end = end;\n\t\tthis.unit = unit || ( jQuery.cssNumber[ prop ] ? \"\" : \"px\" );\n\t},\n\tcur: function() {\n\t\tvar hooks = Tween.propHooks[ this.prop ];\n\n\t\treturn hooks && hooks.get ?\n\t\t\thooks.get( this ) :\n\t\t\tTween.propHooks._default.get( this );\n\t},\n\trun: function( percent ) {\n\t\tvar eased,\n\t\t\thooks = Tween.propHooks[ this.prop ];\n\n\t\tif ( this.options.duration ) {\n\t\t\tthis.pos = eased = jQuery.easing[ this.easing ](\n\t\t\t\tpercent, this.options.duration * percent, 0, 1, this.options.duration\n\t\t\t);\n\t\t} else {\n\t\t\tthis.pos = eased = percent;\n\t\t}\n\t\tthis.now = ( this.end - this.start ) * eased + this.start;\n\n\t\tif ( this.options.step ) {\n\t\t\tthis.options.step.call( this.elem, this.now, this );\n\t\t}\n\n\t\tif ( hooks && hooks.set ) {\n\t\t\thooks.set( this );\n\t\t} else {\n\t\t\tTween.propHooks._default.set( this );\n\t\t}\n\t\treturn this;\n\t}\n};\n\nTween.prototype.init.prototype = Tween.prototype;\n\nTween.propHooks = {\n\t_default: {\n\t\tget: function( tween ) {\n\t\t\tvar result;\n\n\t\t\t// Use a property on the element directly when it is not a DOM element,\n\t\t\t// or when there is no matching style property that exists.\n\t\t\tif ( tween.elem.nodeType !== 1 ||\n\t\t\t\ttween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) {\n\t\t\t\treturn tween.elem[ tween.prop ];\n\t\t\t}\n\n\t\t\t// Passing an empty string as a 3rd parameter to .css will automatically\n\t\t\t// attempt a parseFloat and fallback to a string if the parse fails.\n\t\t\t// Simple values such as \"10px\" are parsed to Float;\n\t\t\t// complex values such as \"rotate(1rad)\" are returned as-is.\n\t\t\tresult = jQuery.css( tween.elem, tween.prop, \"\" );\n\n\t\t\t// Empty strings, null, undefined and \"auto\" are converted to 0.\n\t\t\treturn !result || result === \"auto\" ? 0 : result;\n\t\t},\n\t\tset: function( tween ) {\n\n\t\t\t// Use step hook for back compat.\n\t\t\t// Use cssHook if its there.\n\t\t\t// Use .style if available and use plain properties where available.\n\t\t\tif ( jQuery.fx.step[ tween.prop ] ) {\n\t\t\t\tjQuery.fx.step[ tween.prop ]( tween );\n\t\t\t} else if ( tween.elem.nodeType === 1 &&\n\t\t\t\t( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null ||\n\t\t\t\t\tjQuery.cssHooks[ tween.prop ] ) ) {\n\t\t\t\tjQuery.style( tween.elem, tween.prop, tween.now + tween.unit );\n\t\t\t} else {\n\t\t\t\ttween.elem[ tween.prop ] = tween.now;\n\t\t\t}\n\t\t}\n\t}\n};\n\n// Support: IE <=9 only\n// Panic based approach to setting things on disconnected nodes\nTween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {\n\tset: function( tween ) {\n\t\tif ( tween.elem.nodeType && tween.elem.parentNode ) {\n\t\t\ttween.elem[ tween.prop ] = tween.now;\n\t\t}\n\t}\n};\n\njQuery.easing = {\n\tlinear: function( p ) {\n\t\treturn p;\n\t},\n\tswing: function( p ) {\n\t\treturn 0.5 - Math.cos( p * Math.PI ) / 2;\n\t},\n\t_default: \"swing\"\n};\n\njQuery.fx = Tween.prototype.init;\n\n// Back compat <1.8 extension point\njQuery.fx.step = {};\n\n\n\n\nvar\n\tfxNow, inProgress,\n\trfxtypes = /^(?:toggle|show|hide)$/,\n\trrun = /queueHooks$/;\n\nfunction schedule() {\n\tif ( inProgress ) {\n\t\tif ( document.hidden === false && window.requestAnimationFrame ) {\n\t\t\twindow.requestAnimationFrame( schedule );\n\t\t} else {\n\t\t\twindow.setTimeout( schedule, jQuery.fx.interval );\n\t\t}\n\n\t\tjQuery.fx.tick();\n\t}\n}\n\n// Animations created synchronously will run synchronously\nfunction createFxNow() {\n\twindow.setTimeout( function() {\n\t\tfxNow = undefined;\n\t} );\n\treturn ( fxNow = Date.now() );\n}\n\n// Generate parameters to create a standard animation\nfunction genFx( type, includeWidth ) {\n\tvar which,\n\t\ti = 0,\n\t\tattrs = { height: type };\n\n\t// If we include width, step value is 1 to do all cssExpand values,\n\t// otherwise step value is 2 to skip over Left and Right\n\tincludeWidth = includeWidth ? 1 : 0;\n\tfor ( ; i < 4; i += 2 - includeWidth ) {\n\t\twhich = cssExpand[ i ];\n\t\tattrs[ \"margin\" + which ] = attrs[ \"padding\" + which ] = type;\n\t}\n\n\tif ( includeWidth ) {\n\t\tattrs.opacity = attrs.width = type;\n\t}\n\n\treturn attrs;\n}\n\nfunction createTween( value, prop, animation ) {\n\tvar tween,\n\t\tcollection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ \"*\" ] ),\n\t\tindex = 0,\n\t\tlength = collection.length;\n\tfor ( ; index < length; index++ ) {\n\t\tif ( ( tween = collection[ index ].call( animation, prop, value ) ) ) {\n\n\t\t\t// We're done with this property\n\t\t\treturn tween;\n\t\t}\n\t}\n}\n\nfunction defaultPrefilter( elem, props, opts ) {\n\tvar prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display,\n\t\tisBox = \"width\" in props || \"height\" in props,\n\t\tanim = this,\n\t\torig = {},\n\t\tstyle = elem.style,\n\t\thidden = elem.nodeType && isHiddenWithinTree( elem ),\n\t\tdataShow = dataPriv.get( elem, \"fxshow\" );\n\n\t// Queue-skipping animations hijack the fx hooks\n\tif ( !opts.queue ) {\n\t\thooks = jQuery._queueHooks( elem, \"fx\" );\n\t\tif ( hooks.unqueued == null ) {\n\t\t\thooks.unqueued = 0;\n\t\t\toldfire = hooks.empty.fire;\n\t\t\thooks.empty.fire = function() {\n\t\t\t\tif ( !hooks.unqueued ) {\n\t\t\t\t\toldfire();\n\t\t\t\t}\n\t\t\t};\n\t\t}\n\t\thooks.unqueued++;\n\n\t\tanim.always( function() {\n\n\t\t\t// Ensure the complete handler is called before this completes\n\t\t\tanim.always( function() {\n\t\t\t\thooks.unqueued--;\n\t\t\t\tif ( !jQuery.queue( elem, \"fx\" ).length ) {\n\t\t\t\t\thooks.empty.fire();\n\t\t\t\t}\n\t\t\t} );\n\t\t} );\n\t}\n\n\t// Detect show/hide animations\n\tfor ( prop in props ) {\n\t\tvalue = props[ prop ];\n\t\tif ( rfxtypes.test( value ) ) {\n\t\t\tdelete props[ prop ];\n\t\t\ttoggle = toggle || value === \"toggle\";\n\t\t\tif ( value === ( hidden ? \"hide\" : \"show\" ) ) {\n\n\t\t\t\t// Pretend to be hidden if this is a \"show\" and\n\t\t\t\t// there is still data from a stopped show/hide\n\t\t\t\tif ( value === \"show\" && dataShow && dataShow[ prop ] !== undefined ) {\n\t\t\t\t\thidden = true;\n\n\t\t\t\t// Ignore all other no-op show/hide data\n\t\t\t\t} else {\n\t\t\t\t\tcontinue;\n\t\t\t\t}\n\t\t\t}\n\t\t\torig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop );\n\t\t}\n\t}\n\n\t// Bail out if this is a no-op like .hide().hide()\n\tpropTween = !jQuery.isEmptyObject( props );\n\tif ( !propTween && jQuery.isEmptyObject( orig ) ) {\n\t\treturn;\n\t}\n\n\t// Restrict \"overflow\" and \"display\" styles during box animations\n\tif ( isBox && elem.nodeType === 1 ) {\n\n\t\t// Support: IE <=9 - 11, Edge 12 - 15\n\t\t// Record all 3 overflow attributes because IE does not infer the shorthand\n\t\t// from identically-valued overflowX and overflowY and Edge just mirrors\n\t\t// the overflowX value there.\n\t\topts.overflow = [ style.overflow, style.overflowX, style.overflowY ];\n\n\t\t// Identify a display type, preferring old show/hide data over the CSS cascade\n\t\trestoreDisplay = dataShow && dataShow.display;\n\t\tif ( restoreDisplay == null ) {\n\t\t\trestoreDisplay = dataPriv.get( elem, \"display\" );\n\t\t}\n\t\tdisplay = jQuery.css( elem, \"display\" );\n\t\tif ( display === \"none\" ) {\n\t\t\tif ( restoreDisplay ) {\n\t\t\t\tdisplay = restoreDisplay;\n\t\t\t} else {\n\n\t\t\t\t// Get nonempty value(s) by temporarily forcing visibility\n\t\t\t\tshowHide( [ elem ], true );\n\t\t\t\trestoreDisplay = elem.style.display || restoreDisplay;\n\t\t\t\tdisplay = jQuery.css( elem, \"display\" );\n\t\t\t\tshowHide( [ elem ] );\n\t\t\t}\n\t\t}\n\n\t\t// Animate inline elements as inline-block\n\t\tif ( display === \"inline\" || display === \"inline-block\" && restoreDisplay != null ) {\n\t\t\tif ( jQuery.css( elem, \"float\" ) === \"none\" ) {\n\n\t\t\t\t// Restore the original display value at the end of pure show/hide animations\n\t\t\t\tif ( !propTween ) {\n\t\t\t\t\tanim.done( function() {\n\t\t\t\t\t\tstyle.display = restoreDisplay;\n\t\t\t\t\t} );\n\t\t\t\t\tif ( restoreDisplay == null ) {\n\t\t\t\t\t\tdisplay = style.display;\n\t\t\t\t\t\trestoreDisplay = display === \"none\" ? \"\" : display;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t\tstyle.display = \"inline-block\";\n\t\t\t}\n\t\t}\n\t}\n\n\tif ( opts.overflow ) {\n\t\tstyle.overflow = \"hidden\";\n\t\tanim.always( function() {\n\t\t\tstyle.overflow = opts.overflow[ 0 ];\n\t\t\tstyle.overflowX = opts.overflow[ 1 ];\n\t\t\tstyle.overflowY = opts.overflow[ 2 ];\n\t\t} );\n\t}\n\n\t// Implement show/hide animations\n\tpropTween = false;\n\tfor ( prop in orig ) {\n\n\t\t// General show/hide setup for this element animation\n\t\tif ( !propTween ) {\n\t\t\tif ( dataShow ) {\n\t\t\t\tif ( \"hidden\" in dataShow ) {\n\t\t\t\t\thidden = dataShow.hidden;\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tdataShow = dataPriv.access( elem, \"fxshow\", { display: restoreDisplay } );\n\t\t\t}\n\n\t\t\t// Store hidden/visible for toggle so `.stop().toggle()` \"reverses\"\n\t\t\tif ( toggle ) {\n\t\t\t\tdataShow.hidden = !hidden;\n\t\t\t}\n\n\t\t\t// Show elements before animating them\n\t\t\tif ( hidden ) {\n\t\t\t\tshowHide( [ elem ], true );\n\t\t\t}\n\n\t\t\t/* eslint-disable no-loop-func */\n\n\t\t\tanim.done( function() {\n\n\t\t\t/* eslint-enable no-loop-func */\n\n\t\t\t\t// The final step of a \"hide\" animation is actually hiding the element\n\t\t\t\tif ( !hidden ) {\n\t\t\t\t\tshowHide( [ elem ] );\n\t\t\t\t}\n\t\t\t\tdataPriv.remove( elem, \"fxshow\" );\n\t\t\t\tfor ( prop in orig ) {\n\t\t\t\t\tjQuery.style( elem, prop, orig[ prop ] );\n\t\t\t\t}\n\t\t\t} );\n\t\t}\n\n\t\t// Per-property setup\n\t\tpropTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim );\n\t\tif ( !( prop in dataShow ) ) {\n\t\t\tdataShow[ prop ] = propTween.start;\n\t\t\tif ( hidden ) {\n\t\t\t\tpropTween.end = propTween.start;\n\t\t\t\tpropTween.start = 0;\n\t\t\t}\n\t\t}\n\t}\n}\n\nfunction propFilter( props, specialEasing ) {\n\tvar index, name, easing, value, hooks;\n\n\t// camelCase, specialEasing and expand cssHook pass\n\tfor ( index in props ) {\n\t\tname = camelCase( index );\n\t\teasing = specialEasing[ name ];\n\t\tvalue = props[ index ];\n\t\tif ( Array.isArray( value ) ) {\n\t\t\teasing = value[ 1 ];\n\t\t\tvalue = props[ index ] = value[ 0 ];\n\t\t}\n\n\t\tif ( index !== name ) {\n\t\t\tprops[ name ] = value;\n\t\t\tdelete props[ index ];\n\t\t}\n\n\t\thooks = jQuery.cssHooks[ name ];\n\t\tif ( hooks && \"expand\" in hooks ) {\n\t\t\tvalue = hooks.expand( value );\n\t\t\tdelete props[ name ];\n\n\t\t\t// Not quite $.extend, this won't overwrite existing keys.\n\t\t\t// Reusing 'index' because we have the correct \"name\"\n\t\t\tfor ( index in value ) {\n\t\t\t\tif ( !( index in props ) ) {\n\t\t\t\t\tprops[ index ] = value[ index ];\n\t\t\t\t\tspecialEasing[ index ] = easing;\n\t\t\t\t}\n\t\t\t}\n\t\t} else {\n\t\t\tspecialEasing[ name ] = easing;\n\t\t}\n\t}\n}\n\nfunction Animation( elem, properties, options ) {\n\tvar result,\n\t\tstopped,\n\t\tindex = 0,\n\t\tlength = Animation.prefilters.length,\n\t\tdeferred = jQuery.Deferred().always( function() {\n\n\t\t\t// Don't match elem in the :animated selector\n\t\t\tdelete tick.elem;\n\t\t} ),\n\t\ttick = function() {\n\t\t\tif ( stopped ) {\n\t\t\t\treturn false;\n\t\t\t}\n\t\t\tvar currentTime = fxNow || createFxNow(),\n\t\t\t\tremaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),\n\n\t\t\t\t// Support: Android 2.3 only\n\t\t\t\t// Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497)\n\t\t\t\ttemp = remaining / animation.duration || 0,\n\t\t\t\tpercent = 1 - temp,\n\t\t\t\tindex = 0,\n\t\t\t\tlength = animation.tweens.length;\n\n\t\t\tfor ( ; index < length; index++ ) {\n\t\t\t\tanimation.tweens[ index ].run( percent );\n\t\t\t}\n\n\t\t\tdeferred.notifyWith( elem, [ animation, percent, remaining ] );\n\n\t\t\t// If there's more to do, yield\n\t\t\tif ( percent < 1 && length ) {\n\t\t\t\treturn remaining;\n\t\t\t}\n\n\t\t\t// If this was an empty animation, synthesize a final progress notification\n\t\t\tif ( !length ) {\n\t\t\t\tdeferred.notifyWith( elem, [ animation, 1, 0 ] );\n\t\t\t}\n\n\t\t\t// Resolve the animation and report its conclusion\n\t\t\tdeferred.resolveWith( elem, [ animation ] );\n\t\t\treturn false;\n\t\t},\n\t\tanimation = deferred.promise( {\n\t\t\telem: elem,\n\t\t\tprops: jQuery.extend( {}, properties ),\n\t\t\topts: jQuery.extend( true, {\n\t\t\t\tspecialEasing: {},\n\t\t\t\teasing: jQuery.easing._default\n\t\t\t}, options ),\n\t\t\toriginalProperties: properties,\n\t\t\toriginalOptions: options,\n\t\t\tstartTime: fxNow || createFxNow(),\n\t\t\tduration: options.duration,\n\t\t\ttweens: [],\n\t\t\tcreateTween: function( prop, end ) {\n\t\t\t\tvar tween = jQuery.Tween( elem, animation.opts, prop, end,\n\t\t\t\t\t\tanimation.opts.specialEasing[ prop ] || animation.opts.easing );\n\t\t\t\tanimation.tweens.push( tween );\n\t\t\t\treturn tween;\n\t\t\t},\n\t\t\tstop: function( gotoEnd ) {\n\t\t\t\tvar index = 0,\n\n\t\t\t\t\t// If we are going to the end, we want to run all the tweens\n\t\t\t\t\t// otherwise we skip this part\n\t\t\t\t\tlength = gotoEnd ? animation.tweens.length : 0;\n\t\t\t\tif ( stopped ) {\n\t\t\t\t\treturn this;\n\t\t\t\t}\n\t\t\t\tstopped = true;\n\t\t\t\tfor ( ; index < length; index++ ) {\n\t\t\t\t\tanimation.tweens[ index ].run( 1 );\n\t\t\t\t}\n\n\t\t\t\t// Resolve when we played the last frame; otherwise, reject\n\t\t\t\tif ( gotoEnd ) {\n\t\t\t\t\tdeferred.notifyWith( elem, [ animation, 1, 0 ] );\n\t\t\t\t\tdeferred.resolveWith( elem, [ animation, gotoEnd ] );\n\t\t\t\t} else {\n\t\t\t\t\tdeferred.rejectWith( elem, [ animation, gotoEnd ] );\n\t\t\t\t}\n\t\t\t\treturn this;\n\t\t\t}\n\t\t} ),\n\t\tprops = animation.props;\n\n\tpropFilter( props, animation.opts.specialEasing );\n\n\tfor ( ; index < length; index++ ) {\n\t\tresult = Animation.prefilters[ index ].call( animation, elem, props, animation.opts );\n\t\tif ( result ) {\n\t\t\tif ( isFunction( result.stop ) ) {\n\t\t\t\tjQuery._queueHooks( animation.elem, animation.opts.queue ).stop =\n\t\t\t\t\tresult.stop.bind( result );\n\t\t\t}\n\t\t\treturn result;\n\t\t}\n\t}\n\n\tjQuery.map( props, createTween, animation );\n\n\tif ( isFunction( animation.opts.start ) ) {\n\t\tanimation.opts.start.call( elem, animation );\n\t}\n\n\t// Attach callbacks from options\n\tanimation\n\t\t.progress( animation.opts.progress )\n\t\t.done( animation.opts.done, animation.opts.complete )\n\t\t.fail( animation.opts.fail )\n\t\t.always( animation.opts.always );\n\n\tjQuery.fx.timer(\n\t\tjQuery.extend( tick, {\n\t\t\telem: elem,\n\t\t\tanim: animation,\n\t\t\tqueue: animation.opts.queue\n\t\t} )\n\t);\n\n\treturn animation;\n}\n\njQuery.Animation = jQuery.extend( Animation, {\n\n\ttweeners: {\n\t\t\"*\": [ function( prop, value ) {\n\t\t\tvar tween = this.createTween( prop, value );\n\t\t\tadjustCSS( tween.elem, prop, rcssNum.exec( value ), tween );\n\t\t\treturn tween;\n\t\t} ]\n\t},\n\n\ttweener: function( props, callback ) {\n\t\tif ( isFunction( props ) ) {\n\t\t\tcallback = props;\n\t\t\tprops = [ \"*\" ];\n\t\t} else {\n\t\t\tprops = props.match( rnothtmlwhite );\n\t\t}\n\n\t\tvar prop,\n\t\t\tindex = 0,\n\t\t\tlength = props.length;\n\n\t\tfor ( ; index < length; index++ ) {\n\t\t\tprop = props[ index ];\n\t\t\tAnimation.tweeners[ prop ] = Animation.tweeners[ prop ] || [];\n\t\t\tAnimation.tweeners[ prop ].unshift( callback );\n\t\t}\n\t},\n\n\tprefilters: [ defaultPrefilter ],\n\n\tprefilter: function( callback, prepend ) {\n\t\tif ( prepend ) {\n\t\t\tAnimation.prefilters.unshift( callback );\n\t\t} else {\n\t\t\tAnimation.prefilters.push( callback );\n\t\t}\n\t}\n} );\n\njQuery.speed = function( speed, easing, fn ) {\n\tvar opt = speed && typeof speed === \"object\" ? jQuery.extend( {}, speed ) : {\n\t\tcomplete: fn || !fn && easing ||\n\t\t\tisFunction( speed ) && speed,\n\t\tduration: speed,\n\t\teasing: fn && easing || easing && !isFunction( easing ) && easing\n\t};\n\n\t// Go to the end state if fx are off\n\tif ( jQuery.fx.off ) {\n\t\topt.duration = 0;\n\n\t} else {\n\t\tif ( typeof opt.duration !== \"number\" ) {\n\t\t\tif ( opt.duration in jQuery.fx.speeds ) {\n\t\t\t\topt.duration = jQuery.fx.speeds[ opt.duration ];\n\n\t\t\t} else {\n\t\t\t\topt.duration = jQuery.fx.speeds._default;\n\t\t\t}\n\t\t}\n\t}\n\n\t// Normalize opt.queue - true/undefined/null -> \"fx\"\n\tif ( opt.queue == null || opt.queue === true ) {\n\t\topt.queue = \"fx\";\n\t}\n\n\t// Queueing\n\topt.old = opt.complete;\n\n\topt.complete = function() {\n\t\tif ( isFunction( opt.old ) ) {\n\t\t\topt.old.call( this );\n\t\t}\n\n\t\tif ( opt.queue ) {\n\t\t\tjQuery.dequeue( this, opt.queue );\n\t\t}\n\t};\n\n\treturn opt;\n};\n\njQuery.fn.extend( {\n\tfadeTo: function( speed, to, easing, callback ) {\n\n\t\t// Show any hidden elements after setting opacity to 0\n\t\treturn this.filter( isHiddenWithinTree ).css( \"opacity\", 0 ).show()\n\n\t\t\t// Animate to the value specified\n\t\t\t.end().animate( { opacity: to }, speed, easing, callback );\n\t},\n\tanimate: function( prop, speed, easing, callback ) {\n\t\tvar empty = jQuery.isEmptyObject( prop ),\n\t\t\toptall = jQuery.speed( speed, easing, callback ),\n\t\t\tdoAnimation = function() {\n\n\t\t\t\t// Operate on a copy of prop so per-property easing won't be lost\n\t\t\t\tvar anim = Animation( this, jQuery.extend( {}, prop ), optall );\n\n\t\t\t\t// Empty animations, or finishing resolves immediately\n\t\t\t\tif ( empty || dataPriv.get( this, \"finish\" ) ) {\n\t\t\t\t\tanim.stop( true );\n\t\t\t\t}\n\t\t\t};\n\t\t\tdoAnimation.finish = doAnimation;\n\n\t\treturn empty || optall.queue === false ?\n\t\t\tthis.each( doAnimation ) :\n\t\t\tthis.queue( optall.queue, doAnimation );\n\t},\n\tstop: function( type, clearQueue, gotoEnd ) {\n\t\tvar stopQueue = function( hooks ) {\n\t\t\tvar stop = hooks.stop;\n\t\t\tdelete hooks.stop;\n\t\t\tstop( gotoEnd );\n\t\t};\n\n\t\tif ( typeof type !== \"string\" ) {\n\t\t\tgotoEnd = clearQueue;\n\t\t\tclearQueue = type;\n\t\t\ttype = undefined;\n\t\t}\n\t\tif ( clearQueue && type !== false ) {\n\t\t\tthis.queue( type || \"fx\", [] );\n\t\t}\n\n\t\treturn this.each( function() {\n\t\t\tvar dequeue = true,\n\t\t\t\tindex = type != null && type + \"queueHooks\",\n\t\t\t\ttimers = jQuery.timers,\n\t\t\t\tdata = dataPriv.get( this );\n\n\t\t\tif ( index ) {\n\t\t\t\tif ( data[ index ] && data[ index ].stop ) {\n\t\t\t\t\tstopQueue( data[ index ] );\n\t\t\t\t}\n\t\t\t} else {\n\t\t\t\tfor ( index in data ) {\n\t\t\t\t\tif ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {\n\t\t\t\t\t\tstopQueue( data[ index ] );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\tfor ( index = timers.length; index--; ) {\n\t\t\t\tif ( timers[ index ].elem === this &&\n\t\t\t\t\t( type == null || timers[ index ].queue === type ) ) {\n\n\t\t\t\t\ttimers[ index ].anim.stop( gotoEnd );\n\t\t\t\t\tdequeue = false;\n\t\t\t\t\ttimers.splice( index, 1 );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Start the next in the queue if the last step wasn't forced.\n\t\t\t// Timers currently will call their complete callbacks, which\n\t\t\t// will dequeue but only if they were gotoEnd.\n\t\t\tif ( dequeue || !gotoEnd ) {\n\t\t\t\tjQuery.dequeue( this, type );\n\t\t\t}\n\t\t} );\n\t},\n\tfinish: function( type ) {\n\t\tif ( type !== false ) {\n\t\t\ttype = type || \"fx\";\n\t\t}\n\t\treturn this.each( function() {\n\t\t\tvar index,\n\t\t\t\tdata = dataPriv.get( this ),\n\t\t\t\tqueue = data[ type + \"queue\" ],\n\t\t\t\thooks = data[ type + \"queueHooks\" ],\n\t\t\t\ttimers = jQuery.timers,\n\t\t\t\tlength = queue ? queue.length : 0;\n\n\t\t\t// Enable finishing flag on private data\n\t\t\tdata.finish = true;\n\n\t\t\t// Empty the queue first\n\t\t\tjQuery.queue( this, type, [] );\n\n\t\t\tif ( hooks && hooks.stop ) {\n\t\t\t\thooks.stop.call( this, true );\n\t\t\t}\n\n\t\t\t// Look for any active animations, and finish them\n\t\t\tfor ( index = timers.length; index--; ) {\n\t\t\t\tif ( timers[ index ].elem === this && timers[ index ].queue === type ) {\n\t\t\t\t\ttimers[ index ].anim.stop( true );\n\t\t\t\t\ttimers.splice( index, 1 );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Look for any animations in the old queue and finish them\n\t\t\tfor ( index = 0; index < length; index++ ) {\n\t\t\t\tif ( queue[ index ] && queue[ index ].finish ) {\n\t\t\t\t\tqueue[ index ].finish.call( this );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Turn off finishing flag\n\t\t\tdelete data.finish;\n\t\t} );\n\t}\n} );\n\njQuery.each( [ \"toggle\", \"show\", \"hide\" ], function( i, name ) {\n\tvar cssFn = jQuery.fn[ name ];\n\tjQuery.fn[ name ] = function( speed, easing, callback ) {\n\t\treturn speed == null || typeof speed === \"boolean\" ?\n\t\t\tcssFn.apply( this, arguments ) :\n\t\t\tthis.animate( genFx( name, true ), speed, easing, callback );\n\t};\n} );\n\n// Generate shortcuts for custom animations\njQuery.each( {\n\tslideDown: genFx( \"show\" ),\n\tslideUp: genFx( \"hide\" ),\n\tslideToggle: genFx( \"toggle\" ),\n\tfadeIn: { opacity: \"show\" },\n\tfadeOut: { opacity: \"hide\" },\n\tfadeToggle: { opacity: \"toggle\" }\n}, function( name, props ) {\n\tjQuery.fn[ name ] = function( speed, easing, callback ) {\n\t\treturn this.animate( props, speed, easing, callback );\n\t};\n} );\n\njQuery.timers = [];\njQuery.fx.tick = function() {\n\tvar timer,\n\t\ti = 0,\n\t\ttimers = jQuery.timers;\n\n\tfxNow = Date.now();\n\n\tfor ( ; i < timers.length; i++ ) {\n\t\ttimer = timers[ i ];\n\n\t\t// Run the timer and safely remove it when done (allowing for external removal)\n\t\tif ( !timer() && timers[ i ] === timer ) {\n\t\t\ttimers.splice( i--, 1 );\n\t\t}\n\t}\n\n\tif ( !timers.length ) {\n\t\tjQuery.fx.stop();\n\t}\n\tfxNow = undefined;\n};\n\njQuery.fx.timer = function( timer ) {\n\tjQuery.timers.push( timer );\n\tjQuery.fx.start();\n};\n\njQuery.fx.interval = 13;\njQuery.fx.start = function() {\n\tif ( inProgress ) {\n\t\treturn;\n\t}\n\n\tinProgress = true;\n\tschedule();\n};\n\njQuery.fx.stop = function() {\n\tinProgress = null;\n};\n\njQuery.fx.speeds = {\n\tslow: 600,\n\tfast: 200,\n\n\t// Default speed\n\t_default: 400\n};\n\n\n// Based off of the plugin by Clint Helfers, with permission.\n// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/\njQuery.fn.delay = function( time, type ) {\n\ttime = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;\n\ttype = type || \"fx\";\n\n\treturn this.queue( type, function( next, hooks ) {\n\t\tvar timeout = window.setTimeout( next, time );\n\t\thooks.stop = function() {\n\t\t\twindow.clearTimeout( timeout );\n\t\t};\n\t} );\n};\n\n\n( function() {\n\tvar input = document.createElement( \"input\" ),\n\t\tselect = document.createElement( \"select\" ),\n\t\topt = select.appendChild( document.createElement( \"option\" ) );\n\n\tinput.type = \"checkbox\";\n\n\t// Support: Android <=4.3 only\n\t// Default value for a checkbox should be \"on\"\n\tsupport.checkOn = input.value !== \"\";\n\n\t// Support: IE <=11 only\n\t// Must access selectedIndex to make default options select\n\tsupport.optSelected = opt.selected;\n\n\t// Support: IE <=11 only\n\t// An input loses its value after becoming a radio\n\tinput = document.createElement( \"input\" );\n\tinput.value = \"t\";\n\tinput.type = \"radio\";\n\tsupport.radioValue = input.value === \"t\";\n} )();\n\n\nvar boolHook,\n\tattrHandle = jQuery.expr.attrHandle;\n\njQuery.fn.extend( {\n\tattr: function( name, value ) {\n\t\treturn access( this, jQuery.attr, name, value, arguments.length > 1 );\n\t},\n\n\tremoveAttr: function( name ) {\n\t\treturn this.each( function() {\n\t\t\tjQuery.removeAttr( this, name );\n\t\t} );\n\t}\n} );\n\njQuery.extend( {\n\tattr: function( elem, name, value ) {\n\t\tvar ret, hooks,\n\t\t\tnType = elem.nodeType;\n\n\t\t// Don't get/set attributes on text, comment and attribute nodes\n\t\tif ( nType === 3 || nType === 8 || nType === 2 ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Fallback to prop when attributes are not supported\n\t\tif ( typeof elem.getAttribute === \"undefined\" ) {\n\t\t\treturn jQuery.prop( elem, name, value );\n\t\t}\n\n\t\t// Attribute hooks are determined by the lowercase version\n\t\t// Grab necessary hook if one is defined\n\t\tif ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {\n\t\t\thooks = jQuery.attrHooks[ name.toLowerCase() ] ||\n\t\t\t\t( jQuery.expr.match.bool.test( name ) ? boolHook : undefined );\n\t\t}\n\n\t\tif ( value !== undefined ) {\n\t\t\tif ( value === null ) {\n\t\t\t\tjQuery.removeAttr( elem, name );\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\tif ( hooks && \"set\" in hooks &&\n\t\t\t\t( ret = hooks.set( elem, value, name ) ) !== undefined ) {\n\t\t\t\treturn ret;\n\t\t\t}\n\n\t\t\telem.setAttribute( name, value + \"\" );\n\t\t\treturn value;\n\t\t}\n\n\t\tif ( hooks && \"get\" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {\n\t\t\treturn ret;\n\t\t}\n\n\t\tret = jQuery.find.attr( elem, name );\n\n\t\t// Non-existent attributes return null, we normalize to undefined\n\t\treturn ret == null ? undefined : ret;\n\t},\n\n\tattrHooks: {\n\t\ttype: {\n\t\t\tset: function( elem, value ) {\n\t\t\t\tif ( !support.radioValue && value === \"radio\" &&\n\t\t\t\t\tnodeName( elem, \"input\" ) ) {\n\t\t\t\t\tvar val = elem.value;\n\t\t\t\t\telem.setAttribute( \"type\", value );\n\t\t\t\t\tif ( val ) {\n\t\t\t\t\t\telem.value = val;\n\t\t\t\t\t}\n\t\t\t\t\treturn value;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t},\n\n\tremoveAttr: function( elem, value ) {\n\t\tvar name,\n\t\t\ti = 0,\n\n\t\t\t// Attribute names can contain non-HTML whitespace characters\n\t\t\t// https://html.spec.whatwg.org/multipage/syntax.html#attributes-2\n\t\t\tattrNames = value && value.match( rnothtmlwhite );\n\n\t\tif ( attrNames && elem.nodeType === 1 ) {\n\t\t\twhile ( ( name = attrNames[ i++ ] ) ) {\n\t\t\t\telem.removeAttribute( name );\n\t\t\t}\n\t\t}\n\t}\n} );\n\n// Hooks for boolean attributes\nboolHook = {\n\tset: function( elem, value, name ) {\n\t\tif ( value === false ) {\n\n\t\t\t// Remove boolean attributes when set to false\n\t\t\tjQuery.removeAttr( elem, name );\n\t\t} else {\n\t\t\telem.setAttribute( name, name );\n\t\t}\n\t\treturn name;\n\t}\n};\n\njQuery.each( jQuery.expr.match.bool.source.match( /\\w+/g ), function( i, name ) {\n\tvar getter = attrHandle[ name ] || jQuery.find.attr;\n\n\tattrHandle[ name ] = function( elem, name, isXML ) {\n\t\tvar ret, handle,\n\t\t\tlowercaseName = name.toLowerCase();\n\n\t\tif ( !isXML ) {\n\n\t\t\t// Avoid an infinite loop by temporarily removing this function from the getter\n\t\t\thandle = attrHandle[ lowercaseName ];\n\t\t\tattrHandle[ lowercaseName ] = ret;\n\t\t\tret = getter( elem, name, isXML ) != null ?\n\t\t\t\tlowercaseName :\n\t\t\t\tnull;\n\t\t\tattrHandle[ lowercaseName ] = handle;\n\t\t}\n\t\treturn ret;\n\t};\n} );\n\n\n\n\nvar rfocusable = /^(?:input|select|textarea|button)$/i,\n\trclickable = /^(?:a|area)$/i;\n\njQuery.fn.extend( {\n\tprop: function( name, value ) {\n\t\treturn access( this, jQuery.prop, name, value, arguments.length > 1 );\n\t},\n\n\tremoveProp: function( name ) {\n\t\treturn this.each( function() {\n\t\t\tdelete this[ jQuery.propFix[ name ] || name ];\n\t\t} );\n\t}\n} );\n\njQuery.extend( {\n\tprop: function( elem, name, value ) {\n\t\tvar ret, hooks,\n\t\t\tnType = elem.nodeType;\n\n\t\t// Don't get/set properties on text, comment and attribute nodes\n\t\tif ( nType === 3 || nType === 8 || nType === 2 ) {\n\t\t\treturn;\n\t\t}\n\n\t\tif ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {\n\n\t\t\t// Fix name and attach hooks\n\t\t\tname = jQuery.propFix[ name ] || name;\n\t\t\thooks = jQuery.propHooks[ name ];\n\t\t}\n\n\t\tif ( value !== undefined ) {\n\t\t\tif ( hooks && \"set\" in hooks &&\n\t\t\t\t( ret = hooks.set( elem, value, name ) ) !== undefined ) {\n\t\t\t\treturn ret;\n\t\t\t}\n\n\t\t\treturn ( elem[ name ] = value );\n\t\t}\n\n\t\tif ( hooks && \"get\" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {\n\t\t\treturn ret;\n\t\t}\n\n\t\treturn elem[ name ];\n\t},\n\n\tpropHooks: {\n\t\ttabIndex: {\n\t\t\tget: function( elem ) {\n\n\t\t\t\t// Support: IE <=9 - 11 only\n\t\t\t\t// elem.tabIndex doesn't always return the\n\t\t\t\t// correct value when it hasn't been explicitly set\n\t\t\t\t// https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/\n\t\t\t\t// Use proper attribute retrieval(#12072)\n\t\t\t\tvar tabindex = jQuery.find.attr( elem, \"tabindex\" );\n\n\t\t\t\tif ( tabindex ) {\n\t\t\t\t\treturn parseInt( tabindex, 10 );\n\t\t\t\t}\n\n\t\t\t\tif (\n\t\t\t\t\trfocusable.test( elem.nodeName ) ||\n\t\t\t\t\trclickable.test( elem.nodeName ) &&\n\t\t\t\t\telem.href\n\t\t\t\t) {\n\t\t\t\t\treturn 0;\n\t\t\t\t}\n\n\t\t\t\treturn -1;\n\t\t\t}\n\t\t}\n\t},\n\n\tpropFix: {\n\t\t\"for\": \"htmlFor\",\n\t\t\"class\": \"className\"\n\t}\n} );\n\n// Support: IE <=11 only\n// Accessing the selectedIndex property\n// forces the browser to respect setting selected\n// on the option\n// The getter ensures a default option is selected\n// when in an optgroup\n// eslint rule \"no-unused-expressions\" is disabled for this code\n// since it considers such accessions noop\nif ( !support.optSelected ) {\n\tjQuery.propHooks.selected = {\n\t\tget: function( elem ) {\n\n\t\t\t/* eslint no-unused-expressions: \"off\" */\n\n\t\t\tvar parent = elem.parentNode;\n\t\t\tif ( parent && parent.parentNode ) {\n\t\t\t\tparent.parentNode.selectedIndex;\n\t\t\t}\n\t\t\treturn null;\n\t\t},\n\t\tset: function( elem ) {\n\n\t\t\t/* eslint no-unused-expressions: \"off\" */\n\n\t\t\tvar parent = elem.parentNode;\n\t\t\tif ( parent ) {\n\t\t\t\tparent.selectedIndex;\n\n\t\t\t\tif ( parent.parentNode ) {\n\t\t\t\t\tparent.parentNode.selectedIndex;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t};\n}\n\njQuery.each( [\n\t\"tabIndex\",\n\t\"readOnly\",\n\t\"maxLength\",\n\t\"cellSpacing\",\n\t\"cellPadding\",\n\t\"rowSpan\",\n\t\"colSpan\",\n\t\"useMap\",\n\t\"frameBorder\",\n\t\"contentEditable\"\n], function() {\n\tjQuery.propFix[ this.toLowerCase() ] = this;\n} );\n\n\n\n\n\t// Strip and collapse whitespace according to HTML spec\n\t// https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace\n\tfunction stripAndCollapse( value ) {\n\t\tvar tokens = value.match( rnothtmlwhite ) || [];\n\t\treturn tokens.join( \" \" );\n\t}\n\n\nfunction getClass( elem ) {\n\treturn elem.getAttribute && elem.getAttribute( \"class\" ) || \"\";\n}\n\nfunction classesToArray( value ) {\n\tif ( Array.isArray( value ) ) {\n\t\treturn value;\n\t}\n\tif ( typeof value === \"string\" ) {\n\t\treturn value.match( rnothtmlwhite ) || [];\n\t}\n\treturn [];\n}\n\njQuery.fn.extend( {\n\taddClass: function( value ) {\n\t\tvar classes, elem, cur, curValue, clazz, j, finalValue,\n\t\t\ti = 0;\n\n\t\tif ( isFunction( value ) ) {\n\t\t\treturn this.each( function( j ) {\n\t\t\t\tjQuery( this ).addClass( value.call( this, j, getClass( this ) ) );\n\t\t\t} );\n\t\t}\n\n\t\tclasses = classesToArray( value );\n\n\t\tif ( classes.length ) {\n\t\t\twhile ( ( elem = this[ i++ ] ) ) {\n\t\t\t\tcurValue = getClass( elem );\n\t\t\t\tcur = elem.nodeType === 1 && ( \" \" + stripAndCollapse( curValue ) + \" \" );\n\n\t\t\t\tif ( cur ) {\n\t\t\t\t\tj = 0;\n\t\t\t\t\twhile ( ( clazz = classes[ j++ ] ) ) {\n\t\t\t\t\t\tif ( cur.indexOf( \" \" + clazz + \" \" ) < 0 ) {\n\t\t\t\t\t\t\tcur += clazz + \" \";\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\t// Only assign if different to avoid unneeded rendering.\n\t\t\t\t\tfinalValue = stripAndCollapse( cur );\n\t\t\t\t\tif ( curValue !== finalValue ) {\n\t\t\t\t\t\telem.setAttribute( \"class\", finalValue );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn this;\n\t},\n\n\tremoveClass: function( value ) {\n\t\tvar classes, elem, cur, curValue, clazz, j, finalValue,\n\t\t\ti = 0;\n\n\t\tif ( isFunction( value ) ) {\n\t\t\treturn this.each( function( j ) {\n\t\t\t\tjQuery( this ).removeClass( value.call( this, j, getClass( this ) ) );\n\t\t\t} );\n\t\t}\n\n\t\tif ( !arguments.length ) {\n\t\t\treturn this.attr( \"class\", \"\" );\n\t\t}\n\n\t\tclasses = classesToArray( value );\n\n\t\tif ( classes.length ) {\n\t\t\twhile ( ( elem = this[ i++ ] ) ) {\n\t\t\t\tcurValue = getClass( elem );\n\n\t\t\t\t// This expression is here for better compressibility (see addClass)\n\t\t\t\tcur = elem.nodeType === 1 && ( \" \" + stripAndCollapse( curValue ) + \" \" );\n\n\t\t\t\tif ( cur ) {\n\t\t\t\t\tj = 0;\n\t\t\t\t\twhile ( ( clazz = classes[ j++ ] ) ) {\n\n\t\t\t\t\t\t// Remove *all* instances\n\t\t\t\t\t\twhile ( cur.indexOf( \" \" + clazz + \" \" ) > -1 ) {\n\t\t\t\t\t\t\tcur = cur.replace( \" \" + clazz + \" \", \" \" );\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\n\t\t\t\t\t// Only assign if different to avoid unneeded rendering.\n\t\t\t\t\tfinalValue = stripAndCollapse( cur );\n\t\t\t\t\tif ( curValue !== finalValue ) {\n\t\t\t\t\t\telem.setAttribute( \"class\", finalValue );\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn this;\n\t},\n\n\ttoggleClass: function( value, stateVal ) {\n\t\tvar type = typeof value,\n\t\t\tisValidValue = type === \"string\" || Array.isArray( value );\n\n\t\tif ( typeof stateVal === \"boolean\" && isValidValue ) {\n\t\t\treturn stateVal ? this.addClass( value ) : this.removeClass( value );\n\t\t}\n\n\t\tif ( isFunction( value ) ) {\n\t\t\treturn this.each( function( i ) {\n\t\t\t\tjQuery( this ).toggleClass(\n\t\t\t\t\tvalue.call( this, i, getClass( this ), stateVal ),\n\t\t\t\t\tstateVal\n\t\t\t\t);\n\t\t\t} );\n\t\t}\n\n\t\treturn this.each( function() {\n\t\t\tvar className, i, self, classNames;\n\n\t\t\tif ( isValidValue ) {\n\n\t\t\t\t// Toggle individual class names\n\t\t\t\ti = 0;\n\t\t\t\tself = jQuery( this );\n\t\t\t\tclassNames = classesToArray( value );\n\n\t\t\t\twhile ( ( className = classNames[ i++ ] ) ) {\n\n\t\t\t\t\t// Check each className given, space separated list\n\t\t\t\t\tif ( self.hasClass( className ) ) {\n\t\t\t\t\t\tself.removeClass( className );\n\t\t\t\t\t} else {\n\t\t\t\t\t\tself.addClass( className );\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t// Toggle whole class name\n\t\t\t} else if ( value === undefined || type === \"boolean\" ) {\n\t\t\t\tclassName = getClass( this );\n\t\t\t\tif ( className ) {\n\n\t\t\t\t\t// Store className if set\n\t\t\t\t\tdataPriv.set( this, \"__className__\", className );\n\t\t\t\t}\n\n\t\t\t\t// If the element has a class name or if we're passed `false`,\n\t\t\t\t// then remove the whole classname (if there was one, the above saved it).\n\t\t\t\t// Otherwise bring back whatever was previously saved (if anything),\n\t\t\t\t// falling back to the empty string if nothing was stored.\n\t\t\t\tif ( this.setAttribute ) {\n\t\t\t\t\tthis.setAttribute( \"class\",\n\t\t\t\t\t\tclassName || value === false ?\n\t\t\t\t\t\t\"\" :\n\t\t\t\t\t\tdataPriv.get( this, \"__className__\" ) || \"\"\n\t\t\t\t\t);\n\t\t\t\t}\n\t\t\t}\n\t\t} );\n\t},\n\n\thasClass: function( selector ) {\n\t\tvar className, elem,\n\t\t\ti = 0;\n\n\t\tclassName = \" \" + selector + \" \";\n\t\twhile ( ( elem = this[ i++ ] ) ) {\n\t\t\tif ( elem.nodeType === 1 &&\n\t\t\t\t( \" \" + stripAndCollapse( getClass( elem ) ) + \" \" ).indexOf( className ) > -1 ) {\n\t\t\t\t\treturn true;\n\t\t\t}\n\t\t}\n\n\t\treturn false;\n\t}\n} );\n\n\n\n\nvar rreturn = /\\r/g;\n\njQuery.fn.extend( {\n\tval: function( value ) {\n\t\tvar hooks, ret, valueIsFunction,\n\t\t\telem = this[ 0 ];\n\n\t\tif ( !arguments.length ) {\n\t\t\tif ( elem ) {\n\t\t\t\thooks = jQuery.valHooks[ elem.type ] ||\n\t\t\t\t\tjQuery.valHooks[ elem.nodeName.toLowerCase() ];\n\n\t\t\t\tif ( hooks &&\n\t\t\t\t\t\"get\" in hooks &&\n\t\t\t\t\t( ret = hooks.get( elem, \"value\" ) ) !== undefined\n\t\t\t\t) {\n\t\t\t\t\treturn ret;\n\t\t\t\t}\n\n\t\t\t\tret = elem.value;\n\n\t\t\t\t// Handle most common string cases\n\t\t\t\tif ( typeof ret === \"string\" ) {\n\t\t\t\t\treturn ret.replace( rreturn, \"\" );\n\t\t\t\t}\n\n\t\t\t\t// Handle cases where value is null/undef or number\n\t\t\t\treturn ret == null ? \"\" : ret;\n\t\t\t}\n\n\t\t\treturn;\n\t\t}\n\n\t\tvalueIsFunction = isFunction( value );\n\n\t\treturn this.each( function( i ) {\n\t\t\tvar val;\n\n\t\t\tif ( this.nodeType !== 1 ) {\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\tif ( valueIsFunction ) {\n\t\t\t\tval = value.call( this, i, jQuery( this ).val() );\n\t\t\t} else {\n\t\t\t\tval = value;\n\t\t\t}\n\n\t\t\t// Treat null/undefined as \"\"; convert numbers to string\n\t\t\tif ( val == null ) {\n\t\t\t\tval = \"\";\n\n\t\t\t} else if ( typeof val === \"number\" ) {\n\t\t\t\tval += \"\";\n\n\t\t\t} else if ( Array.isArray( val ) ) {\n\t\t\t\tval = jQuery.map( val, function( value ) {\n\t\t\t\t\treturn value == null ? \"\" : value + \"\";\n\t\t\t\t} );\n\t\t\t}\n\n\t\t\thooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];\n\n\t\t\t// If set returns undefined, fall back to normal setting\n\t\t\tif ( !hooks || !( \"set\" in hooks ) || hooks.set( this, val, \"value\" ) === undefined ) {\n\t\t\t\tthis.value = val;\n\t\t\t}\n\t\t} );\n\t}\n} );\n\njQuery.extend( {\n\tvalHooks: {\n\t\toption: {\n\t\t\tget: function( elem ) {\n\n\t\t\t\tvar val = jQuery.find.attr( elem, \"value\" );\n\t\t\t\treturn val != null ?\n\t\t\t\t\tval :\n\n\t\t\t\t\t// Support: IE <=10 - 11 only\n\t\t\t\t\t// option.text throws exceptions (#14686, #14858)\n\t\t\t\t\t// Strip and collapse whitespace\n\t\t\t\t\t// https://html.spec.whatwg.org/#strip-and-collapse-whitespace\n\t\t\t\t\tstripAndCollapse( jQuery.text( elem ) );\n\t\t\t}\n\t\t},\n\t\tselect: {\n\t\t\tget: function( elem ) {\n\t\t\t\tvar value, option, i,\n\t\t\t\t\toptions = elem.options,\n\t\t\t\t\tindex = elem.selectedIndex,\n\t\t\t\t\tone = elem.type === \"select-one\",\n\t\t\t\t\tvalues = one ? null : [],\n\t\t\t\t\tmax = one ? index + 1 : options.length;\n\n\t\t\t\tif ( index < 0 ) {\n\t\t\t\t\ti = max;\n\n\t\t\t\t} else {\n\t\t\t\t\ti = one ? index : 0;\n\t\t\t\t}\n\n\t\t\t\t// Loop through all the selected options\n\t\t\t\tfor ( ; i < max; i++ ) {\n\t\t\t\t\toption = options[ i ];\n\n\t\t\t\t\t// Support: IE <=9 only\n\t\t\t\t\t// IE8-9 doesn't update selected after form reset (#2551)\n\t\t\t\t\tif ( ( option.selected || i === index ) &&\n\n\t\t\t\t\t\t\t// Don't return options that are disabled or in a disabled optgroup\n\t\t\t\t\t\t\t!option.disabled &&\n\t\t\t\t\t\t\t( !option.parentNode.disabled ||\n\t\t\t\t\t\t\t\t!nodeName( option.parentNode, \"optgroup\" ) ) ) {\n\n\t\t\t\t\t\t// Get the specific value for the option\n\t\t\t\t\t\tvalue = jQuery( option ).val();\n\n\t\t\t\t\t\t// We don't need an array for one selects\n\t\t\t\t\t\tif ( one ) {\n\t\t\t\t\t\t\treturn value;\n\t\t\t\t\t\t}\n\n\t\t\t\t\t\t// Multi-Selects return an array\n\t\t\t\t\t\tvalues.push( value );\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\treturn values;\n\t\t\t},\n\n\t\t\tset: function( elem, value ) {\n\t\t\t\tvar optionSet, option,\n\t\t\t\t\toptions = elem.options,\n\t\t\t\t\tvalues = jQuery.makeArray( value ),\n\t\t\t\t\ti = options.length;\n\n\t\t\t\twhile ( i-- ) {\n\t\t\t\t\toption = options[ i ];\n\n\t\t\t\t\t/* eslint-disable no-cond-assign */\n\n\t\t\t\t\tif ( option.selected =\n\t\t\t\t\t\tjQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1\n\t\t\t\t\t) {\n\t\t\t\t\t\toptionSet = true;\n\t\t\t\t\t}\n\n\t\t\t\t\t/* eslint-enable no-cond-assign */\n\t\t\t\t}\n\n\t\t\t\t// Force browsers to behave consistently when non-matching value is set\n\t\t\t\tif ( !optionSet ) {\n\t\t\t\t\telem.selectedIndex = -1;\n\t\t\t\t}\n\t\t\t\treturn values;\n\t\t\t}\n\t\t}\n\t}\n} );\n\n// Radios and checkboxes getter/setter\njQuery.each( [ \"radio\", \"checkbox\" ], function() {\n\tjQuery.valHooks[ this ] = {\n\t\tset: function( elem, value ) {\n\t\t\tif ( Array.isArray( value ) ) {\n\t\t\t\treturn ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 );\n\t\t\t}\n\t\t}\n\t};\n\tif ( !support.checkOn ) {\n\t\tjQuery.valHooks[ this ].get = function( elem ) {\n\t\t\treturn elem.getAttribute( \"value\" ) === null ? \"on\" : elem.value;\n\t\t};\n\t}\n} );\n\n\n\n\n// Return jQuery for attributes-only inclusion\n\n\nsupport.focusin = \"onfocusin\" in window;\n\n\nvar rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,\n\tstopPropagationCallback = function( e ) {\n\t\te.stopPropagation();\n\t};\n\njQuery.extend( jQuery.event, {\n\n\ttrigger: function( event, data, elem, onlyHandlers ) {\n\n\t\tvar i, cur, tmp, bubbleType, ontype, handle, special, lastElement,\n\t\t\teventPath = [ elem || document ],\n\t\t\ttype = hasOwn.call( event, \"type\" ) ? event.type : event,\n\t\t\tnamespaces = hasOwn.call( event, \"namespace\" ) ? event.namespace.split( \".\" ) : [];\n\n\t\tcur = lastElement = tmp = elem = elem || document;\n\n\t\t// Don't do events on text and comment nodes\n\t\tif ( elem.nodeType === 3 || elem.nodeType === 8 ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// focus/blur morphs to focusin/out; ensure we're not firing them right now\n\t\tif ( rfocusMorph.test( type + jQuery.event.triggered ) ) {\n\t\t\treturn;\n\t\t}\n\n\t\tif ( type.indexOf( \".\" ) > -1 ) {\n\n\t\t\t// Namespaced trigger; create a regexp to match event type in handle()\n\t\t\tnamespaces = type.split( \".\" );\n\t\t\ttype = namespaces.shift();\n\t\t\tnamespaces.sort();\n\t\t}\n\t\tontype = type.indexOf( \":\" ) < 0 && \"on\" + type;\n\n\t\t// Caller can pass in a jQuery.Event object, Object, or just an event type string\n\t\tevent = event[ jQuery.expando ] ?\n\t\t\tevent :\n\t\t\tnew jQuery.Event( type, typeof event === \"object\" && event );\n\n\t\t// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)\n\t\tevent.isTrigger = onlyHandlers ? 2 : 3;\n\t\tevent.namespace = namespaces.join( \".\" );\n\t\tevent.rnamespace = event.namespace ?\n\t\t\tnew RegExp( \"(^|\\\\.)\" + namespaces.join( \"\\\\.(?:.*\\\\.|)\" ) + \"(\\\\.|$)\" ) :\n\t\t\tnull;\n\n\t\t// Clean up the event in case it is being reused\n\t\tevent.result = undefined;\n\t\tif ( !event.target ) {\n\t\t\tevent.target = elem;\n\t\t}\n\n\t\t// Clone any incoming data and prepend the event, creating the handler arg list\n\t\tdata = data == null ?\n\t\t\t[ event ] :\n\t\t\tjQuery.makeArray( data, [ event ] );\n\n\t\t// Allow special events to draw outside the lines\n\t\tspecial = jQuery.event.special[ type ] || {};\n\t\tif ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Determine event propagation path in advance, per W3C events spec (#9951)\n\t\t// Bubble up to document, then to window; watch for a global ownerDocument var (#9724)\n\t\tif ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) {\n\n\t\t\tbubbleType = special.delegateType || type;\n\t\t\tif ( !rfocusMorph.test( bubbleType + type ) ) {\n\t\t\t\tcur = cur.parentNode;\n\t\t\t}\n\t\t\tfor ( ; cur; cur = cur.parentNode ) {\n\t\t\t\teventPath.push( cur );\n\t\t\t\ttmp = cur;\n\t\t\t}\n\n\t\t\t// Only add window if we got to document (e.g., not plain obj or detached DOM)\n\t\t\tif ( tmp === ( elem.ownerDocument || document ) ) {\n\t\t\t\teventPath.push( tmp.defaultView || tmp.parentWindow || window );\n\t\t\t}\n\t\t}\n\n\t\t// Fire handlers on the event path\n\t\ti = 0;\n\t\twhile ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) {\n\t\t\tlastElement = cur;\n\t\t\tevent.type = i > 1 ?\n\t\t\t\tbubbleType :\n\t\t\t\tspecial.bindType || type;\n\n\t\t\t// jQuery handler\n\t\t\thandle = ( dataPriv.get( cur, \"events\" ) || {} )[ event.type ] &&\n\t\t\t\tdataPriv.get( cur, \"handle\" );\n\t\t\tif ( handle ) {\n\t\t\t\thandle.apply( cur, data );\n\t\t\t}\n\n\t\t\t// Native handler\n\t\t\thandle = ontype && cur[ ontype ];\n\t\t\tif ( handle && handle.apply && acceptData( cur ) ) {\n\t\t\t\tevent.result = handle.apply( cur, data );\n\t\t\t\tif ( event.result === false ) {\n\t\t\t\t\tevent.preventDefault();\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\tevent.type = type;\n\n\t\t// If nobody prevented the default action, do it now\n\t\tif ( !onlyHandlers && !event.isDefaultPrevented() ) {\n\n\t\t\tif ( ( !special._default ||\n\t\t\t\tspecial._default.apply( eventPath.pop(), data ) === false ) &&\n\t\t\t\tacceptData( elem ) ) {\n\n\t\t\t\t// Call a native DOM method on the target with the same name as the event.\n\t\t\t\t// Don't do default actions on window, that's where global variables be (#6170)\n\t\t\t\tif ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) {\n\n\t\t\t\t\t// Don't re-trigger an onFOO event when we call its FOO() method\n\t\t\t\t\ttmp = elem[ ontype ];\n\n\t\t\t\t\tif ( tmp ) {\n\t\t\t\t\t\telem[ ontype ] = null;\n\t\t\t\t\t}\n\n\t\t\t\t\t// Prevent re-triggering of the same event, since we already bubbled it above\n\t\t\t\t\tjQuery.event.triggered = type;\n\n\t\t\t\t\tif ( event.isPropagationStopped() ) {\n\t\t\t\t\t\tlastElement.addEventListener( type, stopPropagationCallback );\n\t\t\t\t\t}\n\n\t\t\t\t\telem[ type ]();\n\n\t\t\t\t\tif ( event.isPropagationStopped() ) {\n\t\t\t\t\t\tlastElement.removeEventListener( type, stopPropagationCallback );\n\t\t\t\t\t}\n\n\t\t\t\t\tjQuery.event.triggered = undefined;\n\n\t\t\t\t\tif ( tmp ) {\n\t\t\t\t\t\telem[ ontype ] = tmp;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn event.result;\n\t},\n\n\t// Piggyback on a donor event to simulate a different one\n\t// Used only for `focus(in | out)` events\n\tsimulate: function( type, elem, event ) {\n\t\tvar e = jQuery.extend(\n\t\t\tnew jQuery.Event(),\n\t\t\tevent,\n\t\t\t{\n\t\t\t\ttype: type,\n\t\t\t\tisSimulated: true\n\t\t\t}\n\t\t);\n\n\t\tjQuery.event.trigger( e, null, elem );\n\t}\n\n} );\n\njQuery.fn.extend( {\n\n\ttrigger: function( type, data ) {\n\t\treturn this.each( function() {\n\t\t\tjQuery.event.trigger( type, data, this );\n\t\t} );\n\t},\n\ttriggerHandler: function( type, data ) {\n\t\tvar elem = this[ 0 ];\n\t\tif ( elem ) {\n\t\t\treturn jQuery.event.trigger( type, data, elem, true );\n\t\t}\n\t}\n} );\n\n\n// Support: Firefox <=44\n// Firefox doesn't have focus(in | out) events\n// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787\n//\n// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1\n// focus(in | out) events fire after focus & blur events,\n// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order\n// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857\nif ( !support.focusin ) {\n\tjQuery.each( { focus: \"focusin\", blur: \"focusout\" }, function( orig, fix ) {\n\n\t\t// Attach a single capturing handler on the document while someone wants focusin/focusout\n\t\tvar handler = function( event ) {\n\t\t\tjQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) );\n\t\t};\n\n\t\tjQuery.event.special[ fix ] = {\n\t\t\tsetup: function() {\n\t\t\t\tvar doc = this.ownerDocument || this,\n\t\t\t\t\tattaches = dataPriv.access( doc, fix );\n\n\t\t\t\tif ( !attaches ) {\n\t\t\t\t\tdoc.addEventListener( orig, handler, true );\n\t\t\t\t}\n\t\t\t\tdataPriv.access( doc, fix, ( attaches || 0 ) + 1 );\n\t\t\t},\n\t\t\tteardown: function() {\n\t\t\t\tvar doc = this.ownerDocument || this,\n\t\t\t\t\tattaches = dataPriv.access( doc, fix ) - 1;\n\n\t\t\t\tif ( !attaches ) {\n\t\t\t\t\tdoc.removeEventListener( orig, handler, true );\n\t\t\t\t\tdataPriv.remove( doc, fix );\n\n\t\t\t\t} else {\n\t\t\t\t\tdataPriv.access( doc, fix, attaches );\n\t\t\t\t}\n\t\t\t}\n\t\t};\n\t} );\n}\nvar location = window.location;\n\nvar nonce = Date.now();\n\nvar rquery = ( /\\?/ );\n\n\n\n// Cross-browser xml parsing\njQuery.parseXML = function( data ) {\n\tvar xml;\n\tif ( !data || typeof data !== \"string\" ) {\n\t\treturn null;\n\t}\n\n\t// Support: IE 9 - 11 only\n\t// IE throws on parseFromString with invalid input.\n\ttry {\n\t\txml = ( new window.DOMParser() ).parseFromString( data, \"text/xml\" );\n\t} catch ( e ) {\n\t\txml = undefined;\n\t}\n\n\tif ( !xml || xml.getElementsByTagName( \"parsererror\" ).length ) {\n\t\tjQuery.error( \"Invalid XML: \" + data );\n\t}\n\treturn xml;\n};\n\n\nvar\n\trbracket = /\\[\\]$/,\n\trCRLF = /\\r?\\n/g,\n\trsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,\n\trsubmittable = /^(?:input|select|textarea|keygen)/i;\n\nfunction buildParams( prefix, obj, traditional, add ) {\n\tvar name;\n\n\tif ( Array.isArray( obj ) ) {\n\n\t\t// Serialize array item.\n\t\tjQuery.each( obj, function( i, v ) {\n\t\t\tif ( traditional || rbracket.test( prefix ) ) {\n\n\t\t\t\t// Treat each array item as a scalar.\n\t\t\t\tadd( prefix, v );\n\n\t\t\t} else {\n\n\t\t\t\t// Item is non-scalar (array or object), encode its numeric index.\n\t\t\t\tbuildParams(\n\t\t\t\t\tprefix + \"[\" + ( typeof v === \"object\" && v != null ? i : \"\" ) + \"]\",\n\t\t\t\t\tv,\n\t\t\t\t\ttraditional,\n\t\t\t\t\tadd\n\t\t\t\t);\n\t\t\t}\n\t\t} );\n\n\t} else if ( !traditional && toType( obj ) === \"object\" ) {\n\n\t\t// Serialize object item.\n\t\tfor ( name in obj ) {\n\t\t\tbuildParams( prefix + \"[\" + name + \"]\", obj[ name ], traditional, add );\n\t\t}\n\n\t} else {\n\n\t\t// Serialize scalar item.\n\t\tadd( prefix, obj );\n\t}\n}\n\n// Serialize an array of form elements or a set of\n// key/values into a query string\njQuery.param = function( a, traditional ) {\n\tvar prefix,\n\t\ts = [],\n\t\tadd = function( key, valueOrFunction ) {\n\n\t\t\t// If value is a function, invoke it and use its return value\n\t\t\tvar value = isFunction( valueOrFunction ) ?\n\t\t\t\tvalueOrFunction() :\n\t\t\t\tvalueOrFunction;\n\n\t\t\ts[ s.length ] = encodeURIComponent( key ) + \"=\" +\n\t\t\t\tencodeURIComponent( value == null ? \"\" : value );\n\t\t};\n\n\t// If an array was passed in, assume that it is an array of form elements.\n\tif ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {\n\n\t\t// Serialize the form elements\n\t\tjQuery.each( a, function() {\n\t\t\tadd( this.name, this.value );\n\t\t} );\n\n\t} else {\n\n\t\t// If traditional, encode the \"old\" way (the way 1.3.2 or older\n\t\t// did it), otherwise encode params recursively.\n\t\tfor ( prefix in a ) {\n\t\t\tbuildParams( prefix, a[ prefix ], traditional, add );\n\t\t}\n\t}\n\n\t// Return the resulting serialization\n\treturn s.join( \"&\" );\n};\n\njQuery.fn.extend( {\n\tserialize: function() {\n\t\treturn jQuery.param( this.serializeArray() );\n\t},\n\tserializeArray: function() {\n\t\treturn this.map( function() {\n\n\t\t\t// Can add propHook for \"elements\" to filter or add form elements\n\t\t\tvar elements = jQuery.prop( this, \"elements\" );\n\t\t\treturn elements ? jQuery.makeArray( elements ) : this;\n\t\t} )\n\t\t.filter( function() {\n\t\t\tvar type = this.type;\n\n\t\t\t// Use .is( \":disabled\" ) so that fieldset[disabled] works\n\t\t\treturn this.name && !jQuery( this ).is( \":disabled\" ) &&\n\t\t\t\trsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&\n\t\t\t\t( this.checked || !rcheckableType.test( type ) );\n\t\t} )\n\t\t.map( function( i, elem ) {\n\t\t\tvar val = jQuery( this ).val();\n\n\t\t\tif ( val == null ) {\n\t\t\t\treturn null;\n\t\t\t}\n\n\t\t\tif ( Array.isArray( val ) ) {\n\t\t\t\treturn jQuery.map( val, function( val ) {\n\t\t\t\t\treturn { name: elem.name, value: val.replace( rCRLF, \"\\r\\n\" ) };\n\t\t\t\t} );\n\t\t\t}\n\n\t\t\treturn { name: elem.name, value: val.replace( rCRLF, \"\\r\\n\" ) };\n\t\t} ).get();\n\t}\n} );\n\n\nvar\n\tr20 = /%20/g,\n\trhash = /#.*$/,\n\trantiCache = /([?&])_=[^&]*/,\n\trheaders = /^(.*?):[ \\t]*([^\\r\\n]*)$/mg,\n\n\t// #7653, #8125, #8152: local protocol detection\n\trlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,\n\trnoContent = /^(?:GET|HEAD)$/,\n\trprotocol = /^\\/\\//,\n\n\t/* Prefilters\n\t * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)\n\t * 2) These are called:\n\t * - BEFORE asking for a transport\n\t * - AFTER param serialization (s.data is a string if s.processData is true)\n\t * 3) key is the dataType\n\t * 4) the catchall symbol \"*\" can be used\n\t * 5) execution will start with transport dataType and THEN continue down to \"*\" if needed\n\t */\n\tprefilters = {},\n\n\t/* Transports bindings\n\t * 1) key is the dataType\n\t * 2) the catchall symbol \"*\" can be used\n\t * 3) selection will start with transport dataType and THEN go to \"*\" if needed\n\t */\n\ttransports = {},\n\n\t// Avoid comment-prolog char sequence (#10098); must appease lint and evade compression\n\tallTypes = \"*/\".concat( \"*\" ),\n\n\t// Anchor tag for parsing the document origin\n\toriginAnchor = document.createElement( \"a\" );\n\toriginAnchor.href = location.href;\n\n// Base \"constructor\" for jQuery.ajaxPrefilter and jQuery.ajaxTransport\nfunction addToPrefiltersOrTransports( structure ) {\n\n\t// dataTypeExpression is optional and defaults to \"*\"\n\treturn function( dataTypeExpression, func ) {\n\n\t\tif ( typeof dataTypeExpression !== \"string\" ) {\n\t\t\tfunc = dataTypeExpression;\n\t\t\tdataTypeExpression = \"*\";\n\t\t}\n\n\t\tvar dataType,\n\t\t\ti = 0,\n\t\t\tdataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || [];\n\n\t\tif ( isFunction( func ) ) {\n\n\t\t\t// For each dataType in the dataTypeExpression\n\t\t\twhile ( ( dataType = dataTypes[ i++ ] ) ) {\n\n\t\t\t\t// Prepend if requested\n\t\t\t\tif ( dataType[ 0 ] === \"+\" ) {\n\t\t\t\t\tdataType = dataType.slice( 1 ) || \"*\";\n\t\t\t\t\t( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func );\n\n\t\t\t\t// Otherwise append\n\t\t\t\t} else {\n\t\t\t\t\t( structure[ dataType ] = structure[ dataType ] || [] ).push( func );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t};\n}\n\n// Base inspection function for prefilters and transports\nfunction inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {\n\n\tvar inspected = {},\n\t\tseekingTransport = ( structure === transports );\n\n\tfunction inspect( dataType ) {\n\t\tvar selected;\n\t\tinspected[ dataType ] = true;\n\t\tjQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) {\n\t\t\tvar dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );\n\t\t\tif ( typeof dataTypeOrTransport === \"string\" &&\n\t\t\t\t!seekingTransport && !inspected[ dataTypeOrTransport ] ) {\n\n\t\t\t\toptions.dataTypes.unshift( dataTypeOrTransport );\n\t\t\t\tinspect( dataTypeOrTransport );\n\t\t\t\treturn false;\n\t\t\t} else if ( seekingTransport ) {\n\t\t\t\treturn !( selected = dataTypeOrTransport );\n\t\t\t}\n\t\t} );\n\t\treturn selected;\n\t}\n\n\treturn inspect( options.dataTypes[ 0 ] ) || !inspected[ \"*\" ] && inspect( \"*\" );\n}\n\n// A special extend for ajax options\n// that takes \"flat\" options (not to be deep extended)\n// Fixes #9887\nfunction ajaxExtend( target, src ) {\n\tvar key, deep,\n\t\tflatOptions = jQuery.ajaxSettings.flatOptions || {};\n\n\tfor ( key in src ) {\n\t\tif ( src[ key ] !== undefined ) {\n\t\t\t( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ];\n\t\t}\n\t}\n\tif ( deep ) {\n\t\tjQuery.extend( true, target, deep );\n\t}\n\n\treturn target;\n}\n\n/* Handles responses to an ajax request:\n * - finds the right dataType (mediates between content-type and expected dataType)\n * - returns the corresponding response\n */\nfunction ajaxHandleResponses( s, jqXHR, responses ) {\n\n\tvar ct, type, finalDataType, firstDataType,\n\t\tcontents = s.contents,\n\t\tdataTypes = s.dataTypes;\n\n\t// Remove auto dataType and get content-type in the process\n\twhile ( dataTypes[ 0 ] === \"*\" ) {\n\t\tdataTypes.shift();\n\t\tif ( ct === undefined ) {\n\t\t\tct = s.mimeType || jqXHR.getResponseHeader( \"Content-Type\" );\n\t\t}\n\t}\n\n\t// Check if we're dealing with a known content-type\n\tif ( ct ) {\n\t\tfor ( type in contents ) {\n\t\t\tif ( contents[ type ] && contents[ type ].test( ct ) ) {\n\t\t\t\tdataTypes.unshift( type );\n\t\t\t\tbreak;\n\t\t\t}\n\t\t}\n\t}\n\n\t// Check to see if we have a response for the expected dataType\n\tif ( dataTypes[ 0 ] in responses ) {\n\t\tfinalDataType = dataTypes[ 0 ];\n\t} else {\n\n\t\t// Try convertible dataTypes\n\t\tfor ( type in responses ) {\n\t\t\tif ( !dataTypes[ 0 ] || s.converters[ type + \" \" + dataTypes[ 0 ] ] ) {\n\t\t\t\tfinalDataType = type;\n\t\t\t\tbreak;\n\t\t\t}\n\t\t\tif ( !firstDataType ) {\n\t\t\t\tfirstDataType = type;\n\t\t\t}\n\t\t}\n\n\t\t// Or just use first one\n\t\tfinalDataType = finalDataType || firstDataType;\n\t}\n\n\t// If we found a dataType\n\t// We add the dataType to the list if needed\n\t// and return the corresponding response\n\tif ( finalDataType ) {\n\t\tif ( finalDataType !== dataTypes[ 0 ] ) {\n\t\t\tdataTypes.unshift( finalDataType );\n\t\t}\n\t\treturn responses[ finalDataType ];\n\t}\n}\n\n/* Chain conversions given the request and the original response\n * Also sets the responseXXX fields on the jqXHR instance\n */\nfunction ajaxConvert( s, response, jqXHR, isSuccess ) {\n\tvar conv2, current, conv, tmp, prev,\n\t\tconverters = {},\n\n\t\t// Work with a copy of dataTypes in case we need to modify it for conversion\n\t\tdataTypes = s.dataTypes.slice();\n\n\t// Create converters map with lowercased keys\n\tif ( dataTypes[ 1 ] ) {\n\t\tfor ( conv in s.converters ) {\n\t\t\tconverters[ conv.toLowerCase() ] = s.converters[ conv ];\n\t\t}\n\t}\n\n\tcurrent = dataTypes.shift();\n\n\t// Convert to each sequential dataType\n\twhile ( current ) {\n\n\t\tif ( s.responseFields[ current ] ) {\n\t\t\tjqXHR[ s.responseFields[ current ] ] = response;\n\t\t}\n\n\t\t// Apply the dataFilter if provided\n\t\tif ( !prev && isSuccess && s.dataFilter ) {\n\t\t\tresponse = s.dataFilter( response, s.dataType );\n\t\t}\n\n\t\tprev = current;\n\t\tcurrent = dataTypes.shift();\n\n\t\tif ( current ) {\n\n\t\t\t// There's only work to do if current dataType is non-auto\n\t\t\tif ( current === \"*\" ) {\n\n\t\t\t\tcurrent = prev;\n\n\t\t\t// Convert response if prev dataType is non-auto and differs from current\n\t\t\t} else if ( prev !== \"*\" && prev !== current ) {\n\n\t\t\t\t// Seek a direct converter\n\t\t\t\tconv = converters[ prev + \" \" + current ] || converters[ \"* \" + current ];\n\n\t\t\t\t// If none found, seek a pair\n\t\t\t\tif ( !conv ) {\n\t\t\t\t\tfor ( conv2 in converters ) {\n\n\t\t\t\t\t\t// If conv2 outputs current\n\t\t\t\t\t\ttmp = conv2.split( \" \" );\n\t\t\t\t\t\tif ( tmp[ 1 ] === current ) {\n\n\t\t\t\t\t\t\t// If prev can be converted to accepted input\n\t\t\t\t\t\t\tconv = converters[ prev + \" \" + tmp[ 0 ] ] ||\n\t\t\t\t\t\t\t\tconverters[ \"* \" + tmp[ 0 ] ];\n\t\t\t\t\t\t\tif ( conv ) {\n\n\t\t\t\t\t\t\t\t// Condense equivalence converters\n\t\t\t\t\t\t\t\tif ( conv === true ) {\n\t\t\t\t\t\t\t\t\tconv = converters[ conv2 ];\n\n\t\t\t\t\t\t\t\t// Otherwise, insert the intermediate dataType\n\t\t\t\t\t\t\t\t} else if ( converters[ conv2 ] !== true ) {\n\t\t\t\t\t\t\t\t\tcurrent = tmp[ 0 ];\n\t\t\t\t\t\t\t\t\tdataTypes.unshift( tmp[ 1 ] );\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\t// Apply converter (if not an equivalence)\n\t\t\t\tif ( conv !== true ) {\n\n\t\t\t\t\t// Unless errors are allowed to bubble, catch and return them\n\t\t\t\t\tif ( conv && s.throws ) {\n\t\t\t\t\t\tresponse = conv( response );\n\t\t\t\t\t} else {\n\t\t\t\t\t\ttry {\n\t\t\t\t\t\t\tresponse = conv( response );\n\t\t\t\t\t\t} catch ( e ) {\n\t\t\t\t\t\t\treturn {\n\t\t\t\t\t\t\t\tstate: \"parsererror\",\n\t\t\t\t\t\t\t\terror: conv ? e : \"No conversion from \" + prev + \" to \" + current\n\t\t\t\t\t\t\t};\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t}\n\n\treturn { state: \"success\", data: response };\n}\n\njQuery.extend( {\n\n\t// Counter for holding the number of active queries\n\tactive: 0,\n\n\t// Last-Modified header cache for next request\n\tlastModified: {},\n\tetag: {},\n\n\tajaxSettings: {\n\t\turl: location.href,\n\t\ttype: \"GET\",\n\t\tisLocal: rlocalProtocol.test( location.protocol ),\n\t\tglobal: true,\n\t\tprocessData: true,\n\t\tasync: true,\n\t\tcontentType: \"application/x-www-form-urlencoded; charset=UTF-8\",\n\n\t\t/*\n\t\ttimeout: 0,\n\t\tdata: null,\n\t\tdataType: null,\n\t\tusername: null,\n\t\tpassword: null,\n\t\tcache: null,\n\t\tthrows: false,\n\t\ttraditional: false,\n\t\theaders: {},\n\t\t*/\n\n\t\taccepts: {\n\t\t\t\"*\": allTypes,\n\t\t\ttext: \"text/plain\",\n\t\t\thtml: \"text/html\",\n\t\t\txml: \"application/xml, text/xml\",\n\t\t\tjson: \"application/json, text/javascript\"\n\t\t},\n\n\t\tcontents: {\n\t\t\txml: /\\bxml\\b/,\n\t\t\thtml: /\\bhtml/,\n\t\t\tjson: /\\bjson\\b/\n\t\t},\n\n\t\tresponseFields: {\n\t\t\txml: \"responseXML\",\n\t\t\ttext: \"responseText\",\n\t\t\tjson: \"responseJSON\"\n\t\t},\n\n\t\t// Data converters\n\t\t// Keys separate source (or catchall \"*\") and destination types with a single space\n\t\tconverters: {\n\n\t\t\t// Convert anything to text\n\t\t\t\"* text\": String,\n\n\t\t\t// Text to html (true = no transformation)\n\t\t\t\"text html\": true,\n\n\t\t\t// Evaluate text as a json expression\n\t\t\t\"text json\": JSON.parse,\n\n\t\t\t// Parse text as xml\n\t\t\t\"text xml\": jQuery.parseXML\n\t\t},\n\n\t\t// For options that shouldn't be deep extended:\n\t\t// you can add your own custom options here if\n\t\t// and when you create one that shouldn't be\n\t\t// deep extended (see ajaxExtend)\n\t\tflatOptions: {\n\t\t\turl: true,\n\t\t\tcontext: true\n\t\t}\n\t},\n\n\t// Creates a full fledged settings object into target\n\t// with both ajaxSettings and settings fields.\n\t// If target is omitted, writes into ajaxSettings.\n\tajaxSetup: function( target, settings ) {\n\t\treturn settings ?\n\n\t\t\t// Building a settings object\n\t\t\tajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :\n\n\t\t\t// Extending ajaxSettings\n\t\t\tajaxExtend( jQuery.ajaxSettings, target );\n\t},\n\n\tajaxPrefilter: addToPrefiltersOrTransports( prefilters ),\n\tajaxTransport: addToPrefiltersOrTransports( transports ),\n\n\t// Main method\n\tajax: function( url, options ) {\n\n\t\t// If url is an object, simulate pre-1.5 signature\n\t\tif ( typeof url === \"object\" ) {\n\t\t\toptions = url;\n\t\t\turl = undefined;\n\t\t}\n\n\t\t// Force options to be an object\n\t\toptions = options || {};\n\n\t\tvar transport,\n\n\t\t\t// URL without anti-cache param\n\t\t\tcacheURL,\n\n\t\t\t// Response headers\n\t\t\tresponseHeadersString,\n\t\t\tresponseHeaders,\n\n\t\t\t// timeout handle\n\t\t\ttimeoutTimer,\n\n\t\t\t// Url cleanup var\n\t\t\turlAnchor,\n\n\t\t\t// Request state (becomes false upon send and true upon completion)\n\t\t\tcompleted,\n\n\t\t\t// To know if global events are to be dispatched\n\t\t\tfireGlobals,\n\n\t\t\t// Loop variable\n\t\t\ti,\n\n\t\t\t// uncached part of the url\n\t\t\tuncached,\n\n\t\t\t// Create the final options object\n\t\t\ts = jQuery.ajaxSetup( {}, options ),\n\n\t\t\t// Callbacks context\n\t\t\tcallbackContext = s.context || s,\n\n\t\t\t// Context for global events is callbackContext if it is a DOM node or jQuery collection\n\t\t\tglobalEventContext = s.context &&\n\t\t\t\t( callbackContext.nodeType || callbackContext.jquery ) ?\n\t\t\t\t\tjQuery( callbackContext ) :\n\t\t\t\t\tjQuery.event,\n\n\t\t\t// Deferreds\n\t\t\tdeferred = jQuery.Deferred(),\n\t\t\tcompleteDeferred = jQuery.Callbacks( \"once memory\" ),\n\n\t\t\t// Status-dependent callbacks\n\t\t\tstatusCode = s.statusCode || {},\n\n\t\t\t// Headers (they are sent all at once)\n\t\t\trequestHeaders = {},\n\t\t\trequestHeadersNames = {},\n\n\t\t\t// Default abort message\n\t\t\tstrAbort = \"canceled\",\n\n\t\t\t// Fake xhr\n\t\t\tjqXHR = {\n\t\t\t\treadyState: 0,\n\n\t\t\t\t// Builds headers hashtable if needed\n\t\t\t\tgetResponseHeader: function( key ) {\n\t\t\t\t\tvar match;\n\t\t\t\t\tif ( completed ) {\n\t\t\t\t\t\tif ( !responseHeaders ) {\n\t\t\t\t\t\t\tresponseHeaders = {};\n\t\t\t\t\t\t\twhile ( ( match = rheaders.exec( responseHeadersString ) ) ) {\n\t\t\t\t\t\t\t\tresponseHeaders[ match[ 1 ].toLowerCase() ] = match[ 2 ];\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t\tmatch = responseHeaders[ key.toLowerCase() ];\n\t\t\t\t\t}\n\t\t\t\t\treturn match == null ? null : match;\n\t\t\t\t},\n\n\t\t\t\t// Raw string\n\t\t\t\tgetAllResponseHeaders: function() {\n\t\t\t\t\treturn completed ? responseHeadersString : null;\n\t\t\t\t},\n\n\t\t\t\t// Caches the header\n\t\t\t\tsetRequestHeader: function( name, value ) {\n\t\t\t\t\tif ( completed == null ) {\n\t\t\t\t\t\tname = requestHeadersNames[ name.toLowerCase() ] =\n\t\t\t\t\t\t\trequestHeadersNames[ name.toLowerCase() ] || name;\n\t\t\t\t\t\trequestHeaders[ name ] = value;\n\t\t\t\t\t}\n\t\t\t\t\treturn this;\n\t\t\t\t},\n\n\t\t\t\t// Overrides response content-type header\n\t\t\t\toverrideMimeType: function( type ) {\n\t\t\t\t\tif ( completed == null ) {\n\t\t\t\t\t\ts.mimeType = type;\n\t\t\t\t\t}\n\t\t\t\t\treturn this;\n\t\t\t\t},\n\n\t\t\t\t// Status-dependent callbacks\n\t\t\t\tstatusCode: function( map ) {\n\t\t\t\t\tvar code;\n\t\t\t\t\tif ( map ) {\n\t\t\t\t\t\tif ( completed ) {\n\n\t\t\t\t\t\t\t// Execute the appropriate callbacks\n\t\t\t\t\t\t\tjqXHR.always( map[ jqXHR.status ] );\n\t\t\t\t\t\t} else {\n\n\t\t\t\t\t\t\t// Lazy-add the new callbacks in a way that preserves old ones\n\t\t\t\t\t\t\tfor ( code in map ) {\n\t\t\t\t\t\t\t\tstatusCode[ code ] = [ statusCode[ code ], map[ code ] ];\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\treturn this;\n\t\t\t\t},\n\n\t\t\t\t// Cancel the request\n\t\t\t\tabort: function( statusText ) {\n\t\t\t\t\tvar finalText = statusText || strAbort;\n\t\t\t\t\tif ( transport ) {\n\t\t\t\t\t\ttransport.abort( finalText );\n\t\t\t\t\t}\n\t\t\t\t\tdone( 0, finalText );\n\t\t\t\t\treturn this;\n\t\t\t\t}\n\t\t\t};\n\n\t\t// Attach deferreds\n\t\tdeferred.promise( jqXHR );\n\n\t\t// Add protocol if not provided (prefilters might expect it)\n\t\t// Handle falsy url in the settings object (#10093: consistency with old signature)\n\t\t// We also use the url parameter if available\n\t\ts.url = ( ( url || s.url || location.href ) + \"\" )\n\t\t\t.replace( rprotocol, location.protocol + \"//\" );\n\n\t\t// Alias method option to type as per ticket #12004\n\t\ts.type = options.method || options.type || s.method || s.type;\n\n\t\t// Extract dataTypes list\n\t\ts.dataTypes = ( s.dataType || \"*\" ).toLowerCase().match( rnothtmlwhite ) || [ \"\" ];\n\n\t\t// A cross-domain request is in order when the origin doesn't match the current origin.\n\t\tif ( s.crossDomain == null ) {\n\t\t\turlAnchor = document.createElement( \"a\" );\n\n\t\t\t// Support: IE <=8 - 11, Edge 12 - 15\n\t\t\t// IE throws exception on accessing the href property if url is malformed,\n\t\t\t// e.g. http://example.com:80x/\n\t\t\ttry {\n\t\t\t\turlAnchor.href = s.url;\n\n\t\t\t\t// Support: IE <=8 - 11 only\n\t\t\t\t// Anchor's host property isn't correctly set when s.url is relative\n\t\t\t\turlAnchor.href = urlAnchor.href;\n\t\t\t\ts.crossDomain = originAnchor.protocol + \"//\" + originAnchor.host !==\n\t\t\t\t\turlAnchor.protocol + \"//\" + urlAnchor.host;\n\t\t\t} catch ( e ) {\n\n\t\t\t\t// If there is an error parsing the URL, assume it is crossDomain,\n\t\t\t\t// it can be rejected by the transport if it is invalid\n\t\t\t\ts.crossDomain = true;\n\t\t\t}\n\t\t}\n\n\t\t// Convert data if not already a string\n\t\tif ( s.data && s.processData && typeof s.data !== \"string\" ) {\n\t\t\ts.data = jQuery.param( s.data, s.traditional );\n\t\t}\n\n\t\t// Apply prefilters\n\t\tinspectPrefiltersOrTransports( prefilters, s, options, jqXHR );\n\n\t\t// If request was aborted inside a prefilter, stop there\n\t\tif ( completed ) {\n\t\t\treturn jqXHR;\n\t\t}\n\n\t\t// We can fire global events as of now if asked to\n\t\t// Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118)\n\t\tfireGlobals = jQuery.event && s.global;\n\n\t\t// Watch for a new set of requests\n\t\tif ( fireGlobals && jQuery.active++ === 0 ) {\n\t\t\tjQuery.event.trigger( \"ajaxStart\" );\n\t\t}\n\n\t\t// Uppercase the type\n\t\ts.type = s.type.toUpperCase();\n\n\t\t// Determine if request has content\n\t\ts.hasContent = !rnoContent.test( s.type );\n\n\t\t// Save the URL in case we're toying with the If-Modified-Since\n\t\t// and/or If-None-Match header later on\n\t\t// Remove hash to simplify url manipulation\n\t\tcacheURL = s.url.replace( rhash, \"\" );\n\n\t\t// More options handling for requests with no content\n\t\tif ( !s.hasContent ) {\n\n\t\t\t// Remember the hash so we can put it back\n\t\t\tuncached = s.url.slice( cacheURL.length );\n\n\t\t\t// If data is available and should be processed, append data to url\n\t\t\tif ( s.data && ( s.processData || typeof s.data === \"string\" ) ) {\n\t\t\t\tcacheURL += ( rquery.test( cacheURL ) ? \"&\" : \"?\" ) + s.data;\n\n\t\t\t\t// #9682: remove data so that it's not used in an eventual retry\n\t\t\t\tdelete s.data;\n\t\t\t}\n\n\t\t\t// Add or update anti-cache param if needed\n\t\t\tif ( s.cache === false ) {\n\t\t\t\tcacheURL = cacheURL.replace( rantiCache, \"$1\" );\n\t\t\t\tuncached = ( rquery.test( cacheURL ) ? \"&\" : \"?\" ) + \"_=\" + ( nonce++ ) + uncached;\n\t\t\t}\n\n\t\t\t// Put hash and anti-cache on the URL that will be requested (gh-1732)\n\t\t\ts.url = cacheURL + uncached;\n\n\t\t// Change '%20' to '+' if this is encoded form body content (gh-2658)\n\t\t} else if ( s.data && s.processData &&\n\t\t\t( s.contentType || \"\" ).indexOf( \"application/x-www-form-urlencoded\" ) === 0 ) {\n\t\t\ts.data = s.data.replace( r20, \"+\" );\n\t\t}\n\n\t\t// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.\n\t\tif ( s.ifModified ) {\n\t\t\tif ( jQuery.lastModified[ cacheURL ] ) {\n\t\t\t\tjqXHR.setRequestHeader( \"If-Modified-Since\", jQuery.lastModified[ cacheURL ] );\n\t\t\t}\n\t\t\tif ( jQuery.etag[ cacheURL ] ) {\n\t\t\t\tjqXHR.setRequestHeader( \"If-None-Match\", jQuery.etag[ cacheURL ] );\n\t\t\t}\n\t\t}\n\n\t\t// Set the correct header, if data is being sent\n\t\tif ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {\n\t\t\tjqXHR.setRequestHeader( \"Content-Type\", s.contentType );\n\t\t}\n\n\t\t// Set the Accepts header for the server, depending on the dataType\n\t\tjqXHR.setRequestHeader(\n\t\t\t\"Accept\",\n\t\t\ts.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ?\n\t\t\t\ts.accepts[ s.dataTypes[ 0 ] ] +\n\t\t\t\t\t( s.dataTypes[ 0 ] !== \"*\" ? \", \" + allTypes + \"; q=0.01\" : \"\" ) :\n\t\t\t\ts.accepts[ \"*\" ]\n\t\t);\n\n\t\t// Check for headers option\n\t\tfor ( i in s.headers ) {\n\t\t\tjqXHR.setRequestHeader( i, s.headers[ i ] );\n\t\t}\n\n\t\t// Allow custom headers/mimetypes and early abort\n\t\tif ( s.beforeSend &&\n\t\t\t( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) {\n\n\t\t\t// Abort if not done already and return\n\t\t\treturn jqXHR.abort();\n\t\t}\n\n\t\t// Aborting is no longer a cancellation\n\t\tstrAbort = \"abort\";\n\n\t\t// Install callbacks on deferreds\n\t\tcompleteDeferred.add( s.complete );\n\t\tjqXHR.done( s.success );\n\t\tjqXHR.fail( s.error );\n\n\t\t// Get transport\n\t\ttransport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );\n\n\t\t// If no transport, we auto-abort\n\t\tif ( !transport ) {\n\t\t\tdone( -1, \"No Transport\" );\n\t\t} else {\n\t\t\tjqXHR.readyState = 1;\n\n\t\t\t// Send global event\n\t\t\tif ( fireGlobals ) {\n\t\t\t\tglobalEventContext.trigger( \"ajaxSend\", [ jqXHR, s ] );\n\t\t\t}\n\n\t\t\t// If request was aborted inside ajaxSend, stop there\n\t\t\tif ( completed ) {\n\t\t\t\treturn jqXHR;\n\t\t\t}\n\n\t\t\t// Timeout\n\t\t\tif ( s.async && s.timeout > 0 ) {\n\t\t\t\ttimeoutTimer = window.setTimeout( function() {\n\t\t\t\t\tjqXHR.abort( \"timeout\" );\n\t\t\t\t}, s.timeout );\n\t\t\t}\n\n\t\t\ttry {\n\t\t\t\tcompleted = false;\n\t\t\t\ttransport.send( requestHeaders, done );\n\t\t\t} catch ( e ) {\n\n\t\t\t\t// Rethrow post-completion exceptions\n\t\t\t\tif ( completed ) {\n\t\t\t\t\tthrow e;\n\t\t\t\t}\n\n\t\t\t\t// Propagate others as results\n\t\t\t\tdone( -1, e );\n\t\t\t}\n\t\t}\n\n\t\t// Callback for when everything is done\n\t\tfunction done( status, nativeStatusText, responses, headers ) {\n\t\t\tvar isSuccess, success, error, response, modified,\n\t\t\t\tstatusText = nativeStatusText;\n\n\t\t\t// Ignore repeat invocations\n\t\t\tif ( completed ) {\n\t\t\t\treturn;\n\t\t\t}\n\n\t\t\tcompleted = true;\n\n\t\t\t// Clear timeout if it exists\n\t\t\tif ( timeoutTimer ) {\n\t\t\t\twindow.clearTimeout( timeoutTimer );\n\t\t\t}\n\n\t\t\t// Dereference transport for early garbage collection\n\t\t\t// (no matter how long the jqXHR object will be used)\n\t\t\ttransport = undefined;\n\n\t\t\t// Cache response headers\n\t\t\tresponseHeadersString = headers || \"\";\n\n\t\t\t// Set readyState\n\t\t\tjqXHR.readyState = status > 0 ? 4 : 0;\n\n\t\t\t// Determine if successful\n\t\t\tisSuccess = status >= 200 && status < 300 || status === 304;\n\n\t\t\t// Get response data\n\t\t\tif ( responses ) {\n\t\t\t\tresponse = ajaxHandleResponses( s, jqXHR, responses );\n\t\t\t}\n\n\t\t\t// Convert no matter what (that way responseXXX fields are always set)\n\t\t\tresponse = ajaxConvert( s, response, jqXHR, isSuccess );\n\n\t\t\t// If successful, handle type chaining\n\t\t\tif ( isSuccess ) {\n\n\t\t\t\t// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.\n\t\t\t\tif ( s.ifModified ) {\n\t\t\t\t\tmodified = jqXHR.getResponseHeader( \"Last-Modified\" );\n\t\t\t\t\tif ( modified ) {\n\t\t\t\t\t\tjQuery.lastModified[ cacheURL ] = modified;\n\t\t\t\t\t}\n\t\t\t\t\tmodified = jqXHR.getResponseHeader( \"etag\" );\n\t\t\t\t\tif ( modified ) {\n\t\t\t\t\t\tjQuery.etag[ cacheURL ] = modified;\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\t// if no content\n\t\t\t\tif ( status === 204 || s.type === \"HEAD\" ) {\n\t\t\t\t\tstatusText = \"nocontent\";\n\n\t\t\t\t// if not modified\n\t\t\t\t} else if ( status === 304 ) {\n\t\t\t\t\tstatusText = \"notmodified\";\n\n\t\t\t\t// If we have data, let's convert it\n\t\t\t\t} else {\n\t\t\t\t\tstatusText = response.state;\n\t\t\t\t\tsuccess = response.data;\n\t\t\t\t\terror = response.error;\n\t\t\t\t\tisSuccess = !error;\n\t\t\t\t}\n\t\t\t} else {\n\n\t\t\t\t// Extract error from statusText and normalize for non-aborts\n\t\t\t\terror = statusText;\n\t\t\t\tif ( status || !statusText ) {\n\t\t\t\t\tstatusText = \"error\";\n\t\t\t\t\tif ( status < 0 ) {\n\t\t\t\t\t\tstatus = 0;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t// Set data for the fake xhr object\n\t\t\tjqXHR.status = status;\n\t\t\tjqXHR.statusText = ( nativeStatusText || statusText ) + \"\";\n\n\t\t\t// Success/Error\n\t\t\tif ( isSuccess ) {\n\t\t\t\tdeferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );\n\t\t\t} else {\n\t\t\t\tdeferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );\n\t\t\t}\n\n\t\t\t// Status-dependent callbacks\n\t\t\tjqXHR.statusCode( statusCode );\n\t\t\tstatusCode = undefined;\n\n\t\t\tif ( fireGlobals ) {\n\t\t\t\tglobalEventContext.trigger( isSuccess ? \"ajaxSuccess\" : \"ajaxError\",\n\t\t\t\t\t[ jqXHR, s, isSuccess ? success : error ] );\n\t\t\t}\n\n\t\t\t// Complete\n\t\t\tcompleteDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );\n\n\t\t\tif ( fireGlobals ) {\n\t\t\t\tglobalEventContext.trigger( \"ajaxComplete\", [ jqXHR, s ] );\n\n\t\t\t\t// Handle the global AJAX counter\n\t\t\t\tif ( !( --jQuery.active ) ) {\n\t\t\t\t\tjQuery.event.trigger( \"ajaxStop\" );\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\treturn jqXHR;\n\t},\n\n\tgetJSON: function( url, data, callback ) {\n\t\treturn jQuery.get( url, data, callback, \"json\" );\n\t},\n\n\tgetScript: function( url, callback ) {\n\t\treturn jQuery.get( url, undefined, callback, \"script\" );\n\t}\n} );\n\njQuery.each( [ \"get\", \"post\" ], function( i, method ) {\n\tjQuery[ method ] = function( url, data, callback, type ) {\n\n\t\t// Shift arguments if data argument was omitted\n\t\tif ( isFunction( data ) ) {\n\t\t\ttype = type || callback;\n\t\t\tcallback = data;\n\t\t\tdata = undefined;\n\t\t}\n\n\t\t// The url can be an options object (which then must have .url)\n\t\treturn jQuery.ajax( jQuery.extend( {\n\t\t\turl: url,\n\t\t\ttype: method,\n\t\t\tdataType: type,\n\t\t\tdata: data,\n\t\t\tsuccess: callback\n\t\t}, jQuery.isPlainObject( url ) && url ) );\n\t};\n} );\n\n\njQuery._evalUrl = function( url ) {\n\treturn jQuery.ajax( {\n\t\turl: url,\n\n\t\t// Make this explicit, since user can override this through ajaxSetup (#11264)\n\t\ttype: \"GET\",\n\t\tdataType: \"script\",\n\t\tcache: true,\n\t\tasync: false,\n\t\tglobal: false,\n\t\t\"throws\": true\n\t} );\n};\n\n\njQuery.fn.extend( {\n\twrapAll: function( html ) {\n\t\tvar wrap;\n\n\t\tif ( this[ 0 ] ) {\n\t\t\tif ( isFunction( html ) ) {\n\t\t\t\thtml = html.call( this[ 0 ] );\n\t\t\t}\n\n\t\t\t// The elements to wrap the target around\n\t\t\twrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true );\n\n\t\t\tif ( this[ 0 ].parentNode ) {\n\t\t\t\twrap.insertBefore( this[ 0 ] );\n\t\t\t}\n\n\t\t\twrap.map( function() {\n\t\t\t\tvar elem = this;\n\n\t\t\t\twhile ( elem.firstElementChild ) {\n\t\t\t\t\telem = elem.firstElementChild;\n\t\t\t\t}\n\n\t\t\t\treturn elem;\n\t\t\t} ).append( this );\n\t\t}\n\n\t\treturn this;\n\t},\n\n\twrapInner: function( html ) {\n\t\tif ( isFunction( html ) ) {\n\t\t\treturn this.each( function( i ) {\n\t\t\t\tjQuery( this ).wrapInner( html.call( this, i ) );\n\t\t\t} );\n\t\t}\n\n\t\treturn this.each( function() {\n\t\t\tvar self = jQuery( this ),\n\t\t\t\tcontents = self.contents();\n\n\t\t\tif ( contents.length ) {\n\t\t\t\tcontents.wrapAll( html );\n\n\t\t\t} else {\n\t\t\t\tself.append( html );\n\t\t\t}\n\t\t} );\n\t},\n\n\twrap: function( html ) {\n\t\tvar htmlIsFunction = isFunction( html );\n\n\t\treturn this.each( function( i ) {\n\t\t\tjQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html );\n\t\t} );\n\t},\n\n\tunwrap: function( selector ) {\n\t\tthis.parent( selector ).not( \"body\" ).each( function() {\n\t\t\tjQuery( this ).replaceWith( this.childNodes );\n\t\t} );\n\t\treturn this;\n\t}\n} );\n\n\njQuery.expr.pseudos.hidden = function( elem ) {\n\treturn !jQuery.expr.pseudos.visible( elem );\n};\njQuery.expr.pseudos.visible = function( elem ) {\n\treturn !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length );\n};\n\n\n\n\njQuery.ajaxSettings.xhr = function() {\n\ttry {\n\t\treturn new window.XMLHttpRequest();\n\t} catch ( e ) {}\n};\n\nvar xhrSuccessStatus = {\n\n\t\t// File protocol always yields status code 0, assume 200\n\t\t0: 200,\n\n\t\t// Support: IE <=9 only\n\t\t// #1450: sometimes IE returns 1223 when it should be 204\n\t\t1223: 204\n\t},\n\txhrSupported = jQuery.ajaxSettings.xhr();\n\nsupport.cors = !!xhrSupported && ( \"withCredentials\" in xhrSupported );\nsupport.ajax = xhrSupported = !!xhrSupported;\n\njQuery.ajaxTransport( function( options ) {\n\tvar callback, errorCallback;\n\n\t// Cross domain only allowed if supported through XMLHttpRequest\n\tif ( support.cors || xhrSupported && !options.crossDomain ) {\n\t\treturn {\n\t\t\tsend: function( headers, complete ) {\n\t\t\t\tvar i,\n\t\t\t\t\txhr = options.xhr();\n\n\t\t\t\txhr.open(\n\t\t\t\t\toptions.type,\n\t\t\t\t\toptions.url,\n\t\t\t\t\toptions.async,\n\t\t\t\t\toptions.username,\n\t\t\t\t\toptions.password\n\t\t\t\t);\n\n\t\t\t\t// Apply custom fields if provided\n\t\t\t\tif ( options.xhrFields ) {\n\t\t\t\t\tfor ( i in options.xhrFields ) {\n\t\t\t\t\t\txhr[ i ] = options.xhrFields[ i ];\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t\t// Override mime type if needed\n\t\t\t\tif ( options.mimeType && xhr.overrideMimeType ) {\n\t\t\t\t\txhr.overrideMimeType( options.mimeType );\n\t\t\t\t}\n\n\t\t\t\t// X-Requested-With header\n\t\t\t\t// For cross-domain requests, seeing as conditions for a preflight are\n\t\t\t\t// akin to a jigsaw puzzle, we simply never set it to be sure.\n\t\t\t\t// (it can always be set on a per-request basis or even using ajaxSetup)\n\t\t\t\t// For same-domain requests, won't change header if already provided.\n\t\t\t\tif ( !options.crossDomain && !headers[ \"X-Requested-With\" ] ) {\n\t\t\t\t\theaders[ \"X-Requested-With\" ] = \"XMLHttpRequest\";\n\t\t\t\t}\n\n\t\t\t\t// Set headers\n\t\t\t\tfor ( i in headers ) {\n\t\t\t\t\txhr.setRequestHeader( i, headers[ i ] );\n\t\t\t\t}\n\n\t\t\t\t// Callback\n\t\t\t\tcallback = function( type ) {\n\t\t\t\t\treturn function() {\n\t\t\t\t\t\tif ( callback ) {\n\t\t\t\t\t\t\tcallback = errorCallback = xhr.onload =\n\t\t\t\t\t\t\t\txhr.onerror = xhr.onabort = xhr.ontimeout =\n\t\t\t\t\t\t\t\t\txhr.onreadystatechange = null;\n\n\t\t\t\t\t\t\tif ( type === \"abort\" ) {\n\t\t\t\t\t\t\t\txhr.abort();\n\t\t\t\t\t\t\t} else if ( type === \"error\" ) {\n\n\t\t\t\t\t\t\t\t// Support: IE <=9 only\n\t\t\t\t\t\t\t\t// On a manual native abort, IE9 throws\n\t\t\t\t\t\t\t\t// errors on any property access that is not readyState\n\t\t\t\t\t\t\t\tif ( typeof xhr.status !== \"number\" ) {\n\t\t\t\t\t\t\t\t\tcomplete( 0, \"error\" );\n\t\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\t\tcomplete(\n\n\t\t\t\t\t\t\t\t\t\t// File: protocol always yields status 0; see #8605, #14207\n\t\t\t\t\t\t\t\t\t\txhr.status,\n\t\t\t\t\t\t\t\t\t\txhr.statusText\n\t\t\t\t\t\t\t\t\t);\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t} else {\n\t\t\t\t\t\t\t\tcomplete(\n\t\t\t\t\t\t\t\t\txhrSuccessStatus[ xhr.status ] || xhr.status,\n\t\t\t\t\t\t\t\t\txhr.statusText,\n\n\t\t\t\t\t\t\t\t\t// Support: IE <=9 only\n\t\t\t\t\t\t\t\t\t// IE9 has no XHR2 but throws on binary (trac-11426)\n\t\t\t\t\t\t\t\t\t// For XHR2 non-text, let the caller handle it (gh-2498)\n\t\t\t\t\t\t\t\t\t( xhr.responseType || \"text\" ) !== \"text\" ||\n\t\t\t\t\t\t\t\t\ttypeof xhr.responseText !== \"string\" ?\n\t\t\t\t\t\t\t\t\t\t{ binary: xhr.response } :\n\t\t\t\t\t\t\t\t\t\t{ text: xhr.responseText },\n\t\t\t\t\t\t\t\t\txhr.getAllResponseHeaders()\n\t\t\t\t\t\t\t\t);\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t};\n\t\t\t\t};\n\n\t\t\t\t// Listen to events\n\t\t\t\txhr.onload = callback();\n\t\t\t\terrorCallback = xhr.onerror = xhr.ontimeout = callback( \"error\" );\n\n\t\t\t\t// Support: IE 9 only\n\t\t\t\t// Use onreadystatechange to replace onabort\n\t\t\t\t// to handle uncaught aborts\n\t\t\t\tif ( xhr.onabort !== undefined ) {\n\t\t\t\t\txhr.onabort = errorCallback;\n\t\t\t\t} else {\n\t\t\t\t\txhr.onreadystatechange = function() {\n\n\t\t\t\t\t\t// Check readyState before timeout as it changes\n\t\t\t\t\t\tif ( xhr.readyState === 4 ) {\n\n\t\t\t\t\t\t\t// Allow onerror to be called first,\n\t\t\t\t\t\t\t// but that will not handle a native abort\n\t\t\t\t\t\t\t// Also, save errorCallback to a variable\n\t\t\t\t\t\t\t// as xhr.onerror cannot be accessed\n\t\t\t\t\t\t\twindow.setTimeout( function() {\n\t\t\t\t\t\t\t\tif ( callback ) {\n\t\t\t\t\t\t\t\t\terrorCallback();\n\t\t\t\t\t\t\t\t}\n\t\t\t\t\t\t\t} );\n\t\t\t\t\t\t}\n\t\t\t\t\t};\n\t\t\t\t}\n\n\t\t\t\t// Create the abort callback\n\t\t\t\tcallback = callback( \"abort\" );\n\n\t\t\t\ttry {\n\n\t\t\t\t\t// Do send the request (this may raise an exception)\n\t\t\t\t\txhr.send( options.hasContent && options.data || null );\n\t\t\t\t} catch ( e ) {\n\n\t\t\t\t\t// #14683: Only rethrow if this hasn't been notified as an error yet\n\t\t\t\t\tif ( callback ) {\n\t\t\t\t\t\tthrow e;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t},\n\n\t\t\tabort: function() {\n\t\t\t\tif ( callback ) {\n\t\t\t\t\tcallback();\n\t\t\t\t}\n\t\t\t}\n\t\t};\n\t}\n} );\n\n\n\n\n// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432)\njQuery.ajaxPrefilter( function( s ) {\n\tif ( s.crossDomain ) {\n\t\ts.contents.script = false;\n\t}\n} );\n\n// Install script dataType\njQuery.ajaxSetup( {\n\taccepts: {\n\t\tscript: \"text/javascript, application/javascript, \" +\n\t\t\t\"application/ecmascript, application/x-ecmascript\"\n\t},\n\tcontents: {\n\t\tscript: /\\b(?:java|ecma)script\\b/\n\t},\n\tconverters: {\n\t\t\"text script\": function( text ) {\n\t\t\tjQuery.globalEval( text );\n\t\t\treturn text;\n\t\t}\n\t}\n} );\n\n// Handle cache's special case and crossDomain\njQuery.ajaxPrefilter( \"script\", function( s ) {\n\tif ( s.cache === undefined ) {\n\t\ts.cache = false;\n\t}\n\tif ( s.crossDomain ) {\n\t\ts.type = \"GET\";\n\t}\n} );\n\n// Bind script tag hack transport\njQuery.ajaxTransport( \"script\", function( s ) {\n\n\t// This transport only deals with cross domain requests\n\tif ( s.crossDomain ) {\n\t\tvar script, callback;\n\t\treturn {\n\t\t\tsend: function( _, complete ) {\n\t\t\t\tscript = jQuery( \"<script>\" ).prop( {\n\t\t\t\t\tcharset: s.scriptCharset,\n\t\t\t\t\tsrc: s.url\n\t\t\t\t} ).on(\n\t\t\t\t\t\"load error\",\n\t\t\t\t\tcallback = function( evt ) {\n\t\t\t\t\t\tscript.remove();\n\t\t\t\t\t\tcallback = null;\n\t\t\t\t\t\tif ( evt ) {\n\t\t\t\t\t\t\tcomplete( evt.type === \"error\" ? 404 : 200, evt.type );\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t);\n\n\t\t\t\t// Use native DOM manipulation to avoid our domManip AJAX trickery\n\t\t\t\tdocument.head.appendChild( script[ 0 ] );\n\t\t\t},\n\t\t\tabort: function() {\n\t\t\t\tif ( callback ) {\n\t\t\t\t\tcallback();\n\t\t\t\t}\n\t\t\t}\n\t\t};\n\t}\n} );\n\n\n\n\nvar oldCallbacks = [],\n\trjsonp = /(=)\\?(?=&|$)|\\?\\?/;\n\n// Default jsonp settings\njQuery.ajaxSetup( {\n\tjsonp: \"callback\",\n\tjsonpCallback: function() {\n\t\tvar callback = oldCallbacks.pop() || ( jQuery.expando + \"_\" + ( nonce++ ) );\n\t\tthis[ callback ] = true;\n\t\treturn callback;\n\t}\n} );\n\n// Detect, normalize options and install callbacks for jsonp requests\njQuery.ajaxPrefilter( \"json jsonp\", function( s, originalSettings, jqXHR ) {\n\n\tvar callbackName, overwritten, responseContainer,\n\t\tjsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?\n\t\t\t\"url\" :\n\t\t\ttypeof s.data === \"string\" &&\n\t\t\t\t( s.contentType || \"\" )\n\t\t\t\t\t.indexOf( \"application/x-www-form-urlencoded\" ) === 0 &&\n\t\t\t\trjsonp.test( s.data ) && \"data\"\n\t\t);\n\n\t// Handle iff the expected data type is \"jsonp\" or we have a parameter to set\n\tif ( jsonProp || s.dataTypes[ 0 ] === \"jsonp\" ) {\n\n\t\t// Get callback name, remembering preexisting value associated with it\n\t\tcallbackName = s.jsonpCallback = isFunction( s.jsonpCallback ) ?\n\t\t\ts.jsonpCallback() :\n\t\t\ts.jsonpCallback;\n\n\t\t// Insert callback into url or form data\n\t\tif ( jsonProp ) {\n\t\t\ts[ jsonProp ] = s[ jsonProp ].replace( rjsonp, \"$1\" + callbackName );\n\t\t} else if ( s.jsonp !== false ) {\n\t\t\ts.url += ( rquery.test( s.url ) ? \"&\" : \"?\" ) + s.jsonp + \"=\" + callbackName;\n\t\t}\n\n\t\t// Use data converter to retrieve json after script execution\n\t\ts.converters[ \"script json\" ] = function() {\n\t\t\tif ( !responseContainer ) {\n\t\t\t\tjQuery.error( callbackName + \" was not called\" );\n\t\t\t}\n\t\t\treturn responseContainer[ 0 ];\n\t\t};\n\n\t\t// Force json dataType\n\t\ts.dataTypes[ 0 ] = \"json\";\n\n\t\t// Install callback\n\t\toverwritten = window[ callbackName ];\n\t\twindow[ callbackName ] = function() {\n\t\t\tresponseContainer = arguments;\n\t\t};\n\n\t\t// Clean-up function (fires after converters)\n\t\tjqXHR.always( function() {\n\n\t\t\t// If previous value didn't exist - remove it\n\t\t\tif ( overwritten === undefined ) {\n\t\t\t\tjQuery( window ).removeProp( callbackName );\n\n\t\t\t// Otherwise restore preexisting value\n\t\t\t} else {\n\t\t\t\twindow[ callbackName ] = overwritten;\n\t\t\t}\n\n\t\t\t// Save back as free\n\t\t\tif ( s[ callbackName ] ) {\n\n\t\t\t\t// Make sure that re-using the options doesn't screw things around\n\t\t\t\ts.jsonpCallback = originalSettings.jsonpCallback;\n\n\t\t\t\t// Save the callback name for future use\n\t\t\t\toldCallbacks.push( callbackName );\n\t\t\t}\n\n\t\t\t// Call if it was a function and we have a response\n\t\t\tif ( responseContainer && isFunction( overwritten ) ) {\n\t\t\t\toverwritten( responseContainer[ 0 ] );\n\t\t\t}\n\n\t\t\tresponseContainer = overwritten = undefined;\n\t\t} );\n\n\t\t// Delegate to script\n\t\treturn \"script\";\n\t}\n} );\n\n\n\n\n// Support: Safari 8 only\n// In Safari 8 documents created via document.implementation.createHTMLDocument\n// collapse sibling forms: the second one becomes a child of the first one.\n// Because of that, this security measure has to be disabled in Safari 8.\n// https://bugs.webkit.org/show_bug.cgi?id=137337\nsupport.createHTMLDocument = ( function() {\n\tvar body = document.implementation.createHTMLDocument( \"\" ).body;\n\tbody.innerHTML = \"<form></form><form></form>\";\n\treturn body.childNodes.length === 2;\n} )();\n\n\n// Argument \"data\" should be string of html\n// context (optional): If specified, the fragment will be created in this context,\n// defaults to document\n// keepScripts (optional): If true, will include scripts passed in the html string\njQuery.parseHTML = function( data, context, keepScripts ) {\n\tif ( typeof data !== \"string\" ) {\n\t\treturn [];\n\t}\n\tif ( typeof context === \"boolean\" ) {\n\t\tkeepScripts = context;\n\t\tcontext = false;\n\t}\n\n\tvar base, parsed, scripts;\n\n\tif ( !context ) {\n\n\t\t// Stop scripts or inline event handlers from being executed immediately\n\t\t// by using document.implementation\n\t\tif ( support.createHTMLDocument ) {\n\t\t\tcontext = document.implementation.createHTMLDocument( \"\" );\n\n\t\t\t// Set the base href for the created document\n\t\t\t// so any parsed elements with URLs\n\t\t\t// are based on the document's URL (gh-2965)\n\t\t\tbase = context.createElement( \"base\" );\n\t\t\tbase.href = document.location.href;\n\t\t\tcontext.head.appendChild( base );\n\t\t} else {\n\t\t\tcontext = document;\n\t\t}\n\t}\n\n\tparsed = rsingleTag.exec( data );\n\tscripts = !keepScripts && [];\n\n\t// Single tag\n\tif ( parsed ) {\n\t\treturn [ context.createElement( parsed[ 1 ] ) ];\n\t}\n\n\tparsed = buildFragment( [ data ], context, scripts );\n\n\tif ( scripts && scripts.length ) {\n\t\tjQuery( scripts ).remove();\n\t}\n\n\treturn jQuery.merge( [], parsed.childNodes );\n};\n\n\n/**\n * Load a url into a page\n */\njQuery.fn.load = function( url, params, callback ) {\n\tvar selector, type, response,\n\t\tself = this,\n\t\toff = url.indexOf( \" \" );\n\n\tif ( off > -1 ) {\n\t\tselector = stripAndCollapse( url.slice( off ) );\n\t\turl = url.slice( 0, off );\n\t}\n\n\t// If it's a function\n\tif ( isFunction( params ) ) {\n\n\t\t// We assume that it's the callback\n\t\tcallback = params;\n\t\tparams = undefined;\n\n\t// Otherwise, build a param string\n\t} else if ( params && typeof params === \"object\" ) {\n\t\ttype = \"POST\";\n\t}\n\n\t// If we have elements to modify, make the request\n\tif ( self.length > 0 ) {\n\t\tjQuery.ajax( {\n\t\t\turl: url,\n\n\t\t\t// If \"type\" variable is undefined, then \"GET\" method will be used.\n\t\t\t// Make value of this field explicit since\n\t\t\t// user can override it through ajaxSetup method\n\t\t\ttype: type || \"GET\",\n\t\t\tdataType: \"html\",\n\t\t\tdata: params\n\t\t} ).done( function( responseText ) {\n\n\t\t\t// Save response for use in complete callback\n\t\t\tresponse = arguments;\n\n\t\t\tself.html( selector ?\n\n\t\t\t\t// If a selector was specified, locate the right elements in a dummy div\n\t\t\t\t// Exclude scripts to avoid IE 'Permission Denied' errors\n\t\t\t\tjQuery( \"<div>\" ).append( jQuery.parseHTML( responseText ) ).find( selector ) :\n\n\t\t\t\t// Otherwise use the full result\n\t\t\t\tresponseText );\n\n\t\t// If the request succeeds, this function gets \"data\", \"status\", \"jqXHR\"\n\t\t// but they are ignored because response was set above.\n\t\t// If it fails, this function gets \"jqXHR\", \"status\", \"error\"\n\t\t} ).always( callback && function( jqXHR, status ) {\n\t\t\tself.each( function() {\n\t\t\t\tcallback.apply( this, response || [ jqXHR.responseText, status, jqXHR ] );\n\t\t\t} );\n\t\t} );\n\t}\n\n\treturn this;\n};\n\n\n\n\n// Attach a bunch of functions for handling common AJAX events\njQuery.each( [\n\t\"ajaxStart\",\n\t\"ajaxStop\",\n\t\"ajaxComplete\",\n\t\"ajaxError\",\n\t\"ajaxSuccess\",\n\t\"ajaxSend\"\n], function( i, type ) {\n\tjQuery.fn[ type ] = function( fn ) {\n\t\treturn this.on( type, fn );\n\t};\n} );\n\n\n\n\njQuery.expr.pseudos.animated = function( elem ) {\n\treturn jQuery.grep( jQuery.timers, function( fn ) {\n\t\treturn elem === fn.elem;\n\t} ).length;\n};\n\n\n\n\njQuery.offset = {\n\tsetOffset: function( elem, options, i ) {\n\t\tvar curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,\n\t\t\tposition = jQuery.css( elem, \"position\" ),\n\t\t\tcurElem = jQuery( elem ),\n\t\t\tprops = {};\n\n\t\t// Set position first, in-case top/left are set even on static elem\n\t\tif ( position === \"static\" ) {\n\t\t\telem.style.position = \"relative\";\n\t\t}\n\n\t\tcurOffset = curElem.offset();\n\t\tcurCSSTop = jQuery.css( elem, \"top\" );\n\t\tcurCSSLeft = jQuery.css( elem, \"left\" );\n\t\tcalculatePosition = ( position === \"absolute\" || position === \"fixed\" ) &&\n\t\t\t( curCSSTop + curCSSLeft ).indexOf( \"auto\" ) > -1;\n\n\t\t// Need to be able to calculate position if either\n\t\t// top or left is auto and position is either absolute or fixed\n\t\tif ( calculatePosition ) {\n\t\t\tcurPosition = curElem.position();\n\t\t\tcurTop = curPosition.top;\n\t\t\tcurLeft = curPosition.left;\n\n\t\t} else {\n\t\t\tcurTop = parseFloat( curCSSTop ) || 0;\n\t\t\tcurLeft = parseFloat( curCSSLeft ) || 0;\n\t\t}\n\n\t\tif ( isFunction( options ) ) {\n\n\t\t\t// Use jQuery.extend here to allow modification of coordinates argument (gh-1848)\n\t\t\toptions = options.call( elem, i, jQuery.extend( {}, curOffset ) );\n\t\t}\n\n\t\tif ( options.top != null ) {\n\t\t\tprops.top = ( options.top - curOffset.top ) + curTop;\n\t\t}\n\t\tif ( options.left != null ) {\n\t\t\tprops.left = ( options.left - curOffset.left ) + curLeft;\n\t\t}\n\n\t\tif ( \"using\" in options ) {\n\t\t\toptions.using.call( elem, props );\n\n\t\t} else {\n\t\t\tcurElem.css( props );\n\t\t}\n\t}\n};\n\njQuery.fn.extend( {\n\n\t// offset() relates an element's border box to the document origin\n\toffset: function( options ) {\n\n\t\t// Preserve chaining for setter\n\t\tif ( arguments.length ) {\n\t\t\treturn options === undefined ?\n\t\t\t\tthis :\n\t\t\t\tthis.each( function( i ) {\n\t\t\t\t\tjQuery.offset.setOffset( this, options, i );\n\t\t\t\t} );\n\t\t}\n\n\t\tvar rect, win,\n\t\t\telem = this[ 0 ];\n\n\t\tif ( !elem ) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Return zeros for disconnected and hidden (display: none) elements (gh-2310)\n\t\t// Support: IE <=11 only\n\t\t// Running getBoundingClientRect on a\n\t\t// disconnected node in IE throws an error\n\t\tif ( !elem.getClientRects().length ) {\n\t\t\treturn { top: 0, left: 0 };\n\t\t}\n\n\t\t// Get document-relative position by adding viewport scroll to viewport-relative gBCR\n\t\trect = elem.getBoundingClientRect();\n\t\twin = elem.ownerDocument.defaultView;\n\t\treturn {\n\t\t\ttop: rect.top + win.pageYOffset,\n\t\t\tleft: rect.left + win.pageXOffset\n\t\t};\n\t},\n\n\t// position() relates an element's margin box to its offset parent's padding box\n\t// This corresponds to the behavior of CSS absolute positioning\n\tposition: function() {\n\t\tif ( !this[ 0 ] ) {\n\t\t\treturn;\n\t\t}\n\n\t\tvar offsetParent, offset, doc,\n\t\t\telem = this[ 0 ],\n\t\t\tparentOffset = { top: 0, left: 0 };\n\n\t\t// position:fixed elements are offset from the viewport, which itself always has zero offset\n\t\tif ( jQuery.css( elem, \"position\" ) === \"fixed\" ) {\n\n\t\t\t// Assume position:fixed implies availability of getBoundingClientRect\n\t\t\toffset = elem.getBoundingClientRect();\n\n\t\t} else {\n\t\t\toffset = this.offset();\n\n\t\t\t// Account for the *real* offset parent, which can be the document or its root element\n\t\t\t// when a statically positioned element is identified\n\t\t\tdoc = elem.ownerDocument;\n\t\t\toffsetParent = elem.offsetParent || doc.documentElement;\n\t\t\twhile ( offsetParent &&\n\t\t\t\t( offsetParent === doc.body || offsetParent === doc.documentElement ) &&\n\t\t\t\tjQuery.css( offsetParent, \"position\" ) === \"static\" ) {\n\n\t\t\t\toffsetParent = offsetParent.parentNode;\n\t\t\t}\n\t\t\tif ( offsetParent && offsetParent !== elem && offsetParent.nodeType === 1 ) {\n\n\t\t\t\t// Incorporate borders into its offset, since they are outside its content origin\n\t\t\t\tparentOffset = jQuery( offsetParent ).offset();\n\t\t\t\tparentOffset.top += jQuery.css( offsetParent, \"borderTopWidth\", true );\n\t\t\t\tparentOffset.left += jQuery.css( offsetParent, \"borderLeftWidth\", true );\n\t\t\t}\n\t\t}\n\n\t\t// Subtract parent offsets and element margins\n\t\treturn {\n\t\t\ttop: offset.top - parentOffset.top - jQuery.css( elem, \"marginTop\", true ),\n\t\t\tleft: offset.left - parentOffset.left - jQuery.css( elem, \"marginLeft\", true )\n\t\t};\n\t},\n\n\t// This method will return documentElement in the following cases:\n\t// 1) For the element inside the iframe without offsetParent, this method will return\n\t// documentElement of the parent window\n\t// 2) For the hidden or detached element\n\t// 3) For body or html element, i.e. in case of the html node - it will return itself\n\t//\n\t// but those exceptions were never presented as a real life use-cases\n\t// and might be considered as more preferable results.\n\t//\n\t// This logic, however, is not guaranteed and can change at any point in the future\n\toffsetParent: function() {\n\t\treturn this.map( function() {\n\t\t\tvar offsetParent = this.offsetParent;\n\n\t\t\twhile ( offsetParent && jQuery.css( offsetParent, \"position\" ) === \"static\" ) {\n\t\t\t\toffsetParent = offsetParent.offsetParent;\n\t\t\t}\n\n\t\t\treturn offsetParent || documentElement;\n\t\t} );\n\t}\n} );\n\n// Create scrollLeft and scrollTop methods\njQuery.each( { scrollLeft: \"pageXOffset\", scrollTop: \"pageYOffset\" }, function( method, prop ) {\n\tvar top = \"pageYOffset\" === prop;\n\n\tjQuery.fn[ method ] = function( val ) {\n\t\treturn access( this, function( elem, method, val ) {\n\n\t\t\t// Coalesce documents and windows\n\t\t\tvar win;\n\t\t\tif ( isWindow( elem ) ) {\n\t\t\t\twin = elem;\n\t\t\t} else if ( elem.nodeType === 9 ) {\n\t\t\t\twin = elem.defaultView;\n\t\t\t}\n\n\t\t\tif ( val === undefined ) {\n\t\t\t\treturn win ? win[ prop ] : elem[ method ];\n\t\t\t}\n\n\t\t\tif ( win ) {\n\t\t\t\twin.scrollTo(\n\t\t\t\t\t!top ? val : win.pageXOffset,\n\t\t\t\t\ttop ? val : win.pageYOffset\n\t\t\t\t);\n\n\t\t\t} else {\n\t\t\t\telem[ method ] = val;\n\t\t\t}\n\t\t}, method, val, arguments.length );\n\t};\n} );\n\n// Support: Safari <=7 - 9.1, Chrome <=37 - 49\n// Add the top/left cssHooks using jQuery.fn.position\n// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084\n// Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347\n// getComputedStyle returns percent when specified for top/left/bottom/right;\n// rather than make the css module depend on the offset module, just check for it here\njQuery.each( [ \"top\", \"left\" ], function( i, prop ) {\n\tjQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition,\n\t\tfunction( elem, computed ) {\n\t\t\tif ( computed ) {\n\t\t\t\tcomputed = curCSS( elem, prop );\n\n\t\t\t\t// If curCSS returns percentage, fallback to offset\n\t\t\t\treturn rnumnonpx.test( computed ) ?\n\t\t\t\t\tjQuery( elem ).position()[ prop ] + \"px\" :\n\t\t\t\t\tcomputed;\n\t\t\t}\n\t\t}\n\t);\n} );\n\n\n// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods\njQuery.each( { Height: \"height\", Width: \"width\" }, function( name, type ) {\n\tjQuery.each( { padding: \"inner\" + name, content: type, \"\": \"outer\" + name },\n\t\tfunction( defaultExtra, funcName ) {\n\n\t\t// Margin is only for outerHeight, outerWidth\n\t\tjQuery.fn[ funcName ] = function( margin, value ) {\n\t\t\tvar chainable = arguments.length && ( defaultExtra || typeof margin !== \"boolean\" ),\n\t\t\t\textra = defaultExtra || ( margin === true || value === true ? \"margin\" : \"border\" );\n\n\t\t\treturn access( this, function( elem, type, value ) {\n\t\t\t\tvar doc;\n\n\t\t\t\tif ( isWindow( elem ) ) {\n\n\t\t\t\t\t// $( window ).outerWidth/Height return w/h including scrollbars (gh-1729)\n\t\t\t\t\treturn funcName.indexOf( \"outer\" ) === 0 ?\n\t\t\t\t\t\telem[ \"inner\" + name ] :\n\t\t\t\t\t\telem.document.documentElement[ \"client\" + name ];\n\t\t\t\t}\n\n\t\t\t\t// Get document width or height\n\t\t\t\tif ( elem.nodeType === 9 ) {\n\t\t\t\t\tdoc = elem.documentElement;\n\n\t\t\t\t\t// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],\n\t\t\t\t\t// whichever is greatest\n\t\t\t\t\treturn Math.max(\n\t\t\t\t\t\telem.body[ \"scroll\" + name ], doc[ \"scroll\" + name ],\n\t\t\t\t\t\telem.body[ \"offset\" + name ], doc[ \"offset\" + name ],\n\t\t\t\t\t\tdoc[ \"client\" + name ]\n\t\t\t\t\t);\n\t\t\t\t}\n\n\t\t\t\treturn value === undefined ?\n\n\t\t\t\t\t// Get width or height on the element, requesting but not forcing parseFloat\n\t\t\t\t\tjQuery.css( elem, type, extra ) :\n\n\t\t\t\t\t// Set width or height on the element\n\t\t\t\t\tjQuery.style( elem, type, value, extra );\n\t\t\t}, type, chainable ? margin : undefined, chainable );\n\t\t};\n\t} );\n} );\n\n\njQuery.each( ( \"blur focus focusin focusout resize scroll click dblclick \" +\n\t\"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave \" +\n\t\"change select submit keydown keypress keyup contextmenu\" ).split( \" \" ),\n\tfunction( i, name ) {\n\n\t// Handle event binding\n\tjQuery.fn[ name ] = function( data, fn ) {\n\t\treturn arguments.length > 0 ?\n\t\t\tthis.on( name, null, data, fn ) :\n\t\t\tthis.trigger( name );\n\t};\n} );\n\njQuery.fn.extend( {\n\thover: function( fnOver, fnOut ) {\n\t\treturn this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );\n\t}\n} );\n\n\n\n\njQuery.fn.extend( {\n\n\tbind: function( types, data, fn ) {\n\t\treturn this.on( types, null, data, fn );\n\t},\n\tunbind: function( types, fn ) {\n\t\treturn this.off( types, null, fn );\n\t},\n\n\tdelegate: function( selector, types, data, fn ) {\n\t\treturn this.on( types, selector, data, fn );\n\t},\n\tundelegate: function( selector, types, fn ) {\n\n\t\t// ( namespace ) or ( selector, types [, fn] )\n\t\treturn arguments.length === 1 ?\n\t\t\tthis.off( selector, \"**\" ) :\n\t\t\tthis.off( types, selector || \"**\", fn );\n\t}\n} );\n\n// Bind a function to a context, optionally partially applying any\n// arguments.\n// jQuery.proxy is deprecated to promote standards (specifically Function#bind)\n// However, it is not slated for removal any time soon\njQuery.proxy = function( fn, context ) {\n\tvar tmp, args, proxy;\n\n\tif ( typeof context === \"string\" ) {\n\t\ttmp = fn[ context ];\n\t\tcontext = fn;\n\t\tfn = tmp;\n\t}\n\n\t// Quick check to determine if target is callable, in the spec\n\t// this throws a TypeError, but we will just return undefined.\n\tif ( !isFunction( fn ) ) {\n\t\treturn undefined;\n\t}\n\n\t// Simulated bind\n\targs = slice.call( arguments, 2 );\n\tproxy = function() {\n\t\treturn fn.apply( context || this, args.concat( slice.call( arguments ) ) );\n\t};\n\n\t// Set the guid of unique handler to the same of original handler, so it can be removed\n\tproxy.guid = fn.guid = fn.guid || jQuery.guid++;\n\n\treturn proxy;\n};\n\njQuery.holdReady = function( hold ) {\n\tif ( hold ) {\n\t\tjQuery.readyWait++;\n\t} else {\n\t\tjQuery.ready( true );\n\t}\n};\njQuery.isArray = Array.isArray;\njQuery.parseJSON = JSON.parse;\njQuery.nodeName = nodeName;\njQuery.isFunction = isFunction;\njQuery.isWindow = isWindow;\njQuery.camelCase = camelCase;\njQuery.type = toType;\n\njQuery.now = Date.now;\n\njQuery.isNumeric = function( obj ) {\n\n\t// As of jQuery 3.0, isNumeric is limited to\n\t// strings and numbers (primitives or objects)\n\t// that can be coerced to finite numbers (gh-2662)\n\tvar type = jQuery.type( obj );\n\treturn ( type === \"number\" || type === \"string\" ) &&\n\n\t\t// parseFloat NaNs numeric-cast false positives (\"\")\n\t\t// ...but misinterprets leading-number strings, particularly hex literals (\"0x...\")\n\t\t// subtraction forces infinities to NaN\n\t\t!isNaN( obj - parseFloat( obj ) );\n};\n\n\n\n\n// Register as a named AMD module, since jQuery can be concatenated with other\n// files that may use define, but not via a proper concatenation script that\n// understands anonymous AMD modules. A named AMD is safest and most robust\n// way to register. Lowercase jquery is used because AMD module names are\n// derived from file names, and jQuery is normally delivered in a lowercase\n// file name. Do this after creating the global so that if an AMD module wants\n// to call noConflict to hide this version of jQuery, it will work.\n\n// Note that for maximum portability, libraries that are not jQuery should\n// declare themselves as anonymous modules, and avoid setting a global if an\n// AMD loader is present. jQuery is a special case. For more information, see\n// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon\n\nif ( true ) {\n\t!(__WEBPACK_AMD_DEFINE_ARRAY__ = [], __WEBPACK_AMD_DEFINE_RESULT__ = (function() {\n\t\treturn jQuery;\n\t}).apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__),\n\t\t\t\t__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));\n}\n\n\n\n\nvar\n\n\t// Map over jQuery in case of overwrite\n\t_jQuery = window.jQuery,\n\n\t// Map over the $ in case of overwrite\n\t_$ = window.$;\n\njQuery.noConflict = function( deep ) {\n\tif ( window.$ === jQuery ) {\n\t\twindow.$ = _$;\n\t}\n\n\tif ( deep && window.jQuery === jQuery ) {\n\t\twindow.jQuery = _jQuery;\n\t}\n\n\treturn jQuery;\n};\n\n// Expose jQuery and $ identifiers, even in AMD\n// (#7102#comment:10, https://github.com/jquery/jquery/pull/557)\n// and CommonJS for browser emulators (#13566)\nif ( !noGlobal ) {\n\twindow.jQuery = window.$ = jQuery;\n}\n\n\n\n\nreturn jQuery;\n} );\n\n\n//# sourceURL=webpack:///./node_modules/jquery/dist/jquery.js?");
/***/ }),
/***/ "./node_modules/leaflet-rotatedmarker/leaflet.rotatedMarker.js":
/*!*********************************************************************!*\
!*** ./node_modules/leaflet-rotatedmarker/leaflet.rotatedMarker.js ***!
\*********************************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("(function() {\r\n // save these original methods before they are overwritten\r\n var proto_initIcon = L.Marker.prototype._initIcon;\r\n var proto_setPos = L.Marker.prototype._setPos;\r\n\r\n var oldIE = (L.DomUtil.TRANSFORM === 'msTransform');\r\n\r\n L.Marker.addInitHook(function () {\r\n var iconOptions = this.options.icon && this.options.icon.options;\r\n var iconAnchor = iconOptions && this.options.icon.options.iconAnchor;\r\n if (iconAnchor) {\r\n iconAnchor = (iconAnchor[0] + 'px ' + iconAnchor[1] + 'px');\r\n }\r\n this.options.rotationOrigin = this.options.rotationOrigin || iconAnchor || 'center bottom' ;\r\n this.options.rotationAngle = this.options.rotationAngle || 0;\r\n\r\n // Ensure marker keeps rotated during dragging\r\n this.on('drag', function(e) { e.target._applyRotation(); });\r\n });\r\n\r\n L.Marker.include({\r\n _initIcon: function() {\r\n proto_initIcon.call(this);\r\n },\r\n\r\n _setPos: function (pos) {\r\n proto_setPos.call(this, pos);\r\n this._applyRotation();\r\n },\r\n\r\n _applyRotation: function () {\r\n if(this.options.rotationAngle) {\r\n this._icon.style[L.DomUtil.TRANSFORM+'Origin'] = this.options.rotationOrigin;\r\n\r\n if(oldIE) {\r\n // for IE 9, use the 2D rotation\r\n this._icon.style[L.DomUtil.TRANSFORM] = 'rotate(' + this.options.rotationAngle + 'deg)';\r\n } else {\r\n // for modern browsers, prefer the 3D accelerated version\r\n this._icon.style[L.DomUtil.TRANSFORM] += ' rotateZ(' + this.options.rotationAngle + 'deg)';\r\n }\r\n }\r\n },\r\n\r\n setRotationAngle: function(angle) {\r\n this.options.rotationAngle = angle;\r\n this.update();\r\n return this;\r\n },\r\n\r\n setRotationOrigin: function(origin) {\r\n this.options.rotationOrigin = origin;\r\n this.update();\r\n return this;\r\n }\r\n });\r\n})();\r\n\n\n//# sourceURL=webpack:///./node_modules/leaflet-rotatedmarker/leaflet.rotatedMarker.js?");
/***/ }),
/***/ "./node_modules/leaflet/dist/leaflet-src.js":
/*!**************************************************!*\
!*** ./node_modules/leaflet/dist/leaflet-src.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("/* @preserve\n * Leaflet 1.3.1, a JS library for interactive maps. http://leafletjs.com\n * (c) 2010-2017 Vladimir Agafonkin, (c) 2010-2011 CloudMade\n */\n\n(function (global, factory) {\n\t true ? factory(exports) :\n\tundefined;\n}(this, (function (exports) { 'use strict';\n\nvar version = \"1.3.1\";\n\n/*\r\n * @namespace Util\r\n *\r\n * Various utility functions, used by Leaflet internally.\r\n */\r\n\r\nvar freeze = Object.freeze;\r\nObject.freeze = function (obj) { return obj; };\r\n\r\n// @function extend(dest: Object, src?: Object): Object\r\n// Merges the properties of the `src` object (or multiple objects) into `dest` object and returns the latter. Has an `L.extend` shortcut.\r\nfunction extend(dest) {\r\n\tvar i, j, len, src;\r\n\r\n\tfor (j = 1, len = arguments.length; j < len; j++) {\r\n\t\tsrc = arguments[j];\r\n\t\tfor (i in src) {\r\n\t\t\tdest[i] = src[i];\r\n\t\t}\r\n\t}\r\n\treturn dest;\r\n}\r\n\r\n// @function create(proto: Object, properties?: Object): Object\r\n// Compatibility polyfill for [Object.create](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Object/create)\r\nvar create = Object.create || (function () {\r\n\tfunction F() {}\r\n\treturn function (proto) {\r\n\t\tF.prototype = proto;\r\n\t\treturn new F();\r\n\t};\r\n})();\r\n\r\n// @function bind(fn: Function, …): Function\r\n// Returns a new function bound to the arguments passed, like [Function.prototype.bind](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Function/bind).\r\n// Has a `L.bind()` shortcut.\r\nfunction bind(fn, obj) {\r\n\tvar slice = Array.prototype.slice;\r\n\r\n\tif (fn.bind) {\r\n\t\treturn fn.bind.apply(fn, slice.call(arguments, 1));\r\n\t}\r\n\r\n\tvar args = slice.call(arguments, 2);\r\n\r\n\treturn function () {\r\n\t\treturn fn.apply(obj, args.length ? args.concat(slice.call(arguments)) : arguments);\r\n\t};\r\n}\r\n\r\n// @property lastId: Number\r\n// Last unique ID used by [`stamp()`](#util-stamp)\r\nvar lastId = 0;\r\n\r\n// @function stamp(obj: Object): Number\r\n// Returns the unique ID of an object, assigning it one if it doesn't have it.\r\nfunction stamp(obj) {\r\n\t/*eslint-disable */\r\n\tobj._leaflet_id = obj._leaflet_id || ++lastId;\r\n\treturn obj._leaflet_id;\r\n\t/* eslint-enable */\r\n}\r\n\r\n// @function throttle(fn: Function, time: Number, context: Object): Function\r\n// Returns a function which executes function `fn` with the given scope `context`\r\n// (so that the `this` keyword refers to `context` inside `fn`'s code). The function\r\n// `fn` will be called no more than one time per given amount of `time`. The arguments\r\n// received by the bound function will be any arguments passed when binding the\r\n// function, followed by any arguments passed when invoking the bound function.\r\n// Has an `L.throttle` shortcut.\r\nfunction throttle(fn, time, context) {\r\n\tvar lock, args, wrapperFn, later;\r\n\r\n\tlater = function () {\r\n\t\t// reset lock and call if queued\r\n\t\tlock = false;\r\n\t\tif (args) {\r\n\t\t\twrapperFn.apply(context, args);\r\n\t\t\targs = false;\r\n\t\t}\r\n\t};\r\n\r\n\twrapperFn = function () {\r\n\t\tif (lock) {\r\n\t\t\t// called too soon, queue to call later\r\n\t\t\targs = arguments;\r\n\r\n\t\t} else {\r\n\t\t\t// call and lock until later\r\n\t\t\tfn.apply(context, arguments);\r\n\t\t\tsetTimeout(later, time);\r\n\t\t\tlock = true;\r\n\t\t}\r\n\t};\r\n\r\n\treturn wrapperFn;\r\n}\r\n\r\n// @function wrapNum(num: Number, range: Number[], includeMax?: Boolean): Number\r\n// Returns the number `num` modulo `range` in such a way so it lies within\r\n// `range[0]` and `range[1]`. The returned value will be always smaller than\r\n// `range[1]` unless `includeMax` is set to `true`.\r\nfunction wrapNum(x, range, includeMax) {\r\n\tvar max = range[1],\r\n\t min = range[0],\r\n\t d = max - min;\r\n\treturn x === max && includeMax ? x : ((x - min) % d + d) % d + min;\r\n}\r\n\r\n// @function falseFn(): Function\r\n// Returns a function which always returns `false`.\r\nfunction falseFn() { return false; }\r\n\r\n// @function formatNum(num: Number, digits?: Number): Number\r\n// Returns the number `num` rounded to `digits` decimals, or to 6 decimals by default.\r\nfunction formatNum(num, digits) {\r\n\tvar pow = Math.pow(10, (digits === undefined ? 6 : digits));\r\n\treturn Math.round(num * pow) / pow;\r\n}\r\n\r\n// @function trim(str: String): String\r\n// Compatibility polyfill for [String.prototype.trim](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/String/Trim)\r\nfunction trim(str) {\r\n\treturn str.trim ? str.trim() : str.replace(/^\\s+|\\s+$/g, '');\r\n}\r\n\r\n// @function splitWords(str: String): String[]\r\n// Trims and splits the string on whitespace and returns the array of parts.\r\nfunction splitWords(str) {\r\n\treturn trim(str).split(/\\s+/);\r\n}\r\n\r\n// @function setOptions(obj: Object, options: Object): Object\r\n// Merges the given properties to the `options` of the `obj` object, returning the resulting options. See `Class options`. Has an `L.setOptions` shortcut.\r\nfunction setOptions(obj, options) {\r\n\tif (!obj.hasOwnProperty('options')) {\r\n\t\tobj.options = obj.options ? create(obj.options) : {};\r\n\t}\r\n\tfor (var i in options) {\r\n\t\tobj.options[i] = options[i];\r\n\t}\r\n\treturn obj.options;\r\n}\r\n\r\n// @function getParamString(obj: Object, existingUrl?: String, uppercase?: Boolean): String\r\n// Converts an object into a parameter URL string, e.g. `{a: \"foo\", b: \"bar\"}`\r\n// translates to `'?a=foo&b=bar'`. If `existingUrl` is set, the parameters will\r\n// be appended at the end. If `uppercase` is `true`, the parameter names will\r\n// be uppercased (e.g. `'?A=foo&B=bar'`)\r\nfunction getParamString(obj, existingUrl, uppercase) {\r\n\tvar params = [];\r\n\tfor (var i in obj) {\r\n\t\tparams.push(encodeURIComponent(uppercase ? i.toUpperCase() : i) + '=' + encodeURIComponent(obj[i]));\r\n\t}\r\n\treturn ((!existingUrl || existingUrl.indexOf('?') === -1) ? '?' : '&') + params.join('&');\r\n}\r\n\r\nvar templateRe = /\\{ *([\\w_-]+) *\\}/g;\r\n\r\n// @function template(str: String, data: Object): String\r\n// Simple templating facility, accepts a template string of the form `'Hello {a}, {b}'`\r\n// and a data object like `{a: 'foo', b: 'bar'}`, returns evaluated string\r\n// `('Hello foo, bar')`. You can also specify functions instead of strings for\r\n// data values — they will be evaluated passing `data` as an argument.\r\nfunction template(str, data) {\r\n\treturn str.replace(templateRe, function (str, key) {\r\n\t\tvar value = data[key];\r\n\r\n\t\tif (value === undefined) {\r\n\t\t\tthrow new Error('No value provided for variable ' + str);\r\n\r\n\t\t} else if (typeof value === 'function') {\r\n\t\t\tvalue = value(data);\r\n\t\t}\r\n\t\treturn value;\r\n\t});\r\n}\r\n\r\n// @function isArray(obj): Boolean\r\n// Compatibility polyfill for [Array.isArray](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/isArray)\r\nvar isArray = Array.isArray || function (obj) {\r\n\treturn (Object.prototype.toString.call(obj) === '[object Array]');\r\n};\r\n\r\n// @function indexOf(array: Array, el: Object): Number\r\n// Compatibility polyfill for [Array.prototype.indexOf](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/indexOf)\r\nfunction indexOf(array, el) {\r\n\tfor (var i = 0; i < array.length; i++) {\r\n\t\tif (array[i] === el) { return i; }\r\n\t}\r\n\treturn -1;\r\n}\r\n\r\n// @property emptyImageUrl: String\r\n// Data URI string containing a base64-encoded empty GIF image.\r\n// Used as a hack to free memory from unused images on WebKit-powered\r\n// mobile devices (by setting image `src` to this string).\r\nvar emptyImageUrl = 'data:image/gif;base64,R0lGODlhAQABAAD/ACwAAAAAAQABAAACADs=';\r\n\r\n// inspired by http://paulirish.com/2011/requestanimationframe-for-smart-animating/\r\n\r\nfunction getPrefixed(name) {\r\n\treturn window['webkit' + name] || window['moz' + name] || window['ms' + name];\r\n}\r\n\r\nvar lastTime = 0;\r\n\r\n// fallback for IE 7-8\r\nfunction timeoutDefer(fn) {\r\n\tvar time = +new Date(),\r\n\t timeToCall = Math.max(0, 16 - (time - lastTime));\r\n\r\n\tlastTime = time + timeToCall;\r\n\treturn window.setTimeout(fn, timeToCall);\r\n}\r\n\r\nvar requestFn = window.requestAnimationFrame || getPrefixed('RequestAnimationFrame') || timeoutDefer;\r\nvar cancelFn = window.cancelAnimationFrame || getPrefixed('CancelAnimationFrame') ||\r\n\t\tgetPrefixed('CancelRequestAnimationFrame') || function (id) { window.clearTimeout(id); };\r\n\r\n// @function requestAnimFrame(fn: Function, context?: Object, immediate?: Boolean): Number\r\n// Schedules `fn` to be executed when the browser repaints. `fn` is bound to\r\n// `context` if given. When `immediate` is set, `fn` is called immediately if\r\n// the browser doesn't have native support for\r\n// [`window.requestAnimationFrame`](https://developer.mozilla.org/docs/Web/API/window/requestAnimationFrame),\r\n// otherwise it's delayed. Returns a request ID that can be used to cancel the request.\r\nfunction requestAnimFrame(fn, context, immediate) {\r\n\tif (immediate && requestFn === timeoutDefer) {\r\n\t\tfn.call(context);\r\n\t} else {\r\n\t\treturn requestFn.call(window, bind(fn, context));\r\n\t}\r\n}\r\n\r\n// @function cancelAnimFrame(id: Number): undefined\r\n// Cancels a previous `requestAnimFrame`. See also [window.cancelAnimationFrame](https://developer.mozilla.org/docs/Web/API/window/cancelAnimationFrame).\r\nfunction cancelAnimFrame(id) {\r\n\tif (id) {\r\n\t\tcancelFn.call(window, id);\r\n\t}\r\n}\r\n\n\nvar Util = (Object.freeze || Object)({\n\tfreeze: freeze,\n\textend: extend,\n\tcreate: create,\n\tbind: bind,\n\tlastId: lastId,\n\tstamp: stamp,\n\tthrottle: throttle,\n\twrapNum: wrapNum,\n\tfalseFn: falseFn,\n\tformatNum: formatNum,\n\ttrim: trim,\n\tsplitWords: splitWords,\n\tsetOptions: setOptions,\n\tgetParamString: getParamString,\n\ttemplate: template,\n\tisArray: isArray,\n\tindexOf: indexOf,\n\temptyImageUrl: emptyImageUrl,\n\trequestFn: requestFn,\n\tcancelFn: cancelFn,\n\trequestAnimFrame: requestAnimFrame,\n\tcancelAnimFrame: cancelAnimFrame\n});\n\n// @class Class\r\n// @aka L.Class\r\n\r\n// @section\r\n// @uninheritable\r\n\r\n// Thanks to John Resig and Dean Edwards for inspiration!\r\n\r\nfunction Class() {}\r\n\r\nClass.extend = function (props) {\r\n\r\n\t// @function extend(props: Object): Function\r\n\t// [Extends the current class](#class-inheritance) given the properties to be included.\r\n\t// Returns a Javascript function that is a class constructor (to be called with `new`).\r\n\tvar NewClass = function () {\r\n\r\n\t\t// call the constructor\r\n\t\tif (this.initialize) {\r\n\t\t\tthis.initialize.apply(this, arguments);\r\n\t\t}\r\n\r\n\t\t// call all constructor hooks\r\n\t\tthis.callInitHooks();\r\n\t};\r\n\r\n\tvar parentProto = NewClass.__super__ = this.prototype;\r\n\r\n\tvar proto = create(parentProto);\r\n\tproto.constructor = NewClass;\r\n\r\n\tNewClass.prototype = proto;\r\n\r\n\t// inherit parent's statics\r\n\tfor (var i in this) {\r\n\t\tif (this.hasOwnProperty(i) && i !== 'prototype' && i !== '__super__') {\r\n\t\t\tNewClass[i] = this[i];\r\n\t\t}\r\n\t}\r\n\r\n\t// mix static properties into the class\r\n\tif (props.statics) {\r\n\t\textend(NewClass, props.statics);\r\n\t\tdelete props.statics;\r\n\t}\r\n\r\n\t// mix includes into the prototype\r\n\tif (props.includes) {\r\n\t\tcheckDeprecatedMixinEvents(props.includes);\r\n\t\textend.apply(null, [proto].concat(props.includes));\r\n\t\tdelete props.includes;\r\n\t}\r\n\r\n\t// merge options\r\n\tif (proto.options) {\r\n\t\tprops.options = extend(create(proto.options), props.options);\r\n\t}\r\n\r\n\t// mix given properties into the prototype\r\n\textend(proto, props);\r\n\r\n\tproto._initHooks = [];\r\n\r\n\t// add method for calling all hooks\r\n\tproto.callInitHooks = function () {\r\n\r\n\t\tif (this._initHooksCalled) { return; }\r\n\r\n\t\tif (parentProto.callInitHooks) {\r\n\t\t\tparentProto.callInitHooks.call(this);\r\n\t\t}\r\n\r\n\t\tthis._initHooksCalled = true;\r\n\r\n\t\tfor (var i = 0, len = proto._initHooks.length; i < len; i++) {\r\n\t\t\tproto._initHooks[i].call(this);\r\n\t\t}\r\n\t};\r\n\r\n\treturn NewClass;\r\n};\r\n\r\n\r\n// @function include(properties: Object): this\r\n// [Includes a mixin](#class-includes) into the current class.\r\nClass.include = function (props) {\r\n\textend(this.prototype, props);\r\n\treturn this;\r\n};\r\n\r\n// @function mergeOptions(options: Object): this\r\n// [Merges `options`](#class-options) into the defaults of the class.\r\nClass.mergeOptions = function (options) {\r\n\textend(this.prototype.options, options);\r\n\treturn this;\r\n};\r\n\r\n// @function addInitHook(fn: Function): this\r\n// Adds a [constructor hook](#class-constructor-hooks) to the class.\r\nClass.addInitHook = function (fn) { // (Function) || (String, args...)\r\n\tvar args = Array.prototype.slice.call(arguments, 1);\r\n\r\n\tvar init = typeof fn === 'function' ? fn : function () {\r\n\t\tthis[fn].apply(this, args);\r\n\t};\r\n\r\n\tthis.prototype._initHooks = this.prototype._initHooks || [];\r\n\tthis.prototype._initHooks.push(init);\r\n\treturn this;\r\n};\r\n\r\nfunction checkDeprecatedMixinEvents(includes) {\r\n\tif (typeof L === 'undefined' || !L || !L.Mixin) { return; }\r\n\r\n\tincludes = isArray(includes) ? includes : [includes];\r\n\r\n\tfor (var i = 0; i < includes.length; i++) {\r\n\t\tif (includes[i] === L.Mixin.Events) {\r\n\t\t\tconsole.warn('Deprecated include of L.Mixin.Events: ' +\r\n\t\t\t\t'this property will be removed in future releases, ' +\r\n\t\t\t\t'please inherit from L.Evented instead.', new Error().stack);\r\n\t\t}\r\n\t}\r\n}\n\n/*\r\n * @class Evented\r\n * @aka L.Evented\r\n * @inherits Class\r\n *\r\n * A set of methods shared between event-powered classes (like `Map` and `Marker`). Generally, events allow you to execute some function when something happens with an object (e.g. the user clicks on the map, causing the map to fire `'click'` event).\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * map.on('click', function(e) {\r\n * \talert(e.latlng);\r\n * } );\r\n * ```\r\n *\r\n * Leaflet deals with event listeners by reference, so if you want to add a listener and then remove it, define it as a function:\r\n *\r\n * ```js\r\n * function onClick(e) { ... }\r\n *\r\n * map.on('click', onClick);\r\n * map.off('click', onClick);\r\n * ```\r\n */\r\n\r\nvar Events = {\r\n\t/* @method on(type: String, fn: Function, context?: Object): this\r\n\t * Adds a listener function (`fn`) to a particular event type of the object. You can optionally specify the context of the listener (object the this keyword will point to). You can also pass several space-separated types (e.g. `'click dblclick'`).\r\n\t *\r\n\t * @alternative\r\n\t * @method on(eventMap: Object): this\r\n\t * Adds a set of type/listener pairs, e.g. `{click: onClick, mousemove: onMouseMove}`\r\n\t */\r\n\ton: function (types, fn, context) {\r\n\r\n\t\t// types can be a map of types/handlers\r\n\t\tif (typeof types === 'object') {\r\n\t\t\tfor (var type in types) {\r\n\t\t\t\t// we don't process space-separated events here for performance;\r\n\t\t\t\t// it's a hot path since Layer uses the on(obj) syntax\r\n\t\t\t\tthis._on(type, types[type], fn);\r\n\t\t\t}\r\n\r\n\t\t} else {\r\n\t\t\t// types can be a string of space-separated words\r\n\t\t\ttypes = splitWords(types);\r\n\r\n\t\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n\t\t\t\tthis._on(types[i], fn, context);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t/* @method off(type: String, fn?: Function, context?: Object): this\r\n\t * Removes a previously added listener function. If no function is specified, it will remove all the listeners of that particular event from the object. Note that if you passed a custom context to `on`, you must pass the same context to `off` in order to remove the listener.\r\n\t *\r\n\t * @alternative\r\n\t * @method off(eventMap: Object): this\r\n\t * Removes a set of type/listener pairs.\r\n\t *\r\n\t * @alternative\r\n\t * @method off: this\r\n\t * Removes all listeners to all events on the object.\r\n\t */\r\n\toff: function (types, fn, context) {\r\n\r\n\t\tif (!types) {\r\n\t\t\t// clear all listeners if called without arguments\r\n\t\t\tdelete this._events;\r\n\r\n\t\t} else if (typeof types === 'object') {\r\n\t\t\tfor (var type in types) {\r\n\t\t\t\tthis._off(type, types[type], fn);\r\n\t\t\t}\r\n\r\n\t\t} else {\r\n\t\t\ttypes = splitWords(types);\r\n\r\n\t\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n\t\t\t\tthis._off(types[i], fn, context);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// attach listener (without syntactic sugar now)\r\n\t_on: function (type, fn, context) {\r\n\t\tthis._events = this._events || {};\r\n\r\n\t\t/* get/init listeners for type */\r\n\t\tvar typeListeners = this._events[type];\r\n\t\tif (!typeListeners) {\r\n\t\t\ttypeListeners = [];\r\n\t\t\tthis._events[type] = typeListeners;\r\n\t\t}\r\n\r\n\t\tif (context === this) {\r\n\t\t\t// Less memory footprint.\r\n\t\t\tcontext = undefined;\r\n\t\t}\r\n\t\tvar newListener = {fn: fn, ctx: context},\r\n\t\t listeners = typeListeners;\r\n\r\n\t\t// check if fn already there\r\n\t\tfor (var i = 0, len = listeners.length; i < len; i++) {\r\n\t\t\tif (listeners[i].fn === fn && listeners[i].ctx === context) {\r\n\t\t\t\treturn;\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tlisteners.push(newListener);\r\n\t},\r\n\r\n\t_off: function (type, fn, context) {\r\n\t\tvar listeners,\r\n\t\t i,\r\n\t\t len;\r\n\r\n\t\tif (!this._events) { return; }\r\n\r\n\t\tlisteners = this._events[type];\r\n\r\n\t\tif (!listeners) {\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tif (!fn) {\r\n\t\t\t// Set all removed listeners to noop so they are not called if remove happens in fire\r\n\t\t\tfor (i = 0, len = listeners.length; i < len; i++) {\r\n\t\t\t\tlisteners[i].fn = falseFn;\r\n\t\t\t}\r\n\t\t\t// clear all listeners for a type if function isn't specified\r\n\t\t\tdelete this._events[type];\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tif (context === this) {\r\n\t\t\tcontext = undefined;\r\n\t\t}\r\n\r\n\t\tif (listeners) {\r\n\r\n\t\t\t// find fn and remove it\r\n\t\t\tfor (i = 0, len = listeners.length; i < len; i++) {\r\n\t\t\t\tvar l = listeners[i];\r\n\t\t\t\tif (l.ctx !== context) { continue; }\r\n\t\t\t\tif (l.fn === fn) {\r\n\r\n\t\t\t\t\t// set the removed listener to noop so that's not called if remove happens in fire\r\n\t\t\t\t\tl.fn = falseFn;\r\n\r\n\t\t\t\t\tif (this._firingCount) {\r\n\t\t\t\t\t\t/* copy array in case events are being fired */\r\n\t\t\t\t\t\tthis._events[type] = listeners = listeners.slice();\r\n\t\t\t\t\t}\r\n\t\t\t\t\tlisteners.splice(i, 1);\r\n\r\n\t\t\t\t\treturn;\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\t// @method fire(type: String, data?: Object, propagate?: Boolean): this\r\n\t// Fires an event of the specified type. You can optionally provide an data\r\n\t// object — the first argument of the listener function will contain its\r\n\t// properties. The event can optionally be propagated to event parents.\r\n\tfire: function (type, data, propagate) {\r\n\t\tif (!this.listens(type, propagate)) { return this; }\r\n\r\n\t\tvar event = extend({}, data, {\r\n\t\t\ttype: type,\r\n\t\t\ttarget: this,\r\n\t\t\tsourceTarget: data && data.sourceTarget || this\r\n\t\t});\r\n\r\n\t\tif (this._events) {\r\n\t\t\tvar listeners = this._events[type];\r\n\r\n\t\t\tif (listeners) {\r\n\t\t\t\tthis._firingCount = (this._firingCount + 1) || 1;\r\n\t\t\t\tfor (var i = 0, len = listeners.length; i < len; i++) {\r\n\t\t\t\t\tvar l = listeners[i];\r\n\t\t\t\t\tl.fn.call(l.ctx || this, event);\r\n\t\t\t\t}\r\n\r\n\t\t\t\tthis._firingCount--;\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tif (propagate) {\r\n\t\t\t// propagate the event to parents (set with addEventParent)\r\n\t\t\tthis._propagateEvent(event);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method listens(type: String): Boolean\r\n\t// Returns `true` if a particular event type has any listeners attached to it.\r\n\tlistens: function (type, propagate) {\r\n\t\tvar listeners = this._events && this._events[type];\r\n\t\tif (listeners && listeners.length) { return true; }\r\n\r\n\t\tif (propagate) {\r\n\t\t\t// also check parents for listeners if event propagates\r\n\t\t\tfor (var id in this._eventParents) {\r\n\t\t\t\tif (this._eventParents[id].listens(type, propagate)) { return true; }\r\n\t\t\t}\r\n\t\t}\r\n\t\treturn false;\r\n\t},\r\n\r\n\t// @method once(…): this\r\n\t// Behaves as [`on(…)`](#evented-on), except the listener will only get fired once and then removed.\r\n\tonce: function (types, fn, context) {\r\n\r\n\t\tif (typeof types === 'object') {\r\n\t\t\tfor (var type in types) {\r\n\t\t\t\tthis.once(type, types[type], fn);\r\n\t\t\t}\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tvar handler = bind(function () {\r\n\t\t\tthis\r\n\t\t\t .off(types, fn, context)\r\n\t\t\t .off(types, handler, context);\r\n\t\t}, this);\r\n\r\n\t\t// add a listener that's executed once and removed after that\r\n\t\treturn this\r\n\t\t .on(types, fn, context)\r\n\t\t .on(types, handler, context);\r\n\t},\r\n\r\n\t// @method addEventParent(obj: Evented): this\r\n\t// Adds an event parent - an `Evented` that will receive propagated events\r\n\taddEventParent: function (obj) {\r\n\t\tthis._eventParents = this._eventParents || {};\r\n\t\tthis._eventParents[stamp(obj)] = obj;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method removeEventParent(obj: Evented): this\r\n\t// Removes an event parent, so it will stop receiving propagated events\r\n\tremoveEventParent: function (obj) {\r\n\t\tif (this._eventParents) {\r\n\t\t\tdelete this._eventParents[stamp(obj)];\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_propagateEvent: function (e) {\r\n\t\tfor (var id in this._eventParents) {\r\n\t\t\tthis._eventParents[id].fire(e.type, extend({\r\n\t\t\t\tlayer: e.target,\r\n\t\t\t\tpropagatedFrom: e.target\r\n\t\t\t}, e), true);\r\n\t\t}\r\n\t}\r\n};\r\n\r\n// aliases; we should ditch those eventually\r\n\r\n// @method addEventListener(…): this\r\n// Alias to [`on(…)`](#evented-on)\r\nEvents.addEventListener = Events.on;\r\n\r\n// @method removeEventListener(…): this\r\n// Alias to [`off(…)`](#evented-off)\r\n\r\n// @method clearAllEventListeners(…): this\r\n// Alias to [`off()`](#evented-off)\r\nEvents.removeEventListener = Events.clearAllEventListeners = Events.off;\r\n\r\n// @method addOneTimeEventListener(…): this\r\n// Alias to [`once(…)`](#evented-once)\r\nEvents.addOneTimeEventListener = Events.once;\r\n\r\n// @method fireEvent(…): this\r\n// Alias to [`fire(…)`](#evented-fire)\r\nEvents.fireEvent = Events.fire;\r\n\r\n// @method hasEventListeners(…): Boolean\r\n// Alias to [`listens(…)`](#evented-listens)\r\nEvents.hasEventListeners = Events.listens;\r\n\r\nvar Evented = Class.extend(Events);\n\n/*\r\n * @class Point\r\n * @aka L.Point\r\n *\r\n * Represents a point with `x` and `y` coordinates in pixels.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var point = L.point(200, 300);\r\n * ```\r\n *\r\n * All Leaflet methods and options that accept `Point` objects also accept them in a simple Array form (unless noted otherwise), so these lines are equivalent:\r\n *\r\n * ```js\r\n * map.panBy([200, 300]);\r\n * map.panBy(L.point(200, 300));\r\n * ```\r\n *\r\n * Note that `Point` does not inherit from Leafet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\nfunction Point(x, y, round) {\r\n\t// @property x: Number; The `x` coordinate of the point\r\n\tthis.x = (round ? Math.round(x) : x);\r\n\t// @property y: Number; The `y` coordinate of the point\r\n\tthis.y = (round ? Math.round(y) : y);\r\n}\r\n\r\nvar trunc = Math.trunc || function (v) {\r\n\treturn v > 0 ? Math.floor(v) : Math.ceil(v);\r\n};\r\n\r\nPoint.prototype = {\r\n\r\n\t// @method clone(): Point\r\n\t// Returns a copy of the current point.\r\n\tclone: function () {\r\n\t\treturn new Point(this.x, this.y);\r\n\t},\r\n\r\n\t// @method add(otherPoint: Point): Point\r\n\t// Returns the result of addition of the current and the given points.\r\n\tadd: function (point) {\r\n\t\t// non-destructive, returns a new point\r\n\t\treturn this.clone()._add(toPoint(point));\r\n\t},\r\n\r\n\t_add: function (point) {\r\n\t\t// destructive, used directly for performance in situations where it's safe to modify existing point\r\n\t\tthis.x += point.x;\r\n\t\tthis.y += point.y;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method subtract(otherPoint: Point): Point\r\n\t// Returns the result of subtraction of the given point from the current.\r\n\tsubtract: function (point) {\r\n\t\treturn this.clone()._subtract(toPoint(point));\r\n\t},\r\n\r\n\t_subtract: function (point) {\r\n\t\tthis.x -= point.x;\r\n\t\tthis.y -= point.y;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method divideBy(num: Number): Point\r\n\t// Returns the result of division of the current point by the given number.\r\n\tdivideBy: function (num) {\r\n\t\treturn this.clone()._divideBy(num);\r\n\t},\r\n\r\n\t_divideBy: function (num) {\r\n\t\tthis.x /= num;\r\n\t\tthis.y /= num;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method multiplyBy(num: Number): Point\r\n\t// Returns the result of multiplication of the current point by the given number.\r\n\tmultiplyBy: function (num) {\r\n\t\treturn this.clone()._multiplyBy(num);\r\n\t},\r\n\r\n\t_multiplyBy: function (num) {\r\n\t\tthis.x *= num;\r\n\t\tthis.y *= num;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method scaleBy(scale: Point): Point\r\n\t// Multiply each coordinate of the current point by each coordinate of\r\n\t// `scale`. In linear algebra terms, multiply the point by the\r\n\t// [scaling matrix](https://en.wikipedia.org/wiki/Scaling_%28geometry%29#Matrix_representation)\r\n\t// defined by `scale`.\r\n\tscaleBy: function (point) {\r\n\t\treturn new Point(this.x * point.x, this.y * point.y);\r\n\t},\r\n\r\n\t// @method unscaleBy(scale: Point): Point\r\n\t// Inverse of `scaleBy`. Divide each coordinate of the current point by\r\n\t// each coordinate of `scale`.\r\n\tunscaleBy: function (point) {\r\n\t\treturn new Point(this.x / point.x, this.y / point.y);\r\n\t},\r\n\r\n\t// @method round(): Point\r\n\t// Returns a copy of the current point with rounded coordinates.\r\n\tround: function () {\r\n\t\treturn this.clone()._round();\r\n\t},\r\n\r\n\t_round: function () {\r\n\t\tthis.x = Math.round(this.x);\r\n\t\tthis.y = Math.round(this.y);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method floor(): Point\r\n\t// Returns a copy of the current point with floored coordinates (rounded down).\r\n\tfloor: function () {\r\n\t\treturn this.clone()._floor();\r\n\t},\r\n\r\n\t_floor: function () {\r\n\t\tthis.x = Math.floor(this.x);\r\n\t\tthis.y = Math.floor(this.y);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method ceil(): Point\r\n\t// Returns a copy of the current point with ceiled coordinates (rounded up).\r\n\tceil: function () {\r\n\t\treturn this.clone()._ceil();\r\n\t},\r\n\r\n\t_ceil: function () {\r\n\t\tthis.x = Math.ceil(this.x);\r\n\t\tthis.y = Math.ceil(this.y);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method trunc(): Point\r\n\t// Returns a copy of the current point with truncated coordinates (rounded towards zero).\r\n\ttrunc: function () {\r\n\t\treturn this.clone()._trunc();\r\n\t},\r\n\r\n\t_trunc: function () {\r\n\t\tthis.x = trunc(this.x);\r\n\t\tthis.y = trunc(this.y);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method distanceTo(otherPoint: Point): Number\r\n\t// Returns the cartesian distance between the current and the given points.\r\n\tdistanceTo: function (point) {\r\n\t\tpoint = toPoint(point);\r\n\r\n\t\tvar x = point.x - this.x,\r\n\t\t y = point.y - this.y;\r\n\r\n\t\treturn Math.sqrt(x * x + y * y);\r\n\t},\r\n\r\n\t// @method equals(otherPoint: Point): Boolean\r\n\t// Returns `true` if the given point has the same coordinates.\r\n\tequals: function (point) {\r\n\t\tpoint = toPoint(point);\r\n\r\n\t\treturn point.x === this.x &&\r\n\t\t point.y === this.y;\r\n\t},\r\n\r\n\t// @method contains(otherPoint: Point): Boolean\r\n\t// Returns `true` if both coordinates of the given point are less than the corresponding current point coordinates (in absolute values).\r\n\tcontains: function (point) {\r\n\t\tpoint = toPoint(point);\r\n\r\n\t\treturn Math.abs(point.x) <= Math.abs(this.x) &&\r\n\t\t Math.abs(point.y) <= Math.abs(this.y);\r\n\t},\r\n\r\n\t// @method toString(): String\r\n\t// Returns a string representation of the point for debugging purposes.\r\n\ttoString: function () {\r\n\t\treturn 'Point(' +\r\n\t\t formatNum(this.x) + ', ' +\r\n\t\t formatNum(this.y) + ')';\r\n\t}\r\n};\r\n\r\n// @factory L.point(x: Number, y: Number, round?: Boolean)\r\n// Creates a Point object with the given `x` and `y` coordinates. If optional `round` is set to true, rounds the `x` and `y` values.\r\n\r\n// @alternative\r\n// @factory L.point(coords: Number[])\r\n// Expects an array of the form `[x, y]` instead.\r\n\r\n// @alternative\r\n// @factory L.point(coords: Object)\r\n// Expects a plain object of the form `{x: Number, y: Number}` instead.\r\nfunction toPoint(x, y, round) {\r\n\tif (x instanceof Point) {\r\n\t\treturn x;\r\n\t}\r\n\tif (isArray(x)) {\r\n\t\treturn new Point(x[0], x[1]);\r\n\t}\r\n\tif (x === undefined || x === null) {\r\n\t\treturn x;\r\n\t}\r\n\tif (typeof x === 'object' && 'x' in x && 'y' in x) {\r\n\t\treturn new Point(x.x, x.y);\r\n\t}\r\n\treturn new Point(x, y, round);\r\n}\n\n/*\r\n * @class Bounds\r\n * @aka L.Bounds\r\n *\r\n * Represents a rectangular area in pixel coordinates.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var p1 = L.point(10, 10),\r\n * p2 = L.point(40, 60),\r\n * bounds = L.bounds(p1, p2);\r\n * ```\r\n *\r\n * All Leaflet methods that accept `Bounds` objects also accept them in a simple Array form (unless noted otherwise), so the bounds example above can be passed like this:\r\n *\r\n * ```js\r\n * otherBounds.intersects([[10, 10], [40, 60]]);\r\n * ```\r\n *\r\n * Note that `Bounds` does not inherit from Leafet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\nfunction Bounds(a, b) {\r\n\tif (!a) { return; }\r\n\r\n\tvar points = b ? [a, b] : a;\r\n\r\n\tfor (var i = 0, len = points.length; i < len; i++) {\r\n\t\tthis.extend(points[i]);\r\n\t}\r\n}\r\n\r\nBounds.prototype = {\r\n\t// @method extend(point: Point): this\r\n\t// Extends the bounds to contain the given point.\r\n\textend: function (point) { // (Point)\r\n\t\tpoint = toPoint(point);\r\n\r\n\t\t// @property min: Point\r\n\t\t// The top left corner of the rectangle.\r\n\t\t// @property max: Point\r\n\t\t// The bottom right corner of the rectangle.\r\n\t\tif (!this.min && !this.max) {\r\n\t\t\tthis.min = point.clone();\r\n\t\t\tthis.max = point.clone();\r\n\t\t} else {\r\n\t\t\tthis.min.x = Math.min(point.x, this.min.x);\r\n\t\t\tthis.max.x = Math.max(point.x, this.max.x);\r\n\t\t\tthis.min.y = Math.min(point.y, this.min.y);\r\n\t\t\tthis.max.y = Math.max(point.y, this.max.y);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getCenter(round?: Boolean): Point\r\n\t// Returns the center point of the bounds.\r\n\tgetCenter: function (round) {\r\n\t\treturn new Point(\r\n\t\t (this.min.x + this.max.x) / 2,\r\n\t\t (this.min.y + this.max.y) / 2, round);\r\n\t},\r\n\r\n\t// @method getBottomLeft(): Point\r\n\t// Returns the bottom-left point of the bounds.\r\n\tgetBottomLeft: function () {\r\n\t\treturn new Point(this.min.x, this.max.y);\r\n\t},\r\n\r\n\t// @method getTopRight(): Point\r\n\t// Returns the top-right point of the bounds.\r\n\tgetTopRight: function () { // -> Point\r\n\t\treturn new Point(this.max.x, this.min.y);\r\n\t},\r\n\r\n\t// @method getTopLeft(): Point\r\n\t// Returns the top-left point of the bounds (i.e. [`this.min`](#bounds-min)).\r\n\tgetTopLeft: function () {\r\n\t\treturn this.min; // left, top\r\n\t},\r\n\r\n\t// @method getBottomRight(): Point\r\n\t// Returns the bottom-right point of the bounds (i.e. [`this.max`](#bounds-max)).\r\n\tgetBottomRight: function () {\r\n\t\treturn this.max; // right, bottom\r\n\t},\r\n\r\n\t// @method getSize(): Point\r\n\t// Returns the size of the given bounds\r\n\tgetSize: function () {\r\n\t\treturn this.max.subtract(this.min);\r\n\t},\r\n\r\n\t// @method contains(otherBounds: Bounds): Boolean\r\n\t// Returns `true` if the rectangle contains the given one.\r\n\t// @alternative\r\n\t// @method contains(point: Point): Boolean\r\n\t// Returns `true` if the rectangle contains the given point.\r\n\tcontains: function (obj) {\r\n\t\tvar min, max;\r\n\r\n\t\tif (typeof obj[0] === 'number' || obj instanceof Point) {\r\n\t\t\tobj = toPoint(obj);\r\n\t\t} else {\r\n\t\t\tobj = toBounds(obj);\r\n\t\t}\r\n\r\n\t\tif (obj instanceof Bounds) {\r\n\t\t\tmin = obj.min;\r\n\t\t\tmax = obj.max;\r\n\t\t} else {\r\n\t\t\tmin = max = obj;\r\n\t\t}\r\n\r\n\t\treturn (min.x >= this.min.x) &&\r\n\t\t (max.x <= this.max.x) &&\r\n\t\t (min.y >= this.min.y) &&\r\n\t\t (max.y <= this.max.y);\r\n\t},\r\n\r\n\t// @method intersects(otherBounds: Bounds): Boolean\r\n\t// Returns `true` if the rectangle intersects the given bounds. Two bounds\r\n\t// intersect if they have at least one point in common.\r\n\tintersects: function (bounds) { // (Bounds) -> Boolean\r\n\t\tbounds = toBounds(bounds);\r\n\r\n\t\tvar min = this.min,\r\n\t\t max = this.max,\r\n\t\t min2 = bounds.min,\r\n\t\t max2 = bounds.max,\r\n\t\t xIntersects = (max2.x >= min.x) && (min2.x <= max.x),\r\n\t\t yIntersects = (max2.y >= min.y) && (min2.y <= max.y);\r\n\r\n\t\treturn xIntersects && yIntersects;\r\n\t},\r\n\r\n\t// @method overlaps(otherBounds: Bounds): Boolean\r\n\t// Returns `true` if the rectangle overlaps the given bounds. Two bounds\r\n\t// overlap if their intersection is an area.\r\n\toverlaps: function (bounds) { // (Bounds) -> Boolean\r\n\t\tbounds = toBounds(bounds);\r\n\r\n\t\tvar min = this.min,\r\n\t\t max = this.max,\r\n\t\t min2 = bounds.min,\r\n\t\t max2 = bounds.max,\r\n\t\t xOverlaps = (max2.x > min.x) && (min2.x < max.x),\r\n\t\t yOverlaps = (max2.y > min.y) && (min2.y < max.y);\r\n\r\n\t\treturn xOverlaps && yOverlaps;\r\n\t},\r\n\r\n\tisValid: function () {\r\n\t\treturn !!(this.min && this.max);\r\n\t}\r\n};\r\n\r\n\r\n// @factory L.bounds(corner1: Point, corner2: Point)\r\n// Creates a Bounds object from two corners coordinate pairs.\r\n// @alternative\r\n// @factory L.bounds(points: Point[])\r\n// Creates a Bounds object from the given array of points.\r\nfunction toBounds(a, b) {\r\n\tif (!a || a instanceof Bounds) {\r\n\t\treturn a;\r\n\t}\r\n\treturn new Bounds(a, b);\r\n}\n\n/*\r\n * @class LatLngBounds\r\n * @aka L.LatLngBounds\r\n *\r\n * Represents a rectangular geographical area on a map.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var corner1 = L.latLng(40.712, -74.227),\r\n * corner2 = L.latLng(40.774, -74.125),\r\n * bounds = L.latLngBounds(corner1, corner2);\r\n * ```\r\n *\r\n * All Leaflet methods that accept LatLngBounds objects also accept them in a simple Array form (unless noted otherwise), so the bounds example above can be passed like this:\r\n *\r\n * ```js\r\n * map.fitBounds([\r\n * \t[40.712, -74.227],\r\n * \t[40.774, -74.125]\r\n * ]);\r\n * ```\r\n *\r\n * Caution: if the area crosses the antimeridian (often confused with the International Date Line), you must specify corners _outside_ the [-180, 180] degrees longitude range.\r\n *\r\n * Note that `LatLngBounds` does not inherit from Leafet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\nfunction LatLngBounds(corner1, corner2) { // (LatLng, LatLng) or (LatLng[])\r\n\tif (!corner1) { return; }\r\n\r\n\tvar latlngs = corner2 ? [corner1, corner2] : corner1;\r\n\r\n\tfor (var i = 0, len = latlngs.length; i < len; i++) {\r\n\t\tthis.extend(latlngs[i]);\r\n\t}\r\n}\r\n\r\nLatLngBounds.prototype = {\r\n\r\n\t// @method extend(latlng: LatLng): this\r\n\t// Extend the bounds to contain the given point\r\n\r\n\t// @alternative\r\n\t// @method extend(otherBounds: LatLngBounds): this\r\n\t// Extend the bounds to contain the given bounds\r\n\textend: function (obj) {\r\n\t\tvar sw = this._southWest,\r\n\t\t ne = this._northEast,\r\n\t\t sw2, ne2;\r\n\r\n\t\tif (obj instanceof LatLng) {\r\n\t\t\tsw2 = obj;\r\n\t\t\tne2 = obj;\r\n\r\n\t\t} else if (obj instanceof LatLngBounds) {\r\n\t\t\tsw2 = obj._southWest;\r\n\t\t\tne2 = obj._northEast;\r\n\r\n\t\t\tif (!sw2 || !ne2) { return this; }\r\n\r\n\t\t} else {\r\n\t\t\treturn obj ? this.extend(toLatLng(obj) || toLatLngBounds(obj)) : this;\r\n\t\t}\r\n\r\n\t\tif (!sw && !ne) {\r\n\t\t\tthis._southWest = new LatLng(sw2.lat, sw2.lng);\r\n\t\t\tthis._northEast = new LatLng(ne2.lat, ne2.lng);\r\n\t\t} else {\r\n\t\t\tsw.lat = Math.min(sw2.lat, sw.lat);\r\n\t\t\tsw.lng = Math.min(sw2.lng, sw.lng);\r\n\t\t\tne.lat = Math.max(ne2.lat, ne.lat);\r\n\t\t\tne.lng = Math.max(ne2.lng, ne.lng);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method pad(bufferRatio: Number): LatLngBounds\r\n\t// Returns bounds created by extending or retracting the current bounds by a given ratio in each direction.\r\n\t// For example, a ratio of 0.5 extends the bounds by 50% in each direction.\r\n\t// Negative values will retract the bounds.\r\n\tpad: function (bufferRatio) {\r\n\t\tvar sw = this._southWest,\r\n\t\t ne = this._northEast,\r\n\t\t heightBuffer = Math.abs(sw.lat - ne.lat) * bufferRatio,\r\n\t\t widthBuffer = Math.abs(sw.lng - ne.lng) * bufferRatio;\r\n\r\n\t\treturn new LatLngBounds(\r\n\t\t new LatLng(sw.lat - heightBuffer, sw.lng - widthBuffer),\r\n\t\t new LatLng(ne.lat + heightBuffer, ne.lng + widthBuffer));\r\n\t},\r\n\r\n\t// @method getCenter(): LatLng\r\n\t// Returns the center point of the bounds.\r\n\tgetCenter: function () {\r\n\t\treturn new LatLng(\r\n\t\t (this._southWest.lat + this._northEast.lat) / 2,\r\n\t\t (this._southWest.lng + this._northEast.lng) / 2);\r\n\t},\r\n\r\n\t// @method getSouthWest(): LatLng\r\n\t// Returns the south-west point of the bounds.\r\n\tgetSouthWest: function () {\r\n\t\treturn this._southWest;\r\n\t},\r\n\r\n\t// @method getNorthEast(): LatLng\r\n\t// Returns the north-east point of the bounds.\r\n\tgetNorthEast: function () {\r\n\t\treturn this._northEast;\r\n\t},\r\n\r\n\t// @method getNorthWest(): LatLng\r\n\t// Returns the north-west point of the bounds.\r\n\tgetNorthWest: function () {\r\n\t\treturn new LatLng(this.getNorth(), this.getWest());\r\n\t},\r\n\r\n\t// @method getSouthEast(): LatLng\r\n\t// Returns the south-east point of the bounds.\r\n\tgetSouthEast: function () {\r\n\t\treturn new LatLng(this.getSouth(), this.getEast());\r\n\t},\r\n\r\n\t// @method getWest(): Number\r\n\t// Returns the west longitude of the bounds\r\n\tgetWest: function () {\r\n\t\treturn this._southWest.lng;\r\n\t},\r\n\r\n\t// @method getSouth(): Number\r\n\t// Returns the south latitude of the bounds\r\n\tgetSouth: function () {\r\n\t\treturn this._southWest.lat;\r\n\t},\r\n\r\n\t// @method getEast(): Number\r\n\t// Returns the east longitude of the bounds\r\n\tgetEast: function () {\r\n\t\treturn this._northEast.lng;\r\n\t},\r\n\r\n\t// @method getNorth(): Number\r\n\t// Returns the north latitude of the bounds\r\n\tgetNorth: function () {\r\n\t\treturn this._northEast.lat;\r\n\t},\r\n\r\n\t// @method contains(otherBounds: LatLngBounds): Boolean\r\n\t// Returns `true` if the rectangle contains the given one.\r\n\r\n\t// @alternative\r\n\t// @method contains (latlng: LatLng): Boolean\r\n\t// Returns `true` if the rectangle contains the given point.\r\n\tcontains: function (obj) { // (LatLngBounds) or (LatLng) -> Boolean\r\n\t\tif (typeof obj[0] === 'number' || obj instanceof LatLng || 'lat' in obj) {\r\n\t\t\tobj = toLatLng(obj);\r\n\t\t} else {\r\n\t\t\tobj = toLatLngBounds(obj);\r\n\t\t}\r\n\r\n\t\tvar sw = this._southWest,\r\n\t\t ne = this._northEast,\r\n\t\t sw2, ne2;\r\n\r\n\t\tif (obj instanceof LatLngBounds) {\r\n\t\t\tsw2 = obj.getSouthWest();\r\n\t\t\tne2 = obj.getNorthEast();\r\n\t\t} else {\r\n\t\t\tsw2 = ne2 = obj;\r\n\t\t}\r\n\r\n\t\treturn (sw2.lat >= sw.lat) && (ne2.lat <= ne.lat) &&\r\n\t\t (sw2.lng >= sw.lng) && (ne2.lng <= ne.lng);\r\n\t},\r\n\r\n\t// @method intersects(otherBounds: LatLngBounds): Boolean\r\n\t// Returns `true` if the rectangle intersects the given bounds. Two bounds intersect if they have at least one point in common.\r\n\tintersects: function (bounds) {\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\r\n\t\tvar sw = this._southWest,\r\n\t\t ne = this._northEast,\r\n\t\t sw2 = bounds.getSouthWest(),\r\n\t\t ne2 = bounds.getNorthEast(),\r\n\r\n\t\t latIntersects = (ne2.lat >= sw.lat) && (sw2.lat <= ne.lat),\r\n\t\t lngIntersects = (ne2.lng >= sw.lng) && (sw2.lng <= ne.lng);\r\n\r\n\t\treturn latIntersects && lngIntersects;\r\n\t},\r\n\r\n\t// @method overlaps(otherBounds: Bounds): Boolean\r\n\t// Returns `true` if the rectangle overlaps the given bounds. Two bounds overlap if their intersection is an area.\r\n\toverlaps: function (bounds) {\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\r\n\t\tvar sw = this._southWest,\r\n\t\t ne = this._northEast,\r\n\t\t sw2 = bounds.getSouthWest(),\r\n\t\t ne2 = bounds.getNorthEast(),\r\n\r\n\t\t latOverlaps = (ne2.lat > sw.lat) && (sw2.lat < ne.lat),\r\n\t\t lngOverlaps = (ne2.lng > sw.lng) && (sw2.lng < ne.lng);\r\n\r\n\t\treturn latOverlaps && lngOverlaps;\r\n\t},\r\n\r\n\t// @method toBBoxString(): String\r\n\t// Returns a string with bounding box coordinates in a 'southwest_lng,southwest_lat,northeast_lng,northeast_lat' format. Useful for sending requests to web services that return geo data.\r\n\ttoBBoxString: function () {\r\n\t\treturn [this.getWest(), this.getSouth(), this.getEast(), this.getNorth()].join(',');\r\n\t},\r\n\r\n\t// @method equals(otherBounds: LatLngBounds, maxMargin?: Number): Boolean\r\n\t// Returns `true` if the rectangle is equivalent (within a small margin of error) to the given bounds. The margin of error can be overridden by setting `maxMargin` to a small number.\r\n\tequals: function (bounds, maxMargin) {\r\n\t\tif (!bounds) { return false; }\r\n\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\r\n\t\treturn this._southWest.equals(bounds.getSouthWest(), maxMargin) &&\r\n\t\t this._northEast.equals(bounds.getNorthEast(), maxMargin);\r\n\t},\r\n\r\n\t// @method isValid(): Boolean\r\n\t// Returns `true` if the bounds are properly initialized.\r\n\tisValid: function () {\r\n\t\treturn !!(this._southWest && this._northEast);\r\n\t}\r\n};\r\n\r\n// TODO International date line?\r\n\r\n// @factory L.latLngBounds(corner1: LatLng, corner2: LatLng)\r\n// Creates a `LatLngBounds` object by defining two diagonally opposite corners of the rectangle.\r\n\r\n// @alternative\r\n// @factory L.latLngBounds(latlngs: LatLng[])\r\n// Creates a `LatLngBounds` object defined by the geographical points it contains. Very useful for zooming the map to fit a particular set of locations with [`fitBounds`](#map-fitbounds).\r\nfunction toLatLngBounds(a, b) {\r\n\tif (a instanceof LatLngBounds) {\r\n\t\treturn a;\r\n\t}\r\n\treturn new LatLngBounds(a, b);\r\n}\n\n/* @class LatLng\r\n * @aka L.LatLng\r\n *\r\n * Represents a geographical point with a certain latitude and longitude.\r\n *\r\n * @example\r\n *\r\n * ```\r\n * var latlng = L.latLng(50.5, 30.5);\r\n * ```\r\n *\r\n * All Leaflet methods that accept LatLng objects also accept them in a simple Array form and simple object form (unless noted otherwise), so these lines are equivalent:\r\n *\r\n * ```\r\n * map.panTo([50, 30]);\r\n * map.panTo({lon: 30, lat: 50});\r\n * map.panTo({lat: 50, lng: 30});\r\n * map.panTo(L.latLng(50, 30));\r\n * ```\r\n *\r\n * Note that `LatLng` does not inherit from Leafet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\nfunction LatLng(lat, lng, alt) {\r\n\tif (isNaN(lat) || isNaN(lng)) {\r\n\t\tthrow new Error('Invalid LatLng object: (' + lat + ', ' + lng + ')');\r\n\t}\r\n\r\n\t// @property lat: Number\r\n\t// Latitude in degrees\r\n\tthis.lat = +lat;\r\n\r\n\t// @property lng: Number\r\n\t// Longitude in degrees\r\n\tthis.lng = +lng;\r\n\r\n\t// @property alt: Number\r\n\t// Altitude in meters (optional)\r\n\tif (alt !== undefined) {\r\n\t\tthis.alt = +alt;\r\n\t}\r\n}\r\n\r\nLatLng.prototype = {\r\n\t// @method equals(otherLatLng: LatLng, maxMargin?: Number): Boolean\r\n\t// Returns `true` if the given `LatLng` point is at the same position (within a small margin of error). The margin of error can be overridden by setting `maxMargin` to a small number.\r\n\tequals: function (obj, maxMargin) {\r\n\t\tif (!obj) { return false; }\r\n\r\n\t\tobj = toLatLng(obj);\r\n\r\n\t\tvar margin = Math.max(\r\n\t\t Math.abs(this.lat - obj.lat),\r\n\t\t Math.abs(this.lng - obj.lng));\r\n\r\n\t\treturn margin <= (maxMargin === undefined ? 1.0E-9 : maxMargin);\r\n\t},\r\n\r\n\t// @method toString(): String\r\n\t// Returns a string representation of the point (for debugging purposes).\r\n\ttoString: function (precision) {\r\n\t\treturn 'LatLng(' +\r\n\t\t formatNum(this.lat, precision) + ', ' +\r\n\t\t formatNum(this.lng, precision) + ')';\r\n\t},\r\n\r\n\t// @method distanceTo(otherLatLng: LatLng): Number\r\n\t// Returns the distance (in meters) to the given `LatLng` calculated using the [Spherical Law of Cosines](https://en.wikipedia.org/wiki/Spherical_law_of_cosines).\r\n\tdistanceTo: function (other) {\r\n\t\treturn Earth.distance(this, toLatLng(other));\r\n\t},\r\n\r\n\t// @method wrap(): LatLng\r\n\t// Returns a new `LatLng` object with the longitude wrapped so it's always between -180 and +180 degrees.\r\n\twrap: function () {\r\n\t\treturn Earth.wrapLatLng(this);\r\n\t},\r\n\r\n\t// @method toBounds(sizeInMeters: Number): LatLngBounds\r\n\t// Returns a new `LatLngBounds` object in which each boundary is `sizeInMeters/2` meters apart from the `LatLng`.\r\n\ttoBounds: function (sizeInMeters) {\r\n\t\tvar latAccuracy = 180 * sizeInMeters / 40075017,\r\n\t\t lngAccuracy = latAccuracy / Math.cos((Math.PI / 180) * this.lat);\r\n\r\n\t\treturn toLatLngBounds(\r\n\t\t [this.lat - latAccuracy, this.lng - lngAccuracy],\r\n\t\t [this.lat + latAccuracy, this.lng + lngAccuracy]);\r\n\t},\r\n\r\n\tclone: function () {\r\n\t\treturn new LatLng(this.lat, this.lng, this.alt);\r\n\t}\r\n};\r\n\r\n\r\n\r\n// @factory L.latLng(latitude: Number, longitude: Number, altitude?: Number): LatLng\r\n// Creates an object representing a geographical point with the given latitude and longitude (and optionally altitude).\r\n\r\n// @alternative\r\n// @factory L.latLng(coords: Array): LatLng\r\n// Expects an array of the form `[Number, Number]` or `[Number, Number, Number]` instead.\r\n\r\n// @alternative\r\n// @factory L.latLng(coords: Object): LatLng\r\n// Expects an plain object of the form `{lat: Number, lng: Number}` or `{lat: Number, lng: Number, alt: Number}` instead.\r\n\r\nfunction toLatLng(a, b, c) {\r\n\tif (a instanceof LatLng) {\r\n\t\treturn a;\r\n\t}\r\n\tif (isArray(a) && typeof a[0] !== 'object') {\r\n\t\tif (a.length === 3) {\r\n\t\t\treturn new LatLng(a[0], a[1], a[2]);\r\n\t\t}\r\n\t\tif (a.length === 2) {\r\n\t\t\treturn new LatLng(a[0], a[1]);\r\n\t\t}\r\n\t\treturn null;\r\n\t}\r\n\tif (a === undefined || a === null) {\r\n\t\treturn a;\r\n\t}\r\n\tif (typeof a === 'object' && 'lat' in a) {\r\n\t\treturn new LatLng(a.lat, 'lng' in a ? a.lng : a.lon, a.alt);\r\n\t}\r\n\tif (b === undefined) {\r\n\t\treturn null;\r\n\t}\r\n\treturn new LatLng(a, b, c);\r\n}\n\n/*\r\n * @namespace CRS\r\n * @crs L.CRS.Base\r\n * Object that defines coordinate reference systems for projecting\r\n * geographical points into pixel (screen) coordinates and back (and to\r\n * coordinates in other units for [WMS](https://en.wikipedia.org/wiki/Web_Map_Service) services). See\r\n * [spatial reference system](http://en.wikipedia.org/wiki/Coordinate_reference_system).\r\n *\r\n * Leaflet defines the most usual CRSs by default. If you want to use a\r\n * CRS not defined by default, take a look at the\r\n * [Proj4Leaflet](https://github.com/kartena/Proj4Leaflet) plugin.\r\n *\r\n * Note that the CRS instances do not inherit from Leafet's `Class` object,\r\n * and can't be instantiated. Also, new classes can't inherit from them,\r\n * and methods can't be added to them with the `include` function.\r\n */\r\n\r\nvar CRS = {\r\n\t// @method latLngToPoint(latlng: LatLng, zoom: Number): Point\r\n\t// Projects geographical coordinates into pixel coordinates for a given zoom.\r\n\tlatLngToPoint: function (latlng, zoom) {\r\n\t\tvar projectedPoint = this.projection.project(latlng),\r\n\t\t scale = this.scale(zoom);\r\n\r\n\t\treturn this.transformation._transform(projectedPoint, scale);\r\n\t},\r\n\r\n\t// @method pointToLatLng(point: Point, zoom: Number): LatLng\r\n\t// The inverse of `latLngToPoint`. Projects pixel coordinates on a given\r\n\t// zoom into geographical coordinates.\r\n\tpointToLatLng: function (point, zoom) {\r\n\t\tvar scale = this.scale(zoom),\r\n\t\t untransformedPoint = this.transformation.untransform(point, scale);\r\n\r\n\t\treturn this.projection.unproject(untransformedPoint);\r\n\t},\r\n\r\n\t// @method project(latlng: LatLng): Point\r\n\t// Projects geographical coordinates into coordinates in units accepted for\r\n\t// this CRS (e.g. meters for EPSG:3857, for passing it to WMS services).\r\n\tproject: function (latlng) {\r\n\t\treturn this.projection.project(latlng);\r\n\t},\r\n\r\n\t// @method unproject(point: Point): LatLng\r\n\t// Given a projected coordinate returns the corresponding LatLng.\r\n\t// The inverse of `project`.\r\n\tunproject: function (point) {\r\n\t\treturn this.projection.unproject(point);\r\n\t},\r\n\r\n\t// @method scale(zoom: Number): Number\r\n\t// Returns the scale used when transforming projected coordinates into\r\n\t// pixel coordinates for a particular zoom. For example, it returns\r\n\t// `256 * 2^zoom` for Mercator-based CRS.\r\n\tscale: function (zoom) {\r\n\t\treturn 256 * Math.pow(2, zoom);\r\n\t},\r\n\r\n\t// @method zoom(scale: Number): Number\r\n\t// Inverse of `scale()`, returns the zoom level corresponding to a scale\r\n\t// factor of `scale`.\r\n\tzoom: function (scale) {\r\n\t\treturn Math.log(scale / 256) / Math.LN2;\r\n\t},\r\n\r\n\t// @method getProjectedBounds(zoom: Number): Bounds\r\n\t// Returns the projection's bounds scaled and transformed for the provided `zoom`.\r\n\tgetProjectedBounds: function (zoom) {\r\n\t\tif (this.infinite) { return null; }\r\n\r\n\t\tvar b = this.projection.bounds,\r\n\t\t s = this.scale(zoom),\r\n\t\t min = this.transformation.transform(b.min, s),\r\n\t\t max = this.transformation.transform(b.max, s);\r\n\r\n\t\treturn new Bounds(min, max);\r\n\t},\r\n\r\n\t// @method distance(latlng1: LatLng, latlng2: LatLng): Number\r\n\t// Returns the distance between two geographical coordinates.\r\n\r\n\t// @property code: String\r\n\t// Standard code name of the CRS passed into WMS services (e.g. `'EPSG:3857'`)\r\n\t//\r\n\t// @property wrapLng: Number[]\r\n\t// An array of two numbers defining whether the longitude (horizontal) coordinate\r\n\t// axis wraps around a given range and how. Defaults to `[-180, 180]` in most\r\n\t// geographical CRSs. If `undefined`, the longitude axis does not wrap around.\r\n\t//\r\n\t// @property wrapLat: Number[]\r\n\t// Like `wrapLng`, but for the latitude (vertical) axis.\r\n\r\n\t// wrapLng: [min, max],\r\n\t// wrapLat: [min, max],\r\n\r\n\t// @property infinite: Boolean\r\n\t// If true, the coordinate space will be unbounded (infinite in both axes)\r\n\tinfinite: false,\r\n\r\n\t// @method wrapLatLng(latlng: LatLng): LatLng\r\n\t// Returns a `LatLng` where lat and lng has been wrapped according to the\r\n\t// CRS's `wrapLat` and `wrapLng` properties, if they are outside the CRS's bounds.\r\n\twrapLatLng: function (latlng) {\r\n\t\tvar lng = this.wrapLng ? wrapNum(latlng.lng, this.wrapLng, true) : latlng.lng,\r\n\t\t lat = this.wrapLat ? wrapNum(latlng.lat, this.wrapLat, true) : latlng.lat,\r\n\t\t alt = latlng.alt;\r\n\r\n\t\treturn new LatLng(lat, lng, alt);\r\n\t},\r\n\r\n\t// @method wrapLatLngBounds(bounds: LatLngBounds): LatLngBounds\r\n\t// Returns a `LatLngBounds` with the same size as the given one, ensuring\r\n\t// that its center is within the CRS's bounds.\r\n\t// Only accepts actual `L.LatLngBounds` instances, not arrays.\r\n\twrapLatLngBounds: function (bounds) {\r\n\t\tvar center = bounds.getCenter(),\r\n\t\t newCenter = this.wrapLatLng(center),\r\n\t\t latShift = center.lat - newCenter.lat,\r\n\t\t lngShift = center.lng - newCenter.lng;\r\n\r\n\t\tif (latShift === 0 && lngShift === 0) {\r\n\t\t\treturn bounds;\r\n\t\t}\r\n\r\n\t\tvar sw = bounds.getSouthWest(),\r\n\t\t ne = bounds.getNorthEast(),\r\n\t\t newSw = new LatLng(sw.lat - latShift, sw.lng - lngShift),\r\n\t\t newNe = new LatLng(ne.lat - latShift, ne.lng - lngShift);\r\n\r\n\t\treturn new LatLngBounds(newSw, newNe);\r\n\t}\r\n};\n\n/*\n * @namespace CRS\n * @crs L.CRS.Earth\n *\n * Serves as the base for CRS that are global such that they cover the earth.\n * Can only be used as the base for other CRS and cannot be used directly,\n * since it does not have a `code`, `projection` or `transformation`. `distance()` returns\n * meters.\n */\n\nvar Earth = extend({}, CRS, {\n\twrapLng: [-180, 180],\n\n\t// Mean Earth Radius, as recommended for use by\n\t// the International Union of Geodesy and Geophysics,\n\t// see http://rosettacode.org/wiki/Haversine_formula\n\tR: 6371000,\n\n\t// distance between two geographical points using spherical law of cosines approximation\n\tdistance: function (latlng1, latlng2) {\n\t\tvar rad = Math.PI / 180,\n\t\t lat1 = latlng1.lat * rad,\n\t\t lat2 = latlng2.lat * rad,\n\t\t sinDLat = Math.sin((latlng2.lat - latlng1.lat) * rad / 2),\n\t\t sinDLon = Math.sin((latlng2.lng - latlng1.lng) * rad / 2),\n\t\t a = sinDLat * sinDLat + Math.cos(lat1) * Math.cos(lat2) * sinDLon * sinDLon,\n\t\t c = 2 * Math.atan2(Math.sqrt(a), Math.sqrt(1 - a));\n\t\treturn this.R * c;\n\t}\n});\n\n/*\r\n * @namespace Projection\r\n * @projection L.Projection.SphericalMercator\r\n *\r\n * Spherical Mercator projection — the most common projection for online maps,\r\n * used by almost all free and commercial tile providers. Assumes that Earth is\r\n * a sphere. Used by the `EPSG:3857` CRS.\r\n */\r\n\r\nvar SphericalMercator = {\r\n\r\n\tR: 6378137,\r\n\tMAX_LATITUDE: 85.0511287798,\r\n\r\n\tproject: function (latlng) {\r\n\t\tvar d = Math.PI / 180,\r\n\t\t max = this.MAX_LATITUDE,\r\n\t\t lat = Math.max(Math.min(max, latlng.lat), -max),\r\n\t\t sin = Math.sin(lat * d);\r\n\r\n\t\treturn new Point(\r\n\t\t\tthis.R * latlng.lng * d,\r\n\t\t\tthis.R * Math.log((1 + sin) / (1 - sin)) / 2);\r\n\t},\r\n\r\n\tunproject: function (point) {\r\n\t\tvar d = 180 / Math.PI;\r\n\r\n\t\treturn new LatLng(\r\n\t\t\t(2 * Math.atan(Math.exp(point.y / this.R)) - (Math.PI / 2)) * d,\r\n\t\t\tpoint.x * d / this.R);\r\n\t},\r\n\r\n\tbounds: (function () {\r\n\t\tvar d = 6378137 * Math.PI;\r\n\t\treturn new Bounds([-d, -d], [d, d]);\r\n\t})()\r\n};\n\n/*\r\n * @class Transformation\r\n * @aka L.Transformation\r\n *\r\n * Represents an affine transformation: a set of coefficients `a`, `b`, `c`, `d`\r\n * for transforming a point of a form `(x, y)` into `(a*x + b, c*y + d)` and doing\r\n * the reverse. Used by Leaflet in its projections code.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var transformation = L.transformation(2, 5, -1, 10),\r\n * \tp = L.point(1, 2),\r\n * \tp2 = transformation.transform(p), // L.point(7, 8)\r\n * \tp3 = transformation.untransform(p2); // L.point(1, 2)\r\n * ```\r\n */\r\n\r\n\r\n// factory new L.Transformation(a: Number, b: Number, c: Number, d: Number)\r\n// Creates a `Transformation` object with the given coefficients.\r\nfunction Transformation(a, b, c, d) {\r\n\tif (isArray(a)) {\r\n\t\t// use array properties\r\n\t\tthis._a = a[0];\r\n\t\tthis._b = a[1];\r\n\t\tthis._c = a[2];\r\n\t\tthis._d = a[3];\r\n\t\treturn;\r\n\t}\r\n\tthis._a = a;\r\n\tthis._b = b;\r\n\tthis._c = c;\r\n\tthis._d = d;\r\n}\r\n\r\nTransformation.prototype = {\r\n\t// @method transform(point: Point, scale?: Number): Point\r\n\t// Returns a transformed point, optionally multiplied by the given scale.\r\n\t// Only accepts actual `L.Point` instances, not arrays.\r\n\ttransform: function (point, scale) { // (Point, Number) -> Point\r\n\t\treturn this._transform(point.clone(), scale);\r\n\t},\r\n\r\n\t// destructive transform (faster)\r\n\t_transform: function (point, scale) {\r\n\t\tscale = scale || 1;\r\n\t\tpoint.x = scale * (this._a * point.x + this._b);\r\n\t\tpoint.y = scale * (this._c * point.y + this._d);\r\n\t\treturn point;\r\n\t},\r\n\r\n\t// @method untransform(point: Point, scale?: Number): Point\r\n\t// Returns the reverse transformation of the given point, optionally divided\r\n\t// by the given scale. Only accepts actual `L.Point` instances, not arrays.\r\n\tuntransform: function (point, scale) {\r\n\t\tscale = scale || 1;\r\n\t\treturn new Point(\r\n\t\t (point.x / scale - this._b) / this._a,\r\n\t\t (point.y / scale - this._d) / this._c);\r\n\t}\r\n};\r\n\r\n// factory L.transformation(a: Number, b: Number, c: Number, d: Number)\r\n\r\n// @factory L.transformation(a: Number, b: Number, c: Number, d: Number)\r\n// Instantiates a Transformation object with the given coefficients.\r\n\r\n// @alternative\r\n// @factory L.transformation(coefficients: Array): Transformation\r\n// Expects an coefficients array of the form\r\n// `[a: Number, b: Number, c: Number, d: Number]`.\r\n\r\nfunction toTransformation(a, b, c, d) {\r\n\treturn new Transformation(a, b, c, d);\r\n}\n\n/*\r\n * @namespace CRS\r\n * @crs L.CRS.EPSG3857\r\n *\r\n * The most common CRS for online maps, used by almost all free and commercial\r\n * tile providers. Uses Spherical Mercator projection. Set in by default in\r\n * Map's `crs` option.\r\n */\r\n\r\nvar EPSG3857 = extend({}, Earth, {\r\n\tcode: 'EPSG:3857',\r\n\tprojection: SphericalMercator,\r\n\r\n\ttransformation: (function () {\r\n\t\tvar scale = 0.5 / (Math.PI * SphericalMercator.R);\r\n\t\treturn toTransformation(scale, 0.5, -scale, 0.5);\r\n\t}())\r\n});\r\n\r\nvar EPSG900913 = extend({}, EPSG3857, {\r\n\tcode: 'EPSG:900913'\r\n});\n\n// @namespace SVG; @section\n// There are several static functions which can be called without instantiating L.SVG:\n\n// @function create(name: String): SVGElement\n// Returns a instance of [SVGElement](https://developer.mozilla.org/docs/Web/API/SVGElement),\n// corresponding to the class name passed. For example, using 'line' will return\n// an instance of [SVGLineElement](https://developer.mozilla.org/docs/Web/API/SVGLineElement).\nfunction svgCreate(name) {\n\treturn document.createElementNS('http://www.w3.org/2000/svg', name);\n}\n\n// @function pointsToPath(rings: Point[], closed: Boolean): String\n// Generates a SVG path string for multiple rings, with each ring turning\n// into \"M..L..L..\" instructions\nfunction pointsToPath(rings, closed) {\n\tvar str = '',\n\ti, j, len, len2, points, p;\n\n\tfor (i = 0, len = rings.length; i < len; i++) {\n\t\tpoints = rings[i];\n\n\t\tfor (j = 0, len2 = points.length; j < len2; j++) {\n\t\t\tp = points[j];\n\t\t\tstr += (j ? 'L' : 'M') + p.x + ' ' + p.y;\n\t\t}\n\n\t\t// closes the ring for polygons; \"x\" is VML syntax\n\t\tstr += closed ? (svg ? 'z' : 'x') : '';\n\t}\n\n\t// SVG complains about empty path strings\n\treturn str || 'M0 0';\n}\n\n/*\r\n * @namespace Browser\r\n * @aka L.Browser\r\n *\r\n * A namespace with static properties for browser/feature detection used by Leaflet internally.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * if (L.Browser.ielt9) {\r\n * alert('Upgrade your browser, dude!');\r\n * }\r\n * ```\r\n */\r\n\r\nvar style$1 = document.documentElement.style;\r\n\r\n// @property ie: Boolean; `true` for all Internet Explorer versions (not Edge).\r\nvar ie = 'ActiveXObject' in window;\r\n\r\n// @property ielt9: Boolean; `true` for Internet Explorer versions less than 9.\r\nvar ielt9 = ie && !document.addEventListener;\r\n\r\n// @property edge: Boolean; `true` for the Edge web browser.\r\nvar edge = 'msLaunchUri' in navigator && !('documentMode' in document);\r\n\r\n// @property webkit: Boolean;\r\n// `true` for webkit-based browsers like Chrome and Safari (including mobile versions).\r\nvar webkit = userAgentContains('webkit');\r\n\r\n// @property android: Boolean\r\n// `true` for any browser running on an Android platform.\r\nvar android = userAgentContains('android');\r\n\r\n// @property android23: Boolean; `true` for browsers running on Android 2 or Android 3.\r\nvar android23 = userAgentContains('android 2') || userAgentContains('android 3');\r\n\r\n/* See https://stackoverflow.com/a/17961266 for details on detecting stock Android */\r\nvar webkitVer = parseInt(/WebKit\\/([0-9]+)|$/.exec(navigator.userAgent)[1], 10); // also matches AppleWebKit\r\n// @property androidStock: Boolean; `true` for the Android stock browser (i.e. not Chrome)\r\nvar androidStock = android && userAgentContains('Google') && webkitVer < 537 && !('AudioNode' in window);\r\n\r\n// @property opera: Boolean; `true` for the Opera browser\r\nvar opera = !!window.opera;\r\n\r\n// @property chrome: Boolean; `true` for the Chrome browser.\r\nvar chrome = userAgentContains('chrome');\r\n\r\n// @property gecko: Boolean; `true` for gecko-based browsers like Firefox.\r\nvar gecko = userAgentContains('gecko') && !webkit && !opera && !ie;\r\n\r\n// @property safari: Boolean; `true` for the Safari browser.\r\nvar safari = !chrome && userAgentContains('safari');\r\n\r\nvar phantom = userAgentContains('phantom');\r\n\r\n// @property opera12: Boolean\r\n// `true` for the Opera browser supporting CSS transforms (version 12 or later).\r\nvar opera12 = 'OTransition' in style$1;\r\n\r\n// @property win: Boolean; `true` when the browser is running in a Windows platform\r\nvar win = navigator.platform.indexOf('Win') === 0;\r\n\r\n// @property ie3d: Boolean; `true` for all Internet Explorer versions supporting CSS transforms.\r\nvar ie3d = ie && ('transition' in style$1);\r\n\r\n// @property webkit3d: Boolean; `true` for webkit-based browsers supporting CSS transforms.\r\nvar webkit3d = ('WebKitCSSMatrix' in window) && ('m11' in new window.WebKitCSSMatrix()) && !android23;\r\n\r\n// @property gecko3d: Boolean; `true` for gecko-based browsers supporting CSS transforms.\r\nvar gecko3d = 'MozPerspective' in style$1;\r\n\r\n// @property any3d: Boolean\r\n// `true` for all browsers supporting CSS transforms.\r\nvar any3d = !window.L_DISABLE_3D && (ie3d || webkit3d || gecko3d) && !opera12 && !phantom;\r\n\r\n// @property mobile: Boolean; `true` for all browsers running in a mobile device.\r\nvar mobile = typeof orientation !== 'undefined' || userAgentContains('mobile');\r\n\r\n// @property mobileWebkit: Boolean; `true` for all webkit-based browsers in a mobile device.\r\nvar mobileWebkit = mobile && webkit;\r\n\r\n// @property mobileWebkit3d: Boolean\r\n// `true` for all webkit-based browsers in a mobile device supporting CSS transforms.\r\nvar mobileWebkit3d = mobile && webkit3d;\r\n\r\n// @property msPointer: Boolean\r\n// `true` for browsers implementing the Microsoft touch events model (notably IE10).\r\nvar msPointer = !window.PointerEvent && window.MSPointerEvent;\r\n\r\n// @property pointer: Boolean\r\n// `true` for all browsers supporting [pointer events](https://msdn.microsoft.com/en-us/library/dn433244%28v=vs.85%29.aspx).\r\nvar pointer = !!(window.PointerEvent || msPointer);\r\n\r\n// @property touch: Boolean\r\n// `true` for all browsers supporting [touch events](https://developer.mozilla.org/docs/Web/API/Touch_events).\r\n// This does not necessarily mean that the browser is running in a computer with\r\n// a touchscreen, it only means that the browser is capable of understanding\r\n// touch events.\r\nvar touch = !window.L_NO_TOUCH && (pointer || 'ontouchstart' in window ||\r\n\t\t(window.DocumentTouch && document instanceof window.DocumentTouch));\r\n\r\n// @property mobileOpera: Boolean; `true` for the Opera browser in a mobile device.\r\nvar mobileOpera = mobile && opera;\r\n\r\n// @property mobileGecko: Boolean\r\n// `true` for gecko-based browsers running in a mobile device.\r\nvar mobileGecko = mobile && gecko;\r\n\r\n// @property retina: Boolean\r\n// `true` for browsers on a high-resolution \"retina\" screen.\r\nvar retina = (window.devicePixelRatio || (window.screen.deviceXDPI / window.screen.logicalXDPI)) > 1;\r\n\r\n\r\n// @property canvas: Boolean\r\n// `true` when the browser supports [`<canvas>`](https://developer.mozilla.org/docs/Web/API/Canvas_API).\r\nvar canvas = (function () {\r\n\treturn !!document.createElement('canvas').getContext;\r\n}());\r\n\r\n// @property svg: Boolean\r\n// `true` when the browser supports [SVG](https://developer.mozilla.org/docs/Web/SVG).\r\nvar svg = !!(document.createElementNS && svgCreate('svg').createSVGRect);\r\n\r\n// @property vml: Boolean\r\n// `true` if the browser supports [VML](https://en.wikipedia.org/wiki/Vector_Markup_Language).\r\nvar vml = !svg && (function () {\r\n\ttry {\r\n\t\tvar div = document.createElement('div');\r\n\t\tdiv.innerHTML = '<v:shape adj=\"1\"/>';\r\n\r\n\t\tvar shape = div.firstChild;\r\n\t\tshape.style.behavior = 'url(#default#VML)';\r\n\r\n\t\treturn shape && (typeof shape.adj === 'object');\r\n\r\n\t} catch (e) {\r\n\t\treturn false;\r\n\t}\r\n}());\r\n\r\n\r\nfunction userAgentContains(str) {\r\n\treturn navigator.userAgent.toLowerCase().indexOf(str) >= 0;\r\n}\r\n\n\nvar Browser = (Object.freeze || Object)({\n\tie: ie,\n\tielt9: ielt9,\n\tedge: edge,\n\twebkit: webkit,\n\tandroid: android,\n\tandroid23: android23,\n\tandroidStock: androidStock,\n\topera: opera,\n\tchrome: chrome,\n\tgecko: gecko,\n\tsafari: safari,\n\tphantom: phantom,\n\topera12: opera12,\n\twin: win,\n\tie3d: ie3d,\n\twebkit3d: webkit3d,\n\tgecko3d: gecko3d,\n\tany3d: any3d,\n\tmobile: mobile,\n\tmobileWebkit: mobileWebkit,\n\tmobileWebkit3d: mobileWebkit3d,\n\tmsPointer: msPointer,\n\tpointer: pointer,\n\ttouch: touch,\n\tmobileOpera: mobileOpera,\n\tmobileGecko: mobileGecko,\n\tretina: retina,\n\tcanvas: canvas,\n\tsvg: svg,\n\tvml: vml\n});\n\n/*\n * Extends L.DomEvent to provide touch support for Internet Explorer and Windows-based devices.\n */\n\n\nvar POINTER_DOWN = msPointer ? 'MSPointerDown' : 'pointerdown';\nvar POINTER_MOVE = msPointer ? 'MSPointerMove' : 'pointermove';\nvar POINTER_UP = msPointer ? 'MSPointerUp' : 'pointerup';\nvar POINTER_CANCEL = msPointer ? 'MSPointerCancel' : 'pointercancel';\nvar TAG_WHITE_LIST = ['INPUT', 'SELECT', 'OPTION'];\n\nvar _pointers = {};\nvar _pointerDocListener = false;\n\n// DomEvent.DoubleTap needs to know about this\nvar _pointersCount = 0;\n\n// Provides a touch events wrapper for (ms)pointer events.\n// ref http://www.w3.org/TR/pointerevents/ https://www.w3.org/Bugs/Public/show_bug.cgi?id=22890\n\nfunction addPointerListener(obj, type, handler, id) {\n\tif (type === 'touchstart') {\n\t\t_addPointerStart(obj, handler, id);\n\n\t} else if (type === 'touchmove') {\n\t\t_addPointerMove(obj, handler, id);\n\n\t} else if (type === 'touchend') {\n\t\t_addPointerEnd(obj, handler, id);\n\t}\n\n\treturn this;\n}\n\nfunction removePointerListener(obj, type, id) {\n\tvar handler = obj['_leaflet_' + type + id];\n\n\tif (type === 'touchstart') {\n\t\tobj.removeEventListener(POINTER_DOWN, handler, false);\n\n\t} else if (type === 'touchmove') {\n\t\tobj.removeEventListener(POINTER_MOVE, handler, false);\n\n\t} else if (type === 'touchend') {\n\t\tobj.removeEventListener(POINTER_UP, handler, false);\n\t\tobj.removeEventListener(POINTER_CANCEL, handler, false);\n\t}\n\n\treturn this;\n}\n\nfunction _addPointerStart(obj, handler, id) {\n\tvar onDown = bind(function (e) {\n\t\tif (e.pointerType !== 'mouse' && e.MSPOINTER_TYPE_MOUSE && e.pointerType !== e.MSPOINTER_TYPE_MOUSE) {\n\t\t\t// In IE11, some touch events needs to fire for form controls, or\n\t\t\t// the controls will stop working. We keep a whitelist of tag names that\n\t\t\t// need these events. For other target tags, we prevent default on the event.\n\t\t\tif (TAG_WHITE_LIST.indexOf(e.target.tagName) < 0) {\n\t\t\t\tpreventDefault(e);\n\t\t\t} else {\n\t\t\t\treturn;\n\t\t\t}\n\t\t}\n\n\t\t_handlePointer(e, handler);\n\t});\n\n\tobj['_leaflet_touchstart' + id] = onDown;\n\tobj.addEventListener(POINTER_DOWN, onDown, false);\n\n\t// need to keep track of what pointers and how many are active to provide e.touches emulation\n\tif (!_pointerDocListener) {\n\t\t// we listen documentElement as any drags that end by moving the touch off the screen get fired there\n\t\tdocument.documentElement.addEventListener(POINTER_DOWN, _globalPointerDown, true);\n\t\tdocument.documentElement.addEventListener(POINTER_MOVE, _globalPointerMove, true);\n\t\tdocument.documentElement.addEventListener(POINTER_UP, _globalPointerUp, true);\n\t\tdocument.documentElement.addEventListener(POINTER_CANCEL, _globalPointerUp, true);\n\n\t\t_pointerDocListener = true;\n\t}\n}\n\nfunction _globalPointerDown(e) {\n\t_pointers[e.pointerId] = e;\n\t_pointersCount++;\n}\n\nfunction _globalPointerMove(e) {\n\tif (_pointers[e.pointerId]) {\n\t\t_pointers[e.pointerId] = e;\n\t}\n}\n\nfunction _globalPointerUp(e) {\n\tdelete _pointers[e.pointerId];\n\t_pointersCount--;\n}\n\nfunction _handlePointer(e, handler) {\n\te.touches = [];\n\tfor (var i in _pointers) {\n\t\te.touches.push(_pointers[i]);\n\t}\n\te.changedTouches = [e];\n\n\thandler(e);\n}\n\nfunction _addPointerMove(obj, handler, id) {\n\tvar onMove = function (e) {\n\t\t// don't fire touch moves when mouse isn't down\n\t\tif ((e.pointerType === e.MSPOINTER_TYPE_MOUSE || e.pointerType === 'mouse') && e.buttons === 0) { return; }\n\n\t\t_handlePointer(e, handler);\n\t};\n\n\tobj['_leaflet_touchmove' + id] = onMove;\n\tobj.addEventListener(POINTER_MOVE, onMove, false);\n}\n\nfunction _addPointerEnd(obj, handler, id) {\n\tvar onUp = function (e) {\n\t\t_handlePointer(e, handler);\n\t};\n\n\tobj['_leaflet_touchend' + id] = onUp;\n\tobj.addEventListener(POINTER_UP, onUp, false);\n\tobj.addEventListener(POINTER_CANCEL, onUp, false);\n}\n\n/*\r\n * Extends the event handling code with double tap support for mobile browsers.\r\n */\r\n\r\nvar _touchstart = msPointer ? 'MSPointerDown' : pointer ? 'pointerdown' : 'touchstart';\r\nvar _touchend = msPointer ? 'MSPointerUp' : pointer ? 'pointerup' : 'touchend';\r\nvar _pre = '_leaflet_';\r\n\r\n// inspired by Zepto touch code by Thomas Fuchs\r\nfunction addDoubleTapListener(obj, handler, id) {\r\n\tvar last, touch$$1,\r\n\t doubleTap = false,\r\n\t delay = 250;\r\n\r\n\tfunction onTouchStart(e) {\r\n\t\tvar count;\r\n\r\n\t\tif (pointer) {\r\n\t\t\tif ((!edge) || e.pointerType === 'mouse') { return; }\r\n\t\t\tcount = _pointersCount;\r\n\t\t} else {\r\n\t\t\tcount = e.touches.length;\r\n\t\t}\r\n\r\n\t\tif (count > 1) { return; }\r\n\r\n\t\tvar now = Date.now(),\r\n\t\t delta = now - (last || now);\r\n\r\n\t\ttouch$$1 = e.touches ? e.touches[0] : e;\r\n\t\tdoubleTap = (delta > 0 && delta <= delay);\r\n\t\tlast = now;\r\n\t}\r\n\r\n\tfunction onTouchEnd(e) {\r\n\t\tif (doubleTap && !touch$$1.cancelBubble) {\r\n\t\t\tif (pointer) {\r\n\t\t\t\tif ((!edge) || e.pointerType === 'mouse') { return; }\r\n\t\t\t\t// work around .type being readonly with MSPointer* events\r\n\t\t\t\tvar newTouch = {},\r\n\t\t\t\t prop, i;\r\n\r\n\t\t\t\tfor (i in touch$$1) {\r\n\t\t\t\t\tprop = touch$$1[i];\r\n\t\t\t\t\tnewTouch[i] = prop && prop.bind ? prop.bind(touch$$1) : prop;\r\n\t\t\t\t}\r\n\t\t\t\ttouch$$1 = newTouch;\r\n\t\t\t}\r\n\t\t\ttouch$$1.type = 'dblclick';\r\n\t\t\thandler(touch$$1);\r\n\t\t\tlast = null;\r\n\t\t}\r\n\t}\r\n\r\n\tobj[_pre + _touchstart + id] = onTouchStart;\r\n\tobj[_pre + _touchend + id] = onTouchEnd;\r\n\tobj[_pre + 'dblclick' + id] = handler;\r\n\r\n\tobj.addEventListener(_touchstart, onTouchStart, false);\r\n\tobj.addEventListener(_touchend, onTouchEnd, false);\r\n\r\n\t// On some platforms (notably, chrome<55 on win10 + touchscreen + mouse),\r\n\t// the browser doesn't fire touchend/pointerup events but does fire\r\n\t// native dblclicks. See #4127.\r\n\t// Edge 14 also fires native dblclicks, but only for pointerType mouse, see #5180.\r\n\tobj.addEventListener('dblclick', handler, false);\r\n\r\n\treturn this;\r\n}\r\n\r\nfunction removeDoubleTapListener(obj, id) {\r\n\tvar touchstart = obj[_pre + _touchstart + id],\r\n\t touchend = obj[_pre + _touchend + id],\r\n\t dblclick = obj[_pre + 'dblclick' + id];\r\n\r\n\tobj.removeEventListener(_touchstart, touchstart, false);\r\n\tobj.removeEventListener(_touchend, touchend, false);\r\n\tif (!edge) {\r\n\t\tobj.removeEventListener('dblclick', dblclick, false);\r\n\t}\r\n\r\n\treturn this;\r\n}\n\n/*\r\n * @namespace DomEvent\r\n * Utility functions to work with the [DOM events](https://developer.mozilla.org/docs/Web/API/Event), used by Leaflet internally.\r\n */\r\n\r\n// Inspired by John Resig, Dean Edwards and YUI addEvent implementations.\r\n\r\n// @function on(el: HTMLElement, types: String, fn: Function, context?: Object): this\r\n// Adds a listener function (`fn`) to a particular DOM event type of the\r\n// element `el`. You can optionally specify the context of the listener\r\n// (object the `this` keyword will point to). You can also pass several\r\n// space-separated types (e.g. `'click dblclick'`).\r\n\r\n// @alternative\r\n// @function on(el: HTMLElement, eventMap: Object, context?: Object): this\r\n// Adds a set of type/listener pairs, e.g. `{click: onClick, mousemove: onMouseMove}`\r\nfunction on(obj, types, fn, context) {\r\n\r\n\tif (typeof types === 'object') {\r\n\t\tfor (var type in types) {\r\n\t\t\taddOne(obj, type, types[type], fn);\r\n\t\t}\r\n\t} else {\r\n\t\ttypes = splitWords(types);\r\n\r\n\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n\t\t\taddOne(obj, types[i], fn, context);\r\n\t\t}\r\n\t}\r\n\r\n\treturn this;\r\n}\r\n\r\nvar eventsKey = '_leaflet_events';\r\n\r\n// @function off(el: HTMLElement, types: String, fn: Function, context?: Object): this\r\n// Removes a previously added listener function.\r\n// Note that if you passed a custom context to on, you must pass the same\r\n// context to `off` in order to remove the listener.\r\n\r\n// @alternative\r\n// @function off(el: HTMLElement, eventMap: Object, context?: Object): this\r\n// Removes a set of type/listener pairs, e.g. `{click: onClick, mousemove: onMouseMove}`\r\nfunction off(obj, types, fn, context) {\r\n\r\n\tif (typeof types === 'object') {\r\n\t\tfor (var type in types) {\r\n\t\t\tremoveOne(obj, type, types[type], fn);\r\n\t\t}\r\n\t} else if (types) {\r\n\t\ttypes = splitWords(types);\r\n\r\n\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n\t\t\tremoveOne(obj, types[i], fn, context);\r\n\t\t}\r\n\t} else {\r\n\t\tfor (var j in obj[eventsKey]) {\r\n\t\t\tremoveOne(obj, j, obj[eventsKey][j]);\r\n\t\t}\r\n\t\tdelete obj[eventsKey];\r\n\t}\r\n\r\n\treturn this;\r\n}\r\n\r\nfunction addOne(obj, type, fn, context) {\r\n\tvar id = type + stamp(fn) + (context ? '_' + stamp(context) : '');\r\n\r\n\tif (obj[eventsKey] && obj[eventsKey][id]) { return this; }\r\n\r\n\tvar handler = function (e) {\r\n\t\treturn fn.call(context || obj, e || window.event);\r\n\t};\r\n\r\n\tvar originalHandler = handler;\r\n\r\n\tif (pointer && type.indexOf('touch') === 0) {\r\n\t\t// Needs DomEvent.Pointer.js\r\n\t\taddPointerListener(obj, type, handler, id);\r\n\r\n\t} else if (touch && (type === 'dblclick') && addDoubleTapListener &&\r\n\t !(pointer && chrome)) {\r\n\t\t// Chrome >55 does not need the synthetic dblclicks from addDoubleTapListener\r\n\t\t// See #5180\r\n\t\taddDoubleTapListener(obj, handler, id);\r\n\r\n\t} else if ('addEventListener' in obj) {\r\n\r\n\t\tif (type === 'mousewheel') {\r\n\t\t\tobj.addEventListener('onwheel' in obj ? 'wheel' : 'mousewheel', handler, false);\r\n\r\n\t\t} else if ((type === 'mouseenter') || (type === 'mouseleave')) {\r\n\t\t\thandler = function (e) {\r\n\t\t\t\te = e || window.event;\r\n\t\t\t\tif (isExternalTarget(obj, e)) {\r\n\t\t\t\t\toriginalHandler(e);\r\n\t\t\t\t}\r\n\t\t\t};\r\n\t\t\tobj.addEventListener(type === 'mouseenter' ? 'mouseover' : 'mouseout', handler, false);\r\n\r\n\t\t} else {\r\n\t\t\tif (type === 'click' && android) {\r\n\t\t\t\thandler = function (e) {\r\n\t\t\t\t\tfilterClick(e, originalHandler);\r\n\t\t\t\t};\r\n\t\t\t}\r\n\t\t\tobj.addEventListener(type, handler, false);\r\n\t\t}\r\n\r\n\t} else if ('attachEvent' in obj) {\r\n\t\tobj.attachEvent('on' + type, handler);\r\n\t}\r\n\r\n\tobj[eventsKey] = obj[eventsKey] || {};\r\n\tobj[eventsKey][id] = handler;\r\n}\r\n\r\nfunction removeOne(obj, type, fn, context) {\r\n\r\n\tvar id = type + stamp(fn) + (context ? '_' + stamp(context) : ''),\r\n\t handler = obj[eventsKey] && obj[eventsKey][id];\r\n\r\n\tif (!handler) { return this; }\r\n\r\n\tif (pointer && type.indexOf('touch') === 0) {\r\n\t\tremovePointerListener(obj, type, id);\r\n\r\n\t} else if (touch && (type === 'dblclick') && removeDoubleTapListener &&\r\n\t !(pointer && chrome)) {\r\n\t\tremoveDoubleTapListener(obj, id);\r\n\r\n\t} else if ('removeEventListener' in obj) {\r\n\r\n\t\tif (type === 'mousewheel') {\r\n\t\t\tobj.removeEventListener('onwheel' in obj ? 'wheel' : 'mousewheel', handler, false);\r\n\r\n\t\t} else {\r\n\t\t\tobj.removeEventListener(\r\n\t\t\t\ttype === 'mouseenter' ? 'mouseover' :\r\n\t\t\t\ttype === 'mouseleave' ? 'mouseout' : type, handler, false);\r\n\t\t}\r\n\r\n\t} else if ('detachEvent' in obj) {\r\n\t\tobj.detachEvent('on' + type, handler);\r\n\t}\r\n\r\n\tobj[eventsKey][id] = null;\r\n}\r\n\r\n// @function stopPropagation(ev: DOMEvent): this\r\n// Stop the given event from propagation to parent elements. Used inside the listener functions:\r\n// ```js\r\n// L.DomEvent.on(div, 'click', function (ev) {\r\n// \tL.DomEvent.stopPropagation(ev);\r\n// });\r\n// ```\r\nfunction stopPropagation(e) {\r\n\r\n\tif (e.stopPropagation) {\r\n\t\te.stopPropagation();\r\n\t} else if (e.originalEvent) { // In case of Leaflet event.\r\n\t\te.originalEvent._stopped = true;\r\n\t} else {\r\n\t\te.cancelBubble = true;\r\n\t}\r\n\tskipped(e);\r\n\r\n\treturn this;\r\n}\r\n\r\n// @function disableScrollPropagation(el: HTMLElement): this\r\n// Adds `stopPropagation` to the element's `'mousewheel'` events (plus browser variants).\r\nfunction disableScrollPropagation(el) {\r\n\taddOne(el, 'mousewheel', stopPropagation);\r\n\treturn this;\r\n}\r\n\r\n// @function disableClickPropagation(el: HTMLElement): this\r\n// Adds `stopPropagation` to the element's `'click'`, `'doubleclick'`,\r\n// `'mousedown'` and `'touchstart'` events (plus browser variants).\r\nfunction disableClickPropagation(el) {\r\n\ton(el, 'mousedown touchstart dblclick', stopPropagation);\r\n\taddOne(el, 'click', fakeStop);\r\n\treturn this;\r\n}\r\n\r\n// @function preventDefault(ev: DOMEvent): this\r\n// Prevents the default action of the DOM Event `ev` from happening (such as\r\n// following a link in the href of the a element, or doing a POST request\r\n// with page reload when a `<form>` is submitted).\r\n// Use it inside listener functions.\r\nfunction preventDefault(e) {\r\n\tif (e.preventDefault) {\r\n\t\te.preventDefault();\r\n\t} else {\r\n\t\te.returnValue = false;\r\n\t}\r\n\treturn this;\r\n}\r\n\r\n// @function stop(ev: DOMEvent): this\r\n// Does `stopPropagation` and `preventDefault` at the same time.\r\nfunction stop(e) {\r\n\tpreventDefault(e);\r\n\tstopPropagation(e);\r\n\treturn this;\r\n}\r\n\r\n// @function getMousePosition(ev: DOMEvent, container?: HTMLElement): Point\r\n// Gets normalized mouse position from a DOM event relative to the\r\n// `container` or to the whole page if not specified.\r\nfunction getMousePosition(e, container) {\r\n\tif (!container) {\r\n\t\treturn new Point(e.clientX, e.clientY);\r\n\t}\r\n\r\n\tvar rect = container.getBoundingClientRect();\r\n\r\n\tvar scaleX = rect.width / container.offsetWidth || 1;\r\n\tvar scaleY = rect.height / container.offsetHeight || 1;\r\n\treturn new Point(\r\n\t\te.clientX / scaleX - rect.left - container.clientLeft,\r\n\t\te.clientY / scaleY - rect.top - container.clientTop);\r\n}\r\n\r\n// Chrome on Win scrolls double the pixels as in other platforms (see #4538),\r\n// and Firefox scrolls device pixels, not CSS pixels\r\nvar wheelPxFactor =\r\n\t(win && chrome) ? 2 * window.devicePixelRatio :\r\n\tgecko ? window.devicePixelRatio : 1;\r\n\r\n// @function getWheelDelta(ev: DOMEvent): Number\r\n// Gets normalized wheel delta from a mousewheel DOM event, in vertical\r\n// pixels scrolled (negative if scrolling down).\r\n// Events from pointing devices without precise scrolling are mapped to\r\n// a best guess of 60 pixels.\r\nfunction getWheelDelta(e) {\r\n\treturn (edge) ? e.wheelDeltaY / 2 : // Don't trust window-geometry-based delta\r\n\t (e.deltaY && e.deltaMode === 0) ? -e.deltaY / wheelPxFactor : // Pixels\r\n\t (e.deltaY && e.deltaMode === 1) ? -e.deltaY * 20 : // Lines\r\n\t (e.deltaY && e.deltaMode === 2) ? -e.deltaY * 60 : // Pages\r\n\t (e.deltaX || e.deltaZ) ? 0 :\t// Skip horizontal/depth wheel events\r\n\t e.wheelDelta ? (e.wheelDeltaY || e.wheelDelta) / 2 : // Legacy IE pixels\r\n\t (e.detail && Math.abs(e.detail) < 32765) ? -e.detail * 20 : // Legacy Moz lines\r\n\t e.detail ? e.detail / -32765 * 60 : // Legacy Moz pages\r\n\t 0;\r\n}\r\n\r\nvar skipEvents = {};\r\n\r\nfunction fakeStop(e) {\r\n\t// fakes stopPropagation by setting a special event flag, checked/reset with skipped(e)\r\n\tskipEvents[e.type] = true;\r\n}\r\n\r\nfunction skipped(e) {\r\n\tvar events = skipEvents[e.type];\r\n\t// reset when checking, as it's only used in map container and propagates outside of the map\r\n\tskipEvents[e.type] = false;\r\n\treturn events;\r\n}\r\n\r\n// check if element really left/entered the event target (for mouseenter/mouseleave)\r\nfunction isExternalTarget(el, e) {\r\n\r\n\tvar related = e.relatedTarget;\r\n\r\n\tif (!related) { return true; }\r\n\r\n\ttry {\r\n\t\twhile (related && (related !== el)) {\r\n\t\t\trelated = related.parentNode;\r\n\t\t}\r\n\t} catch (err) {\r\n\t\treturn false;\r\n\t}\r\n\treturn (related !== el);\r\n}\r\n\r\nvar lastClick;\r\n\r\n// this is a horrible workaround for a bug in Android where a single touch triggers two click events\r\nfunction filterClick(e, handler) {\r\n\tvar timeStamp = (e.timeStamp || (e.originalEvent && e.originalEvent.timeStamp)),\r\n\t elapsed = lastClick && (timeStamp - lastClick);\r\n\r\n\t// are they closer together than 500ms yet more than 100ms?\r\n\t// Android typically triggers them ~300ms apart while multiple listeners\r\n\t// on the same event should be triggered far faster;\r\n\t// or check if click is simulated on the element, and if it is, reject any non-simulated events\r\n\r\n\tif ((elapsed && elapsed > 100 && elapsed < 500) || (e.target._simulatedClick && !e._simulated)) {\r\n\t\tstop(e);\r\n\t\treturn;\r\n\t}\r\n\tlastClick = timeStamp;\r\n\r\n\thandler(e);\r\n}\r\n\r\n\r\n\n\nvar DomEvent = (Object.freeze || Object)({\n\ton: on,\n\toff: off,\n\tstopPropagation: stopPropagation,\n\tdisableScrollPropagation: disableScrollPropagation,\n\tdisableClickPropagation: disableClickPropagation,\n\tpreventDefault: preventDefault,\n\tstop: stop,\n\tgetMousePosition: getMousePosition,\n\tgetWheelDelta: getWheelDelta,\n\tfakeStop: fakeStop,\n\tskipped: skipped,\n\tisExternalTarget: isExternalTarget,\n\taddListener: on,\n\tremoveListener: off\n});\n\n/*\r\n * @namespace DomUtil\r\n *\r\n * Utility functions to work with the [DOM](https://developer.mozilla.org/docs/Web/API/Document_Object_Model)\r\n * tree, used by Leaflet internally.\r\n *\r\n * Most functions expecting or returning a `HTMLElement` also work for\r\n * SVG elements. The only difference is that classes refer to CSS classes\r\n * in HTML and SVG classes in SVG.\r\n */\r\n\r\n\r\n// @property TRANSFORM: String\r\n// Vendor-prefixed transform style name (e.g. `'webkitTransform'` for WebKit).\r\nvar TRANSFORM = testProp(\r\n\t['transform', 'WebkitTransform', 'OTransform', 'MozTransform', 'msTransform']);\r\n\r\n// webkitTransition comes first because some browser versions that drop vendor prefix don't do\r\n// the same for the transitionend event, in particular the Android 4.1 stock browser\r\n\r\n// @property TRANSITION: String\r\n// Vendor-prefixed transition style name.\r\nvar TRANSITION = testProp(\r\n\t['webkitTransition', 'transition', 'OTransition', 'MozTransition', 'msTransition']);\r\n\r\n// @property TRANSITION_END: String\r\n// Vendor-prefixed transitionend event name.\r\nvar TRANSITION_END =\r\n\tTRANSITION === 'webkitTransition' || TRANSITION === 'OTransition' ? TRANSITION + 'End' : 'transitionend';\r\n\r\n\r\n// @function get(id: String|HTMLElement): HTMLElement\r\n// Returns an element given its DOM id, or returns the element itself\r\n// if it was passed directly.\r\nfunction get(id) {\r\n\treturn typeof id === 'string' ? document.getElementById(id) : id;\r\n}\r\n\r\n// @function getStyle(el: HTMLElement, styleAttrib: String): String\r\n// Returns the value for a certain style attribute on an element,\r\n// including computed values or values set through CSS.\r\nfunction getStyle(el, style) {\r\n\tvar value = el.style[style] || (el.currentStyle && el.currentStyle[style]);\r\n\r\n\tif ((!value || value === 'auto') && document.defaultView) {\r\n\t\tvar css = document.defaultView.getComputedStyle(el, null);\r\n\t\tvalue = css ? css[style] : null;\r\n\t}\r\n\treturn value === 'auto' ? null : value;\r\n}\r\n\r\n// @function create(tagName: String, className?: String, container?: HTMLElement): HTMLElement\r\n// Creates an HTML element with `tagName`, sets its class to `className`, and optionally appends it to `container` element.\r\nfunction create$1(tagName, className, container) {\r\n\tvar el = document.createElement(tagName);\r\n\tel.className = className || '';\r\n\r\n\tif (container) {\r\n\t\tcontainer.appendChild(el);\r\n\t}\r\n\treturn el;\r\n}\r\n\r\n// @function remove(el: HTMLElement)\r\n// Removes `el` from its parent element\r\nfunction remove(el) {\r\n\tvar parent = el.parentNode;\r\n\tif (parent) {\r\n\t\tparent.removeChild(el);\r\n\t}\r\n}\r\n\r\n// @function empty(el: HTMLElement)\r\n// Removes all of `el`'s children elements from `el`\r\nfunction empty(el) {\r\n\twhile (el.firstChild) {\r\n\t\tel.removeChild(el.firstChild);\r\n\t}\r\n}\r\n\r\n// @function toFront(el: HTMLElement)\r\n// Makes `el` the last child of its parent, so it renders in front of the other children.\r\nfunction toFront(el) {\r\n\tvar parent = el.parentNode;\r\n\tif (parent.lastChild !== el) {\r\n\t\tparent.appendChild(el);\r\n\t}\r\n}\r\n\r\n// @function toBack(el: HTMLElement)\r\n// Makes `el` the first child of its parent, so it renders behind the other children.\r\nfunction toBack(el) {\r\n\tvar parent = el.parentNode;\r\n\tif (parent.firstChild !== el) {\r\n\t\tparent.insertBefore(el, parent.firstChild);\r\n\t}\r\n}\r\n\r\n// @function hasClass(el: HTMLElement, name: String): Boolean\r\n// Returns `true` if the element's class attribute contains `name`.\r\nfunction hasClass(el, name) {\r\n\tif (el.classList !== undefined) {\r\n\t\treturn el.classList.contains(name);\r\n\t}\r\n\tvar className = getClass(el);\r\n\treturn className.length > 0 && new RegExp('(^|\\\\s)' + name + '(\\\\s|$)').test(className);\r\n}\r\n\r\n// @function addClass(el: HTMLElement, name: String)\r\n// Adds `name` to the element's class attribute.\r\nfunction addClass(el, name) {\r\n\tif (el.classList !== undefined) {\r\n\t\tvar classes = splitWords(name);\r\n\t\tfor (var i = 0, len = classes.length; i < len; i++) {\r\n\t\t\tel.classList.add(classes[i]);\r\n\t\t}\r\n\t} else if (!hasClass(el, name)) {\r\n\t\tvar className = getClass(el);\r\n\t\tsetClass(el, (className ? className + ' ' : '') + name);\r\n\t}\r\n}\r\n\r\n// @function removeClass(el: HTMLElement, name: String)\r\n// Removes `name` from the element's class attribute.\r\nfunction removeClass(el, name) {\r\n\tif (el.classList !== undefined) {\r\n\t\tel.classList.remove(name);\r\n\t} else {\r\n\t\tsetClass(el, trim((' ' + getClass(el) + ' ').replace(' ' + name + ' ', ' ')));\r\n\t}\r\n}\r\n\r\n// @function setClass(el: HTMLElement, name: String)\r\n// Sets the element's class.\r\nfunction setClass(el, name) {\r\n\tif (el.className.baseVal === undefined) {\r\n\t\tel.className = name;\r\n\t} else {\r\n\t\t// in case of SVG element\r\n\t\tel.className.baseVal = name;\r\n\t}\r\n}\r\n\r\n// @function getClass(el: HTMLElement): String\r\n// Returns the element's class.\r\nfunction getClass(el) {\r\n\treturn el.className.baseVal === undefined ? el.className : el.className.baseVal;\r\n}\r\n\r\n// @function setOpacity(el: HTMLElement, opacity: Number)\r\n// Set the opacity of an element (including old IE support).\r\n// `opacity` must be a number from `0` to `1`.\r\nfunction setOpacity(el, value) {\r\n\tif ('opacity' in el.style) {\r\n\t\tel.style.opacity = value;\r\n\t} else if ('filter' in el.style) {\r\n\t\t_setOpacityIE(el, value);\r\n\t}\r\n}\r\n\r\nfunction _setOpacityIE(el, value) {\r\n\tvar filter = false,\r\n\t filterName = 'DXImageTransform.Microsoft.Alpha';\r\n\r\n\t// filters collection throws an error if we try to retrieve a filter that doesn't exist\r\n\ttry {\r\n\t\tfilter = el.filters.item(filterName);\r\n\t} catch (e) {\r\n\t\t// don't set opacity to 1 if we haven't already set an opacity,\r\n\t\t// it isn't needed and breaks transparent pngs.\r\n\t\tif (value === 1) { return; }\r\n\t}\r\n\r\n\tvalue = Math.round(value * 100);\r\n\r\n\tif (filter) {\r\n\t\tfilter.Enabled = (value !== 100);\r\n\t\tfilter.Opacity = value;\r\n\t} else {\r\n\t\tel.style.filter += ' progid:' + filterName + '(opacity=' + value + ')';\r\n\t}\r\n}\r\n\r\n// @function testProp(props: String[]): String|false\r\n// Goes through the array of style names and returns the first name\r\n// that is a valid style name for an element. If no such name is found,\r\n// it returns false. Useful for vendor-prefixed styles like `transform`.\r\nfunction testProp(props) {\r\n\tvar style = document.documentElement.style;\r\n\r\n\tfor (var i = 0; i < props.length; i++) {\r\n\t\tif (props[i] in style) {\r\n\t\t\treturn props[i];\r\n\t\t}\r\n\t}\r\n\treturn false;\r\n}\r\n\r\n// @function setTransform(el: HTMLElement, offset: Point, scale?: Number)\r\n// Resets the 3D CSS transform of `el` so it is translated by `offset` pixels\r\n// and optionally scaled by `scale`. Does not have an effect if the\r\n// browser doesn't support 3D CSS transforms.\r\nfunction setTransform(el, offset, scale) {\r\n\tvar pos = offset || new Point(0, 0);\r\n\r\n\tel.style[TRANSFORM] =\r\n\t\t(ie3d ?\r\n\t\t\t'translate(' + pos.x + 'px,' + pos.y + 'px)' :\r\n\t\t\t'translate3d(' + pos.x + 'px,' + pos.y + 'px,0)') +\r\n\t\t(scale ? ' scale(' + scale + ')' : '');\r\n}\r\n\r\n// @function setPosition(el: HTMLElement, position: Point)\r\n// Sets the position of `el` to coordinates specified by `position`,\r\n// using CSS translate or top/left positioning depending on the browser\r\n// (used by Leaflet internally to position its layers).\r\nfunction setPosition(el, point) {\r\n\r\n\t/*eslint-disable */\r\n\tel._leaflet_pos = point;\r\n\t/* eslint-enable */\r\n\r\n\tif (any3d) {\r\n\t\tsetTransform(el, point);\r\n\t} else {\r\n\t\tel.style.left = point.x + 'px';\r\n\t\tel.style.top = point.y + 'px';\r\n\t}\r\n}\r\n\r\n// @function getPosition(el: HTMLElement): Point\r\n// Returns the coordinates of an element previously positioned with setPosition.\r\nfunction getPosition(el) {\r\n\t// this method is only used for elements previously positioned using setPosition,\r\n\t// so it's safe to cache the position for performance\r\n\r\n\treturn el._leaflet_pos || new Point(0, 0);\r\n}\r\n\r\n// @function disableTextSelection()\r\n// Prevents the user from generating `selectstart` DOM events, usually generated\r\n// when the user drags the mouse through a page with text. Used internally\r\n// by Leaflet to override the behaviour of any click-and-drag interaction on\r\n// the map. Affects drag interactions on the whole document.\r\n\r\n// @function enableTextSelection()\r\n// Cancels the effects of a previous [`L.DomUtil.disableTextSelection`](#domutil-disabletextselection).\r\nvar disableTextSelection;\r\nvar enableTextSelection;\r\nvar _userSelect;\r\nif ('onselectstart' in document) {\r\n\tdisableTextSelection = function () {\r\n\t\ton(window, 'selectstart', preventDefault);\r\n\t};\r\n\tenableTextSelection = function () {\r\n\t\toff(window, 'selectstart', preventDefault);\r\n\t};\r\n} else {\r\n\tvar userSelectProperty = testProp(\r\n\t\t['userSelect', 'WebkitUserSelect', 'OUserSelect', 'MozUserSelect', 'msUserSelect']);\r\n\r\n\tdisableTextSelection = function () {\r\n\t\tif (userSelectProperty) {\r\n\t\t\tvar style = document.documentElement.style;\r\n\t\t\t_userSelect = style[userSelectProperty];\r\n\t\t\tstyle[userSelectProperty] = 'none';\r\n\t\t}\r\n\t};\r\n\tenableTextSelection = function () {\r\n\t\tif (userSelectProperty) {\r\n\t\t\tdocument.documentElement.style[userSelectProperty] = _userSelect;\r\n\t\t\t_userSelect = undefined;\r\n\t\t}\r\n\t};\r\n}\r\n\r\n// @function disableImageDrag()\r\n// As [`L.DomUtil.disableTextSelection`](#domutil-disabletextselection), but\r\n// for `dragstart` DOM events, usually generated when the user drags an image.\r\nfunction disableImageDrag() {\r\n\ton(window, 'dragstart', preventDefault);\r\n}\r\n\r\n// @function enableImageDrag()\r\n// Cancels the effects of a previous [`L.DomUtil.disableImageDrag`](#domutil-disabletextselection).\r\nfunction enableImageDrag() {\r\n\toff(window, 'dragstart', preventDefault);\r\n}\r\n\r\nvar _outlineElement;\nvar _outlineStyle;\r\n// @function preventOutline(el: HTMLElement)\r\n// Makes the [outline](https://developer.mozilla.org/docs/Web/CSS/outline)\r\n// of the element `el` invisible. Used internally by Leaflet to prevent\r\n// focusable elements from displaying an outline when the user performs a\r\n// drag interaction on them.\r\nfunction preventOutline(element) {\r\n\twhile (element.tabIndex === -1) {\r\n\t\telement = element.parentNode;\r\n\t}\r\n\tif (!element.style) { return; }\r\n\trestoreOutline();\r\n\t_outlineElement = element;\r\n\t_outlineStyle = element.style.outline;\r\n\telement.style.outline = 'none';\r\n\ton(window, 'keydown', restoreOutline);\r\n}\r\n\r\n// @function restoreOutline()\r\n// Cancels the effects of a previous [`L.DomUtil.preventOutline`]().\r\nfunction restoreOutline() {\r\n\tif (!_outlineElement) { return; }\r\n\t_outlineElement.style.outline = _outlineStyle;\r\n\t_outlineElement = undefined;\r\n\t_outlineStyle = undefined;\r\n\toff(window, 'keydown', restoreOutline);\r\n}\r\n\n\nvar DomUtil = (Object.freeze || Object)({\n\tTRANSFORM: TRANSFORM,\n\tTRANSITION: TRANSITION,\n\tTRANSITION_END: TRANSITION_END,\n\tget: get,\n\tgetStyle: getStyle,\n\tcreate: create$1,\n\tremove: remove,\n\tempty: empty,\n\ttoFront: toFront,\n\ttoBack: toBack,\n\thasClass: hasClass,\n\taddClass: addClass,\n\tremoveClass: removeClass,\n\tsetClass: setClass,\n\tgetClass: getClass,\n\tsetOpacity: setOpacity,\n\ttestProp: testProp,\n\tsetTransform: setTransform,\n\tsetPosition: setPosition,\n\tgetPosition: getPosition,\n\tdisableTextSelection: disableTextSelection,\n\tenableTextSelection: enableTextSelection,\n\tdisableImageDrag: disableImageDrag,\n\tenableImageDrag: enableImageDrag,\n\tpreventOutline: preventOutline,\n\trestoreOutline: restoreOutline\n});\n\n/*\n * @class PosAnimation\n * @aka L.PosAnimation\n * @inherits Evented\n * Used internally for panning animations, utilizing CSS3 Transitions for modern browsers and a timer fallback for IE6-9.\n *\n * @example\n * ```js\n * var fx = new L.PosAnimation();\n * fx.run(el, [300, 500], 0.5);\n * ```\n *\n * @constructor L.PosAnimation()\n * Creates a `PosAnimation` object.\n *\n */\n\nvar PosAnimation = Evented.extend({\n\n\t// @method run(el: HTMLElement, newPos: Point, duration?: Number, easeLinearity?: Number)\n\t// Run an animation of a given element to a new position, optionally setting\n\t// duration in seconds (`0.25` by default) and easing linearity factor (3rd\n\t// argument of the [cubic bezier curve](http://cubic-bezier.com/#0,0,.5,1),\n\t// `0.5` by default).\n\trun: function (el, newPos, duration, easeLinearity) {\n\t\tthis.stop();\n\n\t\tthis._el = el;\n\t\tthis._inProgress = true;\n\t\tthis._duration = duration || 0.25;\n\t\tthis._easeOutPower = 1 / Math.max(easeLinearity || 0.5, 0.2);\n\n\t\tthis._startPos = getPosition(el);\n\t\tthis._offset = newPos.subtract(this._startPos);\n\t\tthis._startTime = +new Date();\n\n\t\t// @event start: Event\n\t\t// Fired when the animation starts\n\t\tthis.fire('start');\n\n\t\tthis._animate();\n\t},\n\n\t// @method stop()\n\t// Stops the animation (if currently running).\n\tstop: function () {\n\t\tif (!this._inProgress) { return; }\n\n\t\tthis._step(true);\n\t\tthis._complete();\n\t},\n\n\t_animate: function () {\n\t\t// animation loop\n\t\tthis._animId = requestAnimFrame(this._animate, this);\n\t\tthis._step();\n\t},\n\n\t_step: function (round) {\n\t\tvar elapsed = (+new Date()) - this._startTime,\n\t\t duration = this._duration * 1000;\n\n\t\tif (elapsed < duration) {\n\t\t\tthis._runFrame(this._easeOut(elapsed / duration), round);\n\t\t} else {\n\t\t\tthis._runFrame(1);\n\t\t\tthis._complete();\n\t\t}\n\t},\n\n\t_runFrame: function (progress, round) {\n\t\tvar pos = this._startPos.add(this._offset.multiplyBy(progress));\n\t\tif (round) {\n\t\t\tpos._round();\n\t\t}\n\t\tsetPosition(this._el, pos);\n\n\t\t// @event step: Event\n\t\t// Fired continuously during the animation.\n\t\tthis.fire('step');\n\t},\n\n\t_complete: function () {\n\t\tcancelAnimFrame(this._animId);\n\n\t\tthis._inProgress = false;\n\t\t// @event end: Event\n\t\t// Fired when the animation ends.\n\t\tthis.fire('end');\n\t},\n\n\t_easeOut: function (t) {\n\t\treturn 1 - Math.pow(1 - t, this._easeOutPower);\n\t}\n});\n\n/*\r\n * @class Map\r\n * @aka L.Map\r\n * @inherits Evented\r\n *\r\n * The central class of the API — it is used to create a map on a page and manipulate it.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * // initialize the map on the \"map\" div with a given center and zoom\r\n * var map = L.map('map', {\r\n * \tcenter: [51.505, -0.09],\r\n * \tzoom: 13\r\n * });\r\n * ```\r\n *\r\n */\r\n\r\nvar Map = Evented.extend({\r\n\r\n\toptions: {\r\n\t\t// @section Map State Options\r\n\t\t// @option crs: CRS = L.CRS.EPSG3857\r\n\t\t// The [Coordinate Reference System](#crs) to use. Don't change this if you're not\r\n\t\t// sure what it means.\r\n\t\tcrs: EPSG3857,\r\n\r\n\t\t// @option center: LatLng = undefined\r\n\t\t// Initial geographic center of the map\r\n\t\tcenter: undefined,\r\n\r\n\t\t// @option zoom: Number = undefined\r\n\t\t// Initial map zoom level\r\n\t\tzoom: undefined,\r\n\r\n\t\t// @option minZoom: Number = *\r\n\t\t// Minimum zoom level of the map.\r\n\t\t// If not specified and at least one `GridLayer` or `TileLayer` is in the map,\r\n\t\t// the lowest of their `minZoom` options will be used instead.\r\n\t\tminZoom: undefined,\r\n\r\n\t\t// @option maxZoom: Number = *\r\n\t\t// Maximum zoom level of the map.\r\n\t\t// If not specified and at least one `GridLayer` or `TileLayer` is in the map,\r\n\t\t// the highest of their `maxZoom` options will be used instead.\r\n\t\tmaxZoom: undefined,\r\n\r\n\t\t// @option layers: Layer[] = []\r\n\t\t// Array of layers that will be added to the map initially\r\n\t\tlayers: [],\r\n\r\n\t\t// @option maxBounds: LatLngBounds = null\r\n\t\t// When this option is set, the map restricts the view to the given\r\n\t\t// geographical bounds, bouncing the user back if the user tries to pan\r\n\t\t// outside the view. To set the restriction dynamically, use\r\n\t\t// [`setMaxBounds`](#map-setmaxbounds) method.\r\n\t\tmaxBounds: undefined,\r\n\r\n\t\t// @option renderer: Renderer = *\r\n\t\t// The default method for drawing vector layers on the map. `L.SVG`\r\n\t\t// or `L.Canvas` by default depending on browser support.\r\n\t\trenderer: undefined,\r\n\r\n\r\n\t\t// @section Animation Options\r\n\t\t// @option zoomAnimation: Boolean = true\r\n\t\t// Whether the map zoom animation is enabled. By default it's enabled\r\n\t\t// in all browsers that support CSS3 Transitions except Android.\r\n\t\tzoomAnimation: true,\r\n\r\n\t\t// @option zoomAnimationThreshold: Number = 4\r\n\t\t// Won't animate zoom if the zoom difference exceeds this value.\r\n\t\tzoomAnimationThreshold: 4,\r\n\r\n\t\t// @option fadeAnimation: Boolean = true\r\n\t\t// Whether the tile fade animation is enabled. By default it's enabled\r\n\t\t// in all browsers that support CSS3 Transitions except Android.\r\n\t\tfadeAnimation: true,\r\n\r\n\t\t// @option markerZoomAnimation: Boolean = true\r\n\t\t// Whether markers animate their zoom with the zoom animation, if disabled\r\n\t\t// they will disappear for the length of the animation. By default it's\r\n\t\t// enabled in all browsers that support CSS3 Transitions except Android.\r\n\t\tmarkerZoomAnimation: true,\r\n\r\n\t\t// @option transform3DLimit: Number = 2^23\r\n\t\t// Defines the maximum size of a CSS translation transform. The default\r\n\t\t// value should not be changed unless a web browser positions layers in\r\n\t\t// the wrong place after doing a large `panBy`.\r\n\t\ttransform3DLimit: 8388608, // Precision limit of a 32-bit float\r\n\r\n\t\t// @section Interaction Options\r\n\t\t// @option zoomSnap: Number = 1\r\n\t\t// Forces the map's zoom level to always be a multiple of this, particularly\r\n\t\t// right after a [`fitBounds()`](#map-fitbounds) or a pinch-zoom.\r\n\t\t// By default, the zoom level snaps to the nearest integer; lower values\r\n\t\t// (e.g. `0.5` or `0.1`) allow for greater granularity. A value of `0`\r\n\t\t// means the zoom level will not be snapped after `fitBounds` or a pinch-zoom.\r\n\t\tzoomSnap: 1,\r\n\r\n\t\t// @option zoomDelta: Number = 1\r\n\t\t// Controls how much the map's zoom level will change after a\r\n\t\t// [`zoomIn()`](#map-zoomin), [`zoomOut()`](#map-zoomout), pressing `+`\r\n\t\t// or `-` on the keyboard, or using the [zoom controls](#control-zoom).\r\n\t\t// Values smaller than `1` (e.g. `0.5`) allow for greater granularity.\r\n\t\tzoomDelta: 1,\r\n\r\n\t\t// @option trackResize: Boolean = true\r\n\t\t// Whether the map automatically handles browser window resize to update itself.\r\n\t\ttrackResize: true\r\n\t},\r\n\r\n\tinitialize: function (id, options) { // (HTMLElement or String, Object)\r\n\t\toptions = setOptions(this, options);\r\n\r\n\t\tthis._initContainer(id);\r\n\t\tthis._initLayout();\r\n\r\n\t\t// hack for https://github.com/Leaflet/Leaflet/issues/1980\r\n\t\tthis._onResize = bind(this._onResize, this);\r\n\r\n\t\tthis._initEvents();\r\n\r\n\t\tif (options.maxBounds) {\r\n\t\t\tthis.setMaxBounds(options.maxBounds);\r\n\t\t}\r\n\r\n\t\tif (options.zoom !== undefined) {\r\n\t\t\tthis._zoom = this._limitZoom(options.zoom);\r\n\t\t}\r\n\r\n\t\tif (options.center && options.zoom !== undefined) {\r\n\t\t\tthis.setView(toLatLng(options.center), options.zoom, {reset: true});\r\n\t\t}\r\n\r\n\t\tthis._handlers = [];\r\n\t\tthis._layers = {};\r\n\t\tthis._zoomBoundLayers = {};\r\n\t\tthis._sizeChanged = true;\r\n\r\n\t\tthis.callInitHooks();\r\n\r\n\t\t// don't animate on browsers without hardware-accelerated transitions or old Android/Opera\r\n\t\tthis._zoomAnimated = TRANSITION && any3d && !mobileOpera &&\r\n\t\t\t\tthis.options.zoomAnimation;\r\n\r\n\t\t// zoom transitions run with the same duration for all layers, so if one of transitionend events\r\n\t\t// happens after starting zoom animation (propagating to the map pane), we know that it ended globally\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tthis._createAnimProxy();\r\n\t\t\ton(this._proxy, TRANSITION_END, this._catchTransitionEnd, this);\r\n\t\t}\r\n\r\n\t\tthis._addLayers(this.options.layers);\r\n\t},\r\n\r\n\r\n\t// @section Methods for modifying map state\r\n\r\n\t// @method setView(center: LatLng, zoom: Number, options?: Zoom/pan options): this\r\n\t// Sets the view of the map (geographical center and zoom) with the given\r\n\t// animation options.\r\n\tsetView: function (center, zoom, options) {\r\n\r\n\t\tzoom = zoom === undefined ? this._zoom : this._limitZoom(zoom);\r\n\t\tcenter = this._limitCenter(toLatLng(center), zoom, this.options.maxBounds);\r\n\t\toptions = options || {};\r\n\r\n\t\tthis._stop();\r\n\r\n\t\tif (this._loaded && !options.reset && options !== true) {\r\n\r\n\t\t\tif (options.animate !== undefined) {\r\n\t\t\t\toptions.zoom = extend({animate: options.animate}, options.zoom);\r\n\t\t\t\toptions.pan = extend({animate: options.animate, duration: options.duration}, options.pan);\r\n\t\t\t}\r\n\r\n\t\t\t// try animating pan or zoom\r\n\t\t\tvar moved = (this._zoom !== zoom) ?\r\n\t\t\t\tthis._tryAnimatedZoom && this._tryAnimatedZoom(center, zoom, options.zoom) :\r\n\t\t\t\tthis._tryAnimatedPan(center, options.pan);\r\n\r\n\t\t\tif (moved) {\r\n\t\t\t\t// prevent resize handler call, the view will refresh after animation anyway\r\n\t\t\t\tclearTimeout(this._sizeTimer);\r\n\t\t\t\treturn this;\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\t// animation didn't start, just reset the map view\r\n\t\tthis._resetView(center, zoom);\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method setZoom(zoom: Number, options?: Zoom/pan options): this\r\n\t// Sets the zoom of the map.\r\n\tsetZoom: function (zoom, options) {\r\n\t\tif (!this._loaded) {\r\n\t\t\tthis._zoom = zoom;\r\n\t\t\treturn this;\r\n\t\t}\r\n\t\treturn this.setView(this.getCenter(), zoom, {zoom: options});\r\n\t},\r\n\r\n\t// @method zoomIn(delta?: Number, options?: Zoom options): this\r\n\t// Increases the zoom of the map by `delta` ([`zoomDelta`](#map-zoomdelta) by default).\r\n\tzoomIn: function (delta, options) {\r\n\t\tdelta = delta || (any3d ? this.options.zoomDelta : 1);\r\n\t\treturn this.setZoom(this._zoom + delta, options);\r\n\t},\r\n\r\n\t// @method zoomOut(delta?: Number, options?: Zoom options): this\r\n\t// Decreases the zoom of the map by `delta` ([`zoomDelta`](#map-zoomdelta) by default).\r\n\tzoomOut: function (delta, options) {\r\n\t\tdelta = delta || (any3d ? this.options.zoomDelta : 1);\r\n\t\treturn this.setZoom(this._zoom - delta, options);\r\n\t},\r\n\r\n\t// @method setZoomAround(latlng: LatLng, zoom: Number, options: Zoom options): this\r\n\t// Zooms the map while keeping a specified geographical point on the map\r\n\t// stationary (e.g. used internally for scroll zoom and double-click zoom).\r\n\t// @alternative\r\n\t// @method setZoomAround(offset: Point, zoom: Number, options: Zoom options): this\r\n\t// Zooms the map while keeping a specified pixel on the map (relative to the top-left corner) stationary.\r\n\tsetZoomAround: function (latlng, zoom, options) {\r\n\t\tvar scale = this.getZoomScale(zoom),\r\n\t\t viewHalf = this.getSize().divideBy(2),\r\n\t\t containerPoint = latlng instanceof Point ? latlng : this.latLngToContainerPoint(latlng),\r\n\r\n\t\t centerOffset = containerPoint.subtract(viewHalf).multiplyBy(1 - 1 / scale),\r\n\t\t newCenter = this.containerPointToLatLng(viewHalf.add(centerOffset));\r\n\r\n\t\treturn this.setView(newCenter, zoom, {zoom: options});\r\n\t},\r\n\r\n\t_getBoundsCenterZoom: function (bounds, options) {\r\n\r\n\t\toptions = options || {};\r\n\t\tbounds = bounds.getBounds ? bounds.getBounds() : toLatLngBounds(bounds);\r\n\r\n\t\tvar paddingTL = toPoint(options.paddingTopLeft || options.padding || [0, 0]),\r\n\t\t paddingBR = toPoint(options.paddingBottomRight || options.padding || [0, 0]),\r\n\r\n\t\t zoom = this.getBoundsZoom(bounds, false, paddingTL.add(paddingBR));\r\n\r\n\t\tzoom = (typeof options.maxZoom === 'number') ? Math.min(options.maxZoom, zoom) : zoom;\r\n\r\n\t\tif (zoom === Infinity) {\r\n\t\t\treturn {\r\n\t\t\t\tcenter: bounds.getCenter(),\r\n\t\t\t\tzoom: zoom\r\n\t\t\t};\r\n\t\t}\r\n\r\n\t\tvar paddingOffset = paddingBR.subtract(paddingTL).divideBy(2),\r\n\r\n\t\t swPoint = this.project(bounds.getSouthWest(), zoom),\r\n\t\t nePoint = this.project(bounds.getNorthEast(), zoom),\r\n\t\t center = this.unproject(swPoint.add(nePoint).divideBy(2).add(paddingOffset), zoom);\r\n\r\n\t\treturn {\r\n\t\t\tcenter: center,\r\n\t\t\tzoom: zoom\r\n\t\t};\r\n\t},\r\n\r\n\t// @method fitBounds(bounds: LatLngBounds, options?: fitBounds options): this\r\n\t// Sets a map view that contains the given geographical bounds with the\r\n\t// maximum zoom level possible.\r\n\tfitBounds: function (bounds, options) {\r\n\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\r\n\t\tif (!bounds.isValid()) {\r\n\t\t\tthrow new Error('Bounds are not valid.');\r\n\t\t}\r\n\r\n\t\tvar target = this._getBoundsCenterZoom(bounds, options);\r\n\t\treturn this.setView(target.center, target.zoom, options);\r\n\t},\r\n\r\n\t// @method fitWorld(options?: fitBounds options): this\r\n\t// Sets a map view that mostly contains the whole world with the maximum\r\n\t// zoom level possible.\r\n\tfitWorld: function (options) {\r\n\t\treturn this.fitBounds([[-90, -180], [90, 180]], options);\r\n\t},\r\n\r\n\t// @method panTo(latlng: LatLng, options?: Pan options): this\r\n\t// Pans the map to a given center.\r\n\tpanTo: function (center, options) { // (LatLng)\r\n\t\treturn this.setView(center, this._zoom, {pan: options});\r\n\t},\r\n\r\n\t// @method panBy(offset: Point, options?: Pan options): this\r\n\t// Pans the map by a given number of pixels (animated).\r\n\tpanBy: function (offset, options) {\r\n\t\toffset = toPoint(offset).round();\r\n\t\toptions = options || {};\r\n\r\n\t\tif (!offset.x && !offset.y) {\r\n\t\t\treturn this.fire('moveend');\r\n\t\t}\r\n\t\t// If we pan too far, Chrome gets issues with tiles\r\n\t\t// and makes them disappear or appear in the wrong place (slightly offset) #2602\r\n\t\tif (options.animate !== true && !this.getSize().contains(offset)) {\r\n\t\t\tthis._resetView(this.unproject(this.project(this.getCenter()).add(offset)), this.getZoom());\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tif (!this._panAnim) {\r\n\t\t\tthis._panAnim = new PosAnimation();\r\n\r\n\t\t\tthis._panAnim.on({\r\n\t\t\t\t'step': this._onPanTransitionStep,\r\n\t\t\t\t'end': this._onPanTransitionEnd\r\n\t\t\t}, this);\r\n\t\t}\r\n\r\n\t\t// don't fire movestart if animating inertia\r\n\t\tif (!options.noMoveStart) {\r\n\t\t\tthis.fire('movestart');\r\n\t\t}\r\n\r\n\t\t// animate pan unless animate: false specified\r\n\t\tif (options.animate !== false) {\r\n\t\t\taddClass(this._mapPane, 'leaflet-pan-anim');\r\n\r\n\t\t\tvar newPos = this._getMapPanePos().subtract(offset).round();\r\n\t\t\tthis._panAnim.run(this._mapPane, newPos, options.duration || 0.25, options.easeLinearity);\r\n\t\t} else {\r\n\t\t\tthis._rawPanBy(offset);\r\n\t\t\tthis.fire('move').fire('moveend');\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method flyTo(latlng: LatLng, zoom?: Number, options?: Zoom/pan options): this\r\n\t// Sets the view of the map (geographical center and zoom) performing a smooth\r\n\t// pan-zoom animation.\r\n\tflyTo: function (targetCenter, targetZoom, options) {\r\n\r\n\t\toptions = options || {};\r\n\t\tif (options.animate === false || !any3d) {\r\n\t\t\treturn this.setView(targetCenter, targetZoom, options);\r\n\t\t}\r\n\r\n\t\tthis._stop();\r\n\r\n\t\tvar from = this.project(this.getCenter()),\r\n\t\t to = this.project(targetCenter),\r\n\t\t size = this.getSize(),\r\n\t\t startZoom = this._zoom;\r\n\r\n\t\ttargetCenter = toLatLng(targetCenter);\r\n\t\ttargetZoom = targetZoom === undefined ? startZoom : targetZoom;\r\n\r\n\t\tvar w0 = Math.max(size.x, size.y),\r\n\t\t w1 = w0 * this.getZoomScale(startZoom, targetZoom),\r\n\t\t u1 = (to.distanceTo(from)) || 1,\r\n\t\t rho = 1.42,\r\n\t\t rho2 = rho * rho;\r\n\r\n\t\tfunction r(i) {\r\n\t\t\tvar s1 = i ? -1 : 1,\r\n\t\t\t s2 = i ? w1 : w0,\r\n\t\t\t t1 = w1 * w1 - w0 * w0 + s1 * rho2 * rho2 * u1 * u1,\r\n\t\t\t b1 = 2 * s2 * rho2 * u1,\r\n\t\t\t b = t1 / b1,\r\n\t\t\t sq = Math.sqrt(b * b + 1) - b;\r\n\r\n\t\t\t // workaround for floating point precision bug when sq = 0, log = -Infinite,\r\n\t\t\t // thus triggering an infinite loop in flyTo\r\n\t\t\t var log = sq < 0.000000001 ? -18 : Math.log(sq);\r\n\r\n\t\t\treturn log;\r\n\t\t}\r\n\r\n\t\tfunction sinh(n) { return (Math.exp(n) - Math.exp(-n)) / 2; }\r\n\t\tfunction cosh(n) { return (Math.exp(n) + Math.exp(-n)) / 2; }\r\n\t\tfunction tanh(n) { return sinh(n) / cosh(n); }\r\n\r\n\t\tvar r0 = r(0);\r\n\r\n\t\tfunction w(s) { return w0 * (cosh(r0) / cosh(r0 + rho * s)); }\r\n\t\tfunction u(s) { return w0 * (cosh(r0) * tanh(r0 + rho * s) - sinh(r0)) / rho2; }\r\n\r\n\t\tfunction easeOut(t) { return 1 - Math.pow(1 - t, 1.5); }\r\n\r\n\t\tvar start = Date.now(),\r\n\t\t S = (r(1) - r0) / rho,\r\n\t\t duration = options.duration ? 1000 * options.duration : 1000 * S * 0.8;\r\n\r\n\t\tfunction frame() {\r\n\t\t\tvar t = (Date.now() - start) / duration,\r\n\t\t\t s = easeOut(t) * S;\r\n\r\n\t\t\tif (t <= 1) {\r\n\t\t\t\tthis._flyToFrame = requestAnimFrame(frame, this);\r\n\r\n\t\t\t\tthis._move(\r\n\t\t\t\t\tthis.unproject(from.add(to.subtract(from).multiplyBy(u(s) / u1)), startZoom),\r\n\t\t\t\t\tthis.getScaleZoom(w0 / w(s), startZoom),\r\n\t\t\t\t\t{flyTo: true});\r\n\r\n\t\t\t} else {\r\n\t\t\t\tthis\r\n\t\t\t\t\t._move(targetCenter, targetZoom)\r\n\t\t\t\t\t._moveEnd(true);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tthis._moveStart(true, options.noMoveStart);\r\n\r\n\t\tframe.call(this);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method flyToBounds(bounds: LatLngBounds, options?: fitBounds options): this\r\n\t// Sets the view of the map with a smooth animation like [`flyTo`](#map-flyto),\r\n\t// but takes a bounds parameter like [`fitBounds`](#map-fitbounds).\r\n\tflyToBounds: function (bounds, options) {\r\n\t\tvar target = this._getBoundsCenterZoom(bounds, options);\r\n\t\treturn this.flyTo(target.center, target.zoom, options);\r\n\t},\r\n\r\n\t// @method setMaxBounds(bounds: Bounds): this\r\n\t// Restricts the map view to the given bounds (see the [maxBounds](#map-maxbounds) option).\r\n\tsetMaxBounds: function (bounds) {\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\r\n\t\tif (!bounds.isValid()) {\r\n\t\t\tthis.options.maxBounds = null;\r\n\t\t\treturn this.off('moveend', this._panInsideMaxBounds);\r\n\t\t} else if (this.options.maxBounds) {\r\n\t\t\tthis.off('moveend', this._panInsideMaxBounds);\r\n\t\t}\r\n\r\n\t\tthis.options.maxBounds = bounds;\r\n\r\n\t\tif (this._loaded) {\r\n\t\t\tthis._panInsideMaxBounds();\r\n\t\t}\r\n\r\n\t\treturn this.on('moveend', this._panInsideMaxBounds);\r\n\t},\r\n\r\n\t// @method setMinZoom(zoom: Number): this\r\n\t// Sets the lower limit for the available zoom levels (see the [minZoom](#map-minzoom) option).\r\n\tsetMinZoom: function (zoom) {\r\n\t\tvar oldZoom = this.options.minZoom;\r\n\t\tthis.options.minZoom = zoom;\r\n\r\n\t\tif (this._loaded && oldZoom !== zoom) {\r\n\t\t\tthis.fire('zoomlevelschange');\r\n\r\n\t\t\tif (this.getZoom() < this.options.minZoom) {\r\n\t\t\t\treturn this.setZoom(zoom);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method setMaxZoom(zoom: Number): this\r\n\t// Sets the upper limit for the available zoom levels (see the [maxZoom](#map-maxzoom) option).\r\n\tsetMaxZoom: function (zoom) {\r\n\t\tvar oldZoom = this.options.maxZoom;\r\n\t\tthis.options.maxZoom = zoom;\r\n\r\n\t\tif (this._loaded && oldZoom !== zoom) {\r\n\t\t\tthis.fire('zoomlevelschange');\r\n\r\n\t\t\tif (this.getZoom() > this.options.maxZoom) {\r\n\t\t\t\treturn this.setZoom(zoom);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method panInsideBounds(bounds: LatLngBounds, options?: Pan options): this\r\n\t// Pans the map to the closest view that would lie inside the given bounds (if it's not already), controlling the animation using the options specific, if any.\r\n\tpanInsideBounds: function (bounds, options) {\r\n\t\tthis._enforcingBounds = true;\r\n\t\tvar center = this.getCenter(),\r\n\t\t newCenter = this._limitCenter(center, this._zoom, toLatLngBounds(bounds));\r\n\r\n\t\tif (!center.equals(newCenter)) {\r\n\t\t\tthis.panTo(newCenter, options);\r\n\t\t}\r\n\r\n\t\tthis._enforcingBounds = false;\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method invalidateSize(options: Zoom/pan options): this\r\n\t// Checks if the map container size changed and updates the map if so —\r\n\t// call it after you've changed the map size dynamically, also animating\r\n\t// pan by default. If `options.pan` is `false`, panning will not occur.\r\n\t// If `options.debounceMoveend` is `true`, it will delay `moveend` event so\r\n\t// that it doesn't happen often even if the method is called many\r\n\t// times in a row.\r\n\r\n\t// @alternative\r\n\t// @method invalidateSize(animate: Boolean): this\r\n\t// Checks if the map container size changed and updates the map if so —\r\n\t// call it after you've changed the map size dynamically, also animating\r\n\t// pan by default.\r\n\tinvalidateSize: function (options) {\r\n\t\tif (!this._loaded) { return this; }\r\n\r\n\t\toptions = extend({\r\n\t\t\tanimate: false,\r\n\t\t\tpan: true\r\n\t\t}, options === true ? {animate: true} : options);\r\n\r\n\t\tvar oldSize = this.getSize();\r\n\t\tthis._sizeChanged = true;\r\n\t\tthis._lastCenter = null;\r\n\r\n\t\tvar newSize = this.getSize(),\r\n\t\t oldCenter = oldSize.divideBy(2).round(),\r\n\t\t newCenter = newSize.divideBy(2).round(),\r\n\t\t offset = oldCenter.subtract(newCenter);\r\n\r\n\t\tif (!offset.x && !offset.y) { return this; }\r\n\r\n\t\tif (options.animate && options.pan) {\r\n\t\t\tthis.panBy(offset);\r\n\r\n\t\t} else {\r\n\t\t\tif (options.pan) {\r\n\t\t\t\tthis._rawPanBy(offset);\r\n\t\t\t}\r\n\r\n\t\t\tthis.fire('move');\r\n\r\n\t\t\tif (options.debounceMoveend) {\r\n\t\t\t\tclearTimeout(this._sizeTimer);\r\n\t\t\t\tthis._sizeTimer = setTimeout(bind(this.fire, this, 'moveend'), 200);\r\n\t\t\t} else {\r\n\t\t\t\tthis.fire('moveend');\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\t// @section Map state change events\r\n\t\t// @event resize: ResizeEvent\r\n\t\t// Fired when the map is resized.\r\n\t\treturn this.fire('resize', {\r\n\t\t\toldSize: oldSize,\r\n\t\t\tnewSize: newSize\r\n\t\t});\r\n\t},\r\n\r\n\t// @section Methods for modifying map state\r\n\t// @method stop(): this\r\n\t// Stops the currently running `panTo` or `flyTo` animation, if any.\r\n\tstop: function () {\r\n\t\tthis.setZoom(this._limitZoom(this._zoom));\r\n\t\tif (!this.options.zoomSnap) {\r\n\t\t\tthis.fire('viewreset');\r\n\t\t}\r\n\t\treturn this._stop();\r\n\t},\r\n\r\n\t// @section Geolocation methods\r\n\t// @method locate(options?: Locate options): this\r\n\t// Tries to locate the user using the Geolocation API, firing a [`locationfound`](#map-locationfound)\r\n\t// event with location data on success or a [`locationerror`](#map-locationerror) event on failure,\r\n\t// and optionally sets the map view to the user's location with respect to\r\n\t// detection accuracy (or to the world view if geolocation failed).\r\n\t// Note that, if your page doesn't use HTTPS, this method will fail in\r\n\t// modern browsers ([Chrome 50 and newer](https://sites.google.com/a/chromium.org/dev/Home/chromium-security/deprecating-powerful-features-on-insecure-origins))\r\n\t// See `Locate options` for more details.\r\n\tlocate: function (options) {\r\n\r\n\t\toptions = this._locateOptions = extend({\r\n\t\t\ttimeout: 10000,\r\n\t\t\twatch: false\r\n\t\t\t// setView: false\r\n\t\t\t// maxZoom: <Number>\r\n\t\t\t// maximumAge: 0\r\n\t\t\t// enableHighAccuracy: false\r\n\t\t}, options);\r\n\r\n\t\tif (!('geolocation' in navigator)) {\r\n\t\t\tthis._handleGeolocationError({\r\n\t\t\t\tcode: 0,\r\n\t\t\t\tmessage: 'Geolocation not supported.'\r\n\t\t\t});\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tvar onResponse = bind(this._handleGeolocationResponse, this),\r\n\t\t onError = bind(this._handleGeolocationError, this);\r\n\r\n\t\tif (options.watch) {\r\n\t\t\tthis._locationWatchId =\r\n\t\t\t navigator.geolocation.watchPosition(onResponse, onError, options);\r\n\t\t} else {\r\n\t\t\tnavigator.geolocation.getCurrentPosition(onResponse, onError, options);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method stopLocate(): this\r\n\t// Stops watching location previously initiated by `map.locate({watch: true})`\r\n\t// and aborts resetting the map view if map.locate was called with\r\n\t// `{setView: true}`.\r\n\tstopLocate: function () {\r\n\t\tif (navigator.geolocation && navigator.geolocation.clearWatch) {\r\n\t\t\tnavigator.geolocation.clearWatch(this._locationWatchId);\r\n\t\t}\r\n\t\tif (this._locateOptions) {\r\n\t\t\tthis._locateOptions.setView = false;\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_handleGeolocationError: function (error) {\r\n\t\tvar c = error.code,\r\n\t\t message = error.message ||\r\n\t\t (c === 1 ? 'permission denied' :\r\n\t\t (c === 2 ? 'position unavailable' : 'timeout'));\r\n\r\n\t\tif (this._locateOptions.setView && !this._loaded) {\r\n\t\t\tthis.fitWorld();\r\n\t\t}\r\n\r\n\t\t// @section Location events\r\n\t\t// @event locationerror: ErrorEvent\r\n\t\t// Fired when geolocation (using the [`locate`](#map-locate) method) failed.\r\n\t\tthis.fire('locationerror', {\r\n\t\t\tcode: c,\r\n\t\t\tmessage: 'Geolocation error: ' + message + '.'\r\n\t\t});\r\n\t},\r\n\r\n\t_handleGeolocationResponse: function (pos) {\r\n\t\tvar lat = pos.coords.latitude,\r\n\t\t lng = pos.coords.longitude,\r\n\t\t latlng = new LatLng(lat, lng),\r\n\t\t bounds = latlng.toBounds(pos.coords.accuracy),\r\n\t\t options = this._locateOptions;\r\n\r\n\t\tif (options.setView) {\r\n\t\t\tvar zoom = this.getBoundsZoom(bounds);\r\n\t\t\tthis.setView(latlng, options.maxZoom ? Math.min(zoom, options.maxZoom) : zoom);\r\n\t\t}\r\n\r\n\t\tvar data = {\r\n\t\t\tlatlng: latlng,\r\n\t\t\tbounds: bounds,\r\n\t\t\ttimestamp: pos.timestamp\r\n\t\t};\r\n\r\n\t\tfor (var i in pos.coords) {\r\n\t\t\tif (typeof pos.coords[i] === 'number') {\r\n\t\t\t\tdata[i] = pos.coords[i];\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\t// @event locationfound: LocationEvent\r\n\t\t// Fired when geolocation (using the [`locate`](#map-locate) method)\r\n\t\t// went successfully.\r\n\t\tthis.fire('locationfound', data);\r\n\t},\r\n\r\n\t// TODO Appropriate docs section?\r\n\t// @section Other Methods\r\n\t// @method addHandler(name: String, HandlerClass: Function): this\r\n\t// Adds a new `Handler` to the map, given its name and constructor function.\r\n\taddHandler: function (name, HandlerClass) {\r\n\t\tif (!HandlerClass) { return this; }\r\n\r\n\t\tvar handler = this[name] = new HandlerClass(this);\r\n\r\n\t\tthis._handlers.push(handler);\r\n\r\n\t\tif (this.options[name]) {\r\n\t\t\thandler.enable();\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method remove(): this\r\n\t// Destroys the map and clears all related event listeners.\r\n\tremove: function () {\r\n\r\n\t\tthis._initEvents(true);\r\n\r\n\t\tif (this._containerId !== this._container._leaflet_id) {\r\n\t\t\tthrow new Error('Map container is being reused by another instance');\r\n\t\t}\r\n\r\n\t\ttry {\r\n\t\t\t// throws error in IE6-8\r\n\t\t\tdelete this._container._leaflet_id;\r\n\t\t\tdelete this._containerId;\r\n\t\t} catch (e) {\r\n\t\t\t/*eslint-disable */\r\n\t\t\tthis._container._leaflet_id = undefined;\r\n\t\t\t/* eslint-enable */\r\n\t\t\tthis._containerId = undefined;\r\n\t\t}\r\n\r\n\t\tif (this._locationWatchId !== undefined) {\r\n\t\t\tthis.stopLocate();\r\n\t\t}\r\n\r\n\t\tthis._stop();\r\n\r\n\t\tremove(this._mapPane);\r\n\r\n\t\tif (this._clearControlPos) {\r\n\t\t\tthis._clearControlPos();\r\n\t\t}\r\n\r\n\t\tthis._clearHandlers();\r\n\r\n\t\tif (this._loaded) {\r\n\t\t\t// @section Map state change events\r\n\t\t\t// @event unload: Event\r\n\t\t\t// Fired when the map is destroyed with [remove](#map-remove) method.\r\n\t\t\tthis.fire('unload');\r\n\t\t}\r\n\r\n\t\tvar i;\r\n\t\tfor (i in this._layers) {\r\n\t\t\tthis._layers[i].remove();\r\n\t\t}\r\n\t\tfor (i in this._panes) {\r\n\t\t\tremove(this._panes[i]);\r\n\t\t}\r\n\r\n\t\tthis._layers = [];\r\n\t\tthis._panes = [];\r\n\t\tdelete this._mapPane;\r\n\t\tdelete this._renderer;\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @section Other Methods\r\n\t// @method createPane(name: String, container?: HTMLElement): HTMLElement\r\n\t// Creates a new [map pane](#map-pane) with the given name if it doesn't exist already,\r\n\t// then returns it. The pane is created as a child of `container`, or\r\n\t// as a child of the main map pane if not set.\r\n\tcreatePane: function (name, container) {\r\n\t\tvar className = 'leaflet-pane' + (name ? ' leaflet-' + name.replace('Pane', '') + '-pane' : ''),\r\n\t\t pane = create$1('div', className, container || this._mapPane);\r\n\r\n\t\tif (name) {\r\n\t\t\tthis._panes[name] = pane;\r\n\t\t}\r\n\t\treturn pane;\r\n\t},\r\n\r\n\t// @section Methods for Getting Map State\r\n\r\n\t// @method getCenter(): LatLng\r\n\t// Returns the geographical center of the map view\r\n\tgetCenter: function () {\r\n\t\tthis._checkIfLoaded();\r\n\r\n\t\tif (this._lastCenter && !this._moved()) {\r\n\t\t\treturn this._lastCenter;\r\n\t\t}\r\n\t\treturn this.layerPointToLatLng(this._getCenterLayerPoint());\r\n\t},\r\n\r\n\t// @method getZoom(): Number\r\n\t// Returns the current zoom level of the map view\r\n\tgetZoom: function () {\r\n\t\treturn this._zoom;\r\n\t},\r\n\r\n\t// @method getBounds(): LatLngBounds\r\n\t// Returns the geographical bounds visible in the current map view\r\n\tgetBounds: function () {\r\n\t\tvar bounds = this.getPixelBounds(),\r\n\t\t sw = this.unproject(bounds.getBottomLeft()),\r\n\t\t ne = this.unproject(bounds.getTopRight());\r\n\r\n\t\treturn new LatLngBounds(sw, ne);\r\n\t},\r\n\r\n\t// @method getMinZoom(): Number\r\n\t// Returns the minimum zoom level of the map (if set in the `minZoom` option of the map or of any layers), or `0` by default.\r\n\tgetMinZoom: function () {\r\n\t\treturn this.options.minZoom === undefined ? this._layersMinZoom || 0 : this.options.minZoom;\r\n\t},\r\n\r\n\t// @method getMaxZoom(): Number\r\n\t// Returns the maximum zoom level of the map (if set in the `maxZoom` option of the map or of any layers).\r\n\tgetMaxZoom: function () {\r\n\t\treturn this.options.maxZoom === undefined ?\r\n\t\t\t(this._layersMaxZoom === undefined ? Infinity : this._layersMaxZoom) :\r\n\t\t\tthis.options.maxZoom;\r\n\t},\r\n\r\n\t// @method getBoundsZoom(bounds: LatLngBounds, inside?: Boolean): Number\r\n\t// Returns the maximum zoom level on which the given bounds fit to the map\r\n\t// view in its entirety. If `inside` (optional) is set to `true`, the method\r\n\t// instead returns the minimum zoom level on which the map view fits into\r\n\t// the given bounds in its entirety.\r\n\tgetBoundsZoom: function (bounds, inside, padding) { // (LatLngBounds[, Boolean, Point]) -> Number\r\n\t\tbounds = toLatLngBounds(bounds);\r\n\t\tpadding = toPoint(padding || [0, 0]);\r\n\r\n\t\tvar zoom = this.getZoom() || 0,\r\n\t\t min = this.getMinZoom(),\r\n\t\t max = this.getMaxZoom(),\r\n\t\t nw = bounds.getNorthWest(),\r\n\t\t se = bounds.getSouthEast(),\r\n\t\t size = this.getSize().subtract(padding),\r\n\t\t boundsSize = toBounds(this.project(se, zoom), this.project(nw, zoom)).getSize(),\r\n\t\t snap = any3d ? this.options.zoomSnap : 1,\r\n\t\t scalex = size.x / boundsSize.x,\r\n\t\t scaley = size.y / boundsSize.y,\r\n\t\t scale = inside ? Math.max(scalex, scaley) : Math.min(scalex, scaley);\r\n\r\n\t\tzoom = this.getScaleZoom(scale, zoom);\r\n\r\n\t\tif (snap) {\r\n\t\t\tzoom = Math.round(zoom / (snap / 100)) * (snap / 100); // don't jump if within 1% of a snap level\r\n\t\t\tzoom = inside ? Math.ceil(zoom / snap) * snap : Math.floor(zoom / snap) * snap;\r\n\t\t}\r\n\r\n\t\treturn Math.max(min, Math.min(max, zoom));\r\n\t},\r\n\r\n\t// @method getSize(): Point\r\n\t// Returns the current size of the map container (in pixels).\r\n\tgetSize: function () {\r\n\t\tif (!this._size || this._sizeChanged) {\r\n\t\t\tthis._size = new Point(\r\n\t\t\t\tthis._container.clientWidth || 0,\r\n\t\t\t\tthis._container.clientHeight || 0);\r\n\r\n\t\t\tthis._sizeChanged = false;\r\n\t\t}\r\n\t\treturn this._size.clone();\r\n\t},\r\n\r\n\t// @method getPixelBounds(): Bounds\r\n\t// Returns the bounds of the current map view in projected pixel\r\n\t// coordinates (sometimes useful in layer and overlay implementations).\r\n\tgetPixelBounds: function (center, zoom) {\r\n\t\tvar topLeftPoint = this._getTopLeftPoint(center, zoom);\r\n\t\treturn new Bounds(topLeftPoint, topLeftPoint.add(this.getSize()));\r\n\t},\r\n\r\n\t// TODO: Check semantics - isn't the pixel origin the 0,0 coord relative to\r\n\t// the map pane? \"left point of the map layer\" can be confusing, specially\r\n\t// since there can be negative offsets.\r\n\t// @method getPixelOrigin(): Point\r\n\t// Returns the projected pixel coordinates of the top left point of\r\n\t// the map layer (useful in custom layer and overlay implementations).\r\n\tgetPixelOrigin: function () {\r\n\t\tthis._checkIfLoaded();\r\n\t\treturn this._pixelOrigin;\r\n\t},\r\n\r\n\t// @method getPixelWorldBounds(zoom?: Number): Bounds\r\n\t// Returns the world's bounds in pixel coordinates for zoom level `zoom`.\r\n\t// If `zoom` is omitted, the map's current zoom level is used.\r\n\tgetPixelWorldBounds: function (zoom) {\r\n\t\treturn this.options.crs.getProjectedBounds(zoom === undefined ? this.getZoom() : zoom);\r\n\t},\r\n\r\n\t// @section Other Methods\r\n\r\n\t// @method getPane(pane: String|HTMLElement): HTMLElement\r\n\t// Returns a [map pane](#map-pane), given its name or its HTML element (its identity).\r\n\tgetPane: function (pane) {\r\n\t\treturn typeof pane === 'string' ? this._panes[pane] : pane;\r\n\t},\r\n\r\n\t// @method getPanes(): Object\r\n\t// Returns a plain object containing the names of all [panes](#map-pane) as keys and\r\n\t// the panes as values.\r\n\tgetPanes: function () {\r\n\t\treturn this._panes;\r\n\t},\r\n\r\n\t// @method getContainer: HTMLElement\r\n\t// Returns the HTML element that contains the map.\r\n\tgetContainer: function () {\r\n\t\treturn this._container;\r\n\t},\r\n\r\n\r\n\t// @section Conversion Methods\r\n\r\n\t// @method getZoomScale(toZoom: Number, fromZoom: Number): Number\r\n\t// Returns the scale factor to be applied to a map transition from zoom level\r\n\t// `fromZoom` to `toZoom`. Used internally to help with zoom animations.\r\n\tgetZoomScale: function (toZoom, fromZoom) {\r\n\t\t// TODO replace with universal implementation after refactoring projections\r\n\t\tvar crs = this.options.crs;\r\n\t\tfromZoom = fromZoom === undefined ? this._zoom : fromZoom;\r\n\t\treturn crs.scale(toZoom) / crs.scale(fromZoom);\r\n\t},\r\n\r\n\t// @method getScaleZoom(scale: Number, fromZoom: Number): Number\r\n\t// Returns the zoom level that the map would end up at, if it is at `fromZoom`\r\n\t// level and everything is scaled by a factor of `scale`. Inverse of\r\n\t// [`getZoomScale`](#map-getZoomScale).\r\n\tgetScaleZoom: function (scale, fromZoom) {\r\n\t\tvar crs = this.options.crs;\r\n\t\tfromZoom = fromZoom === undefined ? this._zoom : fromZoom;\r\n\t\tvar zoom = crs.zoom(scale * crs.scale(fromZoom));\r\n\t\treturn isNaN(zoom) ? Infinity : zoom;\r\n\t},\r\n\r\n\t// @method project(latlng: LatLng, zoom: Number): Point\r\n\t// Projects a geographical coordinate `LatLng` according to the projection\r\n\t// of the map's CRS, then scales it according to `zoom` and the CRS's\r\n\t// `Transformation`. The result is pixel coordinate relative to\r\n\t// the CRS origin.\r\n\tproject: function (latlng, zoom) {\r\n\t\tzoom = zoom === undefined ? this._zoom : zoom;\r\n\t\treturn this.options.crs.latLngToPoint(toLatLng(latlng), zoom);\r\n\t},\r\n\r\n\t// @method unproject(point: Point, zoom: Number): LatLng\r\n\t// Inverse of [`project`](#map-project).\r\n\tunproject: function (point, zoom) {\r\n\t\tzoom = zoom === undefined ? this._zoom : zoom;\r\n\t\treturn this.options.crs.pointToLatLng(toPoint(point), zoom);\r\n\t},\r\n\r\n\t// @method layerPointToLatLng(point: Point): LatLng\r\n\t// Given a pixel coordinate relative to the [origin pixel](#map-getpixelorigin),\r\n\t// returns the corresponding geographical coordinate (for the current zoom level).\r\n\tlayerPointToLatLng: function (point) {\r\n\t\tvar projectedPoint = toPoint(point).add(this.getPixelOrigin());\r\n\t\treturn this.unproject(projectedPoint);\r\n\t},\r\n\r\n\t// @method latLngToLayerPoint(latlng: LatLng): Point\r\n\t// Given a geographical coordinate, returns the corresponding pixel coordinate\r\n\t// relative to the [origin pixel](#map-getpixelorigin).\r\n\tlatLngToLayerPoint: function (latlng) {\r\n\t\tvar projectedPoint = this.project(toLatLng(latlng))._round();\r\n\t\treturn projectedPoint._subtract(this.getPixelOrigin());\r\n\t},\r\n\r\n\t// @method wrapLatLng(latlng: LatLng): LatLng\r\n\t// Returns a `LatLng` where `lat` and `lng` has been wrapped according to the\r\n\t// map's CRS's `wrapLat` and `wrapLng` properties, if they are outside the\r\n\t// CRS's bounds.\r\n\t// By default this means longitude is wrapped around the dateline so its\r\n\t// value is between -180 and +180 degrees.\r\n\twrapLatLng: function (latlng) {\r\n\t\treturn this.options.crs.wrapLatLng(toLatLng(latlng));\r\n\t},\r\n\r\n\t// @method wrapLatLngBounds(bounds: LatLngBounds): LatLngBounds\r\n\t// Returns a `LatLngBounds` with the same size as the given one, ensuring that\r\n\t// its center is within the CRS's bounds.\r\n\t// By default this means the center longitude is wrapped around the dateline so its\r\n\t// value is between -180 and +180 degrees, and the majority of the bounds\r\n\t// overlaps the CRS's bounds.\r\n\twrapLatLngBounds: function (latlng) {\r\n\t\treturn this.options.crs.wrapLatLngBounds(toLatLngBounds(latlng));\r\n\t},\r\n\r\n\t// @method distance(latlng1: LatLng, latlng2: LatLng): Number\r\n\t// Returns the distance between two geographical coordinates according to\r\n\t// the map's CRS. By default this measures distance in meters.\r\n\tdistance: function (latlng1, latlng2) {\r\n\t\treturn this.options.crs.distance(toLatLng(latlng1), toLatLng(latlng2));\r\n\t},\r\n\r\n\t// @method containerPointToLayerPoint(point: Point): Point\r\n\t// Given a pixel coordinate relative to the map container, returns the corresponding\r\n\t// pixel coordinate relative to the [origin pixel](#map-getpixelorigin).\r\n\tcontainerPointToLayerPoint: function (point) { // (Point)\r\n\t\treturn toPoint(point).subtract(this._getMapPanePos());\r\n\t},\r\n\r\n\t// @method layerPointToContainerPoint(point: Point): Point\r\n\t// Given a pixel coordinate relative to the [origin pixel](#map-getpixelorigin),\r\n\t// returns the corresponding pixel coordinate relative to the map container.\r\n\tlayerPointToContainerPoint: function (point) { // (Point)\r\n\t\treturn toPoint(point).add(this._getMapPanePos());\r\n\t},\r\n\r\n\t// @method containerPointToLatLng(point: Point): LatLng\r\n\t// Given a pixel coordinate relative to the map container, returns\r\n\t// the corresponding geographical coordinate (for the current zoom level).\r\n\tcontainerPointToLatLng: function (point) {\r\n\t\tvar layerPoint = this.containerPointToLayerPoint(toPoint(point));\r\n\t\treturn this.layerPointToLatLng(layerPoint);\r\n\t},\r\n\r\n\t// @method latLngToContainerPoint(latlng: LatLng): Point\r\n\t// Given a geographical coordinate, returns the corresponding pixel coordinate\r\n\t// relative to the map container.\r\n\tlatLngToContainerPoint: function (latlng) {\r\n\t\treturn this.layerPointToContainerPoint(this.latLngToLayerPoint(toLatLng(latlng)));\r\n\t},\r\n\r\n\t// @method mouseEventToContainerPoint(ev: MouseEvent): Point\r\n\t// Given a MouseEvent object, returns the pixel coordinate relative to the\r\n\t// map container where the event took place.\r\n\tmouseEventToContainerPoint: function (e) {\r\n\t\treturn getMousePosition(e, this._container);\r\n\t},\r\n\r\n\t// @method mouseEventToLayerPoint(ev: MouseEvent): Point\r\n\t// Given a MouseEvent object, returns the pixel coordinate relative to\r\n\t// the [origin pixel](#map-getpixelorigin) where the event took place.\r\n\tmouseEventToLayerPoint: function (e) {\r\n\t\treturn this.containerPointToLayerPoint(this.mouseEventToContainerPoint(e));\r\n\t},\r\n\r\n\t// @method mouseEventToLatLng(ev: MouseEvent): LatLng\r\n\t// Given a MouseEvent object, returns geographical coordinate where the\r\n\t// event took place.\r\n\tmouseEventToLatLng: function (e) { // (MouseEvent)\r\n\t\treturn this.layerPointToLatLng(this.mouseEventToLayerPoint(e));\r\n\t},\r\n\r\n\r\n\t// map initialization methods\r\n\r\n\t_initContainer: function (id) {\r\n\t\tvar container = this._container = get(id);\r\n\r\n\t\tif (!container) {\r\n\t\t\tthrow new Error('Map container not found.');\r\n\t\t} else if (container._leaflet_id) {\r\n\t\t\tthrow new Error('Map container is already initialized.');\r\n\t\t}\r\n\r\n\t\ton(container, 'scroll', this._onScroll, this);\r\n\t\tthis._containerId = stamp(container);\r\n\t},\r\n\r\n\t_initLayout: function () {\r\n\t\tvar container = this._container;\r\n\r\n\t\tthis._fadeAnimated = this.options.fadeAnimation && any3d;\r\n\r\n\t\taddClass(container, 'leaflet-container' +\r\n\t\t\t(touch ? ' leaflet-touch' : '') +\r\n\t\t\t(retina ? ' leaflet-retina' : '') +\r\n\t\t\t(ielt9 ? ' leaflet-oldie' : '') +\r\n\t\t\t(safari ? ' leaflet-safari' : '') +\r\n\t\t\t(this._fadeAnimated ? ' leaflet-fade-anim' : ''));\r\n\r\n\t\tvar position = getStyle(container, 'position');\r\n\r\n\t\tif (position !== 'absolute' && position !== 'relative' && position !== 'fixed') {\r\n\t\t\tcontainer.style.position = 'relative';\r\n\t\t}\r\n\r\n\t\tthis._initPanes();\r\n\r\n\t\tif (this._initControlPos) {\r\n\t\t\tthis._initControlPos();\r\n\t\t}\r\n\t},\r\n\r\n\t_initPanes: function () {\r\n\t\tvar panes = this._panes = {};\r\n\t\tthis._paneRenderers = {};\r\n\r\n\t\t// @section\r\n\t\t//\r\n\t\t// Panes are DOM elements used to control the ordering of layers on the map. You\r\n\t\t// can access panes with [`map.getPane`](#map-getpane) or\r\n\t\t// [`map.getPanes`](#map-getpanes) methods. New panes can be created with the\r\n\t\t// [`map.createPane`](#map-createpane) method.\r\n\t\t//\r\n\t\t// Every map has the following default panes that differ only in zIndex.\r\n\t\t//\r\n\t\t// @pane mapPane: HTMLElement = 'auto'\r\n\t\t// Pane that contains all other map panes\r\n\r\n\t\tthis._mapPane = this.createPane('mapPane', this._container);\r\n\t\tsetPosition(this._mapPane, new Point(0, 0));\r\n\r\n\t\t// @pane tilePane: HTMLElement = 200\r\n\t\t// Pane for `GridLayer`s and `TileLayer`s\r\n\t\tthis.createPane('tilePane');\r\n\t\t// @pane overlayPane: HTMLElement = 400\r\n\t\t// Pane for vectors (`Path`s, like `Polyline`s and `Polygon`s), `ImageOverlay`s and `VideoOverlay`s\r\n\t\tthis.createPane('shadowPane');\r\n\t\t// @pane shadowPane: HTMLElement = 500\r\n\t\t// Pane for overlay shadows (e.g. `Marker` shadows)\r\n\t\tthis.createPane('overlayPane');\r\n\t\t// @pane markerPane: HTMLElement = 600\r\n\t\t// Pane for `Icon`s of `Marker`s\r\n\t\tthis.createPane('markerPane');\r\n\t\t// @pane tooltipPane: HTMLElement = 650\r\n\t\t// Pane for `Tooltip`s.\r\n\t\tthis.createPane('tooltipPane');\r\n\t\t// @pane popupPane: HTMLElement = 700\r\n\t\t// Pane for `Popup`s.\r\n\t\tthis.createPane('popupPane');\r\n\r\n\t\tif (!this.options.markerZoomAnimation) {\r\n\t\t\taddClass(panes.markerPane, 'leaflet-zoom-hide');\r\n\t\t\taddClass(panes.shadowPane, 'leaflet-zoom-hide');\r\n\t\t}\r\n\t},\r\n\r\n\r\n\t// private methods that modify map state\r\n\r\n\t// @section Map state change events\r\n\t_resetView: function (center, zoom) {\r\n\t\tsetPosition(this._mapPane, new Point(0, 0));\r\n\r\n\t\tvar loading = !this._loaded;\r\n\t\tthis._loaded = true;\r\n\t\tzoom = this._limitZoom(zoom);\r\n\r\n\t\tthis.fire('viewprereset');\r\n\r\n\t\tvar zoomChanged = this._zoom !== zoom;\r\n\t\tthis\r\n\t\t\t._moveStart(zoomChanged, false)\r\n\t\t\t._move(center, zoom)\r\n\t\t\t._moveEnd(zoomChanged);\r\n\r\n\t\t// @event viewreset: Event\r\n\t\t// Fired when the map needs to redraw its content (this usually happens\r\n\t\t// on map zoom or load). Very useful for creating custom overlays.\r\n\t\tthis.fire('viewreset');\r\n\r\n\t\t// @event load: Event\r\n\t\t// Fired when the map is initialized (when its center and zoom are set\r\n\t\t// for the first time).\r\n\t\tif (loading) {\r\n\t\t\tthis.fire('load');\r\n\t\t}\r\n\t},\r\n\r\n\t_moveStart: function (zoomChanged, noMoveStart) {\r\n\t\t// @event zoomstart: Event\r\n\t\t// Fired when the map zoom is about to change (e.g. before zoom animation).\r\n\t\t// @event movestart: Event\r\n\t\t// Fired when the view of the map starts changing (e.g. user starts dragging the map).\r\n\t\tif (zoomChanged) {\r\n\t\t\tthis.fire('zoomstart');\r\n\t\t}\r\n\t\tif (!noMoveStart) {\r\n\t\t\tthis.fire('movestart');\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_move: function (center, zoom, data) {\r\n\t\tif (zoom === undefined) {\r\n\t\t\tzoom = this._zoom;\r\n\t\t}\r\n\t\tvar zoomChanged = this._zoom !== zoom;\r\n\r\n\t\tthis._zoom = zoom;\r\n\t\tthis._lastCenter = center;\r\n\t\tthis._pixelOrigin = this._getNewPixelOrigin(center);\r\n\r\n\t\t// @event zoom: Event\r\n\t\t// Fired repeatedly during any change in zoom level, including zoom\r\n\t\t// and fly animations.\r\n\t\tif (zoomChanged || (data && data.pinch)) {\t// Always fire 'zoom' if pinching because #3530\r\n\t\t\tthis.fire('zoom', data);\r\n\t\t}\r\n\r\n\t\t// @event move: Event\r\n\t\t// Fired repeatedly during any movement of the map, including pan and\r\n\t\t// fly animations.\r\n\t\treturn this.fire('move', data);\r\n\t},\r\n\r\n\t_moveEnd: function (zoomChanged) {\r\n\t\t// @event zoomend: Event\r\n\t\t// Fired when the map has changed, after any animations.\r\n\t\tif (zoomChanged) {\r\n\t\t\tthis.fire('zoomend');\r\n\t\t}\r\n\r\n\t\t// @event moveend: Event\r\n\t\t// Fired when the center of the map stops changing (e.g. user stopped\r\n\t\t// dragging the map).\r\n\t\treturn this.fire('moveend');\r\n\t},\r\n\r\n\t_stop: function () {\r\n\t\tcancelAnimFrame(this._flyToFrame);\r\n\t\tif (this._panAnim) {\r\n\t\t\tthis._panAnim.stop();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_rawPanBy: function (offset) {\r\n\t\tsetPosition(this._mapPane, this._getMapPanePos().subtract(offset));\r\n\t},\r\n\r\n\t_getZoomSpan: function () {\r\n\t\treturn this.getMaxZoom() - this.getMinZoom();\r\n\t},\r\n\r\n\t_panInsideMaxBounds: function () {\r\n\t\tif (!this._enforcingBounds) {\r\n\t\t\tthis.panInsideBounds(this.options.maxBounds);\r\n\t\t}\r\n\t},\r\n\r\n\t_checkIfLoaded: function () {\r\n\t\tif (!this._loaded) {\r\n\t\t\tthrow new Error('Set map center and zoom first.');\r\n\t\t}\r\n\t},\r\n\r\n\t// DOM event handling\r\n\r\n\t// @section Interaction events\r\n\t_initEvents: function (remove$$1) {\r\n\t\tthis._targets = {};\r\n\t\tthis._targets[stamp(this._container)] = this;\r\n\r\n\t\tvar onOff = remove$$1 ? off : on;\r\n\r\n\t\t// @event click: MouseEvent\r\n\t\t// Fired when the user clicks (or taps) the map.\r\n\t\t// @event dblclick: MouseEvent\r\n\t\t// Fired when the user double-clicks (or double-taps) the map.\r\n\t\t// @event mousedown: MouseEvent\r\n\t\t// Fired when the user pushes the mouse button on the map.\r\n\t\t// @event mouseup: MouseEvent\r\n\t\t// Fired when the user releases the mouse button on the map.\r\n\t\t// @event mouseover: MouseEvent\r\n\t\t// Fired when the mouse enters the map.\r\n\t\t// @event mouseout: MouseEvent\r\n\t\t// Fired when the mouse leaves the map.\r\n\t\t// @event mousemove: MouseEvent\r\n\t\t// Fired while the mouse moves over the map.\r\n\t\t// @event contextmenu: MouseEvent\r\n\t\t// Fired when the user pushes the right mouse button on the map, prevents\r\n\t\t// default browser context menu from showing if there are listeners on\r\n\t\t// this event. Also fired on mobile when the user holds a single touch\r\n\t\t// for a second (also called long press).\r\n\t\t// @event keypress: KeyboardEvent\r\n\t\t// Fired when the user presses a key from the keyboard while the map is focused.\r\n\t\tonOff(this._container, 'click dblclick mousedown mouseup ' +\r\n\t\t\t'mouseover mouseout mousemove contextmenu keypress', this._handleDOMEvent, this);\r\n\r\n\t\tif (this.options.trackResize) {\r\n\t\t\tonOff(window, 'resize', this._onResize, this);\r\n\t\t}\r\n\r\n\t\tif (any3d && this.options.transform3DLimit) {\r\n\t\t\t(remove$$1 ? this.off : this.on).call(this, 'moveend', this._onMoveEnd);\r\n\t\t}\r\n\t},\r\n\r\n\t_onResize: function () {\r\n\t\tcancelAnimFrame(this._resizeRequest);\r\n\t\tthis._resizeRequest = requestAnimFrame(\r\n\t\t function () { this.invalidateSize({debounceMoveend: true}); }, this);\r\n\t},\r\n\r\n\t_onScroll: function () {\r\n\t\tthis._container.scrollTop = 0;\r\n\t\tthis._container.scrollLeft = 0;\r\n\t},\r\n\r\n\t_onMoveEnd: function () {\r\n\t\tvar pos = this._getMapPanePos();\r\n\t\tif (Math.max(Math.abs(pos.x), Math.abs(pos.y)) >= this.options.transform3DLimit) {\r\n\t\t\t// https://bugzilla.mozilla.org/show_bug.cgi?id=1203873 but Webkit also have\r\n\t\t\t// a pixel offset on very high values, see: http://jsfiddle.net/dg6r5hhb/\r\n\t\t\tthis._resetView(this.getCenter(), this.getZoom());\r\n\t\t}\r\n\t},\r\n\r\n\t_findEventTargets: function (e, type) {\r\n\t\tvar targets = [],\r\n\t\t target,\r\n\t\t isHover = type === 'mouseout' || type === 'mouseover',\r\n\t\t src = e.target || e.srcElement,\r\n\t\t dragging = false;\r\n\r\n\t\twhile (src) {\r\n\t\t\ttarget = this._targets[stamp(src)];\r\n\t\t\tif (target && (type === 'click' || type === 'preclick') && !e._simulated && this._draggableMoved(target)) {\r\n\t\t\t\t// Prevent firing click after you just dragged an object.\r\n\t\t\t\tdragging = true;\r\n\t\t\t\tbreak;\r\n\t\t\t}\r\n\t\t\tif (target && target.listens(type, true)) {\r\n\t\t\t\tif (isHover && !isExternalTarget(src, e)) { break; }\r\n\t\t\t\ttargets.push(target);\r\n\t\t\t\tif (isHover) { break; }\r\n\t\t\t}\r\n\t\t\tif (src === this._container) { break; }\r\n\t\t\tsrc = src.parentNode;\r\n\t\t}\r\n\t\tif (!targets.length && !dragging && !isHover && isExternalTarget(src, e)) {\r\n\t\t\ttargets = [this];\r\n\t\t}\r\n\t\treturn targets;\r\n\t},\r\n\r\n\t_handleDOMEvent: function (e) {\r\n\t\tif (!this._loaded || skipped(e)) { return; }\r\n\r\n\t\tvar type = e.type;\r\n\r\n\t\tif (type === 'mousedown' || type === 'keypress') {\r\n\t\t\t// prevents outline when clicking on keyboard-focusable element\r\n\t\t\tpreventOutline(e.target || e.srcElement);\r\n\t\t}\r\n\r\n\t\tthis._fireDOMEvent(e, type);\r\n\t},\r\n\r\n\t_mouseEvents: ['click', 'dblclick', 'mouseover', 'mouseout', 'contextmenu'],\r\n\r\n\t_fireDOMEvent: function (e, type, targets) {\r\n\r\n\t\tif (e.type === 'click') {\r\n\t\t\t// Fire a synthetic 'preclick' event which propagates up (mainly for closing popups).\r\n\t\t\t// @event preclick: MouseEvent\r\n\t\t\t// Fired before mouse click on the map (sometimes useful when you\r\n\t\t\t// want something to happen on click before any existing click\r\n\t\t\t// handlers start running).\r\n\t\t\tvar synth = extend({}, e);\r\n\t\t\tsynth.type = 'preclick';\r\n\t\t\tthis._fireDOMEvent(synth, synth.type, targets);\r\n\t\t}\r\n\r\n\t\tif (e._stopped) { return; }\r\n\r\n\t\t// Find the layer the event is propagating from and its parents.\r\n\t\ttargets = (targets || []).concat(this._findEventTargets(e, type));\r\n\r\n\t\tif (!targets.length) { return; }\r\n\r\n\t\tvar target = targets[0];\r\n\t\tif (type === 'contextmenu' && target.listens(type, true)) {\r\n\t\t\tpreventDefault(e);\r\n\t\t}\r\n\r\n\t\tvar data = {\r\n\t\t\toriginalEvent: e\r\n\t\t};\r\n\r\n\t\tif (e.type !== 'keypress') {\r\n\t\t\tvar isMarker = target.getLatLng && (!target._radius || target._radius <= 10);\r\n\t\t\tdata.containerPoint = isMarker ?\r\n\t\t\t\tthis.latLngToContainerPoint(target.getLatLng()) : this.mouseEventToContainerPoint(e);\r\n\t\t\tdata.layerPoint = this.containerPointToLayerPoint(data.containerPoint);\r\n\t\t\tdata.latlng = isMarker ? target.getLatLng() : this.layerPointToLatLng(data.layerPoint);\r\n\t\t}\r\n\r\n\t\tfor (var i = 0; i < targets.length; i++) {\r\n\t\t\ttargets[i].fire(type, data, true);\r\n\t\t\tif (data.originalEvent._stopped ||\r\n\t\t\t\t(targets[i].options.bubblingMouseEvents === false && indexOf(this._mouseEvents, type) !== -1)) { return; }\r\n\t\t}\r\n\t},\r\n\r\n\t_draggableMoved: function (obj) {\r\n\t\tobj = obj.dragging && obj.dragging.enabled() ? obj : this;\r\n\t\treturn (obj.dragging && obj.dragging.moved()) || (this.boxZoom && this.boxZoom.moved());\r\n\t},\r\n\r\n\t_clearHandlers: function () {\r\n\t\tfor (var i = 0, len = this._handlers.length; i < len; i++) {\r\n\t\t\tthis._handlers[i].disable();\r\n\t\t}\r\n\t},\r\n\r\n\t// @section Other Methods\r\n\r\n\t// @method whenReady(fn: Function, context?: Object): this\r\n\t// Runs the given function `fn` when the map gets initialized with\r\n\t// a view (center and zoom) and at least one layer, or immediately\r\n\t// if it's already initialized, optionally passing a function context.\r\n\twhenReady: function (callback, context) {\r\n\t\tif (this._loaded) {\r\n\t\t\tcallback.call(context || this, {target: this});\r\n\t\t} else {\r\n\t\t\tthis.on('load', callback, context);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\r\n\t// private methods for getting map state\r\n\r\n\t_getMapPanePos: function () {\r\n\t\treturn getPosition(this._mapPane) || new Point(0, 0);\r\n\t},\r\n\r\n\t_moved: function () {\r\n\t\tvar pos = this._getMapPanePos();\r\n\t\treturn pos && !pos.equals([0, 0]);\r\n\t},\r\n\r\n\t_getTopLeftPoint: function (center, zoom) {\r\n\t\tvar pixelOrigin = center && zoom !== undefined ?\r\n\t\t\tthis._getNewPixelOrigin(center, zoom) :\r\n\t\t\tthis.getPixelOrigin();\r\n\t\treturn pixelOrigin.subtract(this._getMapPanePos());\r\n\t},\r\n\r\n\t_getNewPixelOrigin: function (center, zoom) {\r\n\t\tvar viewHalf = this.getSize()._divideBy(2);\r\n\t\treturn this.project(center, zoom)._subtract(viewHalf)._add(this._getMapPanePos())._round();\r\n\t},\r\n\r\n\t_latLngToNewLayerPoint: function (latlng, zoom, center) {\r\n\t\tvar topLeft = this._getNewPixelOrigin(center, zoom);\r\n\t\treturn this.project(latlng, zoom)._subtract(topLeft);\r\n\t},\r\n\r\n\t_latLngBoundsToNewLayerBounds: function (latLngBounds, zoom, center) {\r\n\t\tvar topLeft = this._getNewPixelOrigin(center, zoom);\r\n\t\treturn toBounds([\r\n\t\t\tthis.project(latLngBounds.getSouthWest(), zoom)._subtract(topLeft),\r\n\t\t\tthis.project(latLngBounds.getNorthWest(), zoom)._subtract(topLeft),\r\n\t\t\tthis.project(latLngBounds.getSouthEast(), zoom)._subtract(topLeft),\r\n\t\t\tthis.project(latLngBounds.getNorthEast(), zoom)._subtract(topLeft)\r\n\t\t]);\r\n\t},\r\n\r\n\t// layer point of the current center\r\n\t_getCenterLayerPoint: function () {\r\n\t\treturn this.containerPointToLayerPoint(this.getSize()._divideBy(2));\r\n\t},\r\n\r\n\t// offset of the specified place to the current center in pixels\r\n\t_getCenterOffset: function (latlng) {\r\n\t\treturn this.latLngToLayerPoint(latlng).subtract(this._getCenterLayerPoint());\r\n\t},\r\n\r\n\t// adjust center for view to get inside bounds\r\n\t_limitCenter: function (center, zoom, bounds) {\r\n\r\n\t\tif (!bounds) { return center; }\r\n\r\n\t\tvar centerPoint = this.project(center, zoom),\r\n\t\t viewHalf = this.getSize().divideBy(2),\r\n\t\t viewBounds = new Bounds(centerPoint.subtract(viewHalf), centerPoint.add(viewHalf)),\r\n\t\t offset = this._getBoundsOffset(viewBounds, bounds, zoom);\r\n\r\n\t\t// If offset is less than a pixel, ignore.\r\n\t\t// This prevents unstable projections from getting into\r\n\t\t// an infinite loop of tiny offsets.\r\n\t\tif (offset.round().equals([0, 0])) {\r\n\t\t\treturn center;\r\n\t\t}\r\n\r\n\t\treturn this.unproject(centerPoint.add(offset), zoom);\r\n\t},\r\n\r\n\t// adjust offset for view to get inside bounds\r\n\t_limitOffset: function (offset, bounds) {\r\n\t\tif (!bounds) { return offset; }\r\n\r\n\t\tvar viewBounds = this.getPixelBounds(),\r\n\t\t newBounds = new Bounds(viewBounds.min.add(offset), viewBounds.max.add(offset));\r\n\r\n\t\treturn offset.add(this._getBoundsOffset(newBounds, bounds));\r\n\t},\r\n\r\n\t// returns offset needed for pxBounds to get inside maxBounds at a specified zoom\r\n\t_getBoundsOffset: function (pxBounds, maxBounds, zoom) {\r\n\t\tvar projectedMaxBounds = toBounds(\r\n\t\t this.project(maxBounds.getNorthEast(), zoom),\r\n\t\t this.project(maxBounds.getSouthWest(), zoom)\r\n\t\t ),\r\n\t\t minOffset = projectedMaxBounds.min.subtract(pxBounds.min),\r\n\t\t maxOffset = projectedMaxBounds.max.subtract(pxBounds.max),\r\n\r\n\t\t dx = this._rebound(minOffset.x, -maxOffset.x),\r\n\t\t dy = this._rebound(minOffset.y, -maxOffset.y);\r\n\r\n\t\treturn new Point(dx, dy);\r\n\t},\r\n\r\n\t_rebound: function (left, right) {\r\n\t\treturn left + right > 0 ?\r\n\t\t\tMath.round(left - right) / 2 :\r\n\t\t\tMath.max(0, Math.ceil(left)) - Math.max(0, Math.floor(right));\r\n\t},\r\n\r\n\t_limitZoom: function (zoom) {\r\n\t\tvar min = this.getMinZoom(),\r\n\t\t max = this.getMaxZoom(),\r\n\t\t snap = any3d ? this.options.zoomSnap : 1;\r\n\t\tif (snap) {\r\n\t\t\tzoom = Math.round(zoom / snap) * snap;\r\n\t\t}\r\n\t\treturn Math.max(min, Math.min(max, zoom));\r\n\t},\r\n\r\n\t_onPanTransitionStep: function () {\r\n\t\tthis.fire('move');\r\n\t},\r\n\r\n\t_onPanTransitionEnd: function () {\r\n\t\tremoveClass(this._mapPane, 'leaflet-pan-anim');\r\n\t\tthis.fire('moveend');\r\n\t},\r\n\r\n\t_tryAnimatedPan: function (center, options) {\r\n\t\t// difference between the new and current centers in pixels\r\n\t\tvar offset = this._getCenterOffset(center)._trunc();\r\n\r\n\t\t// don't animate too far unless animate: true specified in options\r\n\t\tif ((options && options.animate) !== true && !this.getSize().contains(offset)) { return false; }\r\n\r\n\t\tthis.panBy(offset, options);\r\n\r\n\t\treturn true;\r\n\t},\r\n\r\n\t_createAnimProxy: function () {\r\n\r\n\t\tvar proxy = this._proxy = create$1('div', 'leaflet-proxy leaflet-zoom-animated');\r\n\t\tthis._panes.mapPane.appendChild(proxy);\r\n\r\n\t\tthis.on('zoomanim', function (e) {\r\n\t\t\tvar prop = TRANSFORM,\r\n\t\t\t transform = this._proxy.style[prop];\r\n\r\n\t\t\tsetTransform(this._proxy, this.project(e.center, e.zoom), this.getZoomScale(e.zoom, 1));\r\n\r\n\t\t\t// workaround for case when transform is the same and so transitionend event is not fired\r\n\t\t\tif (transform === this._proxy.style[prop] && this._animatingZoom) {\r\n\t\t\t\tthis._onZoomTransitionEnd();\r\n\t\t\t}\r\n\t\t}, this);\r\n\r\n\t\tthis.on('load moveend', function () {\r\n\t\t\tvar c = this.getCenter(),\r\n\t\t\t z = this.getZoom();\r\n\t\t\tsetTransform(this._proxy, this.project(c, z), this.getZoomScale(z, 1));\r\n\t\t}, this);\r\n\r\n\t\tthis._on('unload', this._destroyAnimProxy, this);\r\n\t},\r\n\r\n\t_destroyAnimProxy: function () {\r\n\t\tremove(this._proxy);\r\n\t\tdelete this._proxy;\r\n\t},\r\n\r\n\t_catchTransitionEnd: function (e) {\r\n\t\tif (this._animatingZoom && e.propertyName.indexOf('transform') >= 0) {\r\n\t\t\tthis._onZoomTransitionEnd();\r\n\t\t}\r\n\t},\r\n\r\n\t_nothingToAnimate: function () {\r\n\t\treturn !this._container.getElementsByClassName('leaflet-zoom-animated').length;\r\n\t},\r\n\r\n\t_tryAnimatedZoom: function (center, zoom, options) {\r\n\r\n\t\tif (this._animatingZoom) { return true; }\r\n\r\n\t\toptions = options || {};\r\n\r\n\t\t// don't animate if disabled, not supported or zoom difference is too large\r\n\t\tif (!this._zoomAnimated || options.animate === false || this._nothingToAnimate() ||\r\n\t\t Math.abs(zoom - this._zoom) > this.options.zoomAnimationThreshold) { return false; }\r\n\r\n\t\t// offset is the pixel coords of the zoom origin relative to the current center\r\n\t\tvar scale = this.getZoomScale(zoom),\r\n\t\t offset = this._getCenterOffset(center)._divideBy(1 - 1 / scale);\r\n\r\n\t\t// don't animate if the zoom origin isn't within one screen from the current center, unless forced\r\n\t\tif (options.animate !== true && !this.getSize().contains(offset)) { return false; }\r\n\r\n\t\trequestAnimFrame(function () {\r\n\t\t\tthis\r\n\t\t\t ._moveStart(true, false)\r\n\t\t\t ._animateZoom(center, zoom, true);\r\n\t\t}, this);\r\n\r\n\t\treturn true;\r\n\t},\r\n\r\n\t_animateZoom: function (center, zoom, startAnim, noUpdate) {\r\n\t\tif (!this._mapPane) { return; }\r\n\r\n\t\tif (startAnim) {\r\n\t\t\tthis._animatingZoom = true;\r\n\r\n\t\t\t// remember what center/zoom to set after animation\r\n\t\t\tthis._animateToCenter = center;\r\n\t\t\tthis._animateToZoom = zoom;\r\n\r\n\t\t\taddClass(this._mapPane, 'leaflet-zoom-anim');\r\n\t\t}\r\n\r\n\t\t// @event zoomanim: ZoomAnimEvent\r\n\t\t// Fired on every frame of a zoom animation\r\n\t\tthis.fire('zoomanim', {\r\n\t\t\tcenter: center,\r\n\t\t\tzoom: zoom,\r\n\t\t\tnoUpdate: noUpdate\r\n\t\t});\r\n\r\n\t\t// Work around webkit not firing 'transitionend', see https://github.com/Leaflet/Leaflet/issues/3689, 2693\r\n\t\tsetTimeout(bind(this._onZoomTransitionEnd, this), 250);\r\n\t},\r\n\r\n\t_onZoomTransitionEnd: function () {\r\n\t\tif (!this._animatingZoom) { return; }\r\n\r\n\t\tif (this._mapPane) {\r\n\t\t\tremoveClass(this._mapPane, 'leaflet-zoom-anim');\r\n\t\t}\r\n\r\n\t\tthis._animatingZoom = false;\r\n\r\n\t\tthis._move(this._animateToCenter, this._animateToZoom);\r\n\r\n\t\t// This anim frame should prevent an obscure iOS webkit tile loading race condition.\r\n\t\trequestAnimFrame(function () {\r\n\t\t\tthis._moveEnd(true);\r\n\t\t}, this);\r\n\t}\r\n});\r\n\r\n// @section\r\n\r\n// @factory L.map(id: String, options?: Map options)\r\n// Instantiates a map object given the DOM ID of a `<div>` element\r\n// and optionally an object literal with `Map options`.\r\n//\r\n// @alternative\r\n// @factory L.map(el: HTMLElement, options?: Map options)\r\n// Instantiates a map object given an instance of a `<div>` HTML element\r\n// and optionally an object literal with `Map options`.\r\nfunction createMap(id, options) {\r\n\treturn new Map(id, options);\r\n}\n\n/*\r\n * @class Control\r\n * @aka L.Control\r\n * @inherits Class\r\n *\r\n * L.Control is a base class for implementing map controls. Handles positioning.\r\n * All other controls extend from this class.\r\n */\r\n\r\nvar Control = Class.extend({\r\n\t// @section\r\n\t// @aka Control options\r\n\toptions: {\r\n\t\t// @option position: String = 'topright'\r\n\t\t// The position of the control (one of the map corners). Possible values are `'topleft'`,\r\n\t\t// `'topright'`, `'bottomleft'` or `'bottomright'`\r\n\t\tposition: 'topright'\r\n\t},\r\n\r\n\tinitialize: function (options) {\r\n\t\tsetOptions(this, options);\r\n\t},\r\n\r\n\t/* @section\r\n\t * Classes extending L.Control will inherit the following methods:\r\n\t *\r\n\t * @method getPosition: string\r\n\t * Returns the position of the control.\r\n\t */\r\n\tgetPosition: function () {\r\n\t\treturn this.options.position;\r\n\t},\r\n\r\n\t// @method setPosition(position: string): this\r\n\t// Sets the position of the control.\r\n\tsetPosition: function (position) {\r\n\t\tvar map = this._map;\r\n\r\n\t\tif (map) {\r\n\t\t\tmap.removeControl(this);\r\n\t\t}\r\n\r\n\t\tthis.options.position = position;\r\n\r\n\t\tif (map) {\r\n\t\t\tmap.addControl(this);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getContainer: HTMLElement\r\n\t// Returns the HTMLElement that contains the control.\r\n\tgetContainer: function () {\r\n\t\treturn this._container;\r\n\t},\r\n\r\n\t// @method addTo(map: Map): this\r\n\t// Adds the control to the given map.\r\n\taddTo: function (map) {\r\n\t\tthis.remove();\r\n\t\tthis._map = map;\r\n\r\n\t\tvar container = this._container = this.onAdd(map),\r\n\t\t pos = this.getPosition(),\r\n\t\t corner = map._controlCorners[pos];\r\n\r\n\t\taddClass(container, 'leaflet-control');\r\n\r\n\t\tif (pos.indexOf('bottom') !== -1) {\r\n\t\t\tcorner.insertBefore(container, corner.firstChild);\r\n\t\t} else {\r\n\t\t\tcorner.appendChild(container);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method remove: this\r\n\t// Removes the control from the map it is currently active on.\r\n\tremove: function () {\r\n\t\tif (!this._map) {\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tremove(this._container);\r\n\r\n\t\tif (this.onRemove) {\r\n\t\t\tthis.onRemove(this._map);\r\n\t\t}\r\n\r\n\t\tthis._map = null;\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_refocusOnMap: function (e) {\r\n\t\t// if map exists and event is not a keyboard event\r\n\t\tif (this._map && e && e.screenX > 0 && e.screenY > 0) {\r\n\t\t\tthis._map.getContainer().focus();\r\n\t\t}\r\n\t}\r\n});\r\n\r\nvar control = function (options) {\r\n\treturn new Control(options);\r\n};\r\n\r\n/* @section Extension methods\r\n * @uninheritable\r\n *\r\n * Every control should extend from `L.Control` and (re-)implement the following methods.\r\n *\r\n * @method onAdd(map: Map): HTMLElement\r\n * Should return the container DOM element for the control and add listeners on relevant map events. Called on [`control.addTo(map)`](#control-addTo).\r\n *\r\n * @method onRemove(map: Map)\r\n * Optional method. Should contain all clean up code that removes the listeners previously added in [`onAdd`](#control-onadd). Called on [`control.remove()`](#control-remove).\r\n */\r\n\r\n/* @namespace Map\r\n * @section Methods for Layers and Controls\r\n */\r\nMap.include({\r\n\t// @method addControl(control: Control): this\r\n\t// Adds the given control to the map\r\n\taddControl: function (control) {\r\n\t\tcontrol.addTo(this);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method removeControl(control: Control): this\r\n\t// Removes the given control from the map\r\n\tremoveControl: function (control) {\r\n\t\tcontrol.remove();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_initControlPos: function () {\r\n\t\tvar corners = this._controlCorners = {},\r\n\t\t l = 'leaflet-',\r\n\t\t container = this._controlContainer =\r\n\t\t create$1('div', l + 'control-container', this._container);\r\n\r\n\t\tfunction createCorner(vSide, hSide) {\r\n\t\t\tvar className = l + vSide + ' ' + l + hSide;\r\n\r\n\t\t\tcorners[vSide + hSide] = create$1('div', className, container);\r\n\t\t}\r\n\r\n\t\tcreateCorner('top', 'left');\r\n\t\tcreateCorner('top', 'right');\r\n\t\tcreateCorner('bottom', 'left');\r\n\t\tcreateCorner('bottom', 'right');\r\n\t},\r\n\r\n\t_clearControlPos: function () {\r\n\t\tfor (var i in this._controlCorners) {\r\n\t\t\tremove(this._controlCorners[i]);\r\n\t\t}\r\n\t\tremove(this._controlContainer);\r\n\t\tdelete this._controlCorners;\r\n\t\tdelete this._controlContainer;\r\n\t}\r\n});\n\n/*\r\n * @class Control.Layers\r\n * @aka L.Control.Layers\r\n * @inherits Control\r\n *\r\n * The layers control gives users the ability to switch between different base layers and switch overlays on/off (check out the [detailed example](http://leafletjs.com/examples/layers-control/)). Extends `Control`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var baseLayers = {\r\n * \t\"Mapbox\": mapbox,\r\n * \t\"OpenStreetMap\": osm\r\n * };\r\n *\r\n * var overlays = {\r\n * \t\"Marker\": marker,\r\n * \t\"Roads\": roadsLayer\r\n * };\r\n *\r\n * L.control.layers(baseLayers, overlays).addTo(map);\r\n * ```\r\n *\r\n * The `baseLayers` and `overlays` parameters are object literals with layer names as keys and `Layer` objects as values:\r\n *\r\n * ```js\r\n * {\r\n * \"<someName1>\": layer1,\r\n * \"<someName2>\": layer2\r\n * }\r\n * ```\r\n *\r\n * The layer names can contain HTML, which allows you to add additional styling to the items:\r\n *\r\n * ```js\r\n * {\"<img src='my-layer-icon' /> <span class='my-layer-item'>My Layer</span>\": myLayer}\r\n * ```\r\n */\r\n\r\nvar Layers = Control.extend({\r\n\t// @section\r\n\t// @aka Control.Layers options\r\n\toptions: {\r\n\t\t// @option collapsed: Boolean = true\r\n\t\t// If `true`, the control will be collapsed into an icon and expanded on mouse hover or touch.\r\n\t\tcollapsed: true,\r\n\t\tposition: 'topright',\r\n\r\n\t\t// @option autoZIndex: Boolean = true\r\n\t\t// If `true`, the control will assign zIndexes in increasing order to all of its layers so that the order is preserved when switching them on/off.\r\n\t\tautoZIndex: true,\r\n\r\n\t\t// @option hideSingleBase: Boolean = false\r\n\t\t// If `true`, the base layers in the control will be hidden when there is only one.\r\n\t\thideSingleBase: false,\r\n\r\n\t\t// @option sortLayers: Boolean = false\r\n\t\t// Whether to sort the layers. When `false`, layers will keep the order\r\n\t\t// in which they were added to the control.\r\n\t\tsortLayers: false,\r\n\r\n\t\t// @option sortFunction: Function = *\r\n\t\t// A [compare function](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/sort)\r\n\t\t// that will be used for sorting the layers, when `sortLayers` is `true`.\r\n\t\t// The function receives both the `L.Layer` instances and their names, as in\r\n\t\t// `sortFunction(layerA, layerB, nameA, nameB)`.\r\n\t\t// By default, it sorts layers alphabetically by their name.\r\n\t\tsortFunction: function (layerA, layerB, nameA, nameB) {\r\n\t\t\treturn nameA < nameB ? -1 : (nameB < nameA ? 1 : 0);\r\n\t\t}\r\n\t},\r\n\r\n\tinitialize: function (baseLayers, overlays, options) {\r\n\t\tsetOptions(this, options);\r\n\r\n\t\tthis._layerControlInputs = [];\r\n\t\tthis._layers = [];\r\n\t\tthis._lastZIndex = 0;\r\n\t\tthis._handlingClick = false;\r\n\r\n\t\tfor (var i in baseLayers) {\r\n\t\t\tthis._addLayer(baseLayers[i], i);\r\n\t\t}\r\n\r\n\t\tfor (i in overlays) {\r\n\t\t\tthis._addLayer(overlays[i], i, true);\r\n\t\t}\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tthis._initLayout();\r\n\t\tthis._update();\r\n\r\n\t\tthis._map = map;\r\n\t\tmap.on('zoomend', this._checkDisabledLayers, this);\r\n\r\n\t\tfor (var i = 0; i < this._layers.length; i++) {\r\n\t\t\tthis._layers[i].layer.on('add remove', this._onLayerChange, this);\r\n\t\t}\r\n\r\n\t\treturn this._container;\r\n\t},\r\n\r\n\taddTo: function (map) {\r\n\t\tControl.prototype.addTo.call(this, map);\r\n\t\t// Trigger expand after Layers Control has been inserted into DOM so that is now has an actual height.\r\n\t\treturn this._expandIfNotCollapsed();\r\n\t},\r\n\r\n\tonRemove: function () {\r\n\t\tthis._map.off('zoomend', this._checkDisabledLayers, this);\r\n\r\n\t\tfor (var i = 0; i < this._layers.length; i++) {\r\n\t\t\tthis._layers[i].layer.off('add remove', this._onLayerChange, this);\r\n\t\t}\r\n\t},\r\n\r\n\t// @method addBaseLayer(layer: Layer, name: String): this\r\n\t// Adds a base layer (radio button entry) with the given name to the control.\r\n\taddBaseLayer: function (layer, name) {\r\n\t\tthis._addLayer(layer, name);\r\n\t\treturn (this._map) ? this._update() : this;\r\n\t},\r\n\r\n\t// @method addOverlay(layer: Layer, name: String): this\r\n\t// Adds an overlay (checkbox entry) with the given name to the control.\r\n\taddOverlay: function (layer, name) {\r\n\t\tthis._addLayer(layer, name, true);\r\n\t\treturn (this._map) ? this._update() : this;\r\n\t},\r\n\r\n\t// @method removeLayer(layer: Layer): this\r\n\t// Remove the given layer from the control.\r\n\tremoveLayer: function (layer) {\r\n\t\tlayer.off('add remove', this._onLayerChange, this);\r\n\r\n\t\tvar obj = this._getLayer(stamp(layer));\r\n\t\tif (obj) {\r\n\t\t\tthis._layers.splice(this._layers.indexOf(obj), 1);\r\n\t\t}\r\n\t\treturn (this._map) ? this._update() : this;\r\n\t},\r\n\r\n\t// @method expand(): this\r\n\t// Expand the control container if collapsed.\r\n\texpand: function () {\r\n\t\taddClass(this._container, 'leaflet-control-layers-expanded');\r\n\t\tthis._form.style.height = null;\r\n\t\tvar acceptableHeight = this._map.getSize().y - (this._container.offsetTop + 50);\r\n\t\tif (acceptableHeight < this._form.clientHeight) {\r\n\t\t\taddClass(this._form, 'leaflet-control-layers-scrollbar');\r\n\t\t\tthis._form.style.height = acceptableHeight + 'px';\r\n\t\t} else {\r\n\t\t\tremoveClass(this._form, 'leaflet-control-layers-scrollbar');\r\n\t\t}\r\n\t\tthis._checkDisabledLayers();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method collapse(): this\r\n\t// Collapse the control container if expanded.\r\n\tcollapse: function () {\r\n\t\tremoveClass(this._container, 'leaflet-control-layers-expanded');\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_initLayout: function () {\r\n\t\tvar className = 'leaflet-control-layers',\r\n\t\t container = this._container = create$1('div', className),\r\n\t\t collapsed = this.options.collapsed;\r\n\r\n\t\t// makes this work on IE touch devices by stopping it from firing a mouseout event when the touch is released\r\n\t\tcontainer.setAttribute('aria-haspopup', true);\r\n\r\n\t\tdisableClickPropagation(container);\r\n\t\tdisableScrollPropagation(container);\r\n\r\n\t\tvar form = this._form = create$1('form', className + '-list');\r\n\r\n\t\tif (collapsed) {\r\n\t\t\tthis._map.on('click', this.collapse, this);\r\n\r\n\t\t\tif (!android) {\r\n\t\t\t\ton(container, {\r\n\t\t\t\t\tmouseenter: this.expand,\r\n\t\t\t\t\tmouseleave: this.collapse\r\n\t\t\t\t}, this);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tvar link = this._layersLink = create$1('a', className + '-toggle', container);\r\n\t\tlink.href = '#';\r\n\t\tlink.title = 'Layers';\r\n\r\n\t\tif (touch) {\r\n\t\t\ton(link, 'click', stop);\r\n\t\t\ton(link, 'click', this.expand, this);\r\n\t\t} else {\r\n\t\t\ton(link, 'focus', this.expand, this);\r\n\t\t}\r\n\r\n\t\tif (!collapsed) {\r\n\t\t\tthis.expand();\r\n\t\t}\r\n\r\n\t\tthis._baseLayersList = create$1('div', className + '-base', form);\r\n\t\tthis._separator = create$1('div', className + '-separator', form);\r\n\t\tthis._overlaysList = create$1('div', className + '-overlays', form);\r\n\r\n\t\tcontainer.appendChild(form);\r\n\t},\r\n\r\n\t_getLayer: function (id) {\r\n\t\tfor (var i = 0; i < this._layers.length; i++) {\r\n\r\n\t\t\tif (this._layers[i] && stamp(this._layers[i].layer) === id) {\r\n\t\t\t\treturn this._layers[i];\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\t_addLayer: function (layer, name, overlay) {\r\n\t\tif (this._map) {\r\n\t\t\tlayer.on('add remove', this._onLayerChange, this);\r\n\t\t}\r\n\r\n\t\tthis._layers.push({\r\n\t\t\tlayer: layer,\r\n\t\t\tname: name,\r\n\t\t\toverlay: overlay\r\n\t\t});\r\n\r\n\t\tif (this.options.sortLayers) {\r\n\t\t\tthis._layers.sort(bind(function (a, b) {\r\n\t\t\t\treturn this.options.sortFunction(a.layer, b.layer, a.name, b.name);\r\n\t\t\t}, this));\r\n\t\t}\r\n\r\n\t\tif (this.options.autoZIndex && layer.setZIndex) {\r\n\t\t\tthis._lastZIndex++;\r\n\t\t\tlayer.setZIndex(this._lastZIndex);\r\n\t\t}\r\n\r\n\t\tthis._expandIfNotCollapsed();\r\n\t},\r\n\r\n\t_update: function () {\r\n\t\tif (!this._container) { return this; }\r\n\r\n\t\tempty(this._baseLayersList);\r\n\t\tempty(this._overlaysList);\r\n\r\n\t\tthis._layerControlInputs = [];\r\n\t\tvar baseLayersPresent, overlaysPresent, i, obj, baseLayersCount = 0;\r\n\r\n\t\tfor (i = 0; i < this._layers.length; i++) {\r\n\t\t\tobj = this._layers[i];\r\n\t\t\tthis._addItem(obj);\r\n\t\t\toverlaysPresent = overlaysPresent || obj.overlay;\r\n\t\t\tbaseLayersPresent = baseLayersPresent || !obj.overlay;\r\n\t\t\tbaseLayersCount += !obj.overlay ? 1 : 0;\r\n\t\t}\r\n\r\n\t\t// Hide base layers section if there's only one layer.\r\n\t\tif (this.options.hideSingleBase) {\r\n\t\t\tbaseLayersPresent = baseLayersPresent && baseLayersCount > 1;\r\n\t\t\tthis._baseLayersList.style.display = baseLayersPresent ? '' : 'none';\r\n\t\t}\r\n\r\n\t\tthis._separator.style.display = overlaysPresent && baseLayersPresent ? '' : 'none';\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_onLayerChange: function (e) {\r\n\t\tif (!this._handlingClick) {\r\n\t\t\tthis._update();\r\n\t\t}\r\n\r\n\t\tvar obj = this._getLayer(stamp(e.target));\r\n\r\n\t\t// @namespace Map\r\n\t\t// @section Layer events\r\n\t\t// @event baselayerchange: LayersControlEvent\r\n\t\t// Fired when the base layer is changed through the [layer control](#control-layers).\r\n\t\t// @event overlayadd: LayersControlEvent\r\n\t\t// Fired when an overlay is selected through the [layer control](#control-layers).\r\n\t\t// @event overlayremove: LayersControlEvent\r\n\t\t// Fired when an overlay is deselected through the [layer control](#control-layers).\r\n\t\t// @namespace Control.Layers\r\n\t\tvar type = obj.overlay ?\r\n\t\t\t(e.type === 'add' ? 'overlayadd' : 'overlayremove') :\r\n\t\t\t(e.type === 'add' ? 'baselayerchange' : null);\r\n\r\n\t\tif (type) {\r\n\t\t\tthis._map.fire(type, obj);\r\n\t\t}\r\n\t},\r\n\r\n\t// IE7 bugs out if you create a radio dynamically, so you have to do it this hacky way (see http://bit.ly/PqYLBe)\r\n\t_createRadioElement: function (name, checked) {\r\n\r\n\t\tvar radioHtml = '<input type=\"radio\" class=\"leaflet-control-layers-selector\" name=\"' +\r\n\t\t\t\tname + '\"' + (checked ? ' checked=\"checked\"' : '') + '/>';\r\n\r\n\t\tvar radioFragment = document.createElement('div');\r\n\t\tradioFragment.innerHTML = radioHtml;\r\n\r\n\t\treturn radioFragment.firstChild;\r\n\t},\r\n\r\n\t_addItem: function (obj) {\r\n\t\tvar label = document.createElement('label'),\r\n\t\t checked = this._map.hasLayer(obj.layer),\r\n\t\t input;\r\n\r\n\t\tif (obj.overlay) {\r\n\t\t\tinput = document.createElement('input');\r\n\t\t\tinput.type = 'checkbox';\r\n\t\t\tinput.className = 'leaflet-control-layers-selector';\r\n\t\t\tinput.defaultChecked = checked;\r\n\t\t} else {\r\n\t\t\tinput = this._createRadioElement('leaflet-base-layers', checked);\r\n\t\t}\r\n\r\n\t\tthis._layerControlInputs.push(input);\r\n\t\tinput.layerId = stamp(obj.layer);\r\n\r\n\t\ton(input, 'click', this._onInputClick, this);\r\n\r\n\t\tvar name = document.createElement('span');\r\n\t\tname.innerHTML = ' ' + obj.name;\r\n\r\n\t\t// Helps from preventing layer control flicker when checkboxes are disabled\r\n\t\t// https://github.com/Leaflet/Leaflet/issues/2771\r\n\t\tvar holder = document.createElement('div');\r\n\r\n\t\tlabel.appendChild(holder);\r\n\t\tholder.appendChild(input);\r\n\t\tholder.appendChild(name);\r\n\r\n\t\tvar container = obj.overlay ? this._overlaysList : this._baseLayersList;\r\n\t\tcontainer.appendChild(label);\r\n\r\n\t\tthis._checkDisabledLayers();\r\n\t\treturn label;\r\n\t},\r\n\r\n\t_onInputClick: function () {\r\n\t\tvar inputs = this._layerControlInputs,\r\n\t\t input, layer;\r\n\t\tvar addedLayers = [],\r\n\t\t removedLayers = [];\r\n\r\n\t\tthis._handlingClick = true;\r\n\r\n\t\tfor (var i = inputs.length - 1; i >= 0; i--) {\r\n\t\t\tinput = inputs[i];\r\n\t\t\tlayer = this._getLayer(input.layerId).layer;\r\n\r\n\t\t\tif (input.checked) {\r\n\t\t\t\taddedLayers.push(layer);\r\n\t\t\t} else if (!input.checked) {\r\n\t\t\t\tremovedLayers.push(layer);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\t// Bugfix issue 2318: Should remove all old layers before readding new ones\r\n\t\tfor (i = 0; i < removedLayers.length; i++) {\r\n\t\t\tif (this._map.hasLayer(removedLayers[i])) {\r\n\t\t\t\tthis._map.removeLayer(removedLayers[i]);\r\n\t\t\t}\r\n\t\t}\r\n\t\tfor (i = 0; i < addedLayers.length; i++) {\r\n\t\t\tif (!this._map.hasLayer(addedLayers[i])) {\r\n\t\t\t\tthis._map.addLayer(addedLayers[i]);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tthis._handlingClick = false;\r\n\r\n\t\tthis._refocusOnMap();\r\n\t},\r\n\r\n\t_checkDisabledLayers: function () {\r\n\t\tvar inputs = this._layerControlInputs,\r\n\t\t input,\r\n\t\t layer,\r\n\t\t zoom = this._map.getZoom();\r\n\r\n\t\tfor (var i = inputs.length - 1; i >= 0; i--) {\r\n\t\t\tinput = inputs[i];\r\n\t\t\tlayer = this._getLayer(input.layerId).layer;\r\n\t\t\tinput.disabled = (layer.options.minZoom !== undefined && zoom < layer.options.minZoom) ||\r\n\t\t\t (layer.options.maxZoom !== undefined && zoom > layer.options.maxZoom);\r\n\r\n\t\t}\r\n\t},\r\n\r\n\t_expandIfNotCollapsed: function () {\r\n\t\tif (this._map && !this.options.collapsed) {\r\n\t\t\tthis.expand();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_expand: function () {\r\n\t\t// Backward compatibility, remove me in 1.1.\r\n\t\treturn this.expand();\r\n\t},\r\n\r\n\t_collapse: function () {\r\n\t\t// Backward compatibility, remove me in 1.1.\r\n\t\treturn this.collapse();\r\n\t}\r\n\r\n});\r\n\r\n\r\n// @factory L.control.layers(baselayers?: Object, overlays?: Object, options?: Control.Layers options)\r\n// Creates an attribution control with the given layers. Base layers will be switched with radio buttons, while overlays will be switched with checkboxes. Note that all base layers should be passed in the base layers object, but only one should be added to the map during map instantiation.\r\nvar layers = function (baseLayers, overlays, options) {\r\n\treturn new Layers(baseLayers, overlays, options);\r\n};\n\n/*\r\n * @class Control.Zoom\r\n * @aka L.Control.Zoom\r\n * @inherits Control\r\n *\r\n * A basic zoom control with two buttons (zoom in and zoom out). It is put on the map by default unless you set its [`zoomControl` option](#map-zoomcontrol) to `false`. Extends `Control`.\r\n */\r\n\r\nvar Zoom = Control.extend({\r\n\t// @section\r\n\t// @aka Control.Zoom options\r\n\toptions: {\r\n\t\tposition: 'topleft',\r\n\r\n\t\t// @option zoomInText: String = '+'\r\n\t\t// The text set on the 'zoom in' button.\r\n\t\tzoomInText: '+',\r\n\r\n\t\t// @option zoomInTitle: String = 'Zoom in'\r\n\t\t// The title set on the 'zoom in' button.\r\n\t\tzoomInTitle: 'Zoom in',\r\n\r\n\t\t// @option zoomOutText: String = '&#x2212;'\r\n\t\t// The text set on the 'zoom out' button.\r\n\t\tzoomOutText: '&#x2212;',\r\n\r\n\t\t// @option zoomOutTitle: String = 'Zoom out'\r\n\t\t// The title set on the 'zoom out' button.\r\n\t\tzoomOutTitle: 'Zoom out'\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tvar zoomName = 'leaflet-control-zoom',\r\n\t\t container = create$1('div', zoomName + ' leaflet-bar'),\r\n\t\t options = this.options;\r\n\r\n\t\tthis._zoomInButton = this._createButton(options.zoomInText, options.zoomInTitle,\r\n\t\t zoomName + '-in', container, this._zoomIn);\r\n\t\tthis._zoomOutButton = this._createButton(options.zoomOutText, options.zoomOutTitle,\r\n\t\t zoomName + '-out', container, this._zoomOut);\r\n\r\n\t\tthis._updateDisabled();\r\n\t\tmap.on('zoomend zoomlevelschange', this._updateDisabled, this);\r\n\r\n\t\treturn container;\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tmap.off('zoomend zoomlevelschange', this._updateDisabled, this);\r\n\t},\r\n\r\n\tdisable: function () {\r\n\t\tthis._disabled = true;\r\n\t\tthis._updateDisabled();\r\n\t\treturn this;\r\n\t},\r\n\r\n\tenable: function () {\r\n\t\tthis._disabled = false;\r\n\t\tthis._updateDisabled();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_zoomIn: function (e) {\r\n\t\tif (!this._disabled && this._map._zoom < this._map.getMaxZoom()) {\r\n\t\t\tthis._map.zoomIn(this._map.options.zoomDelta * (e.shiftKey ? 3 : 1));\r\n\t\t}\r\n\t},\r\n\r\n\t_zoomOut: function (e) {\r\n\t\tif (!this._disabled && this._map._zoom > this._map.getMinZoom()) {\r\n\t\t\tthis._map.zoomOut(this._map.options.zoomDelta * (e.shiftKey ? 3 : 1));\r\n\t\t}\r\n\t},\r\n\r\n\t_createButton: function (html, title, className, container, fn) {\r\n\t\tvar link = create$1('a', className, container);\r\n\t\tlink.innerHTML = html;\r\n\t\tlink.href = '#';\r\n\t\tlink.title = title;\r\n\r\n\t\t/*\r\n\t\t * Will force screen readers like VoiceOver to read this as \"Zoom in - button\"\r\n\t\t */\r\n\t\tlink.setAttribute('role', 'button');\r\n\t\tlink.setAttribute('aria-label', title);\r\n\r\n\t\tdisableClickPropagation(link);\r\n\t\ton(link, 'click', stop);\r\n\t\ton(link, 'click', fn, this);\r\n\t\ton(link, 'click', this._refocusOnMap, this);\r\n\r\n\t\treturn link;\r\n\t},\r\n\r\n\t_updateDisabled: function () {\r\n\t\tvar map = this._map,\r\n\t\t className = 'leaflet-disabled';\r\n\r\n\t\tremoveClass(this._zoomInButton, className);\r\n\t\tremoveClass(this._zoomOutButton, className);\r\n\r\n\t\tif (this._disabled || map._zoom === map.getMinZoom()) {\r\n\t\t\taddClass(this._zoomOutButton, className);\r\n\t\t}\r\n\t\tif (this._disabled || map._zoom === map.getMaxZoom()) {\r\n\t\t\taddClass(this._zoomInButton, className);\r\n\t\t}\r\n\t}\r\n});\r\n\r\n// @namespace Map\r\n// @section Control options\r\n// @option zoomControl: Boolean = true\r\n// Whether a [zoom control](#control-zoom) is added to the map by default.\r\nMap.mergeOptions({\r\n\tzoomControl: true\r\n});\r\n\r\nMap.addInitHook(function () {\r\n\tif (this.options.zoomControl) {\r\n\t\tthis.zoomControl = new Zoom();\r\n\t\tthis.addControl(this.zoomControl);\r\n\t}\r\n});\r\n\r\n// @namespace Control.Zoom\r\n// @factory L.control.zoom(options: Control.Zoom options)\r\n// Creates a zoom control\r\nvar zoom = function (options) {\r\n\treturn new Zoom(options);\r\n};\n\n/*\n * @class Control.Scale\n * @aka L.Control.Scale\n * @inherits Control\n *\n * A simple scale control that shows the scale of the current center of screen in metric (m/km) and imperial (mi/ft) systems. Extends `Control`.\n *\n * @example\n *\n * ```js\n * L.control.scale().addTo(map);\n * ```\n */\n\nvar Scale = Control.extend({\n\t// @section\n\t// @aka Control.Scale options\n\toptions: {\n\t\tposition: 'bottomleft',\n\n\t\t// @option maxWidth: Number = 100\n\t\t// Maximum width of the control in pixels. The width is set dynamically to show round values (e.g. 100, 200, 500).\n\t\tmaxWidth: 100,\n\n\t\t// @option metric: Boolean = True\n\t\t// Whether to show the metric scale line (m/km).\n\t\tmetric: true,\n\n\t\t// @option imperial: Boolean = True\n\t\t// Whether to show the imperial scale line (mi/ft).\n\t\timperial: true\n\n\t\t// @option updateWhenIdle: Boolean = false\n\t\t// If `true`, the control is updated on [`moveend`](#map-moveend), otherwise it's always up-to-date (updated on [`move`](#map-move)).\n\t},\n\n\tonAdd: function (map) {\n\t\tvar className = 'leaflet-control-scale',\n\t\t container = create$1('div', className),\n\t\t options = this.options;\n\n\t\tthis._addScales(options, className + '-line', container);\n\n\t\tmap.on(options.updateWhenIdle ? 'moveend' : 'move', this._update, this);\n\t\tmap.whenReady(this._update, this);\n\n\t\treturn container;\n\t},\n\n\tonRemove: function (map) {\n\t\tmap.off(this.options.updateWhenIdle ? 'moveend' : 'move', this._update, this);\n\t},\n\n\t_addScales: function (options, className, container) {\n\t\tif (options.metric) {\n\t\t\tthis._mScale = create$1('div', className, container);\n\t\t}\n\t\tif (options.imperial) {\n\t\t\tthis._iScale = create$1('div', className, container);\n\t\t}\n\t},\n\n\t_update: function () {\n\t\tvar map = this._map,\n\t\t y = map.getSize().y / 2;\n\n\t\tvar maxMeters = map.distance(\n\t\t\tmap.containerPointToLatLng([0, y]),\n\t\t\tmap.containerPointToLatLng([this.options.maxWidth, y]));\n\n\t\tthis._updateScales(maxMeters);\n\t},\n\n\t_updateScales: function (maxMeters) {\n\t\tif (this.options.metric && maxMeters) {\n\t\t\tthis._updateMetric(maxMeters);\n\t\t}\n\t\tif (this.options.imperial && maxMeters) {\n\t\t\tthis._updateImperial(maxMeters);\n\t\t}\n\t},\n\n\t_updateMetric: function (maxMeters) {\n\t\tvar meters = this._getRoundNum(maxMeters),\n\t\t label = meters < 1000 ? meters + ' m' : (meters / 1000) + ' km';\n\n\t\tthis._updateScale(this._mScale, label, meters / maxMeters);\n\t},\n\n\t_updateImperial: function (maxMeters) {\n\t\tvar maxFeet = maxMeters * 3.2808399,\n\t\t maxMiles, miles, feet;\n\n\t\tif (maxFeet > 5280) {\n\t\t\tmaxMiles = maxFeet / 5280;\n\t\t\tmiles = this._getRoundNum(maxMiles);\n\t\t\tthis._updateScale(this._iScale, miles + ' mi', miles / maxMiles);\n\n\t\t} else {\n\t\t\tfeet = this._getRoundNum(maxFeet);\n\t\t\tthis._updateScale(this._iScale, feet + ' ft', feet / maxFeet);\n\t\t}\n\t},\n\n\t_updateScale: function (scale, text, ratio) {\n\t\tscale.style.width = Math.round(this.options.maxWidth * ratio) + 'px';\n\t\tscale.innerHTML = text;\n\t},\n\n\t_getRoundNum: function (num) {\n\t\tvar pow10 = Math.pow(10, (Math.floor(num) + '').length - 1),\n\t\t d = num / pow10;\n\n\t\td = d >= 10 ? 10 :\n\t\t d >= 5 ? 5 :\n\t\t d >= 3 ? 3 :\n\t\t d >= 2 ? 2 : 1;\n\n\t\treturn pow10 * d;\n\t}\n});\n\n\n// @factory L.control.scale(options?: Control.Scale options)\n// Creates an scale control with the given options.\nvar scale = function (options) {\n\treturn new Scale(options);\n};\n\n/*\r\n * @class Control.Attribution\r\n * @aka L.Control.Attribution\r\n * @inherits Control\r\n *\r\n * The attribution control allows you to display attribution data in a small text box on a map. It is put on the map by default unless you set its [`attributionControl` option](#map-attributioncontrol) to `false`, and it fetches attribution texts from layers with the [`getAttribution` method](#layer-getattribution) automatically. Extends Control.\r\n */\r\n\r\nvar Attribution = Control.extend({\r\n\t// @section\r\n\t// @aka Control.Attribution options\r\n\toptions: {\r\n\t\tposition: 'bottomright',\r\n\r\n\t\t// @option prefix: String = 'Leaflet'\r\n\t\t// The HTML text shown before the attributions. Pass `false` to disable.\r\n\t\tprefix: '<a href=\"http://leafletjs.com\" title=\"A JS library for interactive maps\">Leaflet</a>'\r\n\t},\r\n\r\n\tinitialize: function (options) {\r\n\t\tsetOptions(this, options);\r\n\r\n\t\tthis._attributions = {};\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tmap.attributionControl = this;\r\n\t\tthis._container = create$1('div', 'leaflet-control-attribution');\r\n\t\tdisableClickPropagation(this._container);\r\n\r\n\t\t// TODO ugly, refactor\r\n\t\tfor (var i in map._layers) {\r\n\t\t\tif (map._layers[i].getAttribution) {\r\n\t\t\t\tthis.addAttribution(map._layers[i].getAttribution());\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tthis._update();\r\n\r\n\t\treturn this._container;\r\n\t},\r\n\r\n\t// @method setPrefix(prefix: String): this\r\n\t// Sets the text before the attributions.\r\n\tsetPrefix: function (prefix) {\r\n\t\tthis.options.prefix = prefix;\r\n\t\tthis._update();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method addAttribution(text: String): this\r\n\t// Adds an attribution text (e.g. `'Vector data &copy; Mapbox'`).\r\n\taddAttribution: function (text) {\r\n\t\tif (!text) { return this; }\r\n\r\n\t\tif (!this._attributions[text]) {\r\n\t\t\tthis._attributions[text] = 0;\r\n\t\t}\r\n\t\tthis._attributions[text]++;\r\n\r\n\t\tthis._update();\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method removeAttribution(text: String): this\r\n\t// Removes an attribution text.\r\n\tremoveAttribution: function (text) {\r\n\t\tif (!text) { return this; }\r\n\r\n\t\tif (this._attributions[text]) {\r\n\t\t\tthis._attributions[text]--;\r\n\t\t\tthis._update();\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_update: function () {\r\n\t\tif (!this._map) { return; }\r\n\r\n\t\tvar attribs = [];\r\n\r\n\t\tfor (var i in this._attributions) {\r\n\t\t\tif (this._attributions[i]) {\r\n\t\t\t\tattribs.push(i);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tvar prefixAndAttribs = [];\r\n\r\n\t\tif (this.options.prefix) {\r\n\t\t\tprefixAndAttribs.push(this.options.prefix);\r\n\t\t}\r\n\t\tif (attribs.length) {\r\n\t\t\tprefixAndAttribs.push(attribs.join(', '));\r\n\t\t}\r\n\r\n\t\tthis._container.innerHTML = prefixAndAttribs.join(' | ');\r\n\t}\r\n});\r\n\r\n// @namespace Map\r\n// @section Control options\r\n// @option attributionControl: Boolean = true\r\n// Whether a [attribution control](#control-attribution) is added to the map by default.\r\nMap.mergeOptions({\r\n\tattributionControl: true\r\n});\r\n\r\nMap.addInitHook(function () {\r\n\tif (this.options.attributionControl) {\r\n\t\tnew Attribution().addTo(this);\r\n\t}\r\n});\r\n\r\n// @namespace Control.Attribution\r\n// @factory L.control.attribution(options: Control.Attribution options)\r\n// Creates an attribution control.\r\nvar attribution = function (options) {\r\n\treturn new Attribution(options);\r\n};\n\nControl.Layers = Layers;\nControl.Zoom = Zoom;\nControl.Scale = Scale;\nControl.Attribution = Attribution;\n\ncontrol.layers = layers;\ncontrol.zoom = zoom;\ncontrol.scale = scale;\ncontrol.attribution = attribution;\n\n/*\n\tL.Handler is a base class for handler classes that are used internally to inject\n\tinteraction features like dragging to classes like Map and Marker.\n*/\n\n// @class Handler\n// @aka L.Handler\n// Abstract class for map interaction handlers\n\nvar Handler = Class.extend({\n\tinitialize: function (map) {\n\t\tthis._map = map;\n\t},\n\n\t// @method enable(): this\n\t// Enables the handler\n\tenable: function () {\n\t\tif (this._enabled) { return this; }\n\n\t\tthis._enabled = true;\n\t\tthis.addHooks();\n\t\treturn this;\n\t},\n\n\t// @method disable(): this\n\t// Disables the handler\n\tdisable: function () {\n\t\tif (!this._enabled) { return this; }\n\n\t\tthis._enabled = false;\n\t\tthis.removeHooks();\n\t\treturn this;\n\t},\n\n\t// @method enabled(): Boolean\n\t// Returns `true` if the handler is enabled\n\tenabled: function () {\n\t\treturn !!this._enabled;\n\t}\n\n\t// @section Extension methods\n\t// Classes inheriting from `Handler` must implement the two following methods:\n\t// @method addHooks()\n\t// Called when the handler is enabled, should add event hooks.\n\t// @method removeHooks()\n\t// Called when the handler is disabled, should remove the event hooks added previously.\n});\n\n// @section There is static function which can be called without instantiating L.Handler:\n// @function addTo(map: Map, name: String): this\n// Adds a new Handler to the given map with the given name.\nHandler.addTo = function (map, name) {\n\tmap.addHandler(name, this);\n\treturn this;\n};\n\nvar Mixin = {Events: Events};\n\n/*\r\n * @class Draggable\r\n * @aka L.Draggable\r\n * @inherits Evented\r\n *\r\n * A class for making DOM elements draggable (including touch support).\r\n * Used internally for map and marker dragging. Only works for elements\r\n * that were positioned with [`L.DomUtil.setPosition`](#domutil-setposition).\r\n *\r\n * @example\r\n * ```js\r\n * var draggable = new L.Draggable(elementToDrag);\r\n * draggable.enable();\r\n * ```\r\n */\r\n\r\nvar START = touch ? 'touchstart mousedown' : 'mousedown';\r\nvar END = {\r\n\tmousedown: 'mouseup',\r\n\ttouchstart: 'touchend',\r\n\tpointerdown: 'touchend',\r\n\tMSPointerDown: 'touchend'\r\n};\r\nvar MOVE = {\r\n\tmousedown: 'mousemove',\r\n\ttouchstart: 'touchmove',\r\n\tpointerdown: 'touchmove',\r\n\tMSPointerDown: 'touchmove'\r\n};\r\n\r\n\r\nvar Draggable = Evented.extend({\r\n\r\n\toptions: {\r\n\t\t// @section\r\n\t\t// @aka Draggable options\r\n\t\t// @option clickTolerance: Number = 3\r\n\t\t// The max number of pixels a user can shift the mouse pointer during a click\r\n\t\t// for it to be considered a valid click (as opposed to a mouse drag).\r\n\t\tclickTolerance: 3\r\n\t},\r\n\r\n\t// @constructor L.Draggable(el: HTMLElement, dragHandle?: HTMLElement, preventOutline?: Boolean, options?: Draggable options)\r\n\t// Creates a `Draggable` object for moving `el` when you start dragging the `dragHandle` element (equals `el` itself by default).\r\n\tinitialize: function (element, dragStartTarget, preventOutline$$1, options) {\r\n\t\tsetOptions(this, options);\r\n\r\n\t\tthis._element = element;\r\n\t\tthis._dragStartTarget = dragStartTarget || element;\r\n\t\tthis._preventOutline = preventOutline$$1;\r\n\t},\r\n\r\n\t// @method enable()\r\n\t// Enables the dragging ability\r\n\tenable: function () {\r\n\t\tif (this._enabled) { return; }\r\n\r\n\t\ton(this._dragStartTarget, START, this._onDown, this);\r\n\r\n\t\tthis._enabled = true;\r\n\t},\r\n\r\n\t// @method disable()\r\n\t// Disables the dragging ability\r\n\tdisable: function () {\r\n\t\tif (!this._enabled) { return; }\r\n\r\n\t\t// If we're currently dragging this draggable,\r\n\t\t// disabling it counts as first ending the drag.\r\n\t\tif (Draggable._dragging === this) {\r\n\t\t\tthis.finishDrag();\r\n\t\t}\r\n\r\n\t\toff(this._dragStartTarget, START, this._onDown, this);\r\n\r\n\t\tthis._enabled = false;\r\n\t\tthis._moved = false;\r\n\t},\r\n\r\n\t_onDown: function (e) {\r\n\t\t// Ignore simulated events, since we handle both touch and\r\n\t\t// mouse explicitly; otherwise we risk getting duplicates of\r\n\t\t// touch events, see #4315.\r\n\t\t// Also ignore the event if disabled; this happens in IE11\r\n\t\t// under some circumstances, see #3666.\r\n\t\tif (e._simulated || !this._enabled) { return; }\r\n\r\n\t\tthis._moved = false;\r\n\r\n\t\tif (hasClass(this._element, 'leaflet-zoom-anim')) { return; }\r\n\r\n\t\tif (Draggable._dragging || e.shiftKey || ((e.which !== 1) && (e.button !== 1) && !e.touches)) { return; }\r\n\t\tDraggable._dragging = this; // Prevent dragging multiple objects at once.\r\n\r\n\t\tif (this._preventOutline) {\r\n\t\t\tpreventOutline(this._element);\r\n\t\t}\r\n\r\n\t\tdisableImageDrag();\r\n\t\tdisableTextSelection();\r\n\r\n\t\tif (this._moving) { return; }\r\n\r\n\t\t// @event down: Event\r\n\t\t// Fired when a drag is about to start.\r\n\t\tthis.fire('down');\r\n\r\n\t\tvar first = e.touches ? e.touches[0] : e;\r\n\r\n\t\tthis._startPoint = new Point(first.clientX, first.clientY);\r\n\r\n\t\ton(document, MOVE[e.type], this._onMove, this);\r\n\t\ton(document, END[e.type], this._onUp, this);\r\n\t},\r\n\r\n\t_onMove: function (e) {\r\n\t\t// Ignore simulated events, since we handle both touch and\r\n\t\t// mouse explicitly; otherwise we risk getting duplicates of\r\n\t\t// touch events, see #4315.\r\n\t\t// Also ignore the event if disabled; this happens in IE11\r\n\t\t// under some circumstances, see #3666.\r\n\t\tif (e._simulated || !this._enabled) { return; }\r\n\r\n\t\tif (e.touches && e.touches.length > 1) {\r\n\t\t\tthis._moved = true;\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tvar first = (e.touches && e.touches.length === 1 ? e.touches[0] : e),\r\n\t\t newPoint = new Point(first.clientX, first.clientY),\r\n\t\t offset = newPoint.subtract(this._startPoint);\r\n\r\n\t\tif (!offset.x && !offset.y) { return; }\r\n\t\tif (Math.abs(offset.x) + Math.abs(offset.y) < this.options.clickTolerance) { return; }\r\n\r\n\t\tpreventDefault(e);\r\n\r\n\t\tif (!this._moved) {\r\n\t\t\t// @event dragstart: Event\r\n\t\t\t// Fired when a drag starts\r\n\t\t\tthis.fire('dragstart');\r\n\r\n\t\t\tthis._moved = true;\r\n\t\t\tthis._startPos = getPosition(this._element).subtract(offset);\r\n\r\n\t\t\taddClass(document.body, 'leaflet-dragging');\r\n\r\n\t\t\tthis._lastTarget = e.target || e.srcElement;\r\n\t\t\t// IE and Edge do not give the <use> element, so fetch it\r\n\t\t\t// if necessary\r\n\t\t\tif ((window.SVGElementInstance) && (this._lastTarget instanceof SVGElementInstance)) {\r\n\t\t\t\tthis._lastTarget = this._lastTarget.correspondingUseElement;\r\n\t\t\t}\r\n\t\t\taddClass(this._lastTarget, 'leaflet-drag-target');\r\n\t\t}\r\n\r\n\t\tthis._newPos = this._startPos.add(offset);\r\n\t\tthis._moving = true;\r\n\r\n\t\tcancelAnimFrame(this._animRequest);\r\n\t\tthis._lastEvent = e;\r\n\t\tthis._animRequest = requestAnimFrame(this._updatePosition, this, true);\r\n\t},\r\n\r\n\t_updatePosition: function () {\r\n\t\tvar e = {originalEvent: this._lastEvent};\r\n\r\n\t\t// @event predrag: Event\r\n\t\t// Fired continuously during dragging *before* each corresponding\r\n\t\t// update of the element's position.\r\n\t\tthis.fire('predrag', e);\r\n\t\tsetPosition(this._element, this._newPos);\r\n\r\n\t\t// @event drag: Event\r\n\t\t// Fired continuously during dragging.\r\n\t\tthis.fire('drag', e);\r\n\t},\r\n\r\n\t_onUp: function (e) {\r\n\t\t// Ignore simulated events, since we handle both touch and\r\n\t\t// mouse explicitly; otherwise we risk getting duplicates of\r\n\t\t// touch events, see #4315.\r\n\t\t// Also ignore the event if disabled; this happens in IE11\r\n\t\t// under some circumstances, see #3666.\r\n\t\tif (e._simulated || !this._enabled) { return; }\r\n\t\tthis.finishDrag();\r\n\t},\r\n\r\n\tfinishDrag: function () {\r\n\t\tremoveClass(document.body, 'leaflet-dragging');\r\n\r\n\t\tif (this._lastTarget) {\r\n\t\t\tremoveClass(this._lastTarget, 'leaflet-drag-target');\r\n\t\t\tthis._lastTarget = null;\r\n\t\t}\r\n\r\n\t\tfor (var i in MOVE) {\r\n\t\t\toff(document, MOVE[i], this._onMove, this);\r\n\t\t\toff(document, END[i], this._onUp, this);\r\n\t\t}\r\n\r\n\t\tenableImageDrag();\r\n\t\tenableTextSelection();\r\n\r\n\t\tif (this._moved && this._moving) {\r\n\t\t\t// ensure drag is not fired after dragend\r\n\t\t\tcancelAnimFrame(this._animRequest);\r\n\r\n\t\t\t// @event dragend: DragEndEvent\r\n\t\t\t// Fired when the drag ends.\r\n\t\t\tthis.fire('dragend', {\r\n\t\t\t\tdistance: this._newPos.distanceTo(this._startPos)\r\n\t\t\t});\r\n\t\t}\r\n\r\n\t\tthis._moving = false;\r\n\t\tDraggable._dragging = false;\r\n\t}\r\n\r\n});\n\n/*\r\n * @namespace LineUtil\r\n *\r\n * Various utility functions for polyline points processing, used by Leaflet internally to make polylines lightning-fast.\r\n */\r\n\r\n// Simplify polyline with vertex reduction and Douglas-Peucker simplification.\r\n// Improves rendering performance dramatically by lessening the number of points to draw.\r\n\r\n// @function simplify(points: Point[], tolerance: Number): Point[]\r\n// Dramatically reduces the number of points in a polyline while retaining\r\n// its shape and returns a new array of simplified points, using the\r\n// [Douglas-Peucker algorithm](http://en.wikipedia.org/wiki/Douglas-Peucker_algorithm).\r\n// Used for a huge performance boost when processing/displaying Leaflet polylines for\r\n// each zoom level and also reducing visual noise. tolerance affects the amount of\r\n// simplification (lesser value means higher quality but slower and with more points).\r\n// Also released as a separated micro-library [Simplify.js](http://mourner.github.com/simplify-js/).\r\nfunction simplify(points, tolerance) {\r\n\tif (!tolerance || !points.length) {\r\n\t\treturn points.slice();\r\n\t}\r\n\r\n\tvar sqTolerance = tolerance * tolerance;\r\n\r\n\t // stage 1: vertex reduction\r\n\t points = _reducePoints(points, sqTolerance);\r\n\r\n\t // stage 2: Douglas-Peucker simplification\r\n\t points = _simplifyDP(points, sqTolerance);\r\n\r\n\treturn points;\r\n}\r\n\r\n// @function pointToSegmentDistance(p: Point, p1: Point, p2: Point): Number\r\n// Returns the distance between point `p` and segment `p1` to `p2`.\r\nfunction pointToSegmentDistance(p, p1, p2) {\r\n\treturn Math.sqrt(_sqClosestPointOnSegment(p, p1, p2, true));\r\n}\r\n\r\n// @function closestPointOnSegment(p: Point, p1: Point, p2: Point): Number\r\n// Returns the closest point from a point `p` on a segment `p1` to `p2`.\r\nfunction closestPointOnSegment(p, p1, p2) {\r\n\treturn _sqClosestPointOnSegment(p, p1, p2);\r\n}\r\n\r\n// Douglas-Peucker simplification, see http://en.wikipedia.org/wiki/Douglas-Peucker_algorithm\r\nfunction _simplifyDP(points, sqTolerance) {\r\n\r\n\tvar len = points.length,\r\n\t ArrayConstructor = typeof Uint8Array !== undefined + '' ? Uint8Array : Array,\r\n\t markers = new ArrayConstructor(len);\r\n\r\n\t markers[0] = markers[len - 1] = 1;\r\n\r\n\t_simplifyDPStep(points, markers, sqTolerance, 0, len - 1);\r\n\r\n\tvar i,\r\n\t newPoints = [];\r\n\r\n\tfor (i = 0; i < len; i++) {\r\n\t\tif (markers[i]) {\r\n\t\t\tnewPoints.push(points[i]);\r\n\t\t}\r\n\t}\r\n\r\n\treturn newPoints;\r\n}\r\n\r\nfunction _simplifyDPStep(points, markers, sqTolerance, first, last) {\r\n\r\n\tvar maxSqDist = 0,\r\n\tindex, i, sqDist;\r\n\r\n\tfor (i = first + 1; i <= last - 1; i++) {\r\n\t\tsqDist = _sqClosestPointOnSegment(points[i], points[first], points[last], true);\r\n\r\n\t\tif (sqDist > maxSqDist) {\r\n\t\t\tindex = i;\r\n\t\t\tmaxSqDist = sqDist;\r\n\t\t}\r\n\t}\r\n\r\n\tif (maxSqDist > sqTolerance) {\r\n\t\tmarkers[index] = 1;\r\n\r\n\t\t_simplifyDPStep(points, markers, sqTolerance, first, index);\r\n\t\t_simplifyDPStep(points, markers, sqTolerance, index, last);\r\n\t}\r\n}\r\n\r\n// reduce points that are too close to each other to a single point\r\nfunction _reducePoints(points, sqTolerance) {\r\n\tvar reducedPoints = [points[0]];\r\n\r\n\tfor (var i = 1, prev = 0, len = points.length; i < len; i++) {\r\n\t\tif (_sqDist(points[i], points[prev]) > sqTolerance) {\r\n\t\t\treducedPoints.push(points[i]);\r\n\t\t\tprev = i;\r\n\t\t}\r\n\t}\r\n\tif (prev < len - 1) {\r\n\t\treducedPoints.push(points[len - 1]);\r\n\t}\r\n\treturn reducedPoints;\r\n}\r\n\r\nvar _lastCode;\r\n\r\n// @function clipSegment(a: Point, b: Point, bounds: Bounds, useLastCode?: Boolean, round?: Boolean): Point[]|Boolean\r\n// Clips the segment a to b by rectangular bounds with the\r\n// [Cohen-Sutherland algorithm](https://en.wikipedia.org/wiki/Cohen%E2%80%93Sutherland_algorithm)\r\n// (modifying the segment points directly!). Used by Leaflet to only show polyline\r\n// points that are on the screen or near, increasing performance.\r\nfunction clipSegment(a, b, bounds, useLastCode, round) {\r\n\tvar codeA = useLastCode ? _lastCode : _getBitCode(a, bounds),\r\n\t codeB = _getBitCode(b, bounds),\r\n\r\n\t codeOut, p, newCode;\r\n\r\n\t // save 2nd code to avoid calculating it on the next segment\r\n\t _lastCode = codeB;\r\n\r\n\twhile (true) {\r\n\t\t// if a,b is inside the clip window (trivial accept)\r\n\t\tif (!(codeA | codeB)) {\r\n\t\t\treturn [a, b];\r\n\t\t}\r\n\r\n\t\t// if a,b is outside the clip window (trivial reject)\r\n\t\tif (codeA & codeB) {\r\n\t\t\treturn false;\r\n\t\t}\r\n\r\n\t\t// other cases\r\n\t\tcodeOut = codeA || codeB;\r\n\t\tp = _getEdgeIntersection(a, b, codeOut, bounds, round);\r\n\t\tnewCode = _getBitCode(p, bounds);\r\n\r\n\t\tif (codeOut === codeA) {\r\n\t\t\ta = p;\r\n\t\t\tcodeA = newCode;\r\n\t\t} else {\r\n\t\t\tb = p;\r\n\t\t\tcodeB = newCode;\r\n\t\t}\r\n\t}\r\n}\r\n\r\nfunction _getEdgeIntersection(a, b, code, bounds, round) {\r\n\tvar dx = b.x - a.x,\r\n\t dy = b.y - a.y,\r\n\t min = bounds.min,\r\n\t max = bounds.max,\r\n\t x, y;\r\n\r\n\tif (code & 8) { // top\r\n\t\tx = a.x + dx * (max.y - a.y) / dy;\r\n\t\ty = max.y;\r\n\r\n\t} else if (code & 4) { // bottom\r\n\t\tx = a.x + dx * (min.y - a.y) / dy;\r\n\t\ty = min.y;\r\n\r\n\t} else if (code & 2) { // right\r\n\t\tx = max.x;\r\n\t\ty = a.y + dy * (max.x - a.x) / dx;\r\n\r\n\t} else if (code & 1) { // left\r\n\t\tx = min.x;\r\n\t\ty = a.y + dy * (min.x - a.x) / dx;\r\n\t}\r\n\r\n\treturn new Point(x, y, round);\r\n}\r\n\r\nfunction _getBitCode(p, bounds) {\r\n\tvar code = 0;\r\n\r\n\tif (p.x < bounds.min.x) { // left\r\n\t\tcode |= 1;\r\n\t} else if (p.x > bounds.max.x) { // right\r\n\t\tcode |= 2;\r\n\t}\r\n\r\n\tif (p.y < bounds.min.y) { // bottom\r\n\t\tcode |= 4;\r\n\t} else if (p.y > bounds.max.y) { // top\r\n\t\tcode |= 8;\r\n\t}\r\n\r\n\treturn code;\r\n}\r\n\r\n// square distance (to avoid unnecessary Math.sqrt calls)\r\nfunction _sqDist(p1, p2) {\r\n\tvar dx = p2.x - p1.x,\r\n\t dy = p2.y - p1.y;\r\n\treturn dx * dx + dy * dy;\r\n}\r\n\r\n// return closest point on segment or distance to that point\r\nfunction _sqClosestPointOnSegment(p, p1, p2, sqDist) {\r\n\tvar x = p1.x,\r\n\t y = p1.y,\r\n\t dx = p2.x - x,\r\n\t dy = p2.y - y,\r\n\t dot = dx * dx + dy * dy,\r\n\t t;\r\n\r\n\tif (dot > 0) {\r\n\t\tt = ((p.x - x) * dx + (p.y - y) * dy) / dot;\r\n\r\n\t\tif (t > 1) {\r\n\t\t\tx = p2.x;\r\n\t\t\ty = p2.y;\r\n\t\t} else if (t > 0) {\r\n\t\t\tx += dx * t;\r\n\t\t\ty += dy * t;\r\n\t\t}\r\n\t}\r\n\r\n\tdx = p.x - x;\r\n\tdy = p.y - y;\r\n\r\n\treturn sqDist ? dx * dx + dy * dy : new Point(x, y);\r\n}\r\n\r\n\r\n// @function isFlat(latlngs: LatLng[]): Boolean\r\n// Returns true if `latlngs` is a flat array, false is nested.\r\nfunction isFlat(latlngs) {\r\n\treturn !isArray(latlngs[0]) || (typeof latlngs[0][0] !== 'object' && typeof latlngs[0][0] !== 'undefined');\r\n}\r\n\r\nfunction _flat(latlngs) {\r\n\tconsole.warn('Deprecated use of _flat, please use L.LineUtil.isFlat instead.');\r\n\treturn isFlat(latlngs);\r\n}\r\n\n\nvar LineUtil = (Object.freeze || Object)({\n\tsimplify: simplify,\n\tpointToSegmentDistance: pointToSegmentDistance,\n\tclosestPointOnSegment: closestPointOnSegment,\n\tclipSegment: clipSegment,\n\t_getEdgeIntersection: _getEdgeIntersection,\n\t_getBitCode: _getBitCode,\n\t_sqClosestPointOnSegment: _sqClosestPointOnSegment,\n\tisFlat: isFlat,\n\t_flat: _flat\n});\n\n/*\r\n * @namespace PolyUtil\r\n * Various utility functions for polygon geometries.\r\n */\r\n\r\n/* @function clipPolygon(points: Point[], bounds: Bounds, round?: Boolean): Point[]\r\n * Clips the polygon geometry defined by the given `points` by the given bounds (using the [Sutherland-Hodgman algorithm](https://en.wikipedia.org/wiki/Sutherland%E2%80%93Hodgman_algorithm)).\r\n * Used by Leaflet to only show polygon points that are on the screen or near, increasing\r\n * performance. Note that polygon points needs different algorithm for clipping\r\n * than polyline, so there's a separate method for it.\r\n */\r\nfunction clipPolygon(points, bounds, round) {\r\n\tvar clippedPoints,\r\n\t edges = [1, 4, 2, 8],\r\n\t i, j, k,\r\n\t a, b,\r\n\t len, edge, p;\r\n\r\n\tfor (i = 0, len = points.length; i < len; i++) {\r\n\t\tpoints[i]._code = _getBitCode(points[i], bounds);\r\n\t}\r\n\r\n\t// for each edge (left, bottom, right, top)\r\n\tfor (k = 0; k < 4; k++) {\r\n\t\tedge = edges[k];\r\n\t\tclippedPoints = [];\r\n\r\n\t\tfor (i = 0, len = points.length, j = len - 1; i < len; j = i++) {\r\n\t\t\ta = points[i];\r\n\t\t\tb = points[j];\r\n\r\n\t\t\t// if a is inside the clip window\r\n\t\t\tif (!(a._code & edge)) {\r\n\t\t\t\t// if b is outside the clip window (a->b goes out of screen)\r\n\t\t\t\tif (b._code & edge) {\r\n\t\t\t\t\tp = _getEdgeIntersection(b, a, edge, bounds, round);\r\n\t\t\t\t\tp._code = _getBitCode(p, bounds);\r\n\t\t\t\t\tclippedPoints.push(p);\r\n\t\t\t\t}\r\n\t\t\t\tclippedPoints.push(a);\r\n\r\n\t\t\t// else if b is inside the clip window (a->b enters the screen)\r\n\t\t\t} else if (!(b._code & edge)) {\r\n\t\t\t\tp = _getEdgeIntersection(b, a, edge, bounds, round);\r\n\t\t\t\tp._code = _getBitCode(p, bounds);\r\n\t\t\t\tclippedPoints.push(p);\r\n\t\t\t}\r\n\t\t}\r\n\t\tpoints = clippedPoints;\r\n\t}\r\n\r\n\treturn points;\r\n}\r\n\n\nvar PolyUtil = (Object.freeze || Object)({\n\tclipPolygon: clipPolygon\n});\n\n/*\r\n * @namespace Projection\r\n * @section\r\n * Leaflet comes with a set of already defined Projections out of the box:\r\n *\r\n * @projection L.Projection.LonLat\r\n *\r\n * Equirectangular, or Plate Carree projection — the most simple projection,\r\n * mostly used by GIS enthusiasts. Directly maps `x` as longitude, and `y` as\r\n * latitude. Also suitable for flat worlds, e.g. game maps. Used by the\r\n * `EPSG:4326` and `Simple` CRS.\r\n */\r\n\r\nvar LonLat = {\r\n\tproject: function (latlng) {\r\n\t\treturn new Point(latlng.lng, latlng.lat);\r\n\t},\r\n\r\n\tunproject: function (point) {\r\n\t\treturn new LatLng(point.y, point.x);\r\n\t},\r\n\r\n\tbounds: new Bounds([-180, -90], [180, 90])\r\n};\n\n/*\r\n * @namespace Projection\r\n * @projection L.Projection.Mercator\r\n *\r\n * Elliptical Mercator projection — more complex than Spherical Mercator. Takes into account that Earth is a geoid, not a perfect sphere. Used by the EPSG:3395 CRS.\r\n */\r\n\r\nvar Mercator = {\r\n\tR: 6378137,\r\n\tR_MINOR: 6356752.314245179,\r\n\r\n\tbounds: new Bounds([-20037508.34279, -15496570.73972], [20037508.34279, 18764656.23138]),\r\n\r\n\tproject: function (latlng) {\r\n\t\tvar d = Math.PI / 180,\r\n\t\t r = this.R,\r\n\t\t y = latlng.lat * d,\r\n\t\t tmp = this.R_MINOR / r,\r\n\t\t e = Math.sqrt(1 - tmp * tmp),\r\n\t\t con = e * Math.sin(y);\r\n\r\n\t\tvar ts = Math.tan(Math.PI / 4 - y / 2) / Math.pow((1 - con) / (1 + con), e / 2);\r\n\t\ty = -r * Math.log(Math.max(ts, 1E-10));\r\n\r\n\t\treturn new Point(latlng.lng * d * r, y);\r\n\t},\r\n\r\n\tunproject: function (point) {\r\n\t\tvar d = 180 / Math.PI,\r\n\t\t r = this.R,\r\n\t\t tmp = this.R_MINOR / r,\r\n\t\t e = Math.sqrt(1 - tmp * tmp),\r\n\t\t ts = Math.exp(-point.y / r),\r\n\t\t phi = Math.PI / 2 - 2 * Math.atan(ts);\r\n\r\n\t\tfor (var i = 0, dphi = 0.1, con; i < 15 && Math.abs(dphi) > 1e-7; i++) {\r\n\t\t\tcon = e * Math.sin(phi);\r\n\t\t\tcon = Math.pow((1 - con) / (1 + con), e / 2);\r\n\t\t\tdphi = Math.PI / 2 - 2 * Math.atan(ts * con) - phi;\r\n\t\t\tphi += dphi;\r\n\t\t}\r\n\r\n\t\treturn new LatLng(phi * d, point.x * d / r);\r\n\t}\r\n};\n\n/*\n * @class Projection\n\n * An object with methods for projecting geographical coordinates of the world onto\n * a flat surface (and back). See [Map projection](http://en.wikipedia.org/wiki/Map_projection).\n\n * @property bounds: Bounds\n * The bounds (specified in CRS units) where the projection is valid\n\n * @method project(latlng: LatLng): Point\n * Projects geographical coordinates into a 2D point.\n * Only accepts actual `L.LatLng` instances, not arrays.\n\n * @method unproject(point: Point): LatLng\n * The inverse of `project`. Projects a 2D point into a geographical location.\n * Only accepts actual `L.Point` instances, not arrays.\n\n * Note that the projection instances do not inherit from Leafet's `Class` object,\n * and can't be instantiated. Also, new classes can't inherit from them,\n * and methods can't be added to them with the `include` function.\n\n */\n\n\n\n\nvar index = (Object.freeze || Object)({\n\tLonLat: LonLat,\n\tMercator: Mercator,\n\tSphericalMercator: SphericalMercator\n});\n\n/*\r\n * @namespace CRS\r\n * @crs L.CRS.EPSG3395\r\n *\r\n * Rarely used by some commercial tile providers. Uses Elliptical Mercator projection.\r\n */\r\nvar EPSG3395 = extend({}, Earth, {\r\n\tcode: 'EPSG:3395',\r\n\tprojection: Mercator,\r\n\r\n\ttransformation: (function () {\r\n\t\tvar scale = 0.5 / (Math.PI * Mercator.R);\r\n\t\treturn toTransformation(scale, 0.5, -scale, 0.5);\r\n\t}())\r\n});\n\n/*\r\n * @namespace CRS\r\n * @crs L.CRS.EPSG4326\r\n *\r\n * A common CRS among GIS enthusiasts. Uses simple Equirectangular projection.\r\n *\r\n * Leaflet 1.0.x complies with the [TMS coordinate scheme for EPSG:4326](https://wiki.osgeo.org/wiki/Tile_Map_Service_Specification#global-geodetic),\r\n * which is a breaking change from 0.7.x behaviour. If you are using a `TileLayer`\r\n * with this CRS, ensure that there are two 256x256 pixel tiles covering the\r\n * whole earth at zoom level zero, and that the tile coordinate origin is (-180,+90),\r\n * or (-180,-90) for `TileLayer`s with [the `tms` option](#tilelayer-tms) set.\r\n */\r\n\r\nvar EPSG4326 = extend({}, Earth, {\r\n\tcode: 'EPSG:4326',\r\n\tprojection: LonLat,\r\n\ttransformation: toTransformation(1 / 180, 1, -1 / 180, 0.5)\r\n});\n\n/*\n * @namespace CRS\n * @crs L.CRS.Simple\n *\n * A simple CRS that maps longitude and latitude into `x` and `y` directly.\n * May be used for maps of flat surfaces (e.g. game maps). Note that the `y`\n * axis should still be inverted (going from bottom to top). `distance()` returns\n * simple euclidean distance.\n */\n\nvar Simple = extend({}, CRS, {\n\tprojection: LonLat,\n\ttransformation: toTransformation(1, 0, -1, 0),\n\n\tscale: function (zoom) {\n\t\treturn Math.pow(2, zoom);\n\t},\n\n\tzoom: function (scale) {\n\t\treturn Math.log(scale) / Math.LN2;\n\t},\n\n\tdistance: function (latlng1, latlng2) {\n\t\tvar dx = latlng2.lng - latlng1.lng,\n\t\t dy = latlng2.lat - latlng1.lat;\n\n\t\treturn Math.sqrt(dx * dx + dy * dy);\n\t},\n\n\tinfinite: true\n});\n\nCRS.Earth = Earth;\nCRS.EPSG3395 = EPSG3395;\nCRS.EPSG3857 = EPSG3857;\nCRS.EPSG900913 = EPSG900913;\nCRS.EPSG4326 = EPSG4326;\nCRS.Simple = Simple;\n\n/*\n * @class Layer\n * @inherits Evented\n * @aka L.Layer\n * @aka ILayer\n *\n * A set of methods from the Layer base class that all Leaflet layers use.\n * Inherits all methods, options and events from `L.Evented`.\n *\n * @example\n *\n * ```js\n * var layer = L.Marker(latlng).addTo(map);\n * layer.addTo(map);\n * layer.remove();\n * ```\n *\n * @event add: Event\n * Fired after the layer is added to a map\n *\n * @event remove: Event\n * Fired after the layer is removed from a map\n */\n\n\nvar Layer = Evented.extend({\n\n\t// Classes extending `L.Layer` will inherit the following options:\n\toptions: {\n\t\t// @option pane: String = 'overlayPane'\n\t\t// By default the layer will be added to the map's [overlay pane](#map-overlaypane). Overriding this option will cause the layer to be placed on another pane by default.\n\t\tpane: 'overlayPane',\n\n\t\t// @option attribution: String = null\n\t\t// String to be shown in the attribution control, describes the layer data, e.g. \"© Mapbox\".\n\t\tattribution: null,\n\n\t\tbubblingMouseEvents: true\n\t},\n\n\t/* @section\n\t * Classes extending `L.Layer` will inherit the following methods:\n\t *\n\t * @method addTo(map: Map|LayerGroup): this\n\t * Adds the layer to the given map or layer group.\n\t */\n\taddTo: function (map) {\n\t\tmap.addLayer(this);\n\t\treturn this;\n\t},\n\n\t// @method remove: this\n\t// Removes the layer from the map it is currently active on.\n\tremove: function () {\n\t\treturn this.removeFrom(this._map || this._mapToAdd);\n\t},\n\n\t// @method removeFrom(map: Map): this\n\t// Removes the layer from the given map\n\tremoveFrom: function (obj) {\n\t\tif (obj) {\n\t\t\tobj.removeLayer(this);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method getPane(name? : String): HTMLElement\n\t// Returns the `HTMLElement` representing the named pane on the map. If `name` is omitted, returns the pane for this layer.\n\tgetPane: function (name) {\n\t\treturn this._map.getPane(name ? (this.options[name] || name) : this.options.pane);\n\t},\n\n\taddInteractiveTarget: function (targetEl) {\n\t\tthis._map._targets[stamp(targetEl)] = this;\n\t\treturn this;\n\t},\n\n\tremoveInteractiveTarget: function (targetEl) {\n\t\tdelete this._map._targets[stamp(targetEl)];\n\t\treturn this;\n\t},\n\n\t// @method getAttribution: String\n\t// Used by the `attribution control`, returns the [attribution option](#gridlayer-attribution).\n\tgetAttribution: function () {\n\t\treturn this.options.attribution;\n\t},\n\n\t_layerAdd: function (e) {\n\t\tvar map = e.target;\n\n\t\t// check in case layer gets added and then removed before the map is ready\n\t\tif (!map.hasLayer(this)) { return; }\n\n\t\tthis._map = map;\n\t\tthis._zoomAnimated = map._zoomAnimated;\n\n\t\tif (this.getEvents) {\n\t\t\tvar events = this.getEvents();\n\t\t\tmap.on(events, this);\n\t\t\tthis.once('remove', function () {\n\t\t\t\tmap.off(events, this);\n\t\t\t}, this);\n\t\t}\n\n\t\tthis.onAdd(map);\n\n\t\tif (this.getAttribution && map.attributionControl) {\n\t\t\tmap.attributionControl.addAttribution(this.getAttribution());\n\t\t}\n\n\t\tthis.fire('add');\n\t\tmap.fire('layeradd', {layer: this});\n\t}\n});\n\n/* @section Extension methods\n * @uninheritable\n *\n * Every layer should extend from `L.Layer` and (re-)implement the following methods.\n *\n * @method onAdd(map: Map): this\n * Should contain code that creates DOM elements for the layer, adds them to `map panes` where they should belong and puts listeners on relevant map events. Called on [`map.addLayer(layer)`](#map-addlayer).\n *\n * @method onRemove(map: Map): this\n * Should contain all clean up code that removes the layer's elements from the DOM and removes listeners previously added in [`onAdd`](#layer-onadd). Called on [`map.removeLayer(layer)`](#map-removelayer).\n *\n * @method getEvents(): Object\n * This optional method should return an object like `{ viewreset: this._reset }` for [`addEventListener`](#evented-addeventlistener). The event handlers in this object will be automatically added and removed from the map with your layer.\n *\n * @method getAttribution(): String\n * This optional method should return a string containing HTML to be shown on the `Attribution control` whenever the layer is visible.\n *\n * @method beforeAdd(map: Map): this\n * Optional method. Called on [`map.addLayer(layer)`](#map-addlayer), before the layer is added to the map, before events are initialized, without waiting until the map is in a usable state. Use for early initialization only.\n */\n\n\n/* @namespace Map\n * @section Layer events\n *\n * @event layeradd: LayerEvent\n * Fired when a new layer is added to the map.\n *\n * @event layerremove: LayerEvent\n * Fired when some layer is removed from the map\n *\n * @section Methods for Layers and Controls\n */\nMap.include({\n\t// @method addLayer(layer: Layer): this\n\t// Adds the given layer to the map\n\taddLayer: function (layer) {\n\t\tif (!layer._layerAdd) {\n\t\t\tthrow new Error('The provided object is not a Layer.');\n\t\t}\n\n\t\tvar id = stamp(layer);\n\t\tif (this._layers[id]) { return this; }\n\t\tthis._layers[id] = layer;\n\n\t\tlayer._mapToAdd = this;\n\n\t\tif (layer.beforeAdd) {\n\t\t\tlayer.beforeAdd(this);\n\t\t}\n\n\t\tthis.whenReady(layer._layerAdd, layer);\n\n\t\treturn this;\n\t},\n\n\t// @method removeLayer(layer: Layer): this\n\t// Removes the given layer from the map.\n\tremoveLayer: function (layer) {\n\t\tvar id = stamp(layer);\n\n\t\tif (!this._layers[id]) { return this; }\n\n\t\tif (this._loaded) {\n\t\t\tlayer.onRemove(this);\n\t\t}\n\n\t\tif (layer.getAttribution && this.attributionControl) {\n\t\t\tthis.attributionControl.removeAttribution(layer.getAttribution());\n\t\t}\n\n\t\tdelete this._layers[id];\n\n\t\tif (this._loaded) {\n\t\t\tthis.fire('layerremove', {layer: layer});\n\t\t\tlayer.fire('remove');\n\t\t}\n\n\t\tlayer._map = layer._mapToAdd = null;\n\n\t\treturn this;\n\t},\n\n\t// @method hasLayer(layer: Layer): Boolean\n\t// Returns `true` if the given layer is currently added to the map\n\thasLayer: function (layer) {\n\t\treturn !!layer && (stamp(layer) in this._layers);\n\t},\n\n\t/* @method eachLayer(fn: Function, context?: Object): this\n\t * Iterates over the layers of the map, optionally specifying context of the iterator function.\n\t * ```\n\t * map.eachLayer(function(layer){\n\t * layer.bindPopup('Hello');\n\t * });\n\t * ```\n\t */\n\teachLayer: function (method, context) {\n\t\tfor (var i in this._layers) {\n\t\t\tmethod.call(context, this._layers[i]);\n\t\t}\n\t\treturn this;\n\t},\n\n\t_addLayers: function (layers) {\n\t\tlayers = layers ? (isArray(layers) ? layers : [layers]) : [];\n\n\t\tfor (var i = 0, len = layers.length; i < len; i++) {\n\t\t\tthis.addLayer(layers[i]);\n\t\t}\n\t},\n\n\t_addZoomLimit: function (layer) {\n\t\tif (isNaN(layer.options.maxZoom) || !isNaN(layer.options.minZoom)) {\n\t\t\tthis._zoomBoundLayers[stamp(layer)] = layer;\n\t\t\tthis._updateZoomLevels();\n\t\t}\n\t},\n\n\t_removeZoomLimit: function (layer) {\n\t\tvar id = stamp(layer);\n\n\t\tif (this._zoomBoundLayers[id]) {\n\t\t\tdelete this._zoomBoundLayers[id];\n\t\t\tthis._updateZoomLevels();\n\t\t}\n\t},\n\n\t_updateZoomLevels: function () {\n\t\tvar minZoom = Infinity,\n\t\t maxZoom = -Infinity,\n\t\t oldZoomSpan = this._getZoomSpan();\n\n\t\tfor (var i in this._zoomBoundLayers) {\n\t\t\tvar options = this._zoomBoundLayers[i].options;\n\n\t\t\tminZoom = options.minZoom === undefined ? minZoom : Math.min(minZoom, options.minZoom);\n\t\t\tmaxZoom = options.maxZoom === undefined ? maxZoom : Math.max(maxZoom, options.maxZoom);\n\t\t}\n\n\t\tthis._layersMaxZoom = maxZoom === -Infinity ? undefined : maxZoom;\n\t\tthis._layersMinZoom = minZoom === Infinity ? undefined : minZoom;\n\n\t\t// @section Map state change events\n\t\t// @event zoomlevelschange: Event\n\t\t// Fired when the number of zoomlevels on the map is changed due\n\t\t// to adding or removing a layer.\n\t\tif (oldZoomSpan !== this._getZoomSpan()) {\n\t\t\tthis.fire('zoomlevelschange');\n\t\t}\n\n\t\tif (this.options.maxZoom === undefined && this._layersMaxZoom && this.getZoom() > this._layersMaxZoom) {\n\t\t\tthis.setZoom(this._layersMaxZoom);\n\t\t}\n\t\tif (this.options.minZoom === undefined && this._layersMinZoom && this.getZoom() < this._layersMinZoom) {\n\t\t\tthis.setZoom(this._layersMinZoom);\n\t\t}\n\t}\n});\n\n/*\r\n * @class LayerGroup\r\n * @aka L.LayerGroup\r\n * @inherits Layer\r\n *\r\n * Used to group several layers and handle them as one. If you add it to the map,\r\n * any layers added or removed from the group will be added/removed on the map as\r\n * well. Extends `Layer`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * L.layerGroup([marker1, marker2])\r\n * \t.addLayer(polyline)\r\n * \t.addTo(map);\r\n * ```\r\n */\r\n\r\nvar LayerGroup = Layer.extend({\r\n\r\n\tinitialize: function (layers, options) {\r\n\t\tsetOptions(this, options);\r\n\r\n\t\tthis._layers = {};\r\n\r\n\t\tvar i, len;\r\n\r\n\t\tif (layers) {\r\n\t\t\tfor (i = 0, len = layers.length; i < len; i++) {\r\n\t\t\t\tthis.addLayer(layers[i]);\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\t// @method addLayer(layer: Layer): this\r\n\t// Adds the given layer to the group.\r\n\taddLayer: function (layer) {\r\n\t\tvar id = this.getLayerId(layer);\r\n\r\n\t\tthis._layers[id] = layer;\r\n\r\n\t\tif (this._map) {\r\n\t\t\tthis._map.addLayer(layer);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method removeLayer(layer: Layer): this\r\n\t// Removes the given layer from the group.\r\n\t// @alternative\r\n\t// @method removeLayer(id: Number): this\r\n\t// Removes the layer with the given internal ID from the group.\r\n\tremoveLayer: function (layer) {\r\n\t\tvar id = layer in this._layers ? layer : this.getLayerId(layer);\r\n\r\n\t\tif (this._map && this._layers[id]) {\r\n\t\t\tthis._map.removeLayer(this._layers[id]);\r\n\t\t}\r\n\r\n\t\tdelete this._layers[id];\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method hasLayer(layer: Layer): Boolean\r\n\t// Returns `true` if the given layer is currently added to the group.\r\n\t// @alternative\r\n\t// @method hasLayer(id: Number): Boolean\r\n\t// Returns `true` if the given internal ID is currently added to the group.\r\n\thasLayer: function (layer) {\r\n\t\treturn !!layer && (layer in this._layers || this.getLayerId(layer) in this._layers);\r\n\t},\r\n\r\n\t// @method clearLayers(): this\r\n\t// Removes all the layers from the group.\r\n\tclearLayers: function () {\r\n\t\treturn this.eachLayer(this.removeLayer, this);\r\n\t},\r\n\r\n\t// @method invoke(methodName: String, …): this\r\n\t// Calls `methodName` on every layer contained in this group, passing any\r\n\t// additional parameters. Has no effect if the layers contained do not\r\n\t// implement `methodName`.\r\n\tinvoke: function (methodName) {\r\n\t\tvar args = Array.prototype.slice.call(arguments, 1),\r\n\t\t i, layer;\r\n\r\n\t\tfor (i in this._layers) {\r\n\t\t\tlayer = this._layers[i];\r\n\r\n\t\t\tif (layer[methodName]) {\r\n\t\t\t\tlayer[methodName].apply(layer, args);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tthis.eachLayer(map.addLayer, map);\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tthis.eachLayer(map.removeLayer, map);\r\n\t},\r\n\r\n\t// @method eachLayer(fn: Function, context?: Object): this\r\n\t// Iterates over the layers of the group, optionally specifying context of the iterator function.\r\n\t// ```js\r\n\t// group.eachLayer(function (layer) {\r\n\t// \tlayer.bindPopup('Hello');\r\n\t// });\r\n\t// ```\r\n\teachLayer: function (method, context) {\r\n\t\tfor (var i in this._layers) {\r\n\t\t\tmethod.call(context, this._layers[i]);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getLayer(id: Number): Layer\r\n\t// Returns the layer with the given internal ID.\r\n\tgetLayer: function (id) {\r\n\t\treturn this._layers[id];\r\n\t},\r\n\r\n\t// @method getLayers(): Layer[]\r\n\t// Returns an array of all the layers added to the group.\r\n\tgetLayers: function () {\r\n\t\tvar layers = [];\r\n\t\tthis.eachLayer(layers.push, layers);\r\n\t\treturn layers;\r\n\t},\r\n\r\n\t// @method setZIndex(zIndex: Number): this\r\n\t// Calls `setZIndex` on every layer contained in this group, passing the z-index.\r\n\tsetZIndex: function (zIndex) {\r\n\t\treturn this.invoke('setZIndex', zIndex);\r\n\t},\r\n\r\n\t// @method getLayerId(layer: Layer): Number\r\n\t// Returns the internal ID for a layer\r\n\tgetLayerId: function (layer) {\r\n\t\treturn stamp(layer);\r\n\t}\r\n});\r\n\r\n\r\n// @factory L.layerGroup(layers?: Layer[], options?: Object)\r\n// Create a layer group, optionally given an initial set of layers and an `options` object.\r\nvar layerGroup = function (layers, options) {\r\n\treturn new LayerGroup(layers, options);\r\n};\n\n/*\r\n * @class FeatureGroup\r\n * @aka L.FeatureGroup\r\n * @inherits LayerGroup\r\n *\r\n * Extended `LayerGroup` that makes it easier to do the same thing to all its member layers:\r\n * * [`bindPopup`](#layer-bindpopup) binds a popup to all of the layers at once (likewise with [`bindTooltip`](#layer-bindtooltip))\r\n * * Events are propagated to the `FeatureGroup`, so if the group has an event\r\n * handler, it will handle events from any of the layers. This includes mouse events\r\n * and custom events.\r\n * * Has `layeradd` and `layerremove` events\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * L.featureGroup([marker1, marker2, polyline])\r\n * \t.bindPopup('Hello world!')\r\n * \t.on('click', function() { alert('Clicked on a member of the group!'); })\r\n * \t.addTo(map);\r\n * ```\r\n */\r\n\r\nvar FeatureGroup = LayerGroup.extend({\r\n\r\n\taddLayer: function (layer) {\r\n\t\tif (this.hasLayer(layer)) {\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tlayer.addEventParent(this);\r\n\r\n\t\tLayerGroup.prototype.addLayer.call(this, layer);\r\n\r\n\t\t// @event layeradd: LayerEvent\r\n\t\t// Fired when a layer is added to this `FeatureGroup`\r\n\t\treturn this.fire('layeradd', {layer: layer});\r\n\t},\r\n\r\n\tremoveLayer: function (layer) {\r\n\t\tif (!this.hasLayer(layer)) {\r\n\t\t\treturn this;\r\n\t\t}\r\n\t\tif (layer in this._layers) {\r\n\t\t\tlayer = this._layers[layer];\r\n\t\t}\r\n\r\n\t\tlayer.removeEventParent(this);\r\n\r\n\t\tLayerGroup.prototype.removeLayer.call(this, layer);\r\n\r\n\t\t// @event layerremove: LayerEvent\r\n\t\t// Fired when a layer is removed from this `FeatureGroup`\r\n\t\treturn this.fire('layerremove', {layer: layer});\r\n\t},\r\n\r\n\t// @method setStyle(style: Path options): this\r\n\t// Sets the given path options to each layer of the group that has a `setStyle` method.\r\n\tsetStyle: function (style) {\r\n\t\treturn this.invoke('setStyle', style);\r\n\t},\r\n\r\n\t// @method bringToFront(): this\r\n\t// Brings the layer group to the top of all other layers\r\n\tbringToFront: function () {\r\n\t\treturn this.invoke('bringToFront');\r\n\t},\r\n\r\n\t// @method bringToBack(): this\r\n\t// Brings the layer group to the back of all other layers\r\n\tbringToBack: function () {\r\n\t\treturn this.invoke('bringToBack');\r\n\t},\r\n\r\n\t// @method getBounds(): LatLngBounds\r\n\t// Returns the LatLngBounds of the Feature Group (created from bounds and coordinates of its children).\r\n\tgetBounds: function () {\r\n\t\tvar bounds = new LatLngBounds();\r\n\r\n\t\tfor (var id in this._layers) {\r\n\t\t\tvar layer = this._layers[id];\r\n\t\t\tbounds.extend(layer.getBounds ? layer.getBounds() : layer.getLatLng());\r\n\t\t}\r\n\t\treturn bounds;\r\n\t}\r\n});\r\n\r\n// @factory L.featureGroup(layers: Layer[])\r\n// Create a feature group, optionally given an initial set of layers.\r\nvar featureGroup = function (layers) {\r\n\treturn new FeatureGroup(layers);\r\n};\n\n/*\r\n * @class Icon\r\n * @aka L.Icon\r\n *\r\n * Represents an icon to provide when creating a marker.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var myIcon = L.icon({\r\n * iconUrl: 'my-icon.png',\r\n * iconRetinaUrl: 'my-icon@2x.png',\r\n * iconSize: [38, 95],\r\n * iconAnchor: [22, 94],\r\n * popupAnchor: [-3, -76],\r\n * shadowUrl: 'my-icon-shadow.png',\r\n * shadowRetinaUrl: 'my-icon-shadow@2x.png',\r\n * shadowSize: [68, 95],\r\n * shadowAnchor: [22, 94]\r\n * });\r\n *\r\n * L.marker([50.505, 30.57], {icon: myIcon}).addTo(map);\r\n * ```\r\n *\r\n * `L.Icon.Default` extends `L.Icon` and is the blue icon Leaflet uses for markers by default.\r\n *\r\n */\r\n\r\nvar Icon = Class.extend({\r\n\r\n\t/* @section\r\n\t * @aka Icon options\r\n\t *\r\n\t * @option iconUrl: String = null\r\n\t * **(required)** The URL to the icon image (absolute or relative to your script path).\r\n\t *\r\n\t * @option iconRetinaUrl: String = null\r\n\t * The URL to a retina sized version of the icon image (absolute or relative to your\r\n\t * script path). Used for Retina screen devices.\r\n\t *\r\n\t * @option iconSize: Point = null\r\n\t * Size of the icon image in pixels.\r\n\t *\r\n\t * @option iconAnchor: Point = null\r\n\t * The coordinates of the \"tip\" of the icon (relative to its top left corner). The icon\r\n\t * will be aligned so that this point is at the marker's geographical location. Centered\r\n\t * by default if size is specified, also can be set in CSS with negative margins.\r\n\t *\r\n\t * @option popupAnchor: Point = [0, 0]\r\n\t * The coordinates of the point from which popups will \"open\", relative to the icon anchor.\r\n\t *\r\n\t * @option tooltipAnchor: Point = [0, 0]\r\n\t * The coordinates of the point from which tooltips will \"open\", relative to the icon anchor.\r\n\t *\r\n\t * @option shadowUrl: String = null\r\n\t * The URL to the icon shadow image. If not specified, no shadow image will be created.\r\n\t *\r\n\t * @option shadowRetinaUrl: String = null\r\n\t *\r\n\t * @option shadowSize: Point = null\r\n\t * Size of the shadow image in pixels.\r\n\t *\r\n\t * @option shadowAnchor: Point = null\r\n\t * The coordinates of the \"tip\" of the shadow (relative to its top left corner) (the same\r\n\t * as iconAnchor if not specified).\r\n\t *\r\n\t * @option className: String = ''\r\n\t * A custom class name to assign to both icon and shadow images. Empty by default.\r\n\t */\r\n\r\n\toptions: {\r\n\t\tpopupAnchor: [0, 0],\r\n\t\ttooltipAnchor: [0, 0],\r\n\t},\r\n\r\n\tinitialize: function (options) {\r\n\t\tsetOptions(this, options);\r\n\t},\r\n\r\n\t// @method createIcon(oldIcon?: HTMLElement): HTMLElement\r\n\t// Called internally when the icon has to be shown, returns a `<img>` HTML element\r\n\t// styled according to the options.\r\n\tcreateIcon: function (oldIcon) {\r\n\t\treturn this._createIcon('icon', oldIcon);\r\n\t},\r\n\r\n\t// @method createShadow(oldIcon?: HTMLElement): HTMLElement\r\n\t// As `createIcon`, but for the shadow beneath it.\r\n\tcreateShadow: function (oldIcon) {\r\n\t\treturn this._createIcon('shadow', oldIcon);\r\n\t},\r\n\r\n\t_createIcon: function (name, oldIcon) {\r\n\t\tvar src = this._getIconUrl(name);\r\n\r\n\t\tif (!src) {\r\n\t\t\tif (name === 'icon') {\r\n\t\t\t\tthrow new Error('iconUrl not set in Icon options (see the docs).');\r\n\t\t\t}\r\n\t\t\treturn null;\r\n\t\t}\r\n\r\n\t\tvar img = this._createImg(src, oldIcon && oldIcon.tagName === 'IMG' ? oldIcon : null);\r\n\t\tthis._setIconStyles(img, name);\r\n\r\n\t\treturn img;\r\n\t},\r\n\r\n\t_setIconStyles: function (img, name) {\r\n\t\tvar options = this.options;\r\n\t\tvar sizeOption = options[name + 'Size'];\r\n\r\n\t\tif (typeof sizeOption === 'number') {\r\n\t\t\tsizeOption = [sizeOption, sizeOption];\r\n\t\t}\r\n\r\n\t\tvar size = toPoint(sizeOption),\r\n\t\t anchor = toPoint(name === 'shadow' && options.shadowAnchor || options.iconAnchor ||\r\n\t\t size && size.divideBy(2, true));\r\n\r\n\t\timg.className = 'leaflet-marker-' + name + ' ' + (options.className || '');\r\n\r\n\t\tif (anchor) {\r\n\t\t\timg.style.marginLeft = (-anchor.x) + 'px';\r\n\t\t\timg.style.marginTop = (-anchor.y) + 'px';\r\n\t\t}\r\n\r\n\t\tif (size) {\r\n\t\t\timg.style.width = size.x + 'px';\r\n\t\t\timg.style.height = size.y + 'px';\r\n\t\t}\r\n\t},\r\n\r\n\t_createImg: function (src, el) {\r\n\t\tel = el || document.createElement('img');\r\n\t\tel.src = src;\r\n\t\treturn el;\r\n\t},\r\n\r\n\t_getIconUrl: function (name) {\r\n\t\treturn retina && this.options[name + 'RetinaUrl'] || this.options[name + 'Url'];\r\n\t}\r\n});\r\n\r\n\r\n// @factory L.icon(options: Icon options)\r\n// Creates an icon instance with the given options.\r\nfunction icon(options) {\r\n\treturn new Icon(options);\r\n}\n\n/*\n * @miniclass Icon.Default (Icon)\n * @aka L.Icon.Default\n * @section\n *\n * A trivial subclass of `Icon`, represents the icon to use in `Marker`s when\n * no icon is specified. Points to the blue marker image distributed with Leaflet\n * releases.\n *\n * In order to customize the default icon, just change the properties of `L.Icon.Default.prototype.options`\n * (which is a set of `Icon options`).\n *\n * If you want to _completely_ replace the default icon, override the\n * `L.Marker.prototype.options.icon` with your own icon instead.\n */\n\nvar IconDefault = Icon.extend({\n\n\toptions: {\n\t\ticonUrl: 'marker-icon.png',\n\t\ticonRetinaUrl: 'marker-icon-2x.png',\n\t\tshadowUrl: 'marker-shadow.png',\n\t\ticonSize: [25, 41],\n\t\ticonAnchor: [12, 41],\n\t\tpopupAnchor: [1, -34],\n\t\ttooltipAnchor: [16, -28],\n\t\tshadowSize: [41, 41]\n\t},\n\n\t_getIconUrl: function (name) {\n\t\tif (!IconDefault.imagePath) {\t// Deprecated, backwards-compatibility only\n\t\t\tIconDefault.imagePath = this._detectIconPath();\n\t\t}\n\n\t\t// @option imagePath: String\n\t\t// `Icon.Default` will try to auto-detect the location of the\n\t\t// blue icon images. If you are placing these images in a non-standard\n\t\t// way, set this option to point to the right path.\n\t\treturn (this.options.imagePath || IconDefault.imagePath) + Icon.prototype._getIconUrl.call(this, name);\n\t},\n\n\t_detectIconPath: function () {\n\t\tvar el = create$1('div', 'leaflet-default-icon-path', document.body);\n\t\tvar path = getStyle(el, 'background-image') ||\n\t\t getStyle(el, 'backgroundImage');\t// IE8\n\n\t\tdocument.body.removeChild(el);\n\n\t\tif (path === null || path.indexOf('url') !== 0) {\n\t\t\tpath = '';\n\t\t} else {\n\t\t\tpath = path.replace(/^url\\([\"']?/, '').replace(/marker-icon\\.png[\"']?\\)$/, '');\n\t\t}\n\n\t\treturn path;\n\t}\n});\n\n/*\n * L.Handler.MarkerDrag is used internally by L.Marker to make the markers draggable.\n */\n\n\n/* @namespace Marker\n * @section Interaction handlers\n *\n * Interaction handlers are properties of a marker instance that allow you to control interaction behavior in runtime, enabling or disabling certain features such as dragging (see `Handler` methods). Example:\n *\n * ```js\n * marker.dragging.disable();\n * ```\n *\n * @property dragging: Handler\n * Marker dragging handler (by both mouse and touch). Only valid when the marker is on the map (Otherwise set [`marker.options.draggable`](#marker-draggable)).\n */\n\nvar MarkerDrag = Handler.extend({\n\tinitialize: function (marker) {\n\t\tthis._marker = marker;\n\t},\n\n\taddHooks: function () {\n\t\tvar icon = this._marker._icon;\n\n\t\tif (!this._draggable) {\n\t\t\tthis._draggable = new Draggable(icon, icon, true);\n\t\t}\n\n\t\tthis._draggable.on({\n\t\t\tdragstart: this._onDragStart,\n\t\t\tpredrag: this._onPreDrag,\n\t\t\tdrag: this._onDrag,\n\t\t\tdragend: this._onDragEnd\n\t\t}, this).enable();\n\n\t\taddClass(icon, 'leaflet-marker-draggable');\n\t},\n\n\tremoveHooks: function () {\n\t\tthis._draggable.off({\n\t\t\tdragstart: this._onDragStart,\n\t\t\tpredrag: this._onPreDrag,\n\t\t\tdrag: this._onDrag,\n\t\t\tdragend: this._onDragEnd\n\t\t}, this).disable();\n\n\t\tif (this._marker._icon) {\n\t\t\tremoveClass(this._marker._icon, 'leaflet-marker-draggable');\n\t\t}\n\t},\n\n\tmoved: function () {\n\t\treturn this._draggable && this._draggable._moved;\n\t},\n\n\t_adjustPan: function (e) {\n\t\tvar marker = this._marker,\n\t\t map = marker._map,\n\t\t speed = this._marker.options.autoPanSpeed,\n\t\t padding = this._marker.options.autoPanPadding,\n\t\t iconPos = L.DomUtil.getPosition(marker._icon),\n\t\t bounds = map.getPixelBounds(),\n\t\t origin = map.getPixelOrigin();\n\n\t\tvar panBounds = toBounds(\n\t\t\tbounds.min._subtract(origin).add(padding),\n\t\t\tbounds.max._subtract(origin).subtract(padding)\n\t\t);\n\n\t\tif (!panBounds.contains(iconPos)) {\n\t\t\t// Compute incremental movement\n\t\t\tvar movement = toPoint(\n\t\t\t\t(Math.max(panBounds.max.x, iconPos.x) - panBounds.max.x) / (bounds.max.x - panBounds.max.x) -\n\t\t\t\t(Math.min(panBounds.min.x, iconPos.x) - panBounds.min.x) / (bounds.min.x - panBounds.min.x),\n\n\t\t\t\t(Math.max(panBounds.max.y, iconPos.y) - panBounds.max.y) / (bounds.max.y - panBounds.max.y) -\n\t\t\t\t(Math.min(panBounds.min.y, iconPos.y) - panBounds.min.y) / (bounds.min.y - panBounds.min.y)\n\t\t\t).multiplyBy(speed);\n\n\t\t\tmap.panBy(movement, {animate: false});\n\n\t\t\tthis._draggable._newPos._add(movement);\n\t\t\tthis._draggable._startPos._add(movement);\n\n\t\t\tL.DomUtil.setPosition(marker._icon, this._draggable._newPos);\n\t\t\tthis._onDrag(e);\n\n\t\t\tthis._panRequest = requestAnimFrame(this._adjustPan.bind(this, e));\n\t\t}\n\t},\n\n\t_onDragStart: function () {\n\t\t// @section Dragging events\n\t\t// @event dragstart: Event\n\t\t// Fired when the user starts dragging the marker.\n\n\t\t// @event movestart: Event\n\t\t// Fired when the marker starts moving (because of dragging).\n\n\t\tthis._oldLatLng = this._marker.getLatLng();\n\t\tthis._marker\n\t\t .closePopup()\n\t\t .fire('movestart')\n\t\t .fire('dragstart');\n\t},\n\n\t_onPreDrag: function (e) {\n\t\tif (this._marker.options.autoPan) {\n\t\t\tcancelAnimFrame(this._panRequest);\n\t\t\tthis._panRequest = requestAnimFrame(this._adjustPan.bind(this, e));\n\t\t}\n\t},\n\n\t_onDrag: function (e) {\n\t\tvar marker = this._marker,\n\t\t shadow = marker._shadow,\n\t\ticonPos = getPosition(marker._icon),\n\t\t latlng = marker._map.layerPointToLatLng(iconPos);\n\n\t\t// update shadow position\n\t\tif (shadow) {\n\t\t\tsetPosition(shadow, iconPos);\n\t\t}\n\n\t\tmarker._latlng = latlng;\n\t\te.latlng = latlng;\n\t\te.oldLatLng = this._oldLatLng;\n\n\t\t// @event drag: Event\n\t\t// Fired repeatedly while the user drags the marker.\n\t\tmarker\n\t\t .fire('move', e)\n\t\t .fire('drag', e);\n\t},\n\n\t_onDragEnd: function (e) {\n\t\t// @event dragend: DragEndEvent\n\t\t// Fired when the user stops dragging the marker.\n\n\t\t cancelAnimFrame(this._panRequest);\n\n\t\t// @event moveend: Event\n\t\t// Fired when the marker stops moving (because of dragging).\n\t\tdelete this._oldLatLng;\n\t\tthis._marker\n\t\t .fire('moveend')\n\t\t .fire('dragend', e);\n\t}\n});\n\n/*\r\n * @class Marker\r\n * @inherits Interactive layer\r\n * @aka L.Marker\r\n * L.Marker is used to display clickable/draggable icons on the map. Extends `Layer`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * L.marker([50.5, 30.5]).addTo(map);\r\n * ```\r\n */\r\n\r\nvar Marker = Layer.extend({\r\n\r\n\t// @section\r\n\t// @aka Marker options\r\n\toptions: {\r\n\t\t// @option icon: Icon = *\r\n\t\t// Icon instance to use for rendering the marker.\r\n\t\t// See [Icon documentation](#L.Icon) for details on how to customize the marker icon.\r\n\t\t// If not specified, a common instance of `L.Icon.Default` is used.\r\n\t\ticon: new IconDefault(),\r\n\r\n\t\t// Option inherited from \"Interactive layer\" abstract class\r\n\t\tinteractive: true,\r\n\r\n\t\t// @option draggable: Boolean = false\r\n\t\t// Whether the marker is draggable with mouse/touch or not.\r\n\t\tdraggable: false,\r\n\r\n\t\t// @option autoPan: Boolean = false\r\n\t\t// Set it to `true` if you want the map to do panning animation when marker hits the edges.\r\n\t\tautoPan: false,\r\n\r\n\t\t// @option autoPanPadding: Point = Point(50, 50)\r\n\t\t// Equivalent of setting both top left and bottom right autopan padding to the same value.\r\n\t\tautoPanPadding: [50, 50],\r\n\r\n\t\t// @option autoPanSpeed: Number = 10\r\n\t\t// Number of pixels the map should move by.\r\n\t\tautoPanSpeed: 10,\r\n\r\n\t\t// @option keyboard: Boolean = true\r\n\t\t// Whether the marker can be tabbed to with a keyboard and clicked by pressing enter.\r\n\t\tkeyboard: true,\r\n\r\n\t\t// @option title: String = ''\r\n\t\t// Text for the browser tooltip that appear on marker hover (no tooltip by default).\r\n\t\ttitle: '',\r\n\r\n\t\t// @option alt: String = ''\r\n\t\t// Text for the `alt` attribute of the icon image (useful for accessibility).\r\n\t\talt: '',\r\n\r\n\t\t// @option zIndexOffset: Number = 0\r\n\t\t// By default, marker images zIndex is set automatically based on its latitude. Use this option if you want to put the marker on top of all others (or below), specifying a high value like `1000` (or high negative value, respectively).\r\n\t\tzIndexOffset: 0,\r\n\r\n\t\t// @option opacity: Number = 1.0\r\n\t\t// The opacity of the marker.\r\n\t\topacity: 1,\r\n\r\n\t\t// @option riseOnHover: Boolean = false\r\n\t\t// If `true`, the marker will get on top of others when you hover the mouse over it.\r\n\t\triseOnHover: false,\r\n\r\n\t\t// @option riseOffset: Number = 250\r\n\t\t// The z-index offset used for the `riseOnHover` feature.\r\n\t\triseOffset: 250,\r\n\r\n\t\t// @option pane: String = 'markerPane'\r\n\t\t// `Map pane` where the markers icon will be added.\r\n\t\tpane: 'markerPane',\r\n\r\n\t\t// @option bubblingMouseEvents: Boolean = false\r\n\t\t// When `true`, a mouse event on this marker will trigger the same event on the map\r\n\t\t// (unless [`L.DomEvent.stopPropagation`](#domevent-stoppropagation) is used).\r\n\t\tbubblingMouseEvents: false\r\n\t},\r\n\r\n\t/* @section\r\n\t *\r\n\t * In addition to [shared layer methods](#Layer) like `addTo()` and `remove()` and [popup methods](#Popup) like bindPopup() you can also use the following methods:\r\n\t */\r\n\r\n\tinitialize: function (latlng, options) {\r\n\t\tsetOptions(this, options);\r\n\t\tthis._latlng = toLatLng(latlng);\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tthis._zoomAnimated = this._zoomAnimated && map.options.markerZoomAnimation;\r\n\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tmap.on('zoomanim', this._animateZoom, this);\r\n\t\t}\r\n\r\n\t\tthis._initIcon();\r\n\t\tthis.update();\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tif (this.dragging && this.dragging.enabled()) {\r\n\t\t\tthis.options.draggable = true;\r\n\t\t\tthis.dragging.removeHooks();\r\n\t\t}\r\n\t\tdelete this.dragging;\r\n\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tmap.off('zoomanim', this._animateZoom, this);\r\n\t\t}\r\n\r\n\t\tthis._removeIcon();\r\n\t\tthis._removeShadow();\r\n\t},\r\n\r\n\tgetEvents: function () {\r\n\t\treturn {\r\n\t\t\tzoom: this.update,\r\n\t\t\tviewreset: this.update\r\n\t\t};\r\n\t},\r\n\r\n\t// @method getLatLng: LatLng\r\n\t// Returns the current geographical position of the marker.\r\n\tgetLatLng: function () {\r\n\t\treturn this._latlng;\r\n\t},\r\n\r\n\t// @method setLatLng(latlng: LatLng): this\r\n\t// Changes the marker position to the given point.\r\n\tsetLatLng: function (latlng) {\r\n\t\tvar oldLatLng = this._latlng;\r\n\t\tthis._latlng = toLatLng(latlng);\r\n\t\tthis.update();\r\n\r\n\t\t// @event move: Event\r\n\t\t// Fired when the marker is moved via [`setLatLng`](#marker-setlatlng) or by [dragging](#marker-dragging). Old and new coordinates are included in event arguments as `oldLatLng`, `latlng`.\r\n\t\treturn this.fire('move', {oldLatLng: oldLatLng, latlng: this._latlng});\r\n\t},\r\n\r\n\t// @method setZIndexOffset(offset: Number): this\r\n\t// Changes the [zIndex offset](#marker-zindexoffset) of the marker.\r\n\tsetZIndexOffset: function (offset) {\r\n\t\tthis.options.zIndexOffset = offset;\r\n\t\treturn this.update();\r\n\t},\r\n\r\n\t// @method setIcon(icon: Icon): this\r\n\t// Changes the marker icon.\r\n\tsetIcon: function (icon) {\r\n\r\n\t\tthis.options.icon = icon;\r\n\r\n\t\tif (this._map) {\r\n\t\t\tthis._initIcon();\r\n\t\t\tthis.update();\r\n\t\t}\r\n\r\n\t\tif (this._popup) {\r\n\t\t\tthis.bindPopup(this._popup, this._popup.options);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\tgetElement: function () {\r\n\t\treturn this._icon;\r\n\t},\r\n\r\n\tupdate: function () {\r\n\r\n\t\tif (this._icon && this._map) {\r\n\t\t\tvar pos = this._map.latLngToLayerPoint(this._latlng).round();\r\n\t\t\tthis._setPos(pos);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_initIcon: function () {\r\n\t\tvar options = this.options,\r\n\t\t classToAdd = 'leaflet-zoom-' + (this._zoomAnimated ? 'animated' : 'hide');\r\n\r\n\t\tvar icon = options.icon.createIcon(this._icon),\r\n\t\t addIcon = false;\r\n\r\n\t\t// if we're not reusing the icon, remove the old one and init new one\r\n\t\tif (icon !== this._icon) {\r\n\t\t\tif (this._icon) {\r\n\t\t\t\tthis._removeIcon();\r\n\t\t\t}\r\n\t\t\taddIcon = true;\r\n\r\n\t\t\tif (options.title) {\r\n\t\t\t\ticon.title = options.title;\r\n\t\t\t}\r\n\r\n\t\t\tif (icon.tagName === 'IMG') {\r\n\t\t\t\ticon.alt = options.alt || '';\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\taddClass(icon, classToAdd);\r\n\r\n\t\tif (options.keyboard) {\r\n\t\t\ticon.tabIndex = '0';\r\n\t\t}\r\n\r\n\t\tthis._icon = icon;\r\n\r\n\t\tif (options.riseOnHover) {\r\n\t\t\tthis.on({\r\n\t\t\t\tmouseover: this._bringToFront,\r\n\t\t\t\tmouseout: this._resetZIndex\r\n\t\t\t});\r\n\t\t}\r\n\r\n\t\tvar newShadow = options.icon.createShadow(this._shadow),\r\n\t\t addShadow = false;\r\n\r\n\t\tif (newShadow !== this._shadow) {\r\n\t\t\tthis._removeShadow();\r\n\t\t\taddShadow = true;\r\n\t\t}\r\n\r\n\t\tif (newShadow) {\r\n\t\t\taddClass(newShadow, classToAdd);\r\n\t\t\tnewShadow.alt = '';\r\n\t\t}\r\n\t\tthis._shadow = newShadow;\r\n\r\n\r\n\t\tif (options.opacity < 1) {\r\n\t\t\tthis._updateOpacity();\r\n\t\t}\r\n\r\n\r\n\t\tif (addIcon) {\r\n\t\t\tthis.getPane().appendChild(this._icon);\r\n\t\t}\r\n\t\tthis._initInteraction();\r\n\t\tif (newShadow && addShadow) {\r\n\t\t\tthis.getPane('shadowPane').appendChild(this._shadow);\r\n\t\t}\r\n\t},\r\n\r\n\t_removeIcon: function () {\r\n\t\tif (this.options.riseOnHover) {\r\n\t\t\tthis.off({\r\n\t\t\t\tmouseover: this._bringToFront,\r\n\t\t\t\tmouseout: this._resetZIndex\r\n\t\t\t});\r\n\t\t}\r\n\r\n\t\tremove(this._icon);\r\n\t\tthis.removeInteractiveTarget(this._icon);\r\n\r\n\t\tthis._icon = null;\r\n\t},\r\n\r\n\t_removeShadow: function () {\r\n\t\tif (this._shadow) {\r\n\t\t\tremove(this._shadow);\r\n\t\t}\r\n\t\tthis._shadow = null;\r\n\t},\r\n\r\n\t_setPos: function (pos) {\r\n\t\tsetPosition(this._icon, pos);\r\n\r\n\t\tif (this._shadow) {\r\n\t\t\tsetPosition(this._shadow, pos);\r\n\t\t}\r\n\r\n\t\tthis._zIndex = pos.y + this.options.zIndexOffset;\r\n\r\n\t\tthis._resetZIndex();\r\n\t},\r\n\r\n\t_updateZIndex: function (offset) {\r\n\t\tthis._icon.style.zIndex = this._zIndex + offset;\r\n\t},\r\n\r\n\t_animateZoom: function (opt) {\r\n\t\tvar pos = this._map._latLngToNewLayerPoint(this._latlng, opt.zoom, opt.center).round();\r\n\r\n\t\tthis._setPos(pos);\r\n\t},\r\n\r\n\t_initInteraction: function () {\r\n\r\n\t\tif (!this.options.interactive) { return; }\r\n\r\n\t\taddClass(this._icon, 'leaflet-interactive');\r\n\r\n\t\tthis.addInteractiveTarget(this._icon);\r\n\r\n\t\tif (MarkerDrag) {\r\n\t\t\tvar draggable = this.options.draggable;\r\n\t\t\tif (this.dragging) {\r\n\t\t\t\tdraggable = this.dragging.enabled();\r\n\t\t\t\tthis.dragging.disable();\r\n\t\t\t}\r\n\r\n\t\t\tthis.dragging = new MarkerDrag(this);\r\n\r\n\t\t\tif (draggable) {\r\n\t\t\t\tthis.dragging.enable();\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\t// @method setOpacity(opacity: Number): this\r\n\t// Changes the opacity of the marker.\r\n\tsetOpacity: function (opacity) {\r\n\t\tthis.options.opacity = opacity;\r\n\t\tif (this._map) {\r\n\t\t\tthis._updateOpacity();\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_updateOpacity: function () {\r\n\t\tvar opacity = this.options.opacity;\r\n\r\n\t\tsetOpacity(this._icon, opacity);\r\n\r\n\t\tif (this._shadow) {\r\n\t\t\tsetOpacity(this._shadow, opacity);\r\n\t\t}\r\n\t},\r\n\r\n\t_bringToFront: function () {\r\n\t\tthis._updateZIndex(this.options.riseOffset);\r\n\t},\r\n\r\n\t_resetZIndex: function () {\r\n\t\tthis._updateZIndex(0);\r\n\t},\r\n\r\n\t_getPopupAnchor: function () {\r\n\t\treturn this.options.icon.options.popupAnchor;\r\n\t},\r\n\r\n\t_getTooltipAnchor: function () {\r\n\t\treturn this.options.icon.options.tooltipAnchor;\r\n\t}\r\n});\r\n\r\n\r\n// factory L.marker(latlng: LatLng, options? : Marker options)\r\n\r\n// @factory L.marker(latlng: LatLng, options? : Marker options)\r\n// Instantiates a Marker object given a geographical point and optionally an options object.\r\nfunction marker(latlng, options) {\r\n\treturn new Marker(latlng, options);\r\n}\n\n/*\n * @class Path\n * @aka L.Path\n * @inherits Interactive layer\n *\n * An abstract class that contains options and constants shared between vector\n * overlays (Polygon, Polyline, Circle). Do not use it directly. Extends `Layer`.\n */\n\nvar Path = Layer.extend({\n\n\t// @section\n\t// @aka Path options\n\toptions: {\n\t\t// @option stroke: Boolean = true\n\t\t// Whether to draw stroke along the path. Set it to `false` to disable borders on polygons or circles.\n\t\tstroke: true,\n\n\t\t// @option color: String = '#3388ff'\n\t\t// Stroke color\n\t\tcolor: '#3388ff',\n\n\t\t// @option weight: Number = 3\n\t\t// Stroke width in pixels\n\t\tweight: 3,\n\n\t\t// @option opacity: Number = 1.0\n\t\t// Stroke opacity\n\t\topacity: 1,\n\n\t\t// @option lineCap: String= 'round'\n\t\t// A string that defines [shape to be used at the end](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-linecap) of the stroke.\n\t\tlineCap: 'round',\n\n\t\t// @option lineJoin: String = 'round'\n\t\t// A string that defines [shape to be used at the corners](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-linejoin) of the stroke.\n\t\tlineJoin: 'round',\n\n\t\t// @option dashArray: String = null\n\t\t// A string that defines the stroke [dash pattern](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-dasharray). Doesn't work on `Canvas`-powered layers in [some old browsers](https://developer.mozilla.org/docs/Web/API/CanvasRenderingContext2D/setLineDash#Browser_compatibility).\n\t\tdashArray: null,\n\n\t\t// @option dashOffset: String = null\n\t\t// A string that defines the [distance into the dash pattern to start the dash](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-dashoffset). Doesn't work on `Canvas`-powered layers in [some old browsers](https://developer.mozilla.org/docs/Web/API/CanvasRenderingContext2D/setLineDash#Browser_compatibility).\n\t\tdashOffset: null,\n\n\t\t// @option fill: Boolean = depends\n\t\t// Whether to fill the path with color. Set it to `false` to disable filling on polygons or circles.\n\t\tfill: false,\n\n\t\t// @option fillColor: String = *\n\t\t// Fill color. Defaults to the value of the [`color`](#path-color) option\n\t\tfillColor: null,\n\n\t\t// @option fillOpacity: Number = 0.2\n\t\t// Fill opacity.\n\t\tfillOpacity: 0.2,\n\n\t\t// @option fillRule: String = 'evenodd'\n\t\t// A string that defines [how the inside of a shape](https://developer.mozilla.org/docs/Web/SVG/Attribute/fill-rule) is determined.\n\t\tfillRule: 'evenodd',\n\n\t\t// className: '',\n\n\t\t// Option inherited from \"Interactive layer\" abstract class\n\t\tinteractive: true,\n\n\t\t// @option bubblingMouseEvents: Boolean = true\n\t\t// When `true`, a mouse event on this path will trigger the same event on the map\n\t\t// (unless [`L.DomEvent.stopPropagation`](#domevent-stoppropagation) is used).\n\t\tbubblingMouseEvents: true\n\t},\n\n\tbeforeAdd: function (map) {\n\t\t// Renderer is set here because we need to call renderer.getEvents\n\t\t// before this.getEvents.\n\t\tthis._renderer = map.getRenderer(this);\n\t},\n\n\tonAdd: function () {\n\t\tthis._renderer._initPath(this);\n\t\tthis._reset();\n\t\tthis._renderer._addPath(this);\n\t},\n\n\tonRemove: function () {\n\t\tthis._renderer._removePath(this);\n\t},\n\n\t// @method redraw(): this\n\t// Redraws the layer. Sometimes useful after you changed the coordinates that the path uses.\n\tredraw: function () {\n\t\tif (this._map) {\n\t\t\tthis._renderer._updatePath(this);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method setStyle(style: Path options): this\n\t// Changes the appearance of a Path based on the options in the `Path options` object.\n\tsetStyle: function (style) {\n\t\tsetOptions(this, style);\n\t\tif (this._renderer) {\n\t\t\tthis._renderer._updateStyle(this);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method bringToFront(): this\n\t// Brings the layer to the top of all path layers.\n\tbringToFront: function () {\n\t\tif (this._renderer) {\n\t\t\tthis._renderer._bringToFront(this);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method bringToBack(): this\n\t// Brings the layer to the bottom of all path layers.\n\tbringToBack: function () {\n\t\tif (this._renderer) {\n\t\t\tthis._renderer._bringToBack(this);\n\t\t}\n\t\treturn this;\n\t},\n\n\tgetElement: function () {\n\t\treturn this._path;\n\t},\n\n\t_reset: function () {\n\t\t// defined in child classes\n\t\tthis._project();\n\t\tthis._update();\n\t},\n\n\t_clickTolerance: function () {\n\t\t// used when doing hit detection for Canvas layers\n\t\treturn (this.options.stroke ? this.options.weight / 2 : 0) + this._renderer.options.tolerance;\n\t}\n});\n\n/*\n * @class CircleMarker\n * @aka L.CircleMarker\n * @inherits Path\n *\n * A circle of a fixed size with radius specified in pixels. Extends `Path`.\n */\n\nvar CircleMarker = Path.extend({\n\n\t// @section\n\t// @aka CircleMarker options\n\toptions: {\n\t\tfill: true,\n\n\t\t// @option radius: Number = 10\n\t\t// Radius of the circle marker, in pixels\n\t\tradius: 10\n\t},\n\n\tinitialize: function (latlng, options) {\n\t\tsetOptions(this, options);\n\t\tthis._latlng = toLatLng(latlng);\n\t\tthis._radius = this.options.radius;\n\t},\n\n\t// @method setLatLng(latLng: LatLng): this\n\t// Sets the position of a circle marker to a new location.\n\tsetLatLng: function (latlng) {\n\t\tthis._latlng = toLatLng(latlng);\n\t\tthis.redraw();\n\t\treturn this.fire('move', {latlng: this._latlng});\n\t},\n\n\t// @method getLatLng(): LatLng\n\t// Returns the current geographical position of the circle marker\n\tgetLatLng: function () {\n\t\treturn this._latlng;\n\t},\n\n\t// @method setRadius(radius: Number): this\n\t// Sets the radius of a circle marker. Units are in pixels.\n\tsetRadius: function (radius) {\n\t\tthis.options.radius = this._radius = radius;\n\t\treturn this.redraw();\n\t},\n\n\t// @method getRadius(): Number\n\t// Returns the current radius of the circle\n\tgetRadius: function () {\n\t\treturn this._radius;\n\t},\n\n\tsetStyle : function (options) {\n\t\tvar radius = options && options.radius || this._radius;\n\t\tPath.prototype.setStyle.call(this, options);\n\t\tthis.setRadius(radius);\n\t\treturn this;\n\t},\n\n\t_project: function () {\n\t\tthis._point = this._map.latLngToLayerPoint(this._latlng);\n\t\tthis._updateBounds();\n\t},\n\n\t_updateBounds: function () {\n\t\tvar r = this._radius,\n\t\t r2 = this._radiusY || r,\n\t\t w = this._clickTolerance(),\n\t\t p = [r + w, r2 + w];\n\t\tthis._pxBounds = new Bounds(this._point.subtract(p), this._point.add(p));\n\t},\n\n\t_update: function () {\n\t\tif (this._map) {\n\t\t\tthis._updatePath();\n\t\t}\n\t},\n\n\t_updatePath: function () {\n\t\tthis._renderer._updateCircle(this);\n\t},\n\n\t_empty: function () {\n\t\treturn this._radius && !this._renderer._bounds.intersects(this._pxBounds);\n\t},\n\n\t// Needed by the `Canvas` renderer for interactivity\n\t_containsPoint: function (p) {\n\t\treturn p.distanceTo(this._point) <= this._radius + this._clickTolerance();\n\t}\n});\n\n\n// @factory L.circleMarker(latlng: LatLng, options?: CircleMarker options)\n// Instantiates a circle marker object given a geographical point, and an optional options object.\nfunction circleMarker(latlng, options) {\n\treturn new CircleMarker(latlng, options);\n}\n\n/*\n * @class Circle\n * @aka L.Circle\n * @inherits CircleMarker\n *\n * A class for drawing circle overlays on a map. Extends `CircleMarker`.\n *\n * It's an approximation and starts to diverge from a real circle closer to poles (due to projection distortion).\n *\n * @example\n *\n * ```js\n * L.circle([50.5, 30.5], {radius: 200}).addTo(map);\n * ```\n */\n\nvar Circle = CircleMarker.extend({\n\n\tinitialize: function (latlng, options, legacyOptions) {\n\t\tif (typeof options === 'number') {\n\t\t\t// Backwards compatibility with 0.7.x factory (latlng, radius, options?)\n\t\t\toptions = extend({}, legacyOptions, {radius: options});\n\t\t}\n\t\tsetOptions(this, options);\n\t\tthis._latlng = toLatLng(latlng);\n\n\t\tif (isNaN(this.options.radius)) { throw new Error('Circle radius cannot be NaN'); }\n\n\t\t// @section\n\t\t// @aka Circle options\n\t\t// @option radius: Number; Radius of the circle, in meters.\n\t\tthis._mRadius = this.options.radius;\n\t},\n\n\t// @method setRadius(radius: Number): this\n\t// Sets the radius of a circle. Units are in meters.\n\tsetRadius: function (radius) {\n\t\tthis._mRadius = radius;\n\t\treturn this.redraw();\n\t},\n\n\t// @method getRadius(): Number\n\t// Returns the current radius of a circle. Units are in meters.\n\tgetRadius: function () {\n\t\treturn this._mRadius;\n\t},\n\n\t// @method getBounds(): LatLngBounds\n\t// Returns the `LatLngBounds` of the path.\n\tgetBounds: function () {\n\t\tvar half = [this._radius, this._radiusY || this._radius];\n\n\t\treturn new LatLngBounds(\n\t\t\tthis._map.layerPointToLatLng(this._point.subtract(half)),\n\t\t\tthis._map.layerPointToLatLng(this._point.add(half)));\n\t},\n\n\tsetStyle: Path.prototype.setStyle,\n\n\t_project: function () {\n\n\t\tvar lng = this._latlng.lng,\n\t\t lat = this._latlng.lat,\n\t\t map = this._map,\n\t\t crs = map.options.crs;\n\n\t\tif (crs.distance === Earth.distance) {\n\t\t\tvar d = Math.PI / 180,\n\t\t\t latR = (this._mRadius / Earth.R) / d,\n\t\t\t top = map.project([lat + latR, lng]),\n\t\t\t bottom = map.project([lat - latR, lng]),\n\t\t\t p = top.add(bottom).divideBy(2),\n\t\t\t lat2 = map.unproject(p).lat,\n\t\t\t lngR = Math.acos((Math.cos(latR * d) - Math.sin(lat * d) * Math.sin(lat2 * d)) /\n\t\t\t (Math.cos(lat * d) * Math.cos(lat2 * d))) / d;\n\n\t\t\tif (isNaN(lngR) || lngR === 0) {\n\t\t\t\tlngR = latR / Math.cos(Math.PI / 180 * lat); // Fallback for edge case, #2425\n\t\t\t}\n\n\t\t\tthis._point = p.subtract(map.getPixelOrigin());\n\t\t\tthis._radius = isNaN(lngR) ? 0 : p.x - map.project([lat2, lng - lngR]).x;\n\t\t\tthis._radiusY = p.y - top.y;\n\n\t\t} else {\n\t\t\tvar latlng2 = crs.unproject(crs.project(this._latlng).subtract([this._mRadius, 0]));\n\n\t\t\tthis._point = map.latLngToLayerPoint(this._latlng);\n\t\t\tthis._radius = this._point.x - map.latLngToLayerPoint(latlng2).x;\n\t\t}\n\n\t\tthis._updateBounds();\n\t}\n});\n\n// @factory L.circle(latlng: LatLng, options?: Circle options)\n// Instantiates a circle object given a geographical point, and an options object\n// which contains the circle radius.\n// @alternative\n// @factory L.circle(latlng: LatLng, radius: Number, options?: Circle options)\n// Obsolete way of instantiating a circle, for compatibility with 0.7.x code.\n// Do not use in new applications or plugins.\nfunction circle(latlng, options, legacyOptions) {\n\treturn new Circle(latlng, options, legacyOptions);\n}\n\n/*\n * @class Polyline\n * @aka L.Polyline\n * @inherits Path\n *\n * A class for drawing polyline overlays on a map. Extends `Path`.\n *\n * @example\n *\n * ```js\n * // create a red polyline from an array of LatLng points\n * var latlngs = [\n * \t[45.51, -122.68],\n * \t[37.77, -122.43],\n * \t[34.04, -118.2]\n * ];\n *\n * var polyline = L.polyline(latlngs, {color: 'red'}).addTo(map);\n *\n * // zoom the map to the polyline\n * map.fitBounds(polyline.getBounds());\n * ```\n *\n * You can also pass a multi-dimensional array to represent a `MultiPolyline` shape:\n *\n * ```js\n * // create a red polyline from an array of arrays of LatLng points\n * var latlngs = [\n * \t[[45.51, -122.68],\n * \t [37.77, -122.43],\n * \t [34.04, -118.2]],\n * \t[[40.78, -73.91],\n * \t [41.83, -87.62],\n * \t [32.76, -96.72]]\n * ];\n * ```\n */\n\n\nvar Polyline = Path.extend({\n\n\t// @section\n\t// @aka Polyline options\n\toptions: {\n\t\t// @option smoothFactor: Number = 1.0\n\t\t// How much to simplify the polyline on each zoom level. More means\n\t\t// better performance and smoother look, and less means more accurate representation.\n\t\tsmoothFactor: 1.0,\n\n\t\t// @option noClip: Boolean = false\n\t\t// Disable polyline clipping.\n\t\tnoClip: false\n\t},\n\n\tinitialize: function (latlngs, options) {\n\t\tsetOptions(this, options);\n\t\tthis._setLatLngs(latlngs);\n\t},\n\n\t// @method getLatLngs(): LatLng[]\n\t// Returns an array of the points in the path, or nested arrays of points in case of multi-polyline.\n\tgetLatLngs: function () {\n\t\treturn this._latlngs;\n\t},\n\n\t// @method setLatLngs(latlngs: LatLng[]): this\n\t// Replaces all the points in the polyline with the given array of geographical points.\n\tsetLatLngs: function (latlngs) {\n\t\tthis._setLatLngs(latlngs);\n\t\treturn this.redraw();\n\t},\n\n\t// @method isEmpty(): Boolean\n\t// Returns `true` if the Polyline has no LatLngs.\n\tisEmpty: function () {\n\t\treturn !this._latlngs.length;\n\t},\n\n\t// @method closestLayerPoint: Point\n\t// Returns the point closest to `p` on the Polyline.\n\tclosestLayerPoint: function (p) {\n\t\tvar minDistance = Infinity,\n\t\t minPoint = null,\n\t\t closest = _sqClosestPointOnSegment,\n\t\t p1, p2;\n\n\t\tfor (var j = 0, jLen = this._parts.length; j < jLen; j++) {\n\t\t\tvar points = this._parts[j];\n\n\t\t\tfor (var i = 1, len = points.length; i < len; i++) {\n\t\t\t\tp1 = points[i - 1];\n\t\t\t\tp2 = points[i];\n\n\t\t\t\tvar sqDist = closest(p, p1, p2, true);\n\n\t\t\t\tif (sqDist < minDistance) {\n\t\t\t\t\tminDistance = sqDist;\n\t\t\t\t\tminPoint = closest(p, p1, p2);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\tif (minPoint) {\n\t\t\tminPoint.distance = Math.sqrt(minDistance);\n\t\t}\n\t\treturn minPoint;\n\t},\n\n\t// @method getCenter(): LatLng\n\t// Returns the center ([centroid](http://en.wikipedia.org/wiki/Centroid)) of the polyline.\n\tgetCenter: function () {\n\t\t// throws error when not yet added to map as this center calculation requires projected coordinates\n\t\tif (!this._map) {\n\t\t\tthrow new Error('Must add layer to map before using getCenter()');\n\t\t}\n\n\t\tvar i, halfDist, segDist, dist, p1, p2, ratio,\n\t\t points = this._rings[0],\n\t\t len = points.length;\n\n\t\tif (!len) { return null; }\n\n\t\t// polyline centroid algorithm; only uses the first ring if there are multiple\n\n\t\tfor (i = 0, halfDist = 0; i < len - 1; i++) {\n\t\t\thalfDist += points[i].distanceTo(points[i + 1]) / 2;\n\t\t}\n\n\t\t// The line is so small in the current view that all points are on the same pixel.\n\t\tif (halfDist === 0) {\n\t\t\treturn this._map.layerPointToLatLng(points[0]);\n\t\t}\n\n\t\tfor (i = 0, dist = 0; i < len - 1; i++) {\n\t\t\tp1 = points[i];\n\t\t\tp2 = points[i + 1];\n\t\t\tsegDist = p1.distanceTo(p2);\n\t\t\tdist += segDist;\n\n\t\t\tif (dist > halfDist) {\n\t\t\t\tratio = (dist - halfDist) / segDist;\n\t\t\t\treturn this._map.layerPointToLatLng([\n\t\t\t\t\tp2.x - ratio * (p2.x - p1.x),\n\t\t\t\t\tp2.y - ratio * (p2.y - p1.y)\n\t\t\t\t]);\n\t\t\t}\n\t\t}\n\t},\n\n\t// @method getBounds(): LatLngBounds\n\t// Returns the `LatLngBounds` of the path.\n\tgetBounds: function () {\n\t\treturn this._bounds;\n\t},\n\n\t// @method addLatLng(latlng: LatLng, latlngs? LatLng[]): this\n\t// Adds a given point to the polyline. By default, adds to the first ring of\n\t// the polyline in case of a multi-polyline, but can be overridden by passing\n\t// a specific ring as a LatLng array (that you can earlier access with [`getLatLngs`](#polyline-getlatlngs)).\n\taddLatLng: function (latlng, latlngs) {\n\t\tlatlngs = latlngs || this._defaultShape();\n\t\tlatlng = toLatLng(latlng);\n\t\tlatlngs.push(latlng);\n\t\tthis._bounds.extend(latlng);\n\t\treturn this.redraw();\n\t},\n\n\t_setLatLngs: function (latlngs) {\n\t\tthis._bounds = new LatLngBounds();\n\t\tthis._latlngs = this._convertLatLngs(latlngs);\n\t},\n\n\t_defaultShape: function () {\n\t\treturn isFlat(this._latlngs) ? this._latlngs : this._latlngs[0];\n\t},\n\n\t// recursively convert latlngs input into actual LatLng instances; calculate bounds along the way\n\t_convertLatLngs: function (latlngs) {\n\t\tvar result = [],\n\t\t flat = isFlat(latlngs);\n\n\t\tfor (var i = 0, len = latlngs.length; i < len; i++) {\n\t\t\tif (flat) {\n\t\t\t\tresult[i] = toLatLng(latlngs[i]);\n\t\t\t\tthis._bounds.extend(result[i]);\n\t\t\t} else {\n\t\t\t\tresult[i] = this._convertLatLngs(latlngs[i]);\n\t\t\t}\n\t\t}\n\n\t\treturn result;\n\t},\n\n\t_project: function () {\n\t\tvar pxBounds = new Bounds();\n\t\tthis._rings = [];\n\t\tthis._projectLatlngs(this._latlngs, this._rings, pxBounds);\n\n\t\tvar w = this._clickTolerance(),\n\t\t p = new Point(w, w);\n\n\t\tif (this._bounds.isValid() && pxBounds.isValid()) {\n\t\t\tpxBounds.min._subtract(p);\n\t\t\tpxBounds.max._add(p);\n\t\t\tthis._pxBounds = pxBounds;\n\t\t}\n\t},\n\n\t// recursively turns latlngs into a set of rings with projected coordinates\n\t_projectLatlngs: function (latlngs, result, projectedBounds) {\n\t\tvar flat = latlngs[0] instanceof LatLng,\n\t\t len = latlngs.length,\n\t\t i, ring;\n\n\t\tif (flat) {\n\t\t\tring = [];\n\t\t\tfor (i = 0; i < len; i++) {\n\t\t\t\tring[i] = this._map.latLngToLayerPoint(latlngs[i]);\n\t\t\t\tprojectedBounds.extend(ring[i]);\n\t\t\t}\n\t\t\tresult.push(ring);\n\t\t} else {\n\t\t\tfor (i = 0; i < len; i++) {\n\t\t\t\tthis._projectLatlngs(latlngs[i], result, projectedBounds);\n\t\t\t}\n\t\t}\n\t},\n\n\t// clip polyline by renderer bounds so that we have less to render for performance\n\t_clipPoints: function () {\n\t\tvar bounds = this._renderer._bounds;\n\n\t\tthis._parts = [];\n\t\tif (!this._pxBounds || !this._pxBounds.intersects(bounds)) {\n\t\t\treturn;\n\t\t}\n\n\t\tif (this.options.noClip) {\n\t\t\tthis._parts = this._rings;\n\t\t\treturn;\n\t\t}\n\n\t\tvar parts = this._parts,\n\t\t i, j, k, len, len2, segment, points;\n\n\t\tfor (i = 0, k = 0, len = this._rings.length; i < len; i++) {\n\t\t\tpoints = this._rings[i];\n\n\t\t\tfor (j = 0, len2 = points.length; j < len2 - 1; j++) {\n\t\t\t\tsegment = clipSegment(points[j], points[j + 1], bounds, j, true);\n\n\t\t\t\tif (!segment) { continue; }\n\n\t\t\t\tparts[k] = parts[k] || [];\n\t\t\t\tparts[k].push(segment[0]);\n\n\t\t\t\t// if segment goes out of screen, or it's the last one, it's the end of the line part\n\t\t\t\tif ((segment[1] !== points[j + 1]) || (j === len2 - 2)) {\n\t\t\t\t\tparts[k].push(segment[1]);\n\t\t\t\t\tk++;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t},\n\n\t// simplify each clipped part of the polyline for performance\n\t_simplifyPoints: function () {\n\t\tvar parts = this._parts,\n\t\t tolerance = this.options.smoothFactor;\n\n\t\tfor (var i = 0, len = parts.length; i < len; i++) {\n\t\t\tparts[i] = simplify(parts[i], tolerance);\n\t\t}\n\t},\n\n\t_update: function () {\n\t\tif (!this._map) { return; }\n\n\t\tthis._clipPoints();\n\t\tthis._simplifyPoints();\n\t\tthis._updatePath();\n\t},\n\n\t_updatePath: function () {\n\t\tthis._renderer._updatePoly(this);\n\t},\n\n\t// Needed by the `Canvas` renderer for interactivity\n\t_containsPoint: function (p, closed) {\n\t\tvar i, j, k, len, len2, part,\n\t\t w = this._clickTolerance();\n\n\t\tif (!this._pxBounds || !this._pxBounds.contains(p)) { return false; }\n\n\t\t// hit detection for polylines\n\t\tfor (i = 0, len = this._parts.length; i < len; i++) {\n\t\t\tpart = this._parts[i];\n\n\t\t\tfor (j = 0, len2 = part.length, k = len2 - 1; j < len2; k = j++) {\n\t\t\t\tif (!closed && (j === 0)) { continue; }\n\n\t\t\t\tif (pointToSegmentDistance(p, part[k], part[j]) <= w) {\n\t\t\t\t\treturn true;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\treturn false;\n\t}\n});\n\n// @factory L.polyline(latlngs: LatLng[], options?: Polyline options)\n// Instantiates a polyline object given an array of geographical points and\n// optionally an options object. You can create a `Polyline` object with\n// multiple separate lines (`MultiPolyline`) by passing an array of arrays\n// of geographic points.\nfunction polyline(latlngs, options) {\n\treturn new Polyline(latlngs, options);\n}\n\n// Retrocompat. Allow plugins to support Leaflet versions before and after 1.1.\nPolyline._flat = _flat;\n\n/*\n * @class Polygon\n * @aka L.Polygon\n * @inherits Polyline\n *\n * A class for drawing polygon overlays on a map. Extends `Polyline`.\n *\n * Note that points you pass when creating a polygon shouldn't have an additional last point equal to the first one — it's better to filter out such points.\n *\n *\n * @example\n *\n * ```js\n * // create a red polygon from an array of LatLng points\n * var latlngs = [[37, -109.05],[41, -109.03],[41, -102.05],[37, -102.04]];\n *\n * var polygon = L.polygon(latlngs, {color: 'red'}).addTo(map);\n *\n * // zoom the map to the polygon\n * map.fitBounds(polygon.getBounds());\n * ```\n *\n * You can also pass an array of arrays of latlngs, with the first array representing the outer shape and the other arrays representing holes in the outer shape:\n *\n * ```js\n * var latlngs = [\n * [[37, -109.05],[41, -109.03],[41, -102.05],[37, -102.04]], // outer ring\n * [[37.29, -108.58],[40.71, -108.58],[40.71, -102.50],[37.29, -102.50]] // hole\n * ];\n * ```\n *\n * Additionally, you can pass a multi-dimensional array to represent a MultiPolygon shape.\n *\n * ```js\n * var latlngs = [\n * [ // first polygon\n * [[37, -109.05],[41, -109.03],[41, -102.05],[37, -102.04]], // outer ring\n * [[37.29, -108.58],[40.71, -108.58],[40.71, -102.50],[37.29, -102.50]] // hole\n * ],\n * [ // second polygon\n * [[41, -111.03],[45, -111.04],[45, -104.05],[41, -104.05]]\n * ]\n * ];\n * ```\n */\n\nvar Polygon = Polyline.extend({\n\n\toptions: {\n\t\tfill: true\n\t},\n\n\tisEmpty: function () {\n\t\treturn !this._latlngs.length || !this._latlngs[0].length;\n\t},\n\n\tgetCenter: function () {\n\t\t// throws error when not yet added to map as this center calculation requires projected coordinates\n\t\tif (!this._map) {\n\t\t\tthrow new Error('Must add layer to map before using getCenter()');\n\t\t}\n\n\t\tvar i, j, p1, p2, f, area, x, y, center,\n\t\t points = this._rings[0],\n\t\t len = points.length;\n\n\t\tif (!len) { return null; }\n\n\t\t// polygon centroid algorithm; only uses the first ring if there are multiple\n\n\t\tarea = x = y = 0;\n\n\t\tfor (i = 0, j = len - 1; i < len; j = i++) {\n\t\t\tp1 = points[i];\n\t\t\tp2 = points[j];\n\n\t\t\tf = p1.y * p2.x - p2.y * p1.x;\n\t\t\tx += (p1.x + p2.x) * f;\n\t\t\ty += (p1.y + p2.y) * f;\n\t\t\tarea += f * 3;\n\t\t}\n\n\t\tif (area === 0) {\n\t\t\t// Polygon is so small that all points are on same pixel.\n\t\t\tcenter = points[0];\n\t\t} else {\n\t\t\tcenter = [x / area, y / area];\n\t\t}\n\t\treturn this._map.layerPointToLatLng(center);\n\t},\n\n\t_convertLatLngs: function (latlngs) {\n\t\tvar result = Polyline.prototype._convertLatLngs.call(this, latlngs),\n\t\t len = result.length;\n\n\t\t// remove last point if it equals first one\n\t\tif (len >= 2 && result[0] instanceof LatLng && result[0].equals(result[len - 1])) {\n\t\t\tresult.pop();\n\t\t}\n\t\treturn result;\n\t},\n\n\t_setLatLngs: function (latlngs) {\n\t\tPolyline.prototype._setLatLngs.call(this, latlngs);\n\t\tif (isFlat(this._latlngs)) {\n\t\t\tthis._latlngs = [this._latlngs];\n\t\t}\n\t},\n\n\t_defaultShape: function () {\n\t\treturn isFlat(this._latlngs[0]) ? this._latlngs[0] : this._latlngs[0][0];\n\t},\n\n\t_clipPoints: function () {\n\t\t// polygons need a different clipping algorithm so we redefine that\n\n\t\tvar bounds = this._renderer._bounds,\n\t\t w = this.options.weight,\n\t\t p = new Point(w, w);\n\n\t\t// increase clip padding by stroke width to avoid stroke on clip edges\n\t\tbounds = new Bounds(bounds.min.subtract(p), bounds.max.add(p));\n\n\t\tthis._parts = [];\n\t\tif (!this._pxBounds || !this._pxBounds.intersects(bounds)) {\n\t\t\treturn;\n\t\t}\n\n\t\tif (this.options.noClip) {\n\t\t\tthis._parts = this._rings;\n\t\t\treturn;\n\t\t}\n\n\t\tfor (var i = 0, len = this._rings.length, clipped; i < len; i++) {\n\t\t\tclipped = clipPolygon(this._rings[i], bounds, true);\n\t\t\tif (clipped.length) {\n\t\t\t\tthis._parts.push(clipped);\n\t\t\t}\n\t\t}\n\t},\n\n\t_updatePath: function () {\n\t\tthis._renderer._updatePoly(this, true);\n\t},\n\n\t// Needed by the `Canvas` renderer for interactivity\n\t_containsPoint: function (p) {\n\t\tvar inside = false,\n\t\t part, p1, p2, i, j, k, len, len2;\n\n\t\tif (!this._pxBounds.contains(p)) { return false; }\n\n\t\t// ray casting algorithm for detecting if point is in polygon\n\t\tfor (i = 0, len = this._parts.length; i < len; i++) {\n\t\t\tpart = this._parts[i];\n\n\t\t\tfor (j = 0, len2 = part.length, k = len2 - 1; j < len2; k = j++) {\n\t\t\t\tp1 = part[j];\n\t\t\t\tp2 = part[k];\n\n\t\t\t\tif (((p1.y > p.y) !== (p2.y > p.y)) && (p.x < (p2.x - p1.x) * (p.y - p1.y) / (p2.y - p1.y) + p1.x)) {\n\t\t\t\t\tinside = !inside;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// also check if it's on polygon stroke\n\t\treturn inside || Polyline.prototype._containsPoint.call(this, p, true);\n\t}\n\n});\n\n\n// @factory L.polygon(latlngs: LatLng[], options?: Polyline options)\nfunction polygon(latlngs, options) {\n\treturn new Polygon(latlngs, options);\n}\n\n/*\r\n * @class GeoJSON\r\n * @aka L.GeoJSON\r\n * @inherits FeatureGroup\r\n *\r\n * Represents a GeoJSON object or an array of GeoJSON objects. Allows you to parse\r\n * GeoJSON data and display it on the map. Extends `FeatureGroup`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * L.geoJSON(data, {\r\n * \tstyle: function (feature) {\r\n * \t\treturn {color: feature.properties.color};\r\n * \t}\r\n * }).bindPopup(function (layer) {\r\n * \treturn layer.feature.properties.description;\r\n * }).addTo(map);\r\n * ```\r\n */\r\n\r\nvar GeoJSON = FeatureGroup.extend({\r\n\r\n\t/* @section\r\n\t * @aka GeoJSON options\r\n\t *\r\n\t * @option pointToLayer: Function = *\r\n\t * A `Function` defining how GeoJSON points spawn Leaflet layers. It is internally\r\n\t * called when data is added, passing the GeoJSON point feature and its `LatLng`.\r\n\t * The default is to spawn a default `Marker`:\r\n\t * ```js\r\n\t * function(geoJsonPoint, latlng) {\r\n\t * \treturn L.marker(latlng);\r\n\t * }\r\n\t * ```\r\n\t *\r\n\t * @option style: Function = *\r\n\t * A `Function` defining the `Path options` for styling GeoJSON lines and polygons,\r\n\t * called internally when data is added.\r\n\t * The default value is to not override any defaults:\r\n\t * ```js\r\n\t * function (geoJsonFeature) {\r\n\t * \treturn {}\r\n\t * }\r\n\t * ```\r\n\t *\r\n\t * @option onEachFeature: Function = *\r\n\t * A `Function` that will be called once for each created `Feature`, after it has\r\n\t * been created and styled. Useful for attaching events and popups to features.\r\n\t * The default is to do nothing with the newly created layers:\r\n\t * ```js\r\n\t * function (feature, layer) {}\r\n\t * ```\r\n\t *\r\n\t * @option filter: Function = *\r\n\t * A `Function` that will be used to decide whether to include a feature or not.\r\n\t * The default is to include all features:\r\n\t * ```js\r\n\t * function (geoJsonFeature) {\r\n\t * \treturn true;\r\n\t * }\r\n\t * ```\r\n\t * Note: dynamically changing the `filter` option will have effect only on newly\r\n\t * added data. It will _not_ re-evaluate already included features.\r\n\t *\r\n\t * @option coordsToLatLng: Function = *\r\n\t * A `Function` that will be used for converting GeoJSON coordinates to `LatLng`s.\r\n\t * The default is the `coordsToLatLng` static method.\r\n\t */\r\n\r\n\tinitialize: function (geojson, options) {\r\n\t\tsetOptions(this, options);\r\n\r\n\t\tthis._layers = {};\r\n\r\n\t\tif (geojson) {\r\n\t\t\tthis.addData(geojson);\r\n\t\t}\r\n\t},\r\n\r\n\t// @method addData( <GeoJSON> data ): this\r\n\t// Adds a GeoJSON object to the layer.\r\n\taddData: function (geojson) {\r\n\t\tvar features = isArray(geojson) ? geojson : geojson.features,\r\n\t\t i, len, feature;\r\n\r\n\t\tif (features) {\r\n\t\t\tfor (i = 0, len = features.length; i < len; i++) {\r\n\t\t\t\t// only add this if geometry or geometries are set and not null\r\n\t\t\t\tfeature = features[i];\r\n\t\t\t\tif (feature.geometries || feature.geometry || feature.features || feature.coordinates) {\r\n\t\t\t\t\tthis.addData(feature);\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tvar options = this.options;\r\n\r\n\t\tif (options.filter && !options.filter(geojson)) { return this; }\r\n\r\n\t\tvar layer = geometryToLayer(geojson, options);\r\n\t\tif (!layer) {\r\n\t\t\treturn this;\r\n\t\t}\r\n\t\tlayer.feature = asFeature(geojson);\r\n\r\n\t\tlayer.defaultOptions = layer.options;\r\n\t\tthis.resetStyle(layer);\r\n\r\n\t\tif (options.onEachFeature) {\r\n\t\t\toptions.onEachFeature(geojson, layer);\r\n\t\t}\r\n\r\n\t\treturn this.addLayer(layer);\r\n\t},\r\n\r\n\t// @method resetStyle( <Path> layer ): this\r\n\t// Resets the given vector layer's style to the original GeoJSON style, useful for resetting style after hover events.\r\n\tresetStyle: function (layer) {\r\n\t\t// reset any custom styles\r\n\t\tlayer.options = extend({}, layer.defaultOptions);\r\n\t\tthis._setLayerStyle(layer, this.options.style);\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method setStyle( <Function> style ): this\r\n\t// Changes styles of GeoJSON vector layers with the given style function.\r\n\tsetStyle: function (style) {\r\n\t\treturn this.eachLayer(function (layer) {\r\n\t\t\tthis._setLayerStyle(layer, style);\r\n\t\t}, this);\r\n\t},\r\n\r\n\t_setLayerStyle: function (layer, style) {\r\n\t\tif (typeof style === 'function') {\r\n\t\t\tstyle = style(layer.feature);\r\n\t\t}\r\n\t\tif (layer.setStyle) {\r\n\t\t\tlayer.setStyle(style);\r\n\t\t}\r\n\t}\r\n});\r\n\r\n// @section\r\n// There are several static functions which can be called without instantiating L.GeoJSON:\r\n\r\n// @function geometryToLayer(featureData: Object, options?: GeoJSON options): Layer\r\n// Creates a `Layer` from a given GeoJSON feature. Can use a custom\r\n// [`pointToLayer`](#geojson-pointtolayer) and/or [`coordsToLatLng`](#geojson-coordstolatlng)\r\n// functions if provided as options.\r\nfunction geometryToLayer(geojson, options) {\r\n\r\n\tvar geometry = geojson.type === 'Feature' ? geojson.geometry : geojson,\r\n\t coords = geometry ? geometry.coordinates : null,\r\n\t layers = [],\r\n\t pointToLayer = options && options.pointToLayer,\r\n\t _coordsToLatLng = options && options.coordsToLatLng || coordsToLatLng,\r\n\t latlng, latlngs, i, len;\r\n\r\n\tif (!coords && !geometry) {\r\n\t\treturn null;\r\n\t}\r\n\r\n\tswitch (geometry.type) {\r\n\tcase 'Point':\r\n\t\tlatlng = _coordsToLatLng(coords);\r\n\t\treturn pointToLayer ? pointToLayer(geojson, latlng) : new Marker(latlng);\r\n\r\n\tcase 'MultiPoint':\r\n\t\tfor (i = 0, len = coords.length; i < len; i++) {\r\n\t\t\tlatlng = _coordsToLatLng(coords[i]);\r\n\t\t\tlayers.push(pointToLayer ? pointToLayer(geojson, latlng) : new Marker(latlng));\r\n\t\t}\r\n\t\treturn new FeatureGroup(layers);\r\n\r\n\tcase 'LineString':\r\n\tcase 'MultiLineString':\r\n\t\tlatlngs = coordsToLatLngs(coords, geometry.type === 'LineString' ? 0 : 1, _coordsToLatLng);\r\n\t\treturn new Polyline(latlngs, options);\r\n\r\n\tcase 'Polygon':\r\n\tcase 'MultiPolygon':\r\n\t\tlatlngs = coordsToLatLngs(coords, geometry.type === 'Polygon' ? 1 : 2, _coordsToLatLng);\r\n\t\treturn new Polygon(latlngs, options);\r\n\r\n\tcase 'GeometryCollection':\r\n\t\tfor (i = 0, len = geometry.geometries.length; i < len; i++) {\r\n\t\t\tvar layer = geometryToLayer({\r\n\t\t\t\tgeometry: geometry.geometries[i],\r\n\t\t\t\ttype: 'Feature',\r\n\t\t\t\tproperties: geojson.properties\r\n\t\t\t}, options);\r\n\r\n\t\t\tif (layer) {\r\n\t\t\t\tlayers.push(layer);\r\n\t\t\t}\r\n\t\t}\r\n\t\treturn new FeatureGroup(layers);\r\n\r\n\tdefault:\r\n\t\tthrow new Error('Invalid GeoJSON object.');\r\n\t}\r\n}\r\n\r\n// @function coordsToLatLng(coords: Array): LatLng\r\n// Creates a `LatLng` object from an array of 2 numbers (longitude, latitude)\r\n// or 3 numbers (longitude, latitude, altitude) used in GeoJSON for points.\r\nfunction coordsToLatLng(coords) {\r\n\treturn new LatLng(coords[1], coords[0], coords[2]);\r\n}\r\n\r\n// @function coordsToLatLngs(coords: Array, levelsDeep?: Number, coordsToLatLng?: Function): Array\r\n// Creates a multidimensional array of `LatLng`s from a GeoJSON coordinates array.\r\n// `levelsDeep` specifies the nesting level (0 is for an array of points, 1 for an array of arrays of points, etc., 0 by default).\r\n// Can use a custom [`coordsToLatLng`](#geojson-coordstolatlng) function.\r\nfunction coordsToLatLngs(coords, levelsDeep, _coordsToLatLng) {\r\n\tvar latlngs = [];\r\n\r\n\tfor (var i = 0, len = coords.length, latlng; i < len; i++) {\r\n\t\tlatlng = levelsDeep ?\r\n\t\t\tcoordsToLatLngs(coords[i], levelsDeep - 1, _coordsToLatLng) :\r\n\t\t\t(_coordsToLatLng || coordsToLatLng)(coords[i]);\r\n\r\n\t\tlatlngs.push(latlng);\r\n\t}\r\n\r\n\treturn latlngs;\r\n}\r\n\r\n// @function latLngToCoords(latlng: LatLng, precision?: Number): Array\r\n// Reverse of [`coordsToLatLng`](#geojson-coordstolatlng)\r\nfunction latLngToCoords(latlng, precision) {\r\n\tprecision = typeof precision === 'number' ? precision : 6;\r\n\treturn latlng.alt !== undefined ?\r\n\t\t[formatNum(latlng.lng, precision), formatNum(latlng.lat, precision), formatNum(latlng.alt, precision)] :\r\n\t\t[formatNum(latlng.lng, precision), formatNum(latlng.lat, precision)];\r\n}\r\n\r\n// @function latLngsToCoords(latlngs: Array, levelsDeep?: Number, closed?: Boolean): Array\r\n// Reverse of [`coordsToLatLngs`](#geojson-coordstolatlngs)\r\n// `closed` determines whether the first point should be appended to the end of the array to close the feature, only used when `levelsDeep` is 0. False by default.\r\nfunction latLngsToCoords(latlngs, levelsDeep, closed, precision) {\r\n\tvar coords = [];\r\n\r\n\tfor (var i = 0, len = latlngs.length; i < len; i++) {\r\n\t\tcoords.push(levelsDeep ?\r\n\t\t\tlatLngsToCoords(latlngs[i], levelsDeep - 1, closed, precision) :\r\n\t\t\tlatLngToCoords(latlngs[i], precision));\r\n\t}\r\n\r\n\tif (!levelsDeep && closed) {\r\n\t\tcoords.push(coords[0]);\r\n\t}\r\n\r\n\treturn coords;\r\n}\r\n\r\nfunction getFeature(layer, newGeometry) {\r\n\treturn layer.feature ?\r\n\t\textend({}, layer.feature, {geometry: newGeometry}) :\r\n\t\tasFeature(newGeometry);\r\n}\r\n\r\n// @function asFeature(geojson: Object): Object\r\n// Normalize GeoJSON geometries/features into GeoJSON features.\r\nfunction asFeature(geojson) {\r\n\tif (geojson.type === 'Feature' || geojson.type === 'FeatureCollection') {\r\n\t\treturn geojson;\r\n\t}\r\n\r\n\treturn {\r\n\t\ttype: 'Feature',\r\n\t\tproperties: {},\r\n\t\tgeometry: geojson\r\n\t};\r\n}\r\n\r\nvar PointToGeoJSON = {\r\n\ttoGeoJSON: function (precision) {\r\n\t\treturn getFeature(this, {\r\n\t\t\ttype: 'Point',\r\n\t\t\tcoordinates: latLngToCoords(this.getLatLng(), precision)\r\n\t\t});\r\n\t}\r\n};\r\n\r\n// @namespace Marker\r\n// @method toGeoJSON(): Object\r\n// Returns a [`GeoJSON`](http://en.wikipedia.org/wiki/GeoJSON) representation of the marker (as a GeoJSON `Point` Feature).\r\nMarker.include(PointToGeoJSON);\r\n\r\n// @namespace CircleMarker\r\n// @method toGeoJSON(): Object\r\n// Returns a [`GeoJSON`](http://en.wikipedia.org/wiki/GeoJSON) representation of the circle marker (as a GeoJSON `Point` Feature).\r\nCircle.include(PointToGeoJSON);\r\nCircleMarker.include(PointToGeoJSON);\r\n\r\n\r\n// @namespace Polyline\r\n// @method toGeoJSON(): Object\r\n// Returns a [`GeoJSON`](http://en.wikipedia.org/wiki/GeoJSON) representation of the polyline (as a GeoJSON `LineString` or `MultiLineString` Feature).\r\nPolyline.include({\r\n\ttoGeoJSON: function (precision) {\r\n\t\tvar multi = !isFlat(this._latlngs);\r\n\r\n\t\tvar coords = latLngsToCoords(this._latlngs, multi ? 1 : 0, false, precision);\r\n\r\n\t\treturn getFeature(this, {\r\n\t\t\ttype: (multi ? 'Multi' : '') + 'LineString',\r\n\t\t\tcoordinates: coords\r\n\t\t});\r\n\t}\r\n});\r\n\r\n// @namespace Polygon\r\n// @method toGeoJSON(): Object\r\n// Returns a [`GeoJSON`](http://en.wikipedia.org/wiki/GeoJSON) representation of the polygon (as a GeoJSON `Polygon` or `MultiPolygon` Feature).\r\nPolygon.include({\r\n\ttoGeoJSON: function (precision) {\r\n\t\tvar holes = !isFlat(this._latlngs),\r\n\t\t multi = holes && !isFlat(this._latlngs[0]);\r\n\r\n\t\tvar coords = latLngsToCoords(this._latlngs, multi ? 2 : holes ? 1 : 0, true, precision);\r\n\r\n\t\tif (!holes) {\r\n\t\t\tcoords = [coords];\r\n\t\t}\r\n\r\n\t\treturn getFeature(this, {\r\n\t\t\ttype: (multi ? 'Multi' : '') + 'Polygon',\r\n\t\t\tcoordinates: coords\r\n\t\t});\r\n\t}\r\n});\r\n\r\n\r\n// @namespace LayerGroup\r\nLayerGroup.include({\r\n\ttoMultiPoint: function (precision) {\r\n\t\tvar coords = [];\r\n\r\n\t\tthis.eachLayer(function (layer) {\r\n\t\t\tcoords.push(layer.toGeoJSON(precision).geometry.coordinates);\r\n\t\t});\r\n\r\n\t\treturn getFeature(this, {\r\n\t\t\ttype: 'MultiPoint',\r\n\t\t\tcoordinates: coords\r\n\t\t});\r\n\t},\r\n\r\n\t// @method toGeoJSON(): Object\r\n\t// Returns a [`GeoJSON`](http://en.wikipedia.org/wiki/GeoJSON) representation of the layer group (as a GeoJSON `FeatureCollection`, `GeometryCollection`, or `MultiPoint`).\r\n\ttoGeoJSON: function (precision) {\r\n\r\n\t\tvar type = this.feature && this.feature.geometry && this.feature.geometry.type;\r\n\r\n\t\tif (type === 'MultiPoint') {\r\n\t\t\treturn this.toMultiPoint(precision);\r\n\t\t}\r\n\r\n\t\tvar isGeometryCollection = type === 'GeometryCollection',\r\n\t\t jsons = [];\r\n\r\n\t\tthis.eachLayer(function (layer) {\r\n\t\t\tif (layer.toGeoJSON) {\r\n\t\t\t\tvar json = layer.toGeoJSON(precision);\r\n\t\t\t\tif (isGeometryCollection) {\r\n\t\t\t\t\tjsons.push(json.geometry);\r\n\t\t\t\t} else {\r\n\t\t\t\t\tvar feature = asFeature(json);\r\n\t\t\t\t\t// Squash nested feature collections\r\n\t\t\t\t\tif (feature.type === 'FeatureCollection') {\r\n\t\t\t\t\t\tjsons.push.apply(jsons, feature.features);\r\n\t\t\t\t\t} else {\r\n\t\t\t\t\t\tjsons.push(feature);\r\n\t\t\t\t\t}\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t});\r\n\r\n\t\tif (isGeometryCollection) {\r\n\t\t\treturn getFeature(this, {\r\n\t\t\t\tgeometries: jsons,\r\n\t\t\t\ttype: 'GeometryCollection'\r\n\t\t\t});\r\n\t\t}\r\n\r\n\t\treturn {\r\n\t\t\ttype: 'FeatureCollection',\r\n\t\t\tfeatures: jsons\r\n\t\t};\r\n\t}\r\n});\r\n\r\n// @namespace GeoJSON\r\n// @factory L.geoJSON(geojson?: Object, options?: GeoJSON options)\r\n// Creates a GeoJSON layer. Optionally accepts an object in\r\n// [GeoJSON format](http://geojson.org/geojson-spec.html) to display on the map\r\n// (you can alternatively add it later with `addData` method) and an `options` object.\r\nfunction geoJSON(geojson, options) {\r\n\treturn new GeoJSON(geojson, options);\r\n}\r\n\r\n// Backward compatibility.\r\nvar geoJson = geoJSON;\n\n/*\r\n * @class ImageOverlay\r\n * @aka L.ImageOverlay\r\n * @inherits Interactive layer\r\n *\r\n * Used to load and display a single image over specific bounds of the map. Extends `Layer`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var imageUrl = 'http://www.lib.utexas.edu/maps/historical/newark_nj_1922.jpg',\r\n * \timageBounds = [[40.712216, -74.22655], [40.773941, -74.12544]];\r\n * L.imageOverlay(imageUrl, imageBounds).addTo(map);\r\n * ```\r\n */\r\n\r\nvar ImageOverlay = Layer.extend({\r\n\r\n\t// @section\r\n\t// @aka ImageOverlay options\r\n\toptions: {\r\n\t\t// @option opacity: Number = 1.0\r\n\t\t// The opacity of the image overlay.\r\n\t\topacity: 1,\r\n\r\n\t\t// @option alt: String = ''\r\n\t\t// Text for the `alt` attribute of the image (useful for accessibility).\r\n\t\talt: '',\r\n\r\n\t\t// @option interactive: Boolean = false\r\n\t\t// If `true`, the image overlay will emit [mouse events](#interactive-layer) when clicked or hovered.\r\n\t\tinteractive: false,\r\n\r\n\t\t// @option crossOrigin: Boolean = false\r\n\t\t// If true, the image will have its crossOrigin attribute set to ''. This is needed if you want to access image pixel data.\r\n\t\tcrossOrigin: false,\r\n\r\n\t\t// @option errorOverlayUrl: String = ''\r\n\t\t// URL to the overlay image to show in place of the overlay that failed to load.\r\n\t\terrorOverlayUrl: '',\r\n\r\n\t\t// @option zIndex: Number = 1\r\n\t\t// The explicit [zIndex](https://developer.mozilla.org/docs/Web/CSS/CSS_Positioning/Understanding_z_index) of the tile layer.\r\n\t\tzIndex: 1,\r\n\r\n\t\t// @option className: String = ''\r\n\t\t// A custom class name to assign to the image. Empty by default.\r\n\t\tclassName: '',\r\n\t},\r\n\r\n\tinitialize: function (url, bounds, options) { // (String, LatLngBounds, Object)\r\n\t\tthis._url = url;\r\n\t\tthis._bounds = toLatLngBounds(bounds);\r\n\r\n\t\tsetOptions(this, options);\r\n\t},\r\n\r\n\tonAdd: function () {\r\n\t\tif (!this._image) {\r\n\t\t\tthis._initImage();\r\n\r\n\t\t\tif (this.options.opacity < 1) {\r\n\t\t\t\tthis._updateOpacity();\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tif (this.options.interactive) {\r\n\t\t\taddClass(this._image, 'leaflet-interactive');\r\n\t\t\tthis.addInteractiveTarget(this._image);\r\n\t\t}\r\n\r\n\t\tthis.getPane().appendChild(this._image);\r\n\t\tthis._reset();\r\n\t},\r\n\r\n\tonRemove: function () {\r\n\t\tremove(this._image);\r\n\t\tif (this.options.interactive) {\r\n\t\t\tthis.removeInteractiveTarget(this._image);\r\n\t\t}\r\n\t},\r\n\r\n\t// @method setOpacity(opacity: Number): this\r\n\t// Sets the opacity of the overlay.\r\n\tsetOpacity: function (opacity) {\r\n\t\tthis.options.opacity = opacity;\r\n\r\n\t\tif (this._image) {\r\n\t\t\tthis._updateOpacity();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\tsetStyle: function (styleOpts) {\r\n\t\tif (styleOpts.opacity) {\r\n\t\t\tthis.setOpacity(styleOpts.opacity);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method bringToFront(): this\r\n\t// Brings the layer to the top of all overlays.\r\n\tbringToFront: function () {\r\n\t\tif (this._map) {\r\n\t\t\ttoFront(this._image);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method bringToBack(): this\r\n\t// Brings the layer to the bottom of all overlays.\r\n\tbringToBack: function () {\r\n\t\tif (this._map) {\r\n\t\t\ttoBack(this._image);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method setUrl(url: String): this\r\n\t// Changes the URL of the image.\r\n\tsetUrl: function (url) {\r\n\t\tthis._url = url;\r\n\r\n\t\tif (this._image) {\r\n\t\t\tthis._image.src = url;\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method setBounds(bounds: LatLngBounds): this\r\n\t// Update the bounds that this ImageOverlay covers\r\n\tsetBounds: function (bounds) {\r\n\t\tthis._bounds = toLatLngBounds(bounds);\r\n\r\n\t\tif (this._map) {\r\n\t\t\tthis._reset();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\tgetEvents: function () {\r\n\t\tvar events = {\r\n\t\t\tzoom: this._reset,\r\n\t\t\tviewreset: this._reset\r\n\t\t};\r\n\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tevents.zoomanim = this._animateZoom;\r\n\t\t}\r\n\r\n\t\treturn events;\r\n\t},\r\n\r\n\t// @method: setZIndex(value: Number) : this\r\n\t// Changes the [zIndex](#imageoverlay-zindex) of the image overlay.\r\n\tsetZIndex: function (value) {\r\n\t\tthis.options.zIndex = value;\r\n\t\tthis._updateZIndex();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getBounds(): LatLngBounds\r\n\t// Get the bounds that this ImageOverlay covers\r\n\tgetBounds: function () {\r\n\t\treturn this._bounds;\r\n\t},\r\n\r\n\t// @method getElement(): HTMLElement\r\n\t// Returns the instance of [`HTMLImageElement`](https://developer.mozilla.org/docs/Web/API/HTMLImageElement)\r\n\t// used by this overlay.\r\n\tgetElement: function () {\r\n\t\treturn this._image;\r\n\t},\r\n\r\n\t_initImage: function () {\r\n\t\tvar wasElementSupplied = this._url.tagName === 'IMG';\r\n\t\tvar img = this._image = wasElementSupplied ? this._url : create$1('img');\r\n\r\n\t\taddClass(img, 'leaflet-image-layer');\r\n\t\tif (this._zoomAnimated) { addClass(img, 'leaflet-zoom-animated'); }\r\n\t\tif (this.options.className) { addClass(img, this.options.className); }\r\n\r\n\t\timg.onselectstart = falseFn;\r\n\t\timg.onmousemove = falseFn;\r\n\r\n\t\t// @event load: Event\r\n\t\t// Fired when the ImageOverlay layer has loaded its image\r\n\t\timg.onload = bind(this.fire, this, 'load');\r\n\t\timg.onerror = bind(this._overlayOnError, this, 'error');\r\n\r\n\t\tif (this.options.crossOrigin) {\r\n\t\t\timg.crossOrigin = '';\r\n\t\t}\r\n\r\n\t\tif (this.options.zIndex) {\r\n\t\t\tthis._updateZIndex();\r\n\t\t}\r\n\r\n\t\tif (wasElementSupplied) {\r\n\t\t\tthis._url = img.src;\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\timg.src = this._url;\r\n\t\timg.alt = this.options.alt;\r\n\t},\r\n\r\n\t_animateZoom: function (e) {\r\n\t\tvar scale = this._map.getZoomScale(e.zoom),\r\n\t\t offset = this._map._latLngBoundsToNewLayerBounds(this._bounds, e.zoom, e.center).min;\r\n\r\n\t\tsetTransform(this._image, offset, scale);\r\n\t},\r\n\r\n\t_reset: function () {\r\n\t\tvar image = this._image,\r\n\t\t bounds = new Bounds(\r\n\t\t this._map.latLngToLayerPoint(this._bounds.getNorthWest()),\r\n\t\t this._map.latLngToLayerPoint(this._bounds.getSouthEast())),\r\n\t\t size = bounds.getSize();\r\n\r\n\t\tsetPosition(image, bounds.min);\r\n\r\n\t\timage.style.width = size.x + 'px';\r\n\t\timage.style.height = size.y + 'px';\r\n\t},\r\n\r\n\t_updateOpacity: function () {\r\n\t\tsetOpacity(this._image, this.options.opacity);\r\n\t},\r\n\r\n\t_updateZIndex: function () {\r\n\t\tif (this._image && this.options.zIndex !== undefined && this.options.zIndex !== null) {\r\n\t\t\tthis._image.style.zIndex = this.options.zIndex;\r\n\t\t}\r\n\t},\r\n\r\n\t_overlayOnError: function () {\r\n\t\t// @event error: Event\r\n\t\t// Fired when the ImageOverlay layer has loaded its image\r\n\t\tthis.fire('error');\r\n\r\n\t\tvar errorUrl = this.options.errorOverlayUrl;\r\n\t\tif (errorUrl && this._url !== errorUrl) {\r\n\t\t\tthis._url = errorUrl;\r\n\t\t\tthis._image.src = errorUrl;\r\n\t\t}\r\n\t}\r\n});\r\n\r\n// @factory L.imageOverlay(imageUrl: String, bounds: LatLngBounds, options?: ImageOverlay options)\r\n// Instantiates an image overlay object given the URL of the image and the\r\n// geographical bounds it is tied to.\r\nvar imageOverlay = function (url, bounds, options) {\r\n\treturn new ImageOverlay(url, bounds, options);\r\n};\n\n/*\r\n * @class VideoOverlay\r\n * @aka L.VideoOverlay\r\n * @inherits ImageOverlay\r\n *\r\n * Used to load and display a video player over specific bounds of the map. Extends `ImageOverlay`.\r\n *\r\n * A video overlay uses the [`<video>`](https://developer.mozilla.org/docs/Web/HTML/Element/video)\r\n * HTML5 element.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var videoUrl = 'https://www.mapbox.com/bites/00188/patricia_nasa.webm',\r\n * \tvideoBounds = [[ 32, -130], [ 13, -100]];\r\n * L.VideoOverlay(videoUrl, videoBounds ).addTo(map);\r\n * ```\r\n */\r\n\r\nvar VideoOverlay = ImageOverlay.extend({\r\n\r\n\t// @section\r\n\t// @aka VideoOverlay options\r\n\toptions: {\r\n\t\t// @option autoplay: Boolean = true\r\n\t\t// Whether the video starts playing automatically when loaded.\r\n\t\tautoplay: true,\r\n\r\n\t\t// @option loop: Boolean = true\r\n\t\t// Whether the video will loop back to the beginning when played.\r\n\t\tloop: true\r\n\t},\r\n\r\n\t_initImage: function () {\r\n\t\tvar wasElementSupplied = this._url.tagName === 'VIDEO';\r\n\t\tvar vid = this._image = wasElementSupplied ? this._url : create$1('video');\r\n\r\n\t\taddClass(vid, 'leaflet-image-layer');\r\n\t\tif (this._zoomAnimated) { addClass(vid, 'leaflet-zoom-animated'); }\r\n\r\n\t\tvid.onselectstart = falseFn;\r\n\t\tvid.onmousemove = falseFn;\r\n\r\n\t\t// @event load: Event\r\n\t\t// Fired when the video has finished loading the first frame\r\n\t\tvid.onloadeddata = bind(this.fire, this, 'load');\r\n\r\n\t\tif (wasElementSupplied) {\r\n\t\t\tvar sourceElements = vid.getElementsByTagName('source');\r\n\t\t\tvar sources = [];\r\n\t\t\tfor (var j = 0; j < sourceElements.length; j++) {\r\n\t\t\t\tsources.push(sourceElements[j].src);\r\n\t\t\t}\r\n\r\n\t\t\tthis._url = (sourceElements.length > 0) ? sources : [vid.src];\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tif (!isArray(this._url)) { this._url = [this._url]; }\r\n\r\n\t\tvid.autoplay = !!this.options.autoplay;\r\n\t\tvid.loop = !!this.options.loop;\r\n\t\tfor (var i = 0; i < this._url.length; i++) {\r\n\t\t\tvar source = create$1('source');\r\n\t\t\tsource.src = this._url[i];\r\n\t\t\tvid.appendChild(source);\r\n\t\t}\r\n\t}\r\n\r\n\t// @method getElement(): HTMLVideoElement\r\n\t// Returns the instance of [`HTMLVideoElement`](https://developer.mozilla.org/docs/Web/API/HTMLVideoElement)\r\n\t// used by this overlay.\r\n});\r\n\r\n\r\n// @factory L.videoOverlay(video: String|Array|HTMLVideoElement, bounds: LatLngBounds, options?: VideoOverlay options)\r\n// Instantiates an image overlay object given the URL of the video (or array of URLs, or even a video element) and the\r\n// geographical bounds it is tied to.\r\n\r\nfunction videoOverlay(video, bounds, options) {\r\n\treturn new VideoOverlay(video, bounds, options);\r\n}\n\n/*\r\n * @class DivOverlay\r\n * @inherits Layer\r\n * @aka L.DivOverlay\r\n * Base model for L.Popup and L.Tooltip. Inherit from it for custom popup like plugins.\r\n */\r\n\r\n// @namespace DivOverlay\r\nvar DivOverlay = Layer.extend({\r\n\r\n\t// @section\r\n\t// @aka DivOverlay options\r\n\toptions: {\r\n\t\t// @option offset: Point = Point(0, 7)\r\n\t\t// The offset of the popup position. Useful to control the anchor\r\n\t\t// of the popup when opening it on some overlays.\r\n\t\toffset: [0, 7],\r\n\r\n\t\t// @option className: String = ''\r\n\t\t// A custom CSS class name to assign to the popup.\r\n\t\tclassName: '',\r\n\r\n\t\t// @option pane: String = 'popupPane'\r\n\t\t// `Map pane` where the popup will be added.\r\n\t\tpane: 'popupPane'\r\n\t},\r\n\r\n\tinitialize: function (options, source) {\r\n\t\tsetOptions(this, options);\r\n\r\n\t\tthis._source = source;\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tthis._zoomAnimated = map._zoomAnimated;\r\n\r\n\t\tif (!this._container) {\r\n\t\t\tthis._initLayout();\r\n\t\t}\r\n\r\n\t\tif (map._fadeAnimated) {\r\n\t\t\tsetOpacity(this._container, 0);\r\n\t\t}\r\n\r\n\t\tclearTimeout(this._removeTimeout);\r\n\t\tthis.getPane().appendChild(this._container);\r\n\t\tthis.update();\r\n\r\n\t\tif (map._fadeAnimated) {\r\n\t\t\tsetOpacity(this._container, 1);\r\n\t\t}\r\n\r\n\t\tthis.bringToFront();\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tif (map._fadeAnimated) {\r\n\t\t\tsetOpacity(this._container, 0);\r\n\t\t\tthis._removeTimeout = setTimeout(bind(remove, undefined, this._container), 200);\r\n\t\t} else {\r\n\t\t\tremove(this._container);\r\n\t\t}\r\n\t},\r\n\r\n\t// @namespace Popup\r\n\t// @method getLatLng: LatLng\r\n\t// Returns the geographical point of popup.\r\n\tgetLatLng: function () {\r\n\t\treturn this._latlng;\r\n\t},\r\n\r\n\t// @method setLatLng(latlng: LatLng): this\r\n\t// Sets the geographical point where the popup will open.\r\n\tsetLatLng: function (latlng) {\r\n\t\tthis._latlng = toLatLng(latlng);\r\n\t\tif (this._map) {\r\n\t\t\tthis._updatePosition();\r\n\t\t\tthis._adjustPan();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getContent: String|HTMLElement\r\n\t// Returns the content of the popup.\r\n\tgetContent: function () {\r\n\t\treturn this._content;\r\n\t},\r\n\r\n\t// @method setContent(htmlContent: String|HTMLElement|Function): this\r\n\t// Sets the HTML content of the popup. If a function is passed the source layer will be passed to the function. The function should return a `String` or `HTMLElement` to be used in the popup.\r\n\tsetContent: function (content) {\r\n\t\tthis._content = content;\r\n\t\tthis.update();\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getElement: String|HTMLElement\r\n\t// Alias for [getContent()](#popup-getcontent)\r\n\tgetElement: function () {\r\n\t\treturn this._container;\r\n\t},\r\n\r\n\t// @method update: null\r\n\t// Updates the popup content, layout and position. Useful for updating the popup after something inside changed, e.g. image loaded.\r\n\tupdate: function () {\r\n\t\tif (!this._map) { return; }\r\n\r\n\t\tthis._container.style.visibility = 'hidden';\r\n\r\n\t\tthis._updateContent();\r\n\t\tthis._updateLayout();\r\n\t\tthis._updatePosition();\r\n\r\n\t\tthis._container.style.visibility = '';\r\n\r\n\t\tthis._adjustPan();\r\n\t},\r\n\r\n\tgetEvents: function () {\r\n\t\tvar events = {\r\n\t\t\tzoom: this._updatePosition,\r\n\t\t\tviewreset: this._updatePosition\r\n\t\t};\r\n\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tevents.zoomanim = this._animateZoom;\r\n\t\t}\r\n\t\treturn events;\r\n\t},\r\n\r\n\t// @method isOpen: Boolean\r\n\t// Returns `true` when the popup is visible on the map.\r\n\tisOpen: function () {\r\n\t\treturn !!this._map && this._map.hasLayer(this);\r\n\t},\r\n\r\n\t// @method bringToFront: this\r\n\t// Brings this popup in front of other popups (in the same map pane).\r\n\tbringToFront: function () {\r\n\t\tif (this._map) {\r\n\t\t\ttoFront(this._container);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method bringToBack: this\r\n\t// Brings this popup to the back of other popups (in the same map pane).\r\n\tbringToBack: function () {\r\n\t\tif (this._map) {\r\n\t\t\ttoBack(this._container);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t_updateContent: function () {\r\n\t\tif (!this._content) { return; }\r\n\r\n\t\tvar node = this._contentNode;\r\n\t\tvar content = (typeof this._content === 'function') ? this._content(this._source || this) : this._content;\r\n\r\n\t\tif (typeof content === 'string') {\r\n\t\t\tnode.innerHTML = content;\r\n\t\t} else {\r\n\t\t\twhile (node.hasChildNodes()) {\r\n\t\t\t\tnode.removeChild(node.firstChild);\r\n\t\t\t}\r\n\t\t\tnode.appendChild(content);\r\n\t\t}\r\n\t\tthis.fire('contentupdate');\r\n\t},\r\n\r\n\t_updatePosition: function () {\r\n\t\tif (!this._map) { return; }\r\n\r\n\t\tvar pos = this._map.latLngToLayerPoint(this._latlng),\r\n\t\t offset = toPoint(this.options.offset),\r\n\t\t anchor = this._getAnchor();\r\n\r\n\t\tif (this._zoomAnimated) {\r\n\t\t\tsetPosition(this._container, pos.add(anchor));\r\n\t\t} else {\r\n\t\t\toffset = offset.add(pos).add(anchor);\r\n\t\t}\r\n\r\n\t\tvar bottom = this._containerBottom = -offset.y,\r\n\t\t left = this._containerLeft = -Math.round(this._containerWidth / 2) + offset.x;\r\n\r\n\t\t// bottom position the popup in case the height of the popup changes (images loading etc)\r\n\t\tthis._container.style.bottom = bottom + 'px';\r\n\t\tthis._container.style.left = left + 'px';\r\n\t},\r\n\r\n\t_getAnchor: function () {\r\n\t\treturn [0, 0];\r\n\t}\r\n\r\n});\n\n/*\r\n * @class Popup\r\n * @inherits DivOverlay\r\n * @aka L.Popup\r\n * Used to open popups in certain places of the map. Use [Map.openPopup](#map-openpopup) to\r\n * open popups while making sure that only one popup is open at one time\r\n * (recommended for usability), or use [Map.addLayer](#map-addlayer) to open as many as you want.\r\n *\r\n * @example\r\n *\r\n * If you want to just bind a popup to marker click and then open it, it's really easy:\r\n *\r\n * ```js\r\n * marker.bindPopup(popupContent).openPopup();\r\n * ```\r\n * Path overlays like polylines also have a `bindPopup` method.\r\n * Here's a more complicated way to open a popup on a map:\r\n *\r\n * ```js\r\n * var popup = L.popup()\r\n * \t.setLatLng(latlng)\r\n * \t.setContent('<p>Hello world!<br />This is a nice popup.</p>')\r\n * \t.openOn(map);\r\n * ```\r\n */\r\n\r\n\r\n// @namespace Popup\r\nvar Popup = DivOverlay.extend({\r\n\r\n\t// @section\r\n\t// @aka Popup options\r\n\toptions: {\r\n\t\t// @option maxWidth: Number = 300\r\n\t\t// Max width of the popup, in pixels.\r\n\t\tmaxWidth: 300,\r\n\r\n\t\t// @option minWidth: Number = 50\r\n\t\t// Min width of the popup, in pixels.\r\n\t\tminWidth: 50,\r\n\r\n\t\t// @option maxHeight: Number = null\r\n\t\t// If set, creates a scrollable container of the given height\r\n\t\t// inside a popup if its content exceeds it.\r\n\t\tmaxHeight: null,\r\n\r\n\t\t// @option autoPan: Boolean = true\r\n\t\t// Set it to `false` if you don't want the map to do panning animation\r\n\t\t// to fit the opened popup.\r\n\t\tautoPan: true,\r\n\r\n\t\t// @option autoPanPaddingTopLeft: Point = null\r\n\t\t// The margin between the popup and the top left corner of the map\r\n\t\t// view after autopanning was performed.\r\n\t\tautoPanPaddingTopLeft: null,\r\n\r\n\t\t// @option autoPanPaddingBottomRight: Point = null\r\n\t\t// The margin between the popup and the bottom right corner of the map\r\n\t\t// view after autopanning was performed.\r\n\t\tautoPanPaddingBottomRight: null,\r\n\r\n\t\t// @option autoPanPadding: Point = Point(5, 5)\r\n\t\t// Equivalent of setting both top left and bottom right autopan padding to the same value.\r\n\t\tautoPanPadding: [5, 5],\r\n\r\n\t\t// @option keepInView: Boolean = false\r\n\t\t// Set it to `true` if you want to prevent users from panning the popup\r\n\t\t// off of the screen while it is open.\r\n\t\tkeepInView: false,\r\n\r\n\t\t// @option closeButton: Boolean = true\r\n\t\t// Controls the presence of a close button in the popup.\r\n\t\tcloseButton: true,\r\n\r\n\t\t// @option autoClose: Boolean = true\r\n\t\t// Set it to `false` if you want to override the default behavior of\r\n\t\t// the popup closing when another popup is opened.\r\n\t\tautoClose: true,\r\n\r\n\t\t// @option closeOnEscapeKey: Boolean = true\r\n\t\t// Set it to `false` if you want to override the default behavior of\r\n\t\t// the ESC key for closing of the popup.\r\n\t\tcloseOnEscapeKey: true,\r\n\r\n\t\t// @option closeOnClick: Boolean = *\r\n\t\t// Set it if you want to override the default behavior of the popup closing when user clicks\r\n\t\t// on the map. Defaults to the map's [`closePopupOnClick`](#map-closepopuponclick) option.\r\n\r\n\t\t// @option className: String = ''\r\n\t\t// A custom CSS class name to assign to the popup.\r\n\t\tclassName: ''\r\n\t},\r\n\r\n\t// @namespace Popup\r\n\t// @method openOn(map: Map): this\r\n\t// Adds the popup to the map and closes the previous one. The same as `map.openPopup(popup)`.\r\n\topenOn: function (map) {\r\n\t\tmap.openPopup(this);\r\n\t\treturn this;\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\t\tDivOverlay.prototype.onAdd.call(this, map);\r\n\r\n\t\t// @namespace Map\r\n\t\t// @section Popup events\r\n\t\t// @event popupopen: PopupEvent\r\n\t\t// Fired when a popup is opened in the map\r\n\t\tmap.fire('popupopen', {popup: this});\r\n\r\n\t\tif (this._source) {\r\n\t\t\t// @namespace Layer\r\n\t\t\t// @section Popup events\r\n\t\t\t// @event popupopen: PopupEvent\r\n\t\t\t// Fired when a popup bound to this layer is opened\r\n\t\t\tthis._source.fire('popupopen', {popup: this}, true);\r\n\t\t\t// For non-path layers, we toggle the popup when clicking\r\n\t\t\t// again the layer, so prevent the map to reopen it.\r\n\t\t\tif (!(this._source instanceof Path)) {\r\n\t\t\t\tthis._source.on('preclick', stopPropagation);\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\tonRemove: function (map) {\r\n\t\tDivOverlay.prototype.onRemove.call(this, map);\r\n\r\n\t\t// @namespace Map\r\n\t\t// @section Popup events\r\n\t\t// @event popupclose: PopupEvent\r\n\t\t// Fired when a popup in the map is closed\r\n\t\tmap.fire('popupclose', {popup: this});\r\n\r\n\t\tif (this._source) {\r\n\t\t\t// @namespace Layer\r\n\t\t\t// @section Popup events\r\n\t\t\t// @event popupclose: PopupEvent\r\n\t\t\t// Fired when a popup bound to this layer is closed\r\n\t\t\tthis._source.fire('popupclose', {popup: this}, true);\r\n\t\t\tif (!(this._source instanceof Path)) {\r\n\t\t\t\tthis._source.off('preclick', stopPropagation);\r\n\t\t\t}\r\n\t\t}\r\n\t},\r\n\r\n\tgetEvents: function () {\r\n\t\tvar events = DivOverlay.prototype.getEvents.call(this);\r\n\r\n\t\tif (this.options.closeOnClick !== undefined ? this.options.closeOnClick : this._map.options.closePopupOnClick) {\r\n\t\t\tevents.preclick = this._close;\r\n\t\t}\r\n\r\n\t\tif (this.options.keepInView) {\r\n\t\t\tevents.moveend = this._adjustPan;\r\n\t\t}\r\n\r\n\t\treturn events;\r\n\t},\r\n\r\n\t_close: function () {\r\n\t\tif (this._map) {\r\n\t\t\tthis._map.closePopup(this);\r\n\t\t}\r\n\t},\r\n\r\n\t_initLayout: function () {\r\n\t\tvar prefix = 'leaflet-popup',\r\n\t\t container = this._container = create$1('div',\r\n\t\t\tprefix + ' ' + (this.options.className || '') +\r\n\t\t\t' leaflet-zoom-animated');\r\n\r\n\t\tvar wrapper = this._wrapper = create$1('div', prefix + '-content-wrapper', container);\r\n\t\tthis._contentNode = create$1('div', prefix + '-content', wrapper);\r\n\r\n\t\tdisableClickPropagation(wrapper);\r\n\t\tdisableScrollPropagation(this._contentNode);\r\n\t\ton(wrapper, 'contextmenu', stopPropagation);\r\n\r\n\t\tthis._tipContainer = create$1('div', prefix + '-tip-container', container);\r\n\t\tthis._tip = create$1('div', prefix + '-tip', this._tipContainer);\r\n\r\n\t\tif (this.options.closeButton) {\r\n\t\t\tvar closeButton = this._closeButton = create$1('a', prefix + '-close-button', container);\r\n\t\t\tcloseButton.href = '#close';\r\n\t\t\tcloseButton.innerHTML = '&#215;';\r\n\r\n\t\t\ton(closeButton, 'click', this._onCloseButtonClick, this);\r\n\t\t}\r\n\t},\r\n\r\n\t_updateLayout: function () {\r\n\t\tvar container = this._contentNode,\r\n\t\t style = container.style;\r\n\r\n\t\tstyle.width = '';\r\n\t\tstyle.whiteSpace = 'nowrap';\r\n\r\n\t\tvar width = container.offsetWidth;\r\n\t\twidth = Math.min(width, this.options.maxWidth);\r\n\t\twidth = Math.max(width, this.options.minWidth);\r\n\r\n\t\tstyle.width = (width + 1) + 'px';\r\n\t\tstyle.whiteSpace = '';\r\n\r\n\t\tstyle.height = '';\r\n\r\n\t\tvar height = container.offsetHeight,\r\n\t\t maxHeight = this.options.maxHeight,\r\n\t\t scrolledClass = 'leaflet-popup-scrolled';\r\n\r\n\t\tif (maxHeight && height > maxHeight) {\r\n\t\t\tstyle.height = maxHeight + 'px';\r\n\t\t\taddClass(container, scrolledClass);\r\n\t\t} else {\r\n\t\t\tremoveClass(container, scrolledClass);\r\n\t\t}\r\n\r\n\t\tthis._containerWidth = this._container.offsetWidth;\r\n\t},\r\n\r\n\t_animateZoom: function (e) {\r\n\t\tvar pos = this._map._latLngToNewLayerPoint(this._latlng, e.zoom, e.center),\r\n\t\t anchor = this._getAnchor();\r\n\t\tsetPosition(this._container, pos.add(anchor));\r\n\t},\r\n\r\n\t_adjustPan: function () {\r\n\t\tif (!this.options.autoPan || (this._map._panAnim && this._map._panAnim._inProgress)) { return; }\r\n\r\n\t\tvar map = this._map,\r\n\t\t marginBottom = parseInt(getStyle(this._container, 'marginBottom'), 10) || 0,\r\n\t\t containerHeight = this._container.offsetHeight + marginBottom,\r\n\t\t containerWidth = this._containerWidth,\r\n\t\t layerPos = new Point(this._containerLeft, -containerHeight - this._containerBottom);\r\n\r\n\t\tlayerPos._add(getPosition(this._container));\r\n\r\n\t\tvar containerPos = map.layerPointToContainerPoint(layerPos),\r\n\t\t padding = toPoint(this.options.autoPanPadding),\r\n\t\t paddingTL = toPoint(this.options.autoPanPaddingTopLeft || padding),\r\n\t\t paddingBR = toPoint(this.options.autoPanPaddingBottomRight || padding),\r\n\t\t size = map.getSize(),\r\n\t\t dx = 0,\r\n\t\t dy = 0;\r\n\r\n\t\tif (containerPos.x + containerWidth + paddingBR.x > size.x) { // right\r\n\t\t\tdx = containerPos.x + containerWidth - size.x + paddingBR.x;\r\n\t\t}\r\n\t\tif (containerPos.x - dx - paddingTL.x < 0) { // left\r\n\t\t\tdx = containerPos.x - paddingTL.x;\r\n\t\t}\r\n\t\tif (containerPos.y + containerHeight + paddingBR.y > size.y) { // bottom\r\n\t\t\tdy = containerPos.y + containerHeight - size.y + paddingBR.y;\r\n\t\t}\r\n\t\tif (containerPos.y - dy - paddingTL.y < 0) { // top\r\n\t\t\tdy = containerPos.y - paddingTL.y;\r\n\t\t}\r\n\r\n\t\t// @namespace Map\r\n\t\t// @section Popup events\r\n\t\t// @event autopanstart: Event\r\n\t\t// Fired when the map starts autopanning when opening a popup.\r\n\t\tif (dx || dy) {\r\n\t\t\tmap\r\n\t\t\t .fire('autopanstart')\r\n\t\t\t .panBy([dx, dy]);\r\n\t\t}\r\n\t},\r\n\r\n\t_onCloseButtonClick: function (e) {\r\n\t\tthis._close();\r\n\t\tstop(e);\r\n\t},\r\n\r\n\t_getAnchor: function () {\r\n\t\t// Where should we anchor the popup on the source layer?\r\n\t\treturn toPoint(this._source && this._source._getPopupAnchor ? this._source._getPopupAnchor() : [0, 0]);\r\n\t}\r\n\r\n});\r\n\r\n// @namespace Popup\r\n// @factory L.popup(options?: Popup options, source?: Layer)\r\n// Instantiates a `Popup` object given an optional `options` object that describes its appearance and location and an optional `source` object that is used to tag the popup with a reference to the Layer to which it refers.\r\nvar popup = function (options, source) {\r\n\treturn new Popup(options, source);\r\n};\r\n\r\n\r\n/* @namespace Map\r\n * @section Interaction Options\r\n * @option closePopupOnClick: Boolean = true\r\n * Set it to `false` if you don't want popups to close when user clicks the map.\r\n */\r\nMap.mergeOptions({\r\n\tclosePopupOnClick: true\r\n});\r\n\r\n\r\n// @namespace Map\r\n// @section Methods for Layers and Controls\r\nMap.include({\r\n\t// @method openPopup(popup: Popup): this\r\n\t// Opens the specified popup while closing the previously opened (to make sure only one is opened at one time for usability).\r\n\t// @alternative\r\n\t// @method openPopup(content: String|HTMLElement, latlng: LatLng, options?: Popup options): this\r\n\t// Creates a popup with the specified content and options and opens it in the given point on a map.\r\n\topenPopup: function (popup, latlng, options) {\r\n\t\tif (!(popup instanceof Popup)) {\r\n\t\t\tpopup = new Popup(options).setContent(popup);\r\n\t\t}\r\n\r\n\t\tif (latlng) {\r\n\t\t\tpopup.setLatLng(latlng);\r\n\t\t}\r\n\r\n\t\tif (this.hasLayer(popup)) {\r\n\t\t\treturn this;\r\n\t\t}\r\n\r\n\t\tif (this._popup && this._popup.options.autoClose) {\r\n\t\t\tthis.closePopup();\r\n\t\t}\r\n\r\n\t\tthis._popup = popup;\r\n\t\treturn this.addLayer(popup);\r\n\t},\r\n\r\n\t// @method closePopup(popup?: Popup): this\r\n\t// Closes the popup previously opened with [openPopup](#map-openpopup) (or the given one).\r\n\tclosePopup: function (popup) {\r\n\t\tif (!popup || popup === this._popup) {\r\n\t\t\tpopup = this._popup;\r\n\t\t\tthis._popup = null;\r\n\t\t}\r\n\t\tif (popup) {\r\n\t\t\tthis.removeLayer(popup);\r\n\t\t}\r\n\t\treturn this;\r\n\t}\r\n});\r\n\r\n/*\r\n * @namespace Layer\r\n * @section Popup methods example\r\n *\r\n * All layers share a set of methods convenient for binding popups to it.\r\n *\r\n * ```js\r\n * var layer = L.Polygon(latlngs).bindPopup('Hi There!').addTo(map);\r\n * layer.openPopup();\r\n * layer.closePopup();\r\n * ```\r\n *\r\n * Popups will also be automatically opened when the layer is clicked on and closed when the layer is removed from the map or another popup is opened.\r\n */\r\n\r\n// @section Popup methods\r\nLayer.include({\r\n\r\n\t// @method bindPopup(content: String|HTMLElement|Function|Popup, options?: Popup options): this\r\n\t// Binds a popup to the layer with the passed `content` and sets up the\r\n\t// necessary event listeners. If a `Function` is passed it will receive\r\n\t// the layer as the first argument and should return a `String` or `HTMLElement`.\r\n\tbindPopup: function (content, options) {\r\n\r\n\t\tif (content instanceof Popup) {\r\n\t\t\tsetOptions(content, options);\r\n\t\t\tthis._popup = content;\r\n\t\t\tcontent._source = this;\r\n\t\t} else {\r\n\t\t\tif (!this._popup || options) {\r\n\t\t\t\tthis._popup = new Popup(options, this);\r\n\t\t\t}\r\n\t\t\tthis._popup.setContent(content);\r\n\t\t}\r\n\r\n\t\tif (!this._popupHandlersAdded) {\r\n\t\t\tthis.on({\r\n\t\t\t\tclick: this._openPopup,\r\n\t\t\t\tkeypress: this._onKeyPress,\r\n\t\t\t\tremove: this.closePopup,\r\n\t\t\t\tmove: this._movePopup\r\n\t\t\t});\r\n\t\t\tthis._popupHandlersAdded = true;\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method unbindPopup(): this\r\n\t// Removes the popup previously bound with `bindPopup`.\r\n\tunbindPopup: function () {\r\n\t\tif (this._popup) {\r\n\t\t\tthis.off({\r\n\t\t\t\tclick: this._openPopup,\r\n\t\t\t\tkeypress: this._onKeyPress,\r\n\t\t\t\tremove: this.closePopup,\r\n\t\t\t\tmove: this._movePopup\r\n\t\t\t});\r\n\t\t\tthis._popupHandlersAdded = false;\r\n\t\t\tthis._popup = null;\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method openPopup(latlng?: LatLng): this\r\n\t// Opens the bound popup at the specified `latlng` or at the default popup anchor if no `latlng` is passed.\r\n\topenPopup: function (layer, latlng) {\r\n\t\tif (!(layer instanceof Layer)) {\r\n\t\t\tlatlng = layer;\r\n\t\t\tlayer = this;\r\n\t\t}\r\n\r\n\t\tif (layer instanceof FeatureGroup) {\r\n\t\t\tfor (var id in this._layers) {\r\n\t\t\t\tlayer = this._layers[id];\r\n\t\t\t\tbreak;\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tif (!latlng) {\r\n\t\t\tlatlng = layer.getCenter ? layer.getCenter() : layer.getLatLng();\r\n\t\t}\r\n\r\n\t\tif (this._popup && this._map) {\r\n\t\t\t// set popup source to this layer\r\n\t\t\tthis._popup._source = layer;\r\n\r\n\t\t\t// update the popup (content, layout, ect...)\r\n\t\t\tthis._popup.update();\r\n\r\n\t\t\t// open the popup on the map\r\n\t\t\tthis._map.openPopup(this._popup, latlng);\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method closePopup(): this\r\n\t// Closes the popup bound to this layer if it is open.\r\n\tclosePopup: function () {\r\n\t\tif (this._popup) {\r\n\t\t\tthis._popup._close();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method togglePopup(): this\r\n\t// Opens or closes the popup bound to this layer depending on its current state.\r\n\ttogglePopup: function (target) {\r\n\t\tif (this._popup) {\r\n\t\t\tif (this._popup._map) {\r\n\t\t\t\tthis.closePopup();\r\n\t\t\t} else {\r\n\t\t\t\tthis.openPopup(target);\r\n\t\t\t}\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method isPopupOpen(): boolean\r\n\t// Returns `true` if the popup bound to this layer is currently open.\r\n\tisPopupOpen: function () {\r\n\t\treturn (this._popup ? this._popup.isOpen() : false);\r\n\t},\r\n\r\n\t// @method setPopupContent(content: String|HTMLElement|Popup): this\r\n\t// Sets the content of the popup bound to this layer.\r\n\tsetPopupContent: function (content) {\r\n\t\tif (this._popup) {\r\n\t\t\tthis._popup.setContent(content);\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method getPopup(): Popup\r\n\t// Returns the popup bound to this layer.\r\n\tgetPopup: function () {\r\n\t\treturn this._popup;\r\n\t},\r\n\r\n\t_openPopup: function (e) {\r\n\t\tvar layer = e.layer || e.target;\r\n\r\n\t\tif (!this._popup) {\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\tif (!this._map) {\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\t// prevent map click\r\n\t\tstop(e);\r\n\r\n\t\t// if this inherits from Path its a vector and we can just\r\n\t\t// open the popup at the new location\r\n\t\tif (layer instanceof Path) {\r\n\t\t\tthis.openPopup(e.layer || e.target, e.latlng);\r\n\t\t\treturn;\r\n\t\t}\r\n\r\n\t\t// otherwise treat it like a marker and figure out\r\n\t\t// if we should toggle it open/closed\r\n\t\tif (this._map.hasLayer(this._popup) && this._popup._source === layer) {\r\n\t\t\tthis.closePopup();\r\n\t\t} else {\r\n\t\t\tthis.openPopup(layer, e.latlng);\r\n\t\t}\r\n\t},\r\n\r\n\t_movePopup: function (e) {\r\n\t\tthis._popup.setLatLng(e.latlng);\r\n\t},\r\n\r\n\t_onKeyPress: function (e) {\r\n\t\tif (e.originalEvent.keyCode === 13) {\r\n\t\t\tthis._openPopup(e);\r\n\t\t}\r\n\t}\r\n});\n\n/*\n * @class Tooltip\n * @inherits DivOverlay\n * @aka L.Tooltip\n * Used to display small texts on top of map layers.\n *\n * @example\n *\n * ```js\n * marker.bindTooltip(\"my tooltip text\").openTooltip();\n * ```\n * Note about tooltip offset. Leaflet takes two options in consideration\n * for computing tooltip offsetting:\n * - the `offset` Tooltip option: it defaults to [0, 0], and it's specific to one tooltip.\n * Add a positive x offset to move the tooltip to the right, and a positive y offset to\n * move it to the bottom. Negatives will move to the left and top.\n * - the `tooltipAnchor` Icon option: this will only be considered for Marker. You\n * should adapt this value if you use a custom icon.\n */\n\n\n// @namespace Tooltip\nvar Tooltip = DivOverlay.extend({\n\n\t// @section\n\t// @aka Tooltip options\n\toptions: {\n\t\t// @option pane: String = 'tooltipPane'\n\t\t// `Map pane` where the tooltip will be added.\n\t\tpane: 'tooltipPane',\n\n\t\t// @option offset: Point = Point(0, 0)\n\t\t// Optional offset of the tooltip position.\n\t\toffset: [0, 0],\n\n\t\t// @option direction: String = 'auto'\n\t\t// Direction where to open the tooltip. Possible values are: `right`, `left`,\n\t\t// `top`, `bottom`, `center`, `auto`.\n\t\t// `auto` will dynamically switch between `right` and `left` according to the tooltip\n\t\t// position on the map.\n\t\tdirection: 'auto',\n\n\t\t// @option permanent: Boolean = false\n\t\t// Whether to open the tooltip permanently or only on mouseover.\n\t\tpermanent: false,\n\n\t\t// @option sticky: Boolean = false\n\t\t// If true, the tooltip will follow the mouse instead of being fixed at the feature center.\n\t\tsticky: false,\n\n\t\t// @option interactive: Boolean = false\n\t\t// If true, the tooltip will listen to the feature events.\n\t\tinteractive: false,\n\n\t\t// @option opacity: Number = 0.9\n\t\t// Tooltip container opacity.\n\t\topacity: 0.9\n\t},\n\n\tonAdd: function (map) {\n\t\tDivOverlay.prototype.onAdd.call(this, map);\n\t\tthis.setOpacity(this.options.opacity);\n\n\t\t// @namespace Map\n\t\t// @section Tooltip events\n\t\t// @event tooltipopen: TooltipEvent\n\t\t// Fired when a tooltip is opened in the map.\n\t\tmap.fire('tooltipopen', {tooltip: this});\n\n\t\tif (this._source) {\n\t\t\t// @namespace Layer\n\t\t\t// @section Tooltip events\n\t\t\t// @event tooltipopen: TooltipEvent\n\t\t\t// Fired when a tooltip bound to this layer is opened.\n\t\t\tthis._source.fire('tooltipopen', {tooltip: this}, true);\n\t\t}\n\t},\n\n\tonRemove: function (map) {\n\t\tDivOverlay.prototype.onRemove.call(this, map);\n\n\t\t// @namespace Map\n\t\t// @section Tooltip events\n\t\t// @event tooltipclose: TooltipEvent\n\t\t// Fired when a tooltip in the map is closed.\n\t\tmap.fire('tooltipclose', {tooltip: this});\n\n\t\tif (this._source) {\n\t\t\t// @namespace Layer\n\t\t\t// @section Tooltip events\n\t\t\t// @event tooltipclose: TooltipEvent\n\t\t\t// Fired when a tooltip bound to this layer is closed.\n\t\t\tthis._source.fire('tooltipclose', {tooltip: this}, true);\n\t\t}\n\t},\n\n\tgetEvents: function () {\n\t\tvar events = DivOverlay.prototype.getEvents.call(this);\n\n\t\tif (touch && !this.options.permanent) {\n\t\t\tevents.preclick = this._close;\n\t\t}\n\n\t\treturn events;\n\t},\n\n\t_close: function () {\n\t\tif (this._map) {\n\t\t\tthis._map.closeTooltip(this);\n\t\t}\n\t},\n\n\t_initLayout: function () {\n\t\tvar prefix = 'leaflet-tooltip',\n\t\t className = prefix + ' ' + (this.options.className || '') + ' leaflet-zoom-' + (this._zoomAnimated ? 'animated' : 'hide');\n\n\t\tthis._contentNode = this._container = create$1('div', className);\n\t},\n\n\t_updateLayout: function () {},\n\n\t_adjustPan: function () {},\n\n\t_setPosition: function (pos) {\n\t\tvar map = this._map,\n\t\t container = this._container,\n\t\t centerPoint = map.latLngToContainerPoint(map.getCenter()),\n\t\t tooltipPoint = map.layerPointToContainerPoint(pos),\n\t\t direction = this.options.direction,\n\t\t tooltipWidth = container.offsetWidth,\n\t\t tooltipHeight = container.offsetHeight,\n\t\t offset = toPoint(this.options.offset),\n\t\t anchor = this._getAnchor();\n\n\t\tif (direction === 'top') {\n\t\t\tpos = pos.add(toPoint(-tooltipWidth / 2 + offset.x, -tooltipHeight + offset.y + anchor.y, true));\n\t\t} else if (direction === 'bottom') {\n\t\t\tpos = pos.subtract(toPoint(tooltipWidth / 2 - offset.x, -offset.y, true));\n\t\t} else if (direction === 'center') {\n\t\t\tpos = pos.subtract(toPoint(tooltipWidth / 2 + offset.x, tooltipHeight / 2 - anchor.y + offset.y, true));\n\t\t} else if (direction === 'right' || direction === 'auto' && tooltipPoint.x < centerPoint.x) {\n\t\t\tdirection = 'right';\n\t\t\tpos = pos.add(toPoint(offset.x + anchor.x, anchor.y - tooltipHeight / 2 + offset.y, true));\n\t\t} else {\n\t\t\tdirection = 'left';\n\t\t\tpos = pos.subtract(toPoint(tooltipWidth + anchor.x - offset.x, tooltipHeight / 2 - anchor.y - offset.y, true));\n\t\t}\n\n\t\tremoveClass(container, 'leaflet-tooltip-right');\n\t\tremoveClass(container, 'leaflet-tooltip-left');\n\t\tremoveClass(container, 'leaflet-tooltip-top');\n\t\tremoveClass(container, 'leaflet-tooltip-bottom');\n\t\taddClass(container, 'leaflet-tooltip-' + direction);\n\t\tsetPosition(container, pos);\n\t},\n\n\t_updatePosition: function () {\n\t\tvar pos = this._map.latLngToLayerPoint(this._latlng);\n\t\tthis._setPosition(pos);\n\t},\n\n\tsetOpacity: function (opacity) {\n\t\tthis.options.opacity = opacity;\n\n\t\tif (this._container) {\n\t\t\tsetOpacity(this._container, opacity);\n\t\t}\n\t},\n\n\t_animateZoom: function (e) {\n\t\tvar pos = this._map._latLngToNewLayerPoint(this._latlng, e.zoom, e.center);\n\t\tthis._setPosition(pos);\n\t},\n\n\t_getAnchor: function () {\n\t\t// Where should we anchor the tooltip on the source layer?\n\t\treturn toPoint(this._source && this._source._getTooltipAnchor && !this.options.sticky ? this._source._getTooltipAnchor() : [0, 0]);\n\t}\n\n});\n\n// @namespace Tooltip\n// @factory L.tooltip(options?: Tooltip options, source?: Layer)\n// Instantiates a Tooltip object given an optional `options` object that describes its appearance and location and an optional `source` object that is used to tag the tooltip with a reference to the Layer to which it refers.\nvar tooltip = function (options, source) {\n\treturn new Tooltip(options, source);\n};\n\n// @namespace Map\n// @section Methods for Layers and Controls\nMap.include({\n\n\t// @method openTooltip(tooltip: Tooltip): this\n\t// Opens the specified tooltip.\n\t// @alternative\n\t// @method openTooltip(content: String|HTMLElement, latlng: LatLng, options?: Tooltip options): this\n\t// Creates a tooltip with the specified content and options and open it.\n\topenTooltip: function (tooltip, latlng, options) {\n\t\tif (!(tooltip instanceof Tooltip)) {\n\t\t\ttooltip = new Tooltip(options).setContent(tooltip);\n\t\t}\n\n\t\tif (latlng) {\n\t\t\ttooltip.setLatLng(latlng);\n\t\t}\n\n\t\tif (this.hasLayer(tooltip)) {\n\t\t\treturn this;\n\t\t}\n\n\t\treturn this.addLayer(tooltip);\n\t},\n\n\t// @method closeTooltip(tooltip?: Tooltip): this\n\t// Closes the tooltip given as parameter.\n\tcloseTooltip: function (tooltip) {\n\t\tif (tooltip) {\n\t\t\tthis.removeLayer(tooltip);\n\t\t}\n\t\treturn this;\n\t}\n\n});\n\n/*\n * @namespace Layer\n * @section Tooltip methods example\n *\n * All layers share a set of methods convenient for binding tooltips to it.\n *\n * ```js\n * var layer = L.Polygon(latlngs).bindTooltip('Hi There!').addTo(map);\n * layer.openTooltip();\n * layer.closeTooltip();\n * ```\n */\n\n// @section Tooltip methods\nLayer.include({\n\n\t// @method bindTooltip(content: String|HTMLElement|Function|Tooltip, options?: Tooltip options): this\n\t// Binds a tooltip to the layer with the passed `content` and sets up the\n\t// necessary event listeners. If a `Function` is passed it will receive\n\t// the layer as the first argument and should return a `String` or `HTMLElement`.\n\tbindTooltip: function (content, options) {\n\n\t\tif (content instanceof Tooltip) {\n\t\t\tsetOptions(content, options);\n\t\t\tthis._tooltip = content;\n\t\t\tcontent._source = this;\n\t\t} else {\n\t\t\tif (!this._tooltip || options) {\n\t\t\t\tthis._tooltip = new Tooltip(options, this);\n\t\t\t}\n\t\t\tthis._tooltip.setContent(content);\n\n\t\t}\n\n\t\tthis._initTooltipInteractions();\n\n\t\tif (this._tooltip.options.permanent && this._map && this._map.hasLayer(this)) {\n\t\t\tthis.openTooltip();\n\t\t}\n\n\t\treturn this;\n\t},\n\n\t// @method unbindTooltip(): this\n\t// Removes the tooltip previously bound with `bindTooltip`.\n\tunbindTooltip: function () {\n\t\tif (this._tooltip) {\n\t\t\tthis._initTooltipInteractions(true);\n\t\t\tthis.closeTooltip();\n\t\t\tthis._tooltip = null;\n\t\t}\n\t\treturn this;\n\t},\n\n\t_initTooltipInteractions: function (remove$$1) {\n\t\tif (!remove$$1 && this._tooltipHandlersAdded) { return; }\n\t\tvar onOff = remove$$1 ? 'off' : 'on',\n\t\t events = {\n\t\t\tremove: this.closeTooltip,\n\t\t\tmove: this._moveTooltip\n\t\t };\n\t\tif (!this._tooltip.options.permanent) {\n\t\t\tevents.mouseover = this._openTooltip;\n\t\t\tevents.mouseout = this.closeTooltip;\n\t\t\tif (this._tooltip.options.sticky) {\n\t\t\t\tevents.mousemove = this._moveTooltip;\n\t\t\t}\n\t\t\tif (touch) {\n\t\t\t\tevents.click = this._openTooltip;\n\t\t\t}\n\t\t} else {\n\t\t\tevents.add = this._openTooltip;\n\t\t}\n\t\tthis[onOff](events);\n\t\tthis._tooltipHandlersAdded = !remove$$1;\n\t},\n\n\t// @method openTooltip(latlng?: LatLng): this\n\t// Opens the bound tooltip at the specified `latlng` or at the default tooltip anchor if no `latlng` is passed.\n\topenTooltip: function (layer, latlng) {\n\t\tif (!(layer instanceof Layer)) {\n\t\t\tlatlng = layer;\n\t\t\tlayer = this;\n\t\t}\n\n\t\tif (layer instanceof FeatureGroup) {\n\t\t\tfor (var id in this._layers) {\n\t\t\t\tlayer = this._layers[id];\n\t\t\t\tbreak;\n\t\t\t}\n\t\t}\n\n\t\tif (!latlng) {\n\t\t\tlatlng = layer.getCenter ? layer.getCenter() : layer.getLatLng();\n\t\t}\n\n\t\tif (this._tooltip && this._map) {\n\n\t\t\t// set tooltip source to this layer\n\t\t\tthis._tooltip._source = layer;\n\n\t\t\t// update the tooltip (content, layout, ect...)\n\t\t\tthis._tooltip.update();\n\n\t\t\t// open the tooltip on the map\n\t\t\tthis._map.openTooltip(this._tooltip, latlng);\n\n\t\t\t// Tooltip container may not be defined if not permanent and never\n\t\t\t// opened.\n\t\t\tif (this._tooltip.options.interactive && this._tooltip._container) {\n\t\t\t\taddClass(this._tooltip._container, 'leaflet-clickable');\n\t\t\t\tthis.addInteractiveTarget(this._tooltip._container);\n\t\t\t}\n\t\t}\n\n\t\treturn this;\n\t},\n\n\t// @method closeTooltip(): this\n\t// Closes the tooltip bound to this layer if it is open.\n\tcloseTooltip: function () {\n\t\tif (this._tooltip) {\n\t\t\tthis._tooltip._close();\n\t\t\tif (this._tooltip.options.interactive && this._tooltip._container) {\n\t\t\t\tremoveClass(this._tooltip._container, 'leaflet-clickable');\n\t\t\t\tthis.removeInteractiveTarget(this._tooltip._container);\n\t\t\t}\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method toggleTooltip(): this\n\t// Opens or closes the tooltip bound to this layer depending on its current state.\n\ttoggleTooltip: function (target) {\n\t\tif (this._tooltip) {\n\t\t\tif (this._tooltip._map) {\n\t\t\t\tthis.closeTooltip();\n\t\t\t} else {\n\t\t\t\tthis.openTooltip(target);\n\t\t\t}\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method isTooltipOpen(): boolean\n\t// Returns `true` if the tooltip bound to this layer is currently open.\n\tisTooltipOpen: function () {\n\t\treturn this._tooltip.isOpen();\n\t},\n\n\t// @method setTooltipContent(content: String|HTMLElement|Tooltip): this\n\t// Sets the content of the tooltip bound to this layer.\n\tsetTooltipContent: function (content) {\n\t\tif (this._tooltip) {\n\t\t\tthis._tooltip.setContent(content);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method getTooltip(): Tooltip\n\t// Returns the tooltip bound to this layer.\n\tgetTooltip: function () {\n\t\treturn this._tooltip;\n\t},\n\n\t_openTooltip: function (e) {\n\t\tvar layer = e.layer || e.target;\n\n\t\tif (!this._tooltip || !this._map) {\n\t\t\treturn;\n\t\t}\n\t\tthis.openTooltip(layer, this._tooltip.options.sticky ? e.latlng : undefined);\n\t},\n\n\t_moveTooltip: function (e) {\n\t\tvar latlng = e.latlng, containerPoint, layerPoint;\n\t\tif (this._tooltip.options.sticky && e.originalEvent) {\n\t\t\tcontainerPoint = this._map.mouseEventToContainerPoint(e.originalEvent);\n\t\t\tlayerPoint = this._map.containerPointToLayerPoint(containerPoint);\n\t\t\tlatlng = this._map.layerPointToLatLng(layerPoint);\n\t\t}\n\t\tthis._tooltip.setLatLng(latlng);\n\t}\n});\n\n/*\n * @class DivIcon\n * @aka L.DivIcon\n * @inherits Icon\n *\n * Represents a lightweight icon for markers that uses a simple `<div>`\n * element instead of an image. Inherits from `Icon` but ignores the `iconUrl` and shadow options.\n *\n * @example\n * ```js\n * var myIcon = L.divIcon({className: 'my-div-icon'});\n * // you can set .my-div-icon styles in CSS\n *\n * L.marker([50.505, 30.57], {icon: myIcon}).addTo(map);\n * ```\n *\n * By default, it has a 'leaflet-div-icon' CSS class and is styled as a little white square with a shadow.\n */\n\nvar DivIcon = Icon.extend({\n\toptions: {\n\t\t// @section\n\t\t// @aka DivIcon options\n\t\ticonSize: [12, 12], // also can be set through CSS\n\n\t\t// iconAnchor: (Point),\n\t\t// popupAnchor: (Point),\n\n\t\t// @option html: String = ''\n\t\t// Custom HTML code to put inside the div element, empty by default.\n\t\thtml: false,\n\n\t\t// @option bgPos: Point = [0, 0]\n\t\t// Optional relative position of the background, in pixels\n\t\tbgPos: null,\n\n\t\tclassName: 'leaflet-div-icon'\n\t},\n\n\tcreateIcon: function (oldIcon) {\n\t\tvar div = (oldIcon && oldIcon.tagName === 'DIV') ? oldIcon : document.createElement('div'),\n\t\t options = this.options;\n\n\t\tdiv.innerHTML = options.html !== false ? options.html : '';\n\n\t\tif (options.bgPos) {\n\t\t\tvar bgPos = toPoint(options.bgPos);\n\t\t\tdiv.style.backgroundPosition = (-bgPos.x) + 'px ' + (-bgPos.y) + 'px';\n\t\t}\n\t\tthis._setIconStyles(div, 'icon');\n\n\t\treturn div;\n\t},\n\n\tcreateShadow: function () {\n\t\treturn null;\n\t}\n});\n\n// @factory L.divIcon(options: DivIcon options)\n// Creates a `DivIcon` instance with the given options.\nfunction divIcon(options) {\n\treturn new DivIcon(options);\n}\n\nIcon.Default = IconDefault;\n\n/*\n * @class GridLayer\n * @inherits Layer\n * @aka L.GridLayer\n *\n * Generic class for handling a tiled grid of HTML elements. This is the base class for all tile layers and replaces `TileLayer.Canvas`.\n * GridLayer can be extended to create a tiled grid of HTML elements like `<canvas>`, `<img>` or `<div>`. GridLayer will handle creating and animating these DOM elements for you.\n *\n *\n * @section Synchronous usage\n * @example\n *\n * To create a custom layer, extend GridLayer and implement the `createTile()` method, which will be passed a `Point` object with the `x`, `y`, and `z` (zoom level) coordinates to draw your tile.\n *\n * ```js\n * var CanvasLayer = L.GridLayer.extend({\n * createTile: function(coords){\n * // create a <canvas> element for drawing\n * var tile = L.DomUtil.create('canvas', 'leaflet-tile');\n *\n * // setup tile width and height according to the options\n * var size = this.getTileSize();\n * tile.width = size.x;\n * tile.height = size.y;\n *\n * // get a canvas context and draw something on it using coords.x, coords.y and coords.z\n * var ctx = tile.getContext('2d');\n *\n * // return the tile so it can be rendered on screen\n * return tile;\n * }\n * });\n * ```\n *\n * @section Asynchronous usage\n * @example\n *\n * Tile creation can also be asynchronous, this is useful when using a third-party drawing library. Once the tile is finished drawing it can be passed to the `done()` callback.\n *\n * ```js\n * var CanvasLayer = L.GridLayer.extend({\n * createTile: function(coords, done){\n * var error;\n *\n * // create a <canvas> element for drawing\n * var tile = L.DomUtil.create('canvas', 'leaflet-tile');\n *\n * // setup tile width and height according to the options\n * var size = this.getTileSize();\n * tile.width = size.x;\n * tile.height = size.y;\n *\n * // draw something asynchronously and pass the tile to the done() callback\n * setTimeout(function() {\n * done(error, tile);\n * }, 1000);\n *\n * return tile;\n * }\n * });\n * ```\n *\n * @section\n */\n\n\nvar GridLayer = Layer.extend({\n\n\t// @section\n\t// @aka GridLayer options\n\toptions: {\n\t\t// @option tileSize: Number|Point = 256\n\t\t// Width and height of tiles in the grid. Use a number if width and height are equal, or `L.point(width, height)` otherwise.\n\t\ttileSize: 256,\n\n\t\t// @option opacity: Number = 1.0\n\t\t// Opacity of the tiles. Can be used in the `createTile()` function.\n\t\topacity: 1,\n\n\t\t// @option updateWhenIdle: Boolean = (depends)\n\t\t// Load new tiles only when panning ends.\n\t\t// `true` by default on mobile browsers, in order to avoid too many requests and keep smooth navigation.\n\t\t// `false` otherwise in order to display new tiles _during_ panning, since it is easy to pan outside the\n\t\t// [`keepBuffer`](#gridlayer-keepbuffer) option in desktop browsers.\n\t\tupdateWhenIdle: mobile,\n\n\t\t// @option updateWhenZooming: Boolean = true\n\t\t// By default, a smooth zoom animation (during a [touch zoom](#map-touchzoom) or a [`flyTo()`](#map-flyto)) will update grid layers every integer zoom level. Setting this option to `false` will update the grid layer only when the smooth animation ends.\n\t\tupdateWhenZooming: true,\n\n\t\t// @option updateInterval: Number = 200\n\t\t// Tiles will not update more than once every `updateInterval` milliseconds when panning.\n\t\tupdateInterval: 200,\n\n\t\t// @option zIndex: Number = 1\n\t\t// The explicit zIndex of the tile layer.\n\t\tzIndex: 1,\n\n\t\t// @option bounds: LatLngBounds = undefined\n\t\t// If set, tiles will only be loaded inside the set `LatLngBounds`.\n\t\tbounds: null,\n\n\t\t// @option minZoom: Number = 0\n\t\t// The minimum zoom level down to which this layer will be displayed (inclusive).\n\t\tminZoom: 0,\n\n\t\t// @option maxZoom: Number = undefined\n\t\t// The maximum zoom level up to which this layer will be displayed (inclusive).\n\t\tmaxZoom: undefined,\n\n\t\t// @option maxNativeZoom: Number = undefined\n\t\t// Maximum zoom number the tile source has available. If it is specified,\n\t\t// the tiles on all zoom levels higher than `maxNativeZoom` will be loaded\n\t\t// from `maxNativeZoom` level and auto-scaled.\n\t\tmaxNativeZoom: undefined,\n\n\t\t// @option minNativeZoom: Number = undefined\n\t\t// Minimum zoom number the tile source has available. If it is specified,\n\t\t// the tiles on all zoom levels lower than `minNativeZoom` will be loaded\n\t\t// from `minNativeZoom` level and auto-scaled.\n\t\tminNativeZoom: undefined,\n\n\t\t// @option noWrap: Boolean = false\n\t\t// Whether the layer is wrapped around the antimeridian. If `true`, the\n\t\t// GridLayer will only be displayed once at low zoom levels. Has no\n\t\t// effect when the [map CRS](#map-crs) doesn't wrap around. Can be used\n\t\t// in combination with [`bounds`](#gridlayer-bounds) to prevent requesting\n\t\t// tiles outside the CRS limits.\n\t\tnoWrap: false,\n\n\t\t// @option pane: String = 'tilePane'\n\t\t// `Map pane` where the grid layer will be added.\n\t\tpane: 'tilePane',\n\n\t\t// @option className: String = ''\n\t\t// A custom class name to assign to the tile layer. Empty by default.\n\t\tclassName: '',\n\n\t\t// @option keepBuffer: Number = 2\n\t\t// When panning the map, keep this many rows and columns of tiles before unloading them.\n\t\tkeepBuffer: 2\n\t},\n\n\tinitialize: function (options) {\n\t\tsetOptions(this, options);\n\t},\n\n\tonAdd: function () {\n\t\tthis._initContainer();\n\n\t\tthis._levels = {};\n\t\tthis._tiles = {};\n\n\t\tthis._resetView();\n\t\tthis._update();\n\t},\n\n\tbeforeAdd: function (map) {\n\t\tmap._addZoomLimit(this);\n\t},\n\n\tonRemove: function (map) {\n\t\tthis._removeAllTiles();\n\t\tremove(this._container);\n\t\tmap._removeZoomLimit(this);\n\t\tthis._container = null;\n\t\tthis._tileZoom = undefined;\n\t},\n\n\t// @method bringToFront: this\n\t// Brings the tile layer to the top of all tile layers.\n\tbringToFront: function () {\n\t\tif (this._map) {\n\t\t\ttoFront(this._container);\n\t\t\tthis._setAutoZIndex(Math.max);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method bringToBack: this\n\t// Brings the tile layer to the bottom of all tile layers.\n\tbringToBack: function () {\n\t\tif (this._map) {\n\t\t\ttoBack(this._container);\n\t\t\tthis._setAutoZIndex(Math.min);\n\t\t}\n\t\treturn this;\n\t},\n\n\t// @method getContainer: HTMLElement\n\t// Returns the HTML element that contains the tiles for this layer.\n\tgetContainer: function () {\n\t\treturn this._container;\n\t},\n\n\t// @method setOpacity(opacity: Number): this\n\t// Changes the [opacity](#gridlayer-opacity) of the grid layer.\n\tsetOpacity: function (opacity) {\n\t\tthis.options.opacity = opacity;\n\t\tthis._updateOpacity();\n\t\treturn this;\n\t},\n\n\t// @method setZIndex(zIndex: Number): this\n\t// Changes the [zIndex](#gridlayer-zindex) of the grid layer.\n\tsetZIndex: function (zIndex) {\n\t\tthis.options.zIndex = zIndex;\n\t\tthis._updateZIndex();\n\n\t\treturn this;\n\t},\n\n\t// @method isLoading: Boolean\n\t// Returns `true` if any tile in the grid layer has not finished loading.\n\tisLoading: function () {\n\t\treturn this._loading;\n\t},\n\n\t// @method redraw: this\n\t// Causes the layer to clear all the tiles and request them again.\n\tredraw: function () {\n\t\tif (this._map) {\n\t\t\tthis._removeAllTiles();\n\t\t\tthis._update();\n\t\t}\n\t\treturn this;\n\t},\n\n\tgetEvents: function () {\n\t\tvar events = {\n\t\t\tviewprereset: this._invalidateAll,\n\t\t\tviewreset: this._resetView,\n\t\t\tzoom: this._resetView,\n\t\t\tmoveend: this._onMoveEnd\n\t\t};\n\n\t\tif (!this.options.updateWhenIdle) {\n\t\t\t// update tiles on move, but not more often than once per given interval\n\t\t\tif (!this._onMove) {\n\t\t\t\tthis._onMove = throttle(this._onMoveEnd, this.options.updateInterval, this);\n\t\t\t}\n\n\t\t\tevents.move = this._onMove;\n\t\t}\n\n\t\tif (this._zoomAnimated) {\n\t\t\tevents.zoomanim = this._animateZoom;\n\t\t}\n\n\t\treturn events;\n\t},\n\n\t// @section Extension methods\n\t// Layers extending `GridLayer` shall reimplement the following method.\n\t// @method createTile(coords: Object, done?: Function): HTMLElement\n\t// Called only internally, must be overridden by classes extending `GridLayer`.\n\t// Returns the `HTMLElement` corresponding to the given `coords`. If the `done` callback\n\t// is specified, it must be called when the tile has finished loading and drawing.\n\tcreateTile: function () {\n\t\treturn document.createElement('div');\n\t},\n\n\t// @section\n\t// @method getTileSize: Point\n\t// Normalizes the [tileSize option](#gridlayer-tilesize) into a point. Used by the `createTile()` method.\n\tgetTileSize: function () {\n\t\tvar s = this.options.tileSize;\n\t\treturn s instanceof Point ? s : new Point(s, s);\n\t},\n\n\t_updateZIndex: function () {\n\t\tif (this._container && this.options.zIndex !== undefined && this.options.zIndex !== null) {\n\t\t\tthis._container.style.zIndex = this.options.zIndex;\n\t\t}\n\t},\n\n\t_setAutoZIndex: function (compare) {\n\t\t// go through all other layers of the same pane, set zIndex to max + 1 (front) or min - 1 (back)\n\n\t\tvar layers = this.getPane().children,\n\t\t edgeZIndex = -compare(-Infinity, Infinity); // -Infinity for max, Infinity for min\n\n\t\tfor (var i = 0, len = layers.length, zIndex; i < len; i++) {\n\n\t\t\tzIndex = layers[i].style.zIndex;\n\n\t\t\tif (layers[i] !== this._container && zIndex) {\n\t\t\t\tedgeZIndex = compare(edgeZIndex, +zIndex);\n\t\t\t}\n\t\t}\n\n\t\tif (isFinite(edgeZIndex)) {\n\t\t\tthis.options.zIndex = edgeZIndex + compare(-1, 1);\n\t\t\tthis._updateZIndex();\n\t\t}\n\t},\n\n\t_updateOpacity: function () {\n\t\tif (!this._map) { return; }\n\n\t\t// IE doesn't inherit filter opacity properly, so we're forced to set it on tiles\n\t\tif (ielt9) { return; }\n\n\t\tsetOpacity(this._container, this.options.opacity);\n\n\t\tvar now = +new Date(),\n\t\t nextFrame = false,\n\t\t willPrune = false;\n\n\t\tfor (var key in this._tiles) {\n\t\t\tvar tile = this._tiles[key];\n\t\t\tif (!tile.current || !tile.loaded) { continue; }\n\n\t\t\tvar fade = Math.min(1, (now - tile.loaded) / 200);\n\n\t\t\tsetOpacity(tile.el, fade);\n\t\t\tif (fade < 1) {\n\t\t\t\tnextFrame = true;\n\t\t\t} else {\n\t\t\t\tif (tile.active) {\n\t\t\t\t\twillPrune = true;\n\t\t\t\t} else {\n\t\t\t\t\tthis._onOpaqueTile(tile);\n\t\t\t\t}\n\t\t\t\ttile.active = true;\n\t\t\t}\n\t\t}\n\n\t\tif (willPrune && !this._noPrune) { this._pruneTiles(); }\n\n\t\tif (nextFrame) {\n\t\t\tcancelAnimFrame(this._fadeFrame);\n\t\t\tthis._fadeFrame = requestAnimFrame(this._updateOpacity, this);\n\t\t}\n\t},\n\n\t_onOpaqueTile: falseFn,\n\n\t_initContainer: function () {\n\t\tif (this._container) { return; }\n\n\t\tthis._container = create$1('div', 'leaflet-layer ' + (this.options.className || ''));\n\t\tthis._updateZIndex();\n\n\t\tif (this.options.opacity < 1) {\n\t\t\tthis._updateOpacity();\n\t\t}\n\n\t\tthis.getPane().appendChild(this._container);\n\t},\n\n\t_updateLevels: function () {\n\n\t\tvar zoom = this._tileZoom,\n\t\t maxZoom = this.options.maxZoom;\n\n\t\tif (zoom === undefined) { return undefined; }\n\n\t\tfor (var z in this._levels) {\n\t\t\tif (this._levels[z].el.children.length || z === zoom) {\n\t\t\t\tthis._levels[z].el.style.zIndex = maxZoom - Math.abs(zoom - z);\n\t\t\t\tthis._onUpdateLevel(z);\n\t\t\t} else {\n\t\t\t\tremove(this._levels[z].el);\n\t\t\t\tthis._removeTilesAtZoom(z);\n\t\t\t\tthis._onRemoveLevel(z);\n\t\t\t\tdelete this._levels[z];\n\t\t\t}\n\t\t}\n\n\t\tvar level = this._levels[zoom],\n\t\t map = this._map;\n\n\t\tif (!level) {\n\t\t\tlevel = this._levels[zoom] = {};\n\n\t\t\tlevel.el = create$1('div', 'leaflet-tile-container leaflet-zoom-animated', this._container);\n\t\t\tlevel.el.style.zIndex = maxZoom;\n\n\t\t\tlevel.origin = map.project(map.unproject(map.getPixelOrigin()), zoom).round();\n\t\t\tlevel.zoom = zoom;\n\n\t\t\tthis._setZoomTransform(level, map.getCenter(), map.getZoom());\n\n\t\t\t// force the browser to consider the newly added element for transition\n\t\t\tfalseFn(level.el.offsetWidth);\n\n\t\t\tthis._onCreateLevel(level);\n\t\t}\n\n\t\tthis._level = level;\n\n\t\treturn level;\n\t},\n\n\t_onUpdateLevel: falseFn,\n\n\t_onRemoveLevel: falseFn,\n\n\t_onCreateLevel: falseFn,\n\n\t_pruneTiles: function () {\n\t\tif (!this._map) {\n\t\t\treturn;\n\t\t}\n\n\t\tvar key, tile;\n\n\t\tvar zoom = this._map.getZoom();\n\t\tif (zoom > this.options.maxZoom ||\n\t\t\tzoom < this.options.minZoom) {\n\t\t\tthis._removeAllTiles();\n\t\t\treturn;\n\t\t}\n\n\t\tfor (key in this._tiles) {\n\t\t\ttile = this._tiles[key];\n\t\t\ttile.retain = tile.current;\n\t\t}\n\n\t\tfor (key in this._tiles) {\n\t\t\ttile = this._tiles[key];\n\t\t\tif (tile.current && !tile.active) {\n\t\t\t\tvar coords = tile.coords;\n\t\t\t\tif (!this._retainParent(coords.x, coords.y, coords.z, coords.z - 5)) {\n\t\t\t\t\tthis._retainChildren(coords.x, coords.y, coords.z, coords.z + 2);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\tfor (key in this._tiles) {\n\t\t\tif (!this._tiles[key].retain) {\n\t\t\t\tthis._removeTile(key);\n\t\t\t}\n\t\t}\n\t},\n\n\t_removeTilesAtZoom: function (zoom) {\n\t\tfor (var key in this._tiles) {\n\t\t\tif (this._tiles[key].coords.z !== zoom) {\n\t\t\t\tcontinue;\n\t\t\t}\n\t\t\tthis._removeTile(key);\n\t\t}\n\t},\n\n\t_removeAllTiles: function () {\n\t\tfor (var key in this._tiles) {\n\t\t\tthis._removeTile(key);\n\t\t}\n\t},\n\n\t_invalidateAll: function () {\n\t\tfor (var z in this._levels) {\n\t\t\tremove(this._levels[z].el);\n\t\t\tthis._onRemoveLevel(z);\n\t\t\tdelete this._levels[z];\n\t\t}\n\t\tthis._removeAllTiles();\n\n\t\tthis._tileZoom = undefined;\n\t},\n\n\t_retainParent: function (x, y, z, minZoom) {\n\t\tvar x2 = Math.floor(x / 2),\n\t\t y2 = Math.floor(y / 2),\n\t\t z2 = z - 1,\n\t\t coords2 = new Point(+x2, +y2);\n\t\tcoords2.z = +z2;\n\n\t\tvar key = this._tileCoordsToKey(coords2),\n\t\t tile = this._tiles[key];\n\n\t\tif (tile && tile.active) {\n\t\t\ttile.retain = true;\n\t\t\treturn true;\n\n\t\t} else if (tile && tile.loaded) {\n\t\t\ttile.retain = true;\n\t\t}\n\n\t\tif (z2 > minZoom) {\n\t\t\treturn this._retainParent(x2, y2, z2, minZoom);\n\t\t}\n\n\t\treturn false;\n\t},\n\n\t_retainChildren: function (x, y, z, maxZoom) {\n\n\t\tfor (var i = 2 * x; i < 2 * x + 2; i++) {\n\t\t\tfor (var j = 2 * y; j < 2 * y + 2; j++) {\n\n\t\t\t\tvar coords = new Point(i, j);\n\t\t\t\tcoords.z = z + 1;\n\n\t\t\t\tvar key = this._tileCoordsToKey(coords),\n\t\t\t\t tile = this._tiles[key];\n\n\t\t\t\tif (tile && tile.active) {\n\t\t\t\t\ttile.retain = true;\n\t\t\t\t\tcontinue;\n\n\t\t\t\t} else if (tile && tile.loaded) {\n\t\t\t\t\ttile.retain = true;\n\t\t\t\t}\n\n\t\t\t\tif (z + 1 < maxZoom) {\n\t\t\t\t\tthis._retainChildren(i, j, z + 1, maxZoom);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t},\n\n\t_resetView: function (e) {\n\t\tvar animating = e && (e.pinch || e.flyTo);\n\t\tthis._setView(this._map.getCenter(), this._map.getZoom(), animating, animating);\n\t},\n\n\t_animateZoom: function (e) {\n\t\tthis._setView(e.center, e.zoom, true, e.noUpdate);\n\t},\n\n\t_clampZoom: function (zoom) {\n\t\tvar options = this.options;\n\n\t\tif (undefined !== options.minNativeZoom && zoom < options.minNativeZoom) {\n\t\t\treturn options.minNativeZoom;\n\t\t}\n\n\t\tif (undefined !== options.maxNativeZoom && options.maxNativeZoom < zoom) {\n\t\t\treturn options.maxNativeZoom;\n\t\t}\n\n\t\treturn zoom;\n\t},\n\n\t_setView: function (center, zoom, noPrune, noUpdate) {\n\t\tvar tileZoom = this._clampZoom(Math.round(zoom));\n\t\tif ((this.options.maxZoom !== undefined && tileZoom > this.options.maxZoom) ||\n\t\t (this.options.minZoom !== undefined && tileZoom < this.options.minZoom)) {\n\t\t\ttileZoom = undefined;\n\t\t}\n\n\t\tvar tileZoomChanged = this.options.updateWhenZooming && (tileZoom !== this._tileZoom);\n\n\t\tif (!noUpdate || tileZoomChanged) {\n\n\t\t\tthis._tileZoom = tileZoom;\n\n\t\t\tif (this._abortLoading) {\n\t\t\t\tthis._abortLoading();\n\t\t\t}\n\n\t\t\tthis._updateLevels();\n\t\t\tthis._resetGrid();\n\n\t\t\tif (tileZoom !== undefined) {\n\t\t\t\tthis._update(center);\n\t\t\t}\n\n\t\t\tif (!noPrune) {\n\t\t\t\tthis._pruneTiles();\n\t\t\t}\n\n\t\t\t// Flag to prevent _updateOpacity from pruning tiles during\n\t\t\t// a zoom anim or a pinch gesture\n\t\t\tthis._noPrune = !!noPrune;\n\t\t}\n\n\t\tthis._setZoomTransforms(center, zoom);\n\t},\n\n\t_setZoomTransforms: function (center, zoom) {\n\t\tfor (var i in this._levels) {\n\t\t\tthis._setZoomTransform(this._levels[i], center, zoom);\n\t\t}\n\t},\n\n\t_setZoomTransform: function (level, center, zoom) {\n\t\tvar scale = this._map.getZoomScale(zoom, level.zoom),\n\t\t translate = level.origin.multiplyBy(scale)\n\t\t .subtract(this._map._getNewPixelOrigin(center, zoom)).round();\n\n\t\tif (any3d) {\n\t\t\tsetTransform(level.el, translate, scale);\n\t\t} else {\n\t\t\tsetPosition(level.el, translate);\n\t\t}\n\t},\n\n\t_resetGrid: function () {\n\t\tvar map = this._map,\n\t\t crs = map.options.crs,\n\t\t tileSize = this._tileSize = this.getTileSize(),\n\t\t tileZoom = this._tileZoom;\n\n\t\tvar bounds = this._map.getPixelWorldBounds(this._tileZoom);\n\t\tif (bounds) {\n\t\t\tthis._globalTileRange = this._pxBoundsToTileRange(bounds);\n\t\t}\n\n\t\tthis._wrapX = crs.wrapLng && !this.options.noWrap && [\n\t\t\tMath.floor(map.project([0, crs.wrapLng[0]], tileZoom).x / tileSize.x),\n\t\t\tMath.ceil(map.project([0, crs.wrapLng[1]], tileZoom).x / tileSize.y)\n\t\t];\n\t\tthis._wrapY = crs.wrapLat && !this.options.noWrap && [\n\t\t\tMath.floor(map.project([crs.wrapLat[0], 0], tileZoom).y / tileSize.x),\n\t\t\tMath.ceil(map.project([crs.wrapLat[1], 0], tileZoom).y / tileSize.y)\n\t\t];\n\t},\n\n\t_onMoveEnd: function () {\n\t\tif (!this._map || this._map._animatingZoom) { return; }\n\n\t\tthis._update();\n\t},\n\n\t_getTiledPixelBounds: function (center) {\n\t\tvar map = this._map,\n\t\t mapZoom = map._animatingZoom ? Math.max(map._animateToZoom, map.getZoom()) : map.getZoom(),\n\t\t scale = map.getZoomScale(mapZoom, this._tileZoom),\n\t\t pixelCenter = map.project(center, this._tileZoom).floor(),\n\t\t halfSize = map.getSize().divideBy(scale * 2);\n\n\t\treturn new Bounds(pixelCenter.subtract(halfSize), pixelCenter.add(halfSize));\n\t},\n\n\t// Private method to load tiles in the grid's active zoom level according to map bounds\n\t_update: function (center) {\n\t\tvar map = this._map;\n\t\tif (!map) { return; }\n\t\tvar zoom = this._clampZoom(map.getZoom());\n\n\t\tif (center === undefined) { center = map.getCenter(); }\n\t\tif (this._tileZoom === undefined) { return; }\t// if out of minzoom/maxzoom\n\n\t\tvar pixelBounds = this._getTiledPixelBounds(center),\n\t\t tileRange = this._pxBoundsToTileRange(pixelBounds),\n\t\t tileCenter = tileRange.getCenter(),\n\t\t queue = [],\n\t\t margin = this.options.keepBuffer,\n\t\t noPruneRange = new Bounds(tileRange.getBottomLeft().subtract([margin, -margin]),\n\t\t tileRange.getTopRight().add([margin, -margin]));\n\n\t\t// Sanity check: panic if the tile range contains Infinity somewhere.\n\t\tif (!(isFinite(tileRange.min.x) &&\n\t\t isFinite(tileRange.min.y) &&\n\t\t isFinite(tileRange.max.x) &&\n\t\t isFinite(tileRange.max.y))) { throw new Error('Attempted to load an infinite number of tiles'); }\n\n\t\tfor (var key in this._tiles) {\n\t\t\tvar c = this._tiles[key].coords;\n\t\t\tif (c.z !== this._tileZoom || !noPruneRange.contains(new Point(c.x, c.y))) {\n\t\t\t\tthis._tiles[key].current = false;\n\t\t\t}\n\t\t}\n\n\t\t// _update just loads more tiles. If the tile zoom level differs too much\n\t\t// from the map's, let _setView reset levels and prune old tiles.\n\t\tif (Math.abs(zoom - this._tileZoom) > 1) { this._setView(center, zoom); return; }\n\n\t\t// create a queue of coordinates to load tiles from\n\t\tfor (var j = tileRange.min.y; j <= tileRange.max.y; j++) {\n\t\t\tfor (var i = tileRange.min.x; i <= tileRange.max.x; i++) {\n\t\t\t\tvar coords = new Point(i, j);\n\t\t\t\tcoords.z = this._tileZoom;\n\n\t\t\t\tif (!this._isValidTile(coords)) { continue; }\n\n\t\t\t\tvar tile = this._tiles[this._tileCoordsToKey(coords)];\n\t\t\t\tif (tile) {\n\t\t\t\t\ttile.current = true;\n\t\t\t\t} else {\n\t\t\t\t\tqueue.push(coords);\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// sort tile queue to load tiles in order of their distance to center\n\t\tqueue.sort(function (a, b) {\n\t\t\treturn a.distanceTo(tileCenter) - b.distanceTo(tileCenter);\n\t\t});\n\n\t\tif (queue.length !== 0) {\n\t\t\t// if it's the first batch of tiles to load\n\t\t\tif (!this._loading) {\n\t\t\t\tthis._loading = true;\n\t\t\t\t// @event loading: Event\n\t\t\t\t// Fired when the grid layer starts loading tiles.\n\t\t\t\tthis.fire('loading');\n\t\t\t}\n\n\t\t\t// create DOM fragment to append tiles in one batch\n\t\t\tvar fragment = document.createDocumentFragment();\n\n\t\t\tfor (i = 0; i < queue.length; i++) {\n\t\t\t\tthis._addTile(queue[i], fragment);\n\t\t\t}\n\n\t\t\tthis._level.el.appendChild(fragment);\n\t\t}\n\t},\n\n\t_isValidTile: function (coords) {\n\t\tvar crs = this._map.options.crs;\n\n\t\tif (!crs.infinite) {\n\t\t\t// don't load tile if it's out of bounds and not wrapped\n\t\t\tvar bounds = this._globalTileRange;\n\t\t\tif ((!crs.wrapLng && (coords.x < bounds.min.x || coords.x > bounds.max.x)) ||\n\t\t\t (!crs.wrapLat && (coords.y < bounds.min.y || coords.y > bounds.max.y))) { return false; }\n\t\t}\n\n\t\tif (!this.options.bounds) { return true; }\n\n\t\t// don't load tile if it doesn't intersect the bounds in options\n\t\tvar tileBounds = this._tileCoordsToBounds(coords);\n\t\treturn toLatLngBounds(this.options.bounds).overlaps(tileBounds);\n\t},\n\n\t_keyToBounds: function (key) {\n\t\treturn this._tileCoordsToBounds(this._keyToTileCoords(key));\n\t},\n\n\t_tileCoordsToNwSe: function (coords) {\n\t\tvar map = this._map,\n\t\t tileSize = this.getTileSize(),\n\t\t nwPoint = coords.scaleBy(tileSize),\n\t\t sePoint = nwPoint.add(tileSize),\n\t\t nw = map.unproject(nwPoint, coords.z),\n\t\t se = map.unproject(sePoint, coords.z);\n\t\treturn [nw, se];\n\t},\n\n\t// converts tile coordinates to its geographical bounds\n\t_tileCoordsToBounds: function (coords) {\n\t\tvar bp = this._tileCoordsToNwSe(coords),\n\t\t bounds = new LatLngBounds(bp[0], bp[1]);\n\n\t\tif (!this.options.noWrap) {\n\t\t\tbounds = this._map.wrapLatLngBounds(bounds);\n\t\t}\n\t\treturn bounds;\n\t},\n\t// converts tile coordinates to key for the tile cache\n\t_tileCoordsToKey: function (coords) {\n\t\treturn coords.x + ':' + coords.y + ':' + coords.z;\n\t},\n\n\t// converts tile cache key to coordinates\n\t_keyToTileCoords: function (key) {\n\t\tvar k = key.split(':'),\n\t\t coords = new Point(+k[0], +k[1]);\n\t\tcoords.z = +k[2];\n\t\treturn coords;\n\t},\n\n\t_removeTile: function (key) {\n\t\tvar tile = this._tiles[key];\n\t\tif (!tile) { return; }\n\n\t\t// Cancels any pending http requests associated with the tile\n\t\t// unless we're on Android's stock browser,\n\t\t// see https://github.com/Leaflet/Leaflet/issues/137\n\t\tif (!androidStock) {\n\t\t\ttile.el.setAttribute('src', emptyImageUrl);\n\t\t}\n\t\tremove(tile.el);\n\n\t\tdelete this._tiles[key];\n\n\t\t// @event tileunload: TileEvent\n\t\t// Fired when a tile is removed (e.g. when a tile goes off the screen).\n\t\tthis.fire('tileunload', {\n\t\t\ttile: tile.el,\n\t\t\tcoords: this._keyToTileCoords(key)\n\t\t});\n\t},\n\n\t_initTile: function (tile) {\n\t\taddClass(tile, 'leaflet-tile');\n\n\t\tvar tileSize = this.getTileSize();\n\t\ttile.style.width = tileSize.x + 'px';\n\t\ttile.style.height = tileSize.y + 'px';\n\n\t\ttile.onselectstart = falseFn;\n\t\ttile.onmousemove = falseFn;\n\n\t\t// update opacity on tiles in IE7-8 because of filter inheritance problems\n\t\tif (ielt9 && this.options.opacity < 1) {\n\t\t\tsetOpacity(tile, this.options.opacity);\n\t\t}\n\n\t\t// without this hack, tiles disappear after zoom on Chrome for Android\n\t\t// https://github.com/Leaflet/Leaflet/issues/2078\n\t\tif (android && !android23) {\n\t\t\ttile.style.WebkitBackfaceVisibility = 'hidden';\n\t\t}\n\t},\n\n\t_addTile: function (coords, container) {\n\t\tvar tilePos = this._getTilePos(coords),\n\t\t key = this._tileCoordsToKey(coords);\n\n\t\tvar tile = this.createTile(this._wrapCoords(coords), bind(this._tileReady, this, coords));\n\n\t\tthis._initTile(tile);\n\n\t\t// if createTile is defined with a second argument (\"done\" callback),\n\t\t// we know that tile is async and will be ready later; otherwise\n\t\tif (this.createTile.length < 2) {\n\t\t\t// mark tile as ready, but delay one frame for opacity animation to happen\n\t\t\trequestAnimFrame(bind(this._tileReady, this, coords, null, tile));\n\t\t}\n\n\t\tsetPosition(tile, tilePos);\n\n\t\t// save tile in cache\n\t\tthis._tiles[key] = {\n\t\t\tel: tile,\n\t\t\tcoords: coords,\n\t\t\tcurrent: true\n\t\t};\n\n\t\tcontainer.appendChild(tile);\n\t\t// @event tileloadstart: TileEvent\n\t\t// Fired when a tile is requested and starts loading.\n\t\tthis.fire('tileloadstart', {\n\t\t\ttile: tile,\n\t\t\tcoords: coords\n\t\t});\n\t},\n\n\t_tileReady: function (coords, err, tile) {\n\t\tif (!this._map) { return; }\n\n\t\tif (err) {\n\t\t\t// @event tileerror: TileErrorEvent\n\t\t\t// Fired when there is an error loading a tile.\n\t\t\tthis.fire('tileerror', {\n\t\t\t\terror: err,\n\t\t\t\ttile: tile,\n\t\t\t\tcoords: coords\n\t\t\t});\n\t\t}\n\n\t\tvar key = this._tileCoordsToKey(coords);\n\n\t\ttile = this._tiles[key];\n\t\tif (!tile) { return; }\n\n\t\ttile.loaded = +new Date();\n\t\tif (this._map._fadeAnimated) {\n\t\t\tsetOpacity(tile.el, 0);\n\t\t\tcancelAnimFrame(this._fadeFrame);\n\t\t\tthis._fadeFrame = requestAnimFrame(this._updateOpacity, this);\n\t\t} else {\n\t\t\ttile.active = true;\n\t\t\tthis._pruneTiles();\n\t\t}\n\n\t\tif (!err) {\n\t\t\taddClass(tile.el, 'leaflet-tile-loaded');\n\n\t\t\t// @event tileload: TileEvent\n\t\t\t// Fired when a tile loads.\n\t\t\tthis.fire('tileload', {\n\t\t\t\ttile: tile.el,\n\t\t\t\tcoords: coords\n\t\t\t});\n\t\t}\n\n\t\tif (this._noTilesToLoad()) {\n\t\t\tthis._loading = false;\n\t\t\t// @event load: Event\n\t\t\t// Fired when the grid layer loaded all visible tiles.\n\t\t\tthis.fire('load');\n\n\t\t\tif (ielt9 || !this._map._fadeAnimated) {\n\t\t\t\trequestAnimFrame(this._pruneTiles, this);\n\t\t\t} else {\n\t\t\t\t// Wait a bit more than 0.2 secs (the duration of the tile fade-in)\n\t\t\t\t// to trigger a pruning.\n\t\t\t\tsetTimeout(bind(this._pruneTiles, this), 250);\n\t\t\t}\n\t\t}\n\t},\n\n\t_getTilePos: function (coords) {\n\t\treturn coords.scaleBy(this.getTileSize()).subtract(this._level.origin);\n\t},\n\n\t_wrapCoords: function (coords) {\n\t\tvar newCoords = new Point(\n\t\t\tthis._wrapX ? wrapNum(coords.x, this._wrapX) : coords.x,\n\t\t\tthis._wrapY ? wrapNum(coords.y, this._wrapY) : coords.y);\n\t\tnewCoords.z = coords.z;\n\t\treturn newCoords;\n\t},\n\n\t_pxBoundsToTileRange: function (bounds) {\n\t\tvar tileSize = this.getTileSize();\n\t\treturn new Bounds(\n\t\t\tbounds.min.unscaleBy(tileSize).floor(),\n\t\t\tbounds.max.unscaleBy(tileSize).ceil().subtract([1, 1]));\n\t},\n\n\t_noTilesToLoad: function () {\n\t\tfor (var key in this._tiles) {\n\t\t\tif (!this._tiles[key].loaded) { return false; }\n\t\t}\n\t\treturn true;\n\t}\n});\n\n// @factory L.gridLayer(options?: GridLayer options)\n// Creates a new instance of GridLayer with the supplied options.\nfunction gridLayer(options) {\n\treturn new GridLayer(options);\n}\n\n/*\r\n * @class TileLayer\r\n * @inherits GridLayer\r\n * @aka L.TileLayer\r\n * Used to load and display tile layers on the map. Extends `GridLayer`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * L.tileLayer('http://{s}.tile.openstreetmap.org/{z}/{x}/{y}.png?{foo}', {foo: 'bar'}).addTo(map);\r\n * ```\r\n *\r\n * @section URL template\r\n * @example\r\n *\r\n * A string of the following form:\r\n *\r\n * ```\r\n * 'http://{s}.somedomain.com/blabla/{z}/{x}/{y}{r}.png'\r\n * ```\r\n *\r\n * `{s}` means one of the available subdomains (used sequentially to help with browser parallel requests per domain limitation; subdomain values are specified in options; `a`, `b` or `c` by default, can be omitted), `{z}` — zoom level, `{x}` and `{y}` — tile coordinates. `{r}` can be used to add \"&commat;2x\" to the URL to load retina tiles.\r\n *\r\n * You can use custom keys in the template, which will be [evaluated](#util-template) from TileLayer options, like this:\r\n *\r\n * ```\r\n * L.tileLayer('http://{s}.somedomain.com/{foo}/{z}/{x}/{y}.png', {foo: 'bar'});\r\n * ```\r\n */\r\n\r\n\r\nvar TileLayer = GridLayer.extend({\r\n\r\n\t// @section\r\n\t// @aka TileLayer options\r\n\toptions: {\r\n\t\t// @option minZoom: Number = 0\r\n\t\t// The minimum zoom level down to which this layer will be displayed (inclusive).\r\n\t\tminZoom: 0,\r\n\r\n\t\t// @option maxZoom: Number = 18\r\n\t\t// The maximum zoom level up to which this layer will be displayed (inclusive).\r\n\t\tmaxZoom: 18,\r\n\r\n\t\t// @option subdomains: String|String[] = 'abc'\r\n\t\t// Subdomains of the tile service. Can be passed in the form of one string (where each letter is a subdomain name) or an array of strings.\r\n\t\tsubdomains: 'abc',\r\n\r\n\t\t// @option errorTileUrl: String = ''\r\n\t\t// URL to the tile image to show in place of the tile that failed to load.\r\n\t\terrorTileUrl: '',\r\n\r\n\t\t// @option zoomOffset: Number = 0\r\n\t\t// The zoom number used in tile URLs will be offset with this value.\r\n\t\tzoomOffset: 0,\r\n\r\n\t\t// @option tms: Boolean = false\r\n\t\t// If `true`, inverses Y axis numbering for tiles (turn this on for [TMS](https://en.wikipedia.org/wiki/Tile_Map_Service) services).\r\n\t\ttms: false,\r\n\r\n\t\t// @option zoomReverse: Boolean = false\r\n\t\t// If set to true, the zoom number used in tile URLs will be reversed (`maxZoom - zoom` instead of `zoom`)\r\n\t\tzoomReverse: false,\r\n\r\n\t\t// @option detectRetina: Boolean = false\r\n\t\t// If `true` and user is on a retina display, it will request four tiles of half the specified size and a bigger zoom level in place of one to utilize the high resolution.\r\n\t\tdetectRetina: false,\r\n\r\n\t\t// @option crossOrigin: Boolean = false\r\n\t\t// If true, all tiles will have their crossOrigin attribute set to ''. This is needed if you want to access tile pixel data.\r\n\t\tcrossOrigin: false\r\n\t},\r\n\r\n\tinitialize: function (url, options) {\r\n\r\n\t\tthis._url = url;\r\n\r\n\t\toptions = setOptions(this, options);\r\n\r\n\t\t// detecting retina displays, adjusting tileSize and zoom levels\r\n\t\tif (options.detectRetina && retina && options.maxZoom > 0) {\r\n\r\n\t\t\toptions.tileSize = Math.floor(options.tileSize / 2);\r\n\r\n\t\t\tif (!options.zoomReverse) {\r\n\t\t\t\toptions.zoomOffset++;\r\n\t\t\t\toptions.maxZoom--;\r\n\t\t\t} else {\r\n\t\t\t\toptions.zoomOffset--;\r\n\t\t\t\toptions.minZoom++;\r\n\t\t\t}\r\n\r\n\t\t\toptions.minZoom = Math.max(0, options.minZoom);\r\n\t\t}\r\n\r\n\t\tif (typeof options.subdomains === 'string') {\r\n\t\t\toptions.subdomains = options.subdomains.split('');\r\n\t\t}\r\n\r\n\t\t// for https://github.com/Leaflet/Leaflet/issues/137\r\n\t\tif (!android) {\r\n\t\t\tthis.on('tileunload', this._onTileRemove);\r\n\t\t}\r\n\t},\r\n\r\n\t// @method setUrl(url: String, noRedraw?: Boolean): this\r\n\t// Updates the layer's URL template and redraws it (unless `noRedraw` is set to `true`).\r\n\tsetUrl: function (url, noRedraw) {\r\n\t\tthis._url = url;\r\n\r\n\t\tif (!noRedraw) {\r\n\t\t\tthis.redraw();\r\n\t\t}\r\n\t\treturn this;\r\n\t},\r\n\r\n\t// @method createTile(coords: Object, done?: Function): HTMLElement\r\n\t// Called only internally, overrides GridLayer's [`createTile()`](#gridlayer-createtile)\r\n\t// to return an `<img>` HTML element with the appropriate image URL given `coords`. The `done`\r\n\t// callback is called when the tile has been loaded.\r\n\tcreateTile: function (coords, done) {\r\n\t\tvar tile = document.createElement('img');\r\n\r\n\t\ton(tile, 'load', bind(this._tileOnLoad, this, done, tile));\r\n\t\ton(tile, 'error', bind(this._tileOnError, this, done, tile));\r\n\r\n\t\tif (this.options.crossOrigin) {\r\n\t\t\ttile.crossOrigin = '';\r\n\t\t}\r\n\r\n\t\t/*\r\n\t\t Alt tag is set to empty string to keep screen readers from reading URL and for compliance reasons\r\n\t\t http://www.w3.org/TR/WCAG20-TECHS/H67\r\n\t\t*/\r\n\t\ttile.alt = '';\r\n\r\n\t\t/*\r\n\t\t Set role=\"presentation\" to force screen readers to ignore this\r\n\t\t https://www.w3.org/TR/wai-aria/roles#textalternativecomputation\r\n\t\t*/\r\n\t\ttile.setAttribute('role', 'presentation');\r\n\r\n\t\ttile.src = this.getTileUrl(coords);\r\n\r\n\t\treturn tile;\r\n\t},\r\n\r\n\t// @section Extension methods\r\n\t// @uninheritable\r\n\t// Layers extending `TileLayer` might reimplement the following method.\r\n\t// @method getTileUrl(coords: Object): String\r\n\t// Called only internally, returns the URL for a tile given its coordinates.\r\n\t// Classes extending `TileLayer` can override this function to provide custom tile URL naming schemes.\r\n\tgetTileUrl: function (coords) {\r\n\t\tvar data = {\r\n\t\t\tr: retina ? '@2x' : '',\r\n\t\t\ts: this._getSubdomain(coords),\r\n\t\t\tx: coords.x,\r\n\t\t\ty: coords.y,\r\n\t\t\tz: this._getZoomForUrl()\r\n\t\t};\r\n\t\tif (this._map && !this._map.options.crs.infinite) {\r\n\t\t\tvar invertedY = this._globalTileRange.max.y - coords.y;\r\n\t\t\tif (this.options.tms) {\r\n\t\t\t\tdata['y'] = invertedY;\r\n\t\t\t}\r\n\t\t\tdata['-y'] = invertedY;\r\n\t\t}\r\n\r\n\t\treturn template(this._url, extend(data, this.options));\r\n\t},\r\n\r\n\t_tileOnLoad: function (done, tile) {\r\n\t\t// For https://github.com/Leaflet/Leaflet/issues/3332\r\n\t\tif (ielt9) {\r\n\t\t\tsetTimeout(bind(done, this, null, tile), 0);\r\n\t\t} else {\r\n\t\t\tdone(null, tile);\r\n\t\t}\r\n\t},\r\n\r\n\t_tileOnError: function (done, tile, e) {\r\n\t\tvar errorUrl = this.options.errorTileUrl;\r\n\t\tif (errorUrl && tile.getAttribute('src') !== errorUrl) {\r\n\t\t\ttile.src = errorUrl;\r\n\t\t}\r\n\t\tdone(e, tile);\r\n\t},\r\n\r\n\t_onTileRemove: function (e) {\r\n\t\te.tile.onload = null;\r\n\t},\r\n\r\n\t_getZoomForUrl: function () {\r\n\t\tvar zoom = this._tileZoom,\r\n\t\tmaxZoom = this.options.maxZoom,\r\n\t\tzoomReverse = this.options.zoomReverse,\r\n\t\tzoomOffset = this.options.zoomOffset;\r\n\r\n\t\tif (zoomReverse) {\r\n\t\t\tzoom = maxZoom - zoom;\r\n\t\t}\r\n\r\n\t\treturn zoom + zoomOffset;\r\n\t},\r\n\r\n\t_getSubdomain: function (tilePoint) {\r\n\t\tvar index = Math.abs(tilePoint.x + tilePoint.y) % this.options.subdomains.length;\r\n\t\treturn this.options.subdomains[index];\r\n\t},\r\n\r\n\t// stops loading all tiles in the background layer\r\n\t_abortLoading: function () {\r\n\t\tvar i, tile;\r\n\t\tfor (i in this._tiles) {\r\n\t\t\tif (this._tiles[i].coords.z !== this._tileZoom) {\r\n\t\t\t\ttile = this._tiles[i].el;\r\n\r\n\t\t\t\ttile.onload = falseFn;\r\n\t\t\t\ttile.onerror = falseFn;\r\n\r\n\t\t\t\tif (!tile.complete) {\r\n\t\t\t\t\ttile.src = emptyImageUrl;\r\n\t\t\t\t\tremove(tile);\r\n\t\t\t\t\tdelete this._tiles[i];\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t}\r\n\t}\r\n});\r\n\r\n\r\n// @factory L.tilelayer(urlTemplate: String, options?: TileLayer options)\r\n// Instantiates a tile layer object given a `URL template` and optionally an options object.\r\n\r\nfunction tileLayer(url, options) {\r\n\treturn new TileLayer(url, options);\r\n}\n\n/*\r\n * @class TileLayer.WMS\r\n * @inherits TileLayer\r\n * @aka L.TileLayer.WMS\r\n * Used to display [WMS](https://en.wikipedia.org/wiki/Web_Map_Service) services as tile layers on the map. Extends `TileLayer`.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var nexrad = L.tileLayer.wms(\"http://mesonet.agron.iastate.edu/cgi-bin/wms/nexrad/n0r.cgi\", {\r\n * \tlayers: 'nexrad-n0r-900913',\r\n * \tformat: 'image/png',\r\n * \ttransparent: true,\r\n * \tattribution: \"Weather data © 2012 IEM Nexrad\"\r\n * });\r\n * ```\r\n */\r\n\r\nvar TileLayerWMS = TileLayer.extend({\r\n\r\n\t// @section\r\n\t// @aka TileLayer.WMS options\r\n\t// If any custom options not documented here are used, they will be sent to the\r\n\t// WMS server as extra parameters in each request URL. This can be useful for\r\n\t// [non-standard vendor WMS parameters](http://docs.geoserver.org/stable/en/user/services/wms/vendor.html).\r\n\tdefaultWmsParams: {\r\n\t\tservice: 'WMS',\r\n\t\trequest: 'GetMap',\r\n\r\n\t\t// @option layers: String = ''\r\n\t\t// **(required)** Comma-separated list of WMS layers to show.\r\n\t\tlayers: '',\r\n\r\n\t\t// @option styles: String = ''\r\n\t\t// Comma-separated list of WMS styles.\r\n\t\tstyles: '',\r\n\r\n\t\t// @option format: String = 'image/jpeg'\r\n\t\t// WMS image format (use `'image/png'` for layers with transparency).\r\n\t\tformat: 'image/jpeg',\r\n\r\n\t\t// @option transparent: Boolean = false\r\n\t\t// If `true`, the WMS service will return images with transparency.\r\n\t\ttransparent: false,\r\n\r\n\t\t// @option version: String = '1.1.1'\r\n\t\t// Version of the WMS service to use\r\n\t\tversion: '1.1.1'\r\n\t},\r\n\r\n\toptions: {\r\n\t\t// @option crs: CRS = null\r\n\t\t// Coordinate Reference System to use for the WMS requests, defaults to\r\n\t\t// map CRS. Don't change this if you're not sure what it means.\r\n\t\tcrs: null,\r\n\r\n\t\t// @option uppercase: Boolean = false\r\n\t\t// If `true`, WMS request parameter keys will be uppercase.\r\n\t\tuppercase: false\r\n\t},\r\n\r\n\tinitialize: function (url, options) {\r\n\r\n\t\tthis._url = url;\r\n\r\n\t\tvar wmsParams = extend({}, this.defaultWmsParams);\r\n\r\n\t\t// all keys that are not TileLayer options go to WMS params\r\n\t\tfor (var i in options) {\r\n\t\t\tif (!(i in this.options)) {\r\n\t\t\t\twmsParams[i] = options[i];\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\toptions = setOptions(this, options);\r\n\r\n\t\tvar realRetina = options.detectRetina && retina ? 2 : 1;\r\n\t\tvar tileSize = this.getTileSize();\r\n\t\twmsParams.width = tileSize.x * realRetina;\r\n\t\twmsParams.height = tileSize.y * realRetina;\r\n\r\n\t\tthis.wmsParams = wmsParams;\r\n\t},\r\n\r\n\tonAdd: function (map) {\r\n\r\n\t\tthis._crs = this.options.crs || map.options.crs;\r\n\t\tthis._wmsVersion = parseFloat(this.wmsParams.version);\r\n\r\n\t\tvar projectionKey = this._wmsVersion >= 1.3 ? 'crs' : 'srs';\r\n\t\tthis.wmsParams[projectionKey] = this._crs.code;\r\n\r\n\t\tTileLayer.prototype.onAdd.call(this, map);\r\n\t},\r\n\r\n\tgetTileUrl: function (coords) {\r\n\r\n\t\tvar tileBounds = this._tileCoordsToNwSe(coords),\r\n\t\t crs = this._crs,\r\n\t\t bounds = toBounds(crs.project(tileBounds[0]), crs.project(tileBounds[1])),\r\n\t\t min = bounds.min,\r\n\t\t max = bounds.max,\r\n\t\t bbox = (this._wmsVersion >= 1.3 && this._crs === EPSG4326 ?\r\n\t\t [min.y, min.x, max.y, max.x] :\r\n\t\t [min.x, min.y, max.x, max.y]).join(','),\r\n\t\turl = L.TileLayer.prototype.getTileUrl.call(this, coords);\r\n\t\treturn url +\r\n\t\t\tgetParamString(this.wmsParams, url, this.options.uppercase) +\r\n\t\t\t(this.options.uppercase ? '&BBOX=' : '&bbox=') + bbox;\r\n\t},\r\n\r\n\t// @method setParams(params: Object, noRedraw?: Boolean): this\r\n\t// Merges an object with the new parameters and re-requests tiles on the current screen (unless `noRedraw` was set to true).\r\n\tsetParams: function (params, noRedraw) {\r\n\r\n\t\textend(this.wmsParams, params);\r\n\r\n\t\tif (!noRedraw) {\r\n\t\t\tthis.redraw();\r\n\t\t}\r\n\r\n\t\treturn this;\r\n\t}\r\n});\r\n\r\n\r\n// @factory L.tileLayer.wms(baseUrl: String, options: TileLayer.WMS options)\r\n// Instantiates a WMS tile layer object given a base URL of the WMS service and a WMS parameters/options object.\r\nfunction tileLayerWMS(url, options) {\r\n\treturn new TileLayerWMS(url, options);\r\n}\n\nTileLayer.WMS = TileLayerWMS;\ntileLayer.wms = tileLayerWMS;\n\n/*\n * @class Renderer\n * @inherits Layer\n * @aka L.Renderer\n *\n * Base class for vector renderer implementations (`SVG`, `Canvas`). Handles the\n * DOM container of the renderer, its bounds, and its zoom animation.\n *\n * A `Renderer` works as an implicit layer group for all `Path`s - the renderer\n * itself can be added or removed to the map. All paths use a renderer, which can\n * be implicit (the map will decide the type of renderer and use it automatically)\n * or explicit (using the [`renderer`](#path-renderer) option of the path).\n *\n * Do not use this class directly, use `SVG` and `Canvas` instead.\n *\n * @event update: Event\n * Fired when the renderer updates its bounds, center and zoom, for example when\n * its map has moved\n */\n\nvar Renderer = Layer.extend({\n\n\t// @section\n\t// @aka Renderer options\n\toptions: {\n\t\t// @option padding: Number = 0.1\n\t\t// How much to extend the clip area around the map view (relative to its size)\n\t\t// e.g. 0.1 would be 10% of map view in each direction\n\t\tpadding: 0.1,\n\n\t\t// @option tolerance: Number = 0\n\t\t// How much to extend click tolerance round a path/object on the map\n\t\ttolerance : 0\n\t},\n\n\tinitialize: function (options) {\n\t\tsetOptions(this, options);\n\t\tstamp(this);\n\t\tthis._layers = this._layers || {};\n\t},\n\n\tonAdd: function () {\n\t\tif (!this._container) {\n\t\t\tthis._initContainer(); // defined by renderer implementations\n\n\t\t\tif (this._zoomAnimated) {\n\t\t\t\taddClass(this._container, 'leaflet-zoom-animated');\n\t\t\t}\n\t\t}\n\n\t\tthis.getPane().appendChild(this._container);\n\t\tthis._update();\n\t\tthis.on('update', this._updatePaths, this);\n\t},\n\n\tonRemove: function () {\n\t\tthis.off('update', this._updatePaths, this);\n\t\tthis._destroyContainer();\n\t},\n\n\tgetEvents: function () {\n\t\tvar events = {\n\t\t\tviewreset: this._reset,\n\t\t\tzoom: this._onZoom,\n\t\t\tmoveend: this._update,\n\t\t\tzoomend: this._onZoomEnd\n\t\t};\n\t\tif (this._zoomAnimated) {\n\t\t\tevents.zoomanim = this._onAnimZoom;\n\t\t}\n\t\treturn events;\n\t},\n\n\t_onAnimZoom: function (ev) {\n\t\tthis._updateTransform(ev.center, ev.zoom);\n\t},\n\n\t_onZoom: function () {\n\t\tthis._updateTransform(this._map.getCenter(), this._map.getZoom());\n\t},\n\n\t_updateTransform: function (center, zoom) {\n\t\tvar scale = this._map.getZoomScale(zoom, this._zoom),\n\t\t position = getPosition(this._container),\n\t\t viewHalf = this._map.getSize().multiplyBy(0.5 + this.options.padding),\n\t\t currentCenterPoint = this._map.project(this._center, zoom),\n\t\t destCenterPoint = this._map.project(center, zoom),\n\t\t centerOffset = destCenterPoint.subtract(currentCenterPoint),\n\n\t\t topLeftOffset = viewHalf.multiplyBy(-scale).add(position).add(viewHalf).subtract(centerOffset);\n\n\t\tif (any3d) {\n\t\t\tsetTransform(this._container, topLeftOffset, scale);\n\t\t} else {\n\t\t\tsetPosition(this._container, topLeftOffset);\n\t\t}\n\t},\n\n\t_reset: function () {\n\t\tthis._update();\n\t\tthis._updateTransform(this._center, this._zoom);\n\n\t\tfor (var id in this._layers) {\n\t\t\tthis._layers[id]._reset();\n\t\t}\n\t},\n\n\t_onZoomEnd: function () {\n\t\tfor (var id in this._layers) {\n\t\t\tthis._layers[id]._project();\n\t\t}\n\t},\n\n\t_updatePaths: function () {\n\t\tfor (var id in this._layers) {\n\t\t\tthis._layers[id]._update();\n\t\t}\n\t},\n\n\t_update: function () {\n\t\t// Update pixel bounds of renderer container (for positioning/sizing/clipping later)\n\t\t// Subclasses are responsible of firing the 'update' event.\n\t\tvar p = this.options.padding,\n\t\t size = this._map.getSize(),\n\t\t min = this._map.containerPointToLayerPoint(size.multiplyBy(-p)).round();\n\n\t\tthis._bounds = new Bounds(min, min.add(size.multiplyBy(1 + p * 2)).round());\n\n\t\tthis._center = this._map.getCenter();\n\t\tthis._zoom = this._map.getZoom();\n\t}\n});\n\n/*\n * @class Canvas\n * @inherits Renderer\n * @aka L.Canvas\n *\n * Allows vector layers to be displayed with [`<canvas>`](https://developer.mozilla.org/docs/Web/API/Canvas_API).\n * Inherits `Renderer`.\n *\n * Due to [technical limitations](http://caniuse.com/#search=canvas), Canvas is not\n * available in all web browsers, notably IE8, and overlapping geometries might\n * not display properly in some edge cases.\n *\n * @example\n *\n * Use Canvas by default for all paths in the map:\n *\n * ```js\n * var map = L.map('map', {\n * \trenderer: L.canvas()\n * });\n * ```\n *\n * Use a Canvas renderer with extra padding for specific vector geometries:\n *\n * ```js\n * var map = L.map('map');\n * var myRenderer = L.canvas({ padding: 0.5 });\n * var line = L.polyline( coordinates, { renderer: myRenderer } );\n * var circle = L.circle( center, { renderer: myRenderer } );\n * ```\n */\n\nvar Canvas = Renderer.extend({\n\tgetEvents: function () {\n\t\tvar events = Renderer.prototype.getEvents.call(this);\n\t\tevents.viewprereset = this._onViewPreReset;\n\t\treturn events;\n\t},\n\n\t_onViewPreReset: function () {\n\t\t// Set a flag so that a viewprereset+moveend+viewreset only updates&redraws once\n\t\tthis._postponeUpdatePaths = true;\n\t},\n\n\tonAdd: function () {\n\t\tRenderer.prototype.onAdd.call(this);\n\n\t\t// Redraw vectors since canvas is cleared upon removal,\n\t\t// in case of removing the renderer itself from the map.\n\t\tthis._draw();\n\t},\n\n\t_initContainer: function () {\n\t\tvar container = this._container = document.createElement('canvas');\n\n\t\ton(container, 'mousemove', throttle(this._onMouseMove, 32, this), this);\n\t\ton(container, 'click dblclick mousedown mouseup contextmenu', this._onClick, this);\n\t\ton(container, 'mouseout', this._handleMouseOut, this);\n\n\t\tthis._ctx = container.getContext('2d');\n\t},\n\n\t_destroyContainer: function () {\n\t\tdelete this._ctx;\n\t\tremove(this._container);\n\t\toff(this._container);\n\t\tdelete this._container;\n\t},\n\n\t_updatePaths: function () {\n\t\tif (this._postponeUpdatePaths) { return; }\n\n\t\tvar layer;\n\t\tthis._redrawBounds = null;\n\t\tfor (var id in this._layers) {\n\t\t\tlayer = this._layers[id];\n\t\t\tlayer._update();\n\t\t}\n\t\tthis._redraw();\n\t},\n\n\t_update: function () {\n\t\tif (this._map._animatingZoom && this._bounds) { return; }\n\n\t\tthis._drawnLayers = {};\n\n\t\tRenderer.prototype._update.call(this);\n\n\t\tvar b = this._bounds,\n\t\t container = this._container,\n\t\t size = b.getSize(),\n\t\t m = retina ? 2 : 1;\n\n\t\tsetPosition(container, b.min);\n\n\t\t// set canvas size (also clearing it); use double size on retina\n\t\tcontainer.width = m * size.x;\n\t\tcontainer.height = m * size.y;\n\t\tcontainer.style.width = size.x + 'px';\n\t\tcontainer.style.height = size.y + 'px';\n\n\t\tif (retina) {\n\t\t\tthis._ctx.scale(2, 2);\n\t\t}\n\n\t\t// translate so we use the same path coordinates after canvas element moves\n\t\tthis._ctx.translate(-b.min.x, -b.min.y);\n\n\t\t// Tell paths to redraw themselves\n\t\tthis.fire('update');\n\t},\n\n\t_reset: function () {\n\t\tRenderer.prototype._reset.call(this);\n\n\t\tif (this._postponeUpdatePaths) {\n\t\t\tthis._postponeUpdatePaths = false;\n\t\t\tthis._updatePaths();\n\t\t}\n\t},\n\n\t_initPath: function (layer) {\n\t\tthis._updateDashArray(layer);\n\t\tthis._layers[stamp(layer)] = layer;\n\n\t\tvar order = layer._order = {\n\t\t\tlayer: layer,\n\t\t\tprev: this._drawLast,\n\t\t\tnext: null\n\t\t};\n\t\tif (this._drawLast) { this._drawLast.next = order; }\n\t\tthis._drawLast = order;\n\t\tthis._drawFirst = this._drawFirst || this._drawLast;\n\t},\n\n\t_addPath: function (layer) {\n\t\tthis._requestRedraw(layer);\n\t},\n\n\t_removePath: function (layer) {\n\t\tvar order = layer._order;\n\t\tvar next = order.next;\n\t\tvar prev = order.prev;\n\n\t\tif (next) {\n\t\t\tnext.prev = prev;\n\t\t} else {\n\t\t\tthis._drawLast = prev;\n\t\t}\n\t\tif (prev) {\n\t\t\tprev.next = next;\n\t\t} else {\n\t\t\tthis._drawFirst = next;\n\t\t}\n\n\t\tdelete layer._order;\n\n\t\tdelete this._layers[L.stamp(layer)];\n\n\t\tthis._requestRedraw(layer);\n\t},\n\n\t_updatePath: function (layer) {\n\t\t// Redraw the union of the layer's old pixel\n\t\t// bounds and the new pixel bounds.\n\t\tthis._extendRedrawBounds(layer);\n\t\tlayer._project();\n\t\tlayer._update();\n\t\t// The redraw will extend the redraw bounds\n\t\t// with the new pixel bounds.\n\t\tthis._requestRedraw(layer);\n\t},\n\n\t_updateStyle: function (layer) {\n\t\tthis._updateDashArray(layer);\n\t\tthis._requestRedraw(layer);\n\t},\n\n\t_updateDashArray: function (layer) {\n\t\tif (layer.options.dashArray) {\n\t\t\tvar parts = layer.options.dashArray.split(','),\n\t\t\t dashArray = [],\n\t\t\t i;\n\t\t\tfor (i = 0; i < parts.length; i++) {\n\t\t\t\tdashArray.push(Number(parts[i]));\n\t\t\t}\n\t\t\tlayer.options._dashArray = dashArray;\n\t\t}\n\t},\n\n\t_requestRedraw: function (layer) {\n\t\tif (!this._map) { return; }\n\n\t\tthis._extendRedrawBounds(layer);\n\t\tthis._redrawRequest = this._redrawRequest || requestAnimFrame(this._redraw, this);\n\t},\n\n\t_extendRedrawBounds: function (layer) {\n\t\tif (layer._pxBounds) {\n\t\t\tvar padding = (layer.options.weight || 0) + 1;\n\t\t\tthis._redrawBounds = this._redrawBounds || new Bounds();\n\t\t\tthis._redrawBounds.extend(layer._pxBounds.min.subtract([padding, padding]));\n\t\t\tthis._redrawBounds.extend(layer._pxBounds.max.add([padding, padding]));\n\t\t}\n\t},\n\n\t_redraw: function () {\n\t\tthis._redrawRequest = null;\n\n\t\tif (this._redrawBounds) {\n\t\t\tthis._redrawBounds.min._floor();\n\t\t\tthis._redrawBounds.max._ceil();\n\t\t}\n\n\t\tthis._clear(); // clear layers in redraw bounds\n\t\tthis._draw(); // draw layers\n\n\t\tthis._redrawBounds = null;\n\t},\n\n\t_clear: function () {\n\t\tvar bounds = this._redrawBounds;\n\t\tif (bounds) {\n\t\t\tvar size = bounds.getSize();\n\t\t\tthis._ctx.clearRect(bounds.min.x, bounds.min.y, size.x, size.y);\n\t\t} else {\n\t\t\tthis._ctx.clearRect(0, 0, this._container.width, this._container.height);\n\t\t}\n\t},\n\n\t_draw: function () {\n\t\tvar layer, bounds = this._redrawBounds;\n\t\tthis._ctx.save();\n\t\tif (bounds) {\n\t\t\tvar size = bounds.getSize();\n\t\t\tthis._ctx.beginPath();\n\t\t\tthis._ctx.rect(bounds.min.x, bounds.min.y, size.x, size.y);\n\t\t\tthis._ctx.clip();\n\t\t}\n\n\t\tthis._drawing = true;\n\n\t\tfor (var order = this._drawFirst; order; order = order.next) {\n\t\t\tlayer = order.layer;\n\t\t\tif (!bounds || (layer._pxBounds && layer._pxBounds.intersects(bounds))) {\n\t\t\t\tlayer._updatePath();\n\t\t\t}\n\t\t}\n\n\t\tthis._drawing = false;\n\n\t\tthis._ctx.restore(); // Restore state before clipping.\n\t},\n\n\t_updatePoly: function (layer, closed) {\n\t\tif (!this._drawing) { return; }\n\n\t\tvar i, j, len2, p,\n\t\t parts = layer._parts,\n\t\t len = parts.length,\n\t\t ctx = this._ctx;\n\n\t\tif (!len) { return; }\n\n\t\tthis._drawnLayers[layer._leaflet_id] = layer;\n\n\t\tctx.beginPath();\n\n\t\tfor (i = 0; i < len; i++) {\n\t\t\tfor (j = 0, len2 = parts[i].length; j < len2; j++) {\n\t\t\t\tp = parts[i][j];\n\t\t\t\tctx[j ? 'lineTo' : 'moveTo'](p.x, p.y);\n\t\t\t}\n\t\t\tif (closed) {\n\t\t\t\tctx.closePath();\n\t\t\t}\n\t\t}\n\n\t\tthis._fillStroke(ctx, layer);\n\n\t\t// TODO optimization: 1 fill/stroke for all features with equal style instead of 1 for each feature\n\t},\n\n\t_updateCircle: function (layer) {\n\n\t\tif (!this._drawing || layer._empty()) { return; }\n\n\t\tvar p = layer._point,\n\t\t ctx = this._ctx,\n\t\t r = Math.max(Math.round(layer._radius), 1),\n\t\t s = (Math.max(Math.round(layer._radiusY), 1) || r) / r;\n\n\t\tthis._drawnLayers[layer._leaflet_id] = layer;\n\n\t\tif (s !== 1) {\n\t\t\tctx.save();\n\t\t\tctx.scale(1, s);\n\t\t}\n\n\t\tctx.beginPath();\n\t\tctx.arc(p.x, p.y / s, r, 0, Math.PI * 2, false);\n\n\t\tif (s !== 1) {\n\t\t\tctx.restore();\n\t\t}\n\n\t\tthis._fillStroke(ctx, layer);\n\t},\n\n\t_fillStroke: function (ctx, layer) {\n\t\tvar options = layer.options;\n\n\t\tif (options.fill) {\n\t\t\tctx.globalAlpha = options.fillOpacity;\n\t\t\tctx.fillStyle = options.fillColor || options.color;\n\t\t\tctx.fill(options.fillRule || 'evenodd');\n\t\t}\n\n\t\tif (options.stroke && options.weight !== 0) {\n\t\t\tif (ctx.setLineDash) {\n\t\t\t\tctx.setLineDash(layer.options && layer.options._dashArray || []);\n\t\t\t}\n\t\t\tctx.globalAlpha = options.opacity;\n\t\t\tctx.lineWidth = options.weight;\n\t\t\tctx.strokeStyle = options.color;\n\t\t\tctx.lineCap = options.lineCap;\n\t\t\tctx.lineJoin = options.lineJoin;\n\t\t\tctx.stroke();\n\t\t}\n\t},\n\n\t// Canvas obviously doesn't have mouse events for individual drawn objects,\n\t// so we emulate that by calculating what's under the mouse on mousemove/click manually\n\n\t_onClick: function (e) {\n\t\tvar point = this._map.mouseEventToLayerPoint(e), layer, clickedLayer;\n\n\t\tfor (var order = this._drawFirst; order; order = order.next) {\n\t\t\tlayer = order.layer;\n\t\t\tif (layer.options.interactive && layer._containsPoint(point) && !this._map._draggableMoved(layer)) {\n\t\t\t\tclickedLayer = layer;\n\t\t\t}\n\t\t}\n\t\tif (clickedLayer) {\n\t\t\tfakeStop(e);\n\t\t\tthis._fireEvent([clickedLayer], e);\n\t\t}\n\t},\n\n\t_onMouseMove: function (e) {\n\t\tif (!this._map || this._map.dragging.moving() || this._map._animatingZoom) { return; }\n\n\t\tvar point = this._map.mouseEventToLayerPoint(e);\n\t\tthis._handleMouseHover(e, point);\n\t},\n\n\n\t_handleMouseOut: function (e) {\n\t\tvar layer = this._hoveredLayer;\n\t\tif (layer) {\n\t\t\t// if we're leaving the layer, fire mouseout\n\t\t\tremoveClass(this._container, 'leaflet-interactive');\n\t\t\tthis._fireEvent([layer], e, 'mouseout');\n\t\t\tthis._hoveredLayer = null;\n\t\t}\n\t},\n\n\t_handleMouseHover: function (e, point) {\n\t\tvar layer, candidateHoveredLayer;\n\n\t\tfor (var order = this._drawFirst; order; order = order.next) {\n\t\t\tlayer = order.layer;\n\t\t\tif (layer.options.interactive && layer._containsPoint(point)) {\n\t\t\t\tcandidateHoveredLayer = layer;\n\t\t\t}\n\t\t}\n\n\t\tif (candidateHoveredLayer !== this._hoveredLayer) {\n\t\t\tthis._handleMouseOut(e);\n\n\t\t\tif (candidateHoveredLayer) {\n\t\t\t\taddClass(this._container, 'leaflet-interactive'); // change cursor\n\t\t\t\tthis._fireEvent([candidateHoveredLayer], e, 'mouseover');\n\t\t\t\tthis._hoveredLayer = candidateHoveredLayer;\n\t\t\t}\n\t\t}\n\n\t\tif (this._hoveredLayer) {\n\t\t\tthis._fireEvent([this._hoveredLayer], e);\n\t\t}\n\t},\n\n\t_fireEvent: function (layers, e, type) {\n\t\tthis._map._fireDOMEvent(e, type || e.type, layers);\n\t},\n\n\t_bringToFront: function (layer) {\n\t\tvar order = layer._order;\n\t\tvar next = order.next;\n\t\tvar prev = order.prev;\n\n\t\tif (next) {\n\t\t\tnext.prev = prev;\n\t\t} else {\n\t\t\t// Already last\n\t\t\treturn;\n\t\t}\n\t\tif (prev) {\n\t\t\tprev.next = next;\n\t\t} else if (next) {\n\t\t\t// Update first entry unless this is the\n\t\t\t// single entry\n\t\t\tthis._drawFirst = next;\n\t\t}\n\n\t\torder.prev = this._drawLast;\n\t\tthis._drawLast.next = order;\n\n\t\torder.next = null;\n\t\tthis._drawLast = order;\n\n\t\tthis._requestRedraw(layer);\n\t},\n\n\t_bringToBack: function (layer) {\n\t\tvar order = layer._order;\n\t\tvar next = order.next;\n\t\tvar prev = order.prev;\n\n\t\tif (prev) {\n\t\t\tprev.next = next;\n\t\t} else {\n\t\t\t// Already first\n\t\t\treturn;\n\t\t}\n\t\tif (next) {\n\t\t\tnext.prev = prev;\n\t\t} else if (prev) {\n\t\t\t// Update last entry unless this is the\n\t\t\t// single entry\n\t\t\tthis._drawLast = prev;\n\t\t}\n\n\t\torder.prev = null;\n\n\t\torder.next = this._drawFirst;\n\t\tthis._drawFirst.prev = order;\n\t\tthis._drawFirst = order;\n\n\t\tthis._requestRedraw(layer);\n\t}\n});\n\n// @factory L.canvas(options?: Renderer options)\n// Creates a Canvas renderer with the given options.\nfunction canvas$1(options) {\n\treturn canvas ? new Canvas(options) : null;\n}\n\n/*\n * Thanks to Dmitry Baranovsky and his Raphael library for inspiration!\n */\n\n\nvar vmlCreate = (function () {\n\ttry {\n\t\tdocument.namespaces.add('lvml', 'urn:schemas-microsoft-com:vml');\n\t\treturn function (name) {\n\t\t\treturn document.createElement('<lvml:' + name + ' class=\"lvml\">');\n\t\t};\n\t} catch (e) {\n\t\treturn function (name) {\n\t\t\treturn document.createElement('<' + name + ' xmlns=\"urn:schemas-microsoft.com:vml\" class=\"lvml\">');\n\t\t};\n\t}\n})();\n\n\n/*\n * @class SVG\n *\n * Although SVG is not available on IE7 and IE8, these browsers support [VML](https://en.wikipedia.org/wiki/Vector_Markup_Language), and the SVG renderer will fall back to VML in this case.\n *\n * VML was deprecated in 2012, which means VML functionality exists only for backwards compatibility\n * with old versions of Internet Explorer.\n */\n\n// mixin to redefine some SVG methods to handle VML syntax which is similar but with some differences\nvar vmlMixin = {\n\n\t_initContainer: function () {\n\t\tthis._container = create$1('div', 'leaflet-vml-container');\n\t},\n\n\t_update: function () {\n\t\tif (this._map._animatingZoom) { return; }\n\t\tRenderer.prototype._update.call(this);\n\t\tthis.fire('update');\n\t},\n\n\t_initPath: function (layer) {\n\t\tvar container = layer._container = vmlCreate('shape');\n\n\t\taddClass(container, 'leaflet-vml-shape ' + (this.options.className || ''));\n\n\t\tcontainer.coordsize = '1 1';\n\n\t\tlayer._path = vmlCreate('path');\n\t\tcontainer.appendChild(layer._path);\n\n\t\tthis._updateStyle(layer);\n\t\tthis._layers[stamp(layer)] = layer;\n\t},\n\n\t_addPath: function (layer) {\n\t\tvar container = layer._container;\n\t\tthis._container.appendChild(container);\n\n\t\tif (layer.options.interactive) {\n\t\t\tlayer.addInteractiveTarget(container);\n\t\t}\n\t},\n\n\t_removePath: function (layer) {\n\t\tvar container = layer._container;\n\t\tremove(container);\n\t\tlayer.removeInteractiveTarget(container);\n\t\tdelete this._layers[stamp(layer)];\n\t},\n\n\t_updateStyle: function (layer) {\n\t\tvar stroke = layer._stroke,\n\t\t fill = layer._fill,\n\t\t options = layer.options,\n\t\t container = layer._container;\n\n\t\tcontainer.stroked = !!options.stroke;\n\t\tcontainer.filled = !!options.fill;\n\n\t\tif (options.stroke) {\n\t\t\tif (!stroke) {\n\t\t\t\tstroke = layer._stroke = vmlCreate('stroke');\n\t\t\t}\n\t\t\tcontainer.appendChild(stroke);\n\t\t\tstroke.weight = options.weight + 'px';\n\t\t\tstroke.color = options.color;\n\t\t\tstroke.opacity = options.opacity;\n\n\t\t\tif (options.dashArray) {\n\t\t\t\tstroke.dashStyle = isArray(options.dashArray) ?\n\t\t\t\t options.dashArray.join(' ') :\n\t\t\t\t options.dashArray.replace(/( *, *)/g, ' ');\n\t\t\t} else {\n\t\t\t\tstroke.dashStyle = '';\n\t\t\t}\n\t\t\tstroke.endcap = options.lineCap.replace('butt', 'flat');\n\t\t\tstroke.joinstyle = options.lineJoin;\n\n\t\t} else if (stroke) {\n\t\t\tcontainer.removeChild(stroke);\n\t\t\tlayer._stroke = null;\n\t\t}\n\n\t\tif (options.fill) {\n\t\t\tif (!fill) {\n\t\t\t\tfill = layer._fill = vmlCreate('fill');\n\t\t\t}\n\t\t\tcontainer.appendChild(fill);\n\t\t\tfill.color = options.fillColor || options.color;\n\t\t\tfill.opacity = options.fillOpacity;\n\n\t\t} else if (fill) {\n\t\t\tcontainer.removeChild(fill);\n\t\t\tlayer._fill = null;\n\t\t}\n\t},\n\n\t_updateCircle: function (layer) {\n\t\tvar p = layer._point.round(),\n\t\t r = Math.round(layer._radius),\n\t\t r2 = Math.round(layer._radiusY || r);\n\n\t\tthis._setPath(layer, layer._empty() ? 'M0 0' :\n\t\t\t'AL ' + p.x + ',' + p.y + ' ' + r + ',' + r2 + ' 0,' + (65535 * 360));\n\t},\n\n\t_setPath: function (layer, path) {\n\t\tlayer._path.v = path;\n\t},\n\n\t_bringToFront: function (layer) {\n\t\ttoFront(layer._container);\n\t},\n\n\t_bringToBack: function (layer) {\n\t\ttoBack(layer._container);\n\t}\n};\n\nvar create$2 = vml ? vmlCreate : svgCreate;\n\n/*\n * @class SVG\n * @inherits Renderer\n * @aka L.SVG\n *\n * Allows vector layers to be displayed with [SVG](https://developer.mozilla.org/docs/Web/SVG).\n * Inherits `Renderer`.\n *\n * Due to [technical limitations](http://caniuse.com/#search=svg), SVG is not\n * available in all web browsers, notably Android 2.x and 3.x.\n *\n * Although SVG is not available on IE7 and IE8, these browsers support\n * [VML](https://en.wikipedia.org/wiki/Vector_Markup_Language)\n * (a now deprecated technology), and the SVG renderer will fall back to VML in\n * this case.\n *\n * @example\n *\n * Use SVG by default for all paths in the map:\n *\n * ```js\n * var map = L.map('map', {\n * \trenderer: L.svg()\n * });\n * ```\n *\n * Use a SVG renderer with extra padding for specific vector geometries:\n *\n * ```js\n * var map = L.map('map');\n * var myRenderer = L.svg({ padding: 0.5 });\n * var line = L.polyline( coordinates, { renderer: myRenderer } );\n * var circle = L.circle( center, { renderer: myRenderer } );\n * ```\n */\n\nvar SVG = Renderer.extend({\n\n\tgetEvents: function () {\n\t\tvar events = Renderer.prototype.getEvents.call(this);\n\t\tevents.zoomstart = this._onZoomStart;\n\t\treturn events;\n\t},\n\n\t_initContainer: function () {\n\t\tthis._container = create$2('svg');\n\n\t\t// makes it possible to click through svg root; we'll reset it back in individual paths\n\t\tthis._container.setAttribute('pointer-events', 'none');\n\n\t\tthis._rootGroup = create$2('g');\n\t\tthis._container.appendChild(this._rootGroup);\n\t},\n\n\t_destroyContainer: function () {\n\t\tremove(this._container);\n\t\toff(this._container);\n\t\tdelete this._container;\n\t\tdelete this._rootGroup;\n\t\tdelete this._svgSize;\n\t},\n\n\t_onZoomStart: function () {\n\t\t// Drag-then-pinch interactions might mess up the center and zoom.\n\t\t// In this case, the easiest way to prevent this is re-do the renderer\n\t\t// bounds and padding when the zooming starts.\n\t\tthis._update();\n\t},\n\n\t_update: function () {\n\t\tif (this._map._animatingZoom && this._bounds) { return; }\n\n\t\tRenderer.prototype._update.call(this);\n\n\t\tvar b = this._bounds,\n\t\t size = b.getSize(),\n\t\t container = this._container;\n\n\t\t// set size of svg-container if changed\n\t\tif (!this._svgSize || !this._svgSize.equals(size)) {\n\t\t\tthis._svgSize = size;\n\t\t\tcontainer.setAttribute('width', size.x);\n\t\t\tcontainer.setAttribute('height', size.y);\n\t\t}\n\n\t\t// movement: update container viewBox so that we don't have to change coordinates of individual layers\n\t\tsetPosition(container, b.min);\n\t\tcontainer.setAttribute('viewBox', [b.min.x, b.min.y, size.x, size.y].join(' '));\n\n\t\tthis.fire('update');\n\t},\n\n\t// methods below are called by vector layers implementations\n\n\t_initPath: function (layer) {\n\t\tvar path = layer._path = create$2('path');\n\n\t\t// @namespace Path\n\t\t// @option className: String = null\n\t\t// Custom class name set on an element. Only for SVG renderer.\n\t\tif (layer.options.className) {\n\t\t\taddClass(path, layer.options.className);\n\t\t}\n\n\t\tif (layer.options.interactive) {\n\t\t\taddClass(path, 'leaflet-interactive');\n\t\t}\n\n\t\tthis._updateStyle(layer);\n\t\tthis._layers[stamp(layer)] = layer;\n\t},\n\n\t_addPath: function (layer) {\n\t\tif (!this._rootGroup) { this._initContainer(); }\n\t\tthis._rootGroup.appendChild(layer._path);\n\t\tlayer.addInteractiveTarget(layer._path);\n\t},\n\n\t_removePath: function (layer) {\n\t\tremove(layer._path);\n\t\tlayer.removeInteractiveTarget(layer._path);\n\t\tdelete this._layers[stamp(layer)];\n\t},\n\n\t_updatePath: function (layer) {\n\t\tlayer._project();\n\t\tlayer._update();\n\t},\n\n\t_updateStyle: function (layer) {\n\t\tvar path = layer._path,\n\t\t options = layer.options;\n\n\t\tif (!path) { return; }\n\n\t\tif (options.stroke) {\n\t\t\tpath.setAttribute('stroke', options.color);\n\t\t\tpath.setAttribute('stroke-opacity', options.opacity);\n\t\t\tpath.setAttribute('stroke-width', options.weight);\n\t\t\tpath.setAttribute('stroke-linecap', options.lineCap);\n\t\t\tpath.setAttribute('stroke-linejoin', options.lineJoin);\n\n\t\t\tif (options.dashArray) {\n\t\t\t\tpath.setAttribute('stroke-dasharray', options.dashArray);\n\t\t\t} else {\n\t\t\t\tpath.removeAttribute('stroke-dasharray');\n\t\t\t}\n\n\t\t\tif (options.dashOffset) {\n\t\t\t\tpath.setAttribute('stroke-dashoffset', options.dashOffset);\n\t\t\t} else {\n\t\t\t\tpath.removeAttribute('stroke-dashoffset');\n\t\t\t}\n\t\t} else {\n\t\t\tpath.setAttribute('stroke', 'none');\n\t\t}\n\n\t\tif (options.fill) {\n\t\t\tpath.setAttribute('fill', options.fillColor || options.color);\n\t\t\tpath.setAttribute('fill-opacity', options.fillOpacity);\n\t\t\tpath.setAttribute('fill-rule', options.fillRule || 'evenodd');\n\t\t} else {\n\t\t\tpath.setAttribute('fill', 'none');\n\t\t}\n\t},\n\n\t_updatePoly: function (layer, closed) {\n\t\tthis._setPath(layer, pointsToPath(layer._parts, closed));\n\t},\n\n\t_updateCircle: function (layer) {\n\t\tvar p = layer._point,\n\t\t r = Math.max(Math.round(layer._radius), 1),\n\t\t r2 = Math.max(Math.round(layer._radiusY), 1) || r,\n\t\t arc = 'a' + r + ',' + r2 + ' 0 1,0 ';\n\n\t\t// drawing a circle with two half-arcs\n\t\tvar d = layer._empty() ? 'M0 0' :\n\t\t\t'M' + (p.x - r) + ',' + p.y +\n\t\t\tarc + (r * 2) + ',0 ' +\n\t\t\tarc + (-r * 2) + ',0 ';\n\n\t\tthis._setPath(layer, d);\n\t},\n\n\t_setPath: function (layer, path) {\n\t\tlayer._path.setAttribute('d', path);\n\t},\n\n\t// SVG does not have the concept of zIndex so we resort to changing the DOM order of elements\n\t_bringToFront: function (layer) {\n\t\ttoFront(layer._path);\n\t},\n\n\t_bringToBack: function (layer) {\n\t\ttoBack(layer._path);\n\t}\n});\n\nif (vml) {\n\tSVG.include(vmlMixin);\n}\n\n// @namespace SVG\n// @factory L.svg(options?: Renderer options)\n// Creates a SVG renderer with the given options.\nfunction svg$1(options) {\n\treturn svg || vml ? new SVG(options) : null;\n}\n\nMap.include({\n\t// @namespace Map; @method getRenderer(layer: Path): Renderer\n\t// Returns the instance of `Renderer` that should be used to render the given\n\t// `Path`. It will ensure that the `renderer` options of the map and paths\n\t// are respected, and that the renderers do exist on the map.\n\tgetRenderer: function (layer) {\n\t\t// @namespace Path; @option renderer: Renderer\n\t\t// Use this specific instance of `Renderer` for this path. Takes\n\t\t// precedence over the map's [default renderer](#map-renderer).\n\t\tvar renderer = layer.options.renderer || this._getPaneRenderer(layer.options.pane) || this.options.renderer || this._renderer;\n\n\t\tif (!renderer) {\n\t\t\t// @namespace Map; @option preferCanvas: Boolean = false\n\t\t\t// Whether `Path`s should be rendered on a `Canvas` renderer.\n\t\t\t// By default, all `Path`s are rendered in a `SVG` renderer.\n\t\t\trenderer = this._renderer = (this.options.preferCanvas && canvas$1()) || svg$1();\n\t\t}\n\n\t\tif (!this.hasLayer(renderer)) {\n\t\t\tthis.addLayer(renderer);\n\t\t}\n\t\treturn renderer;\n\t},\n\n\t_getPaneRenderer: function (name) {\n\t\tif (name === 'overlayPane' || name === undefined) {\n\t\t\treturn false;\n\t\t}\n\n\t\tvar renderer = this._paneRenderers[name];\n\t\tif (renderer === undefined) {\n\t\t\trenderer = (SVG && svg$1({pane: name})) || (Canvas && canvas$1({pane: name}));\n\t\t\tthis._paneRenderers[name] = renderer;\n\t\t}\n\t\treturn renderer;\n\t}\n});\n\n/*\n * L.Rectangle extends Polygon and creates a rectangle when passed a LatLngBounds object.\n */\n\n/*\n * @class Rectangle\n * @aka L.Rectangle\n * @inherits Polygon\n *\n * A class for drawing rectangle overlays on a map. Extends `Polygon`.\n *\n * @example\n *\n * ```js\n * // define rectangle geographical bounds\n * var bounds = [[54.559322, -5.767822], [56.1210604, -3.021240]];\n *\n * // create an orange rectangle\n * L.rectangle(bounds, {color: \"#ff7800\", weight: 1}).addTo(map);\n *\n * // zoom the map to the rectangle bounds\n * map.fitBounds(bounds);\n * ```\n *\n */\n\n\nvar Rectangle = Polygon.extend({\n\tinitialize: function (latLngBounds, options) {\n\t\tPolygon.prototype.initialize.call(this, this._boundsToLatLngs(latLngBounds), options);\n\t},\n\n\t// @method setBounds(latLngBounds: LatLngBounds): this\n\t// Redraws the rectangle with the passed bounds.\n\tsetBounds: function (latLngBounds) {\n\t\treturn this.setLatLngs(this._boundsToLatLngs(latLngBounds));\n\t},\n\n\t_boundsToLatLngs: function (latLngBounds) {\n\t\tlatLngBounds = toLatLngBounds(latLngBounds);\n\t\treturn [\n\t\t\tlatLngBounds.getSouthWest(),\n\t\t\tlatLngBounds.getNorthWest(),\n\t\t\tlatLngBounds.getNorthEast(),\n\t\t\tlatLngBounds.getSouthEast()\n\t\t];\n\t}\n});\n\n\n// @factory L.rectangle(latLngBounds: LatLngBounds, options?: Polyline options)\nfunction rectangle(latLngBounds, options) {\n\treturn new Rectangle(latLngBounds, options);\n}\n\nSVG.create = create$2;\nSVG.pointsToPath = pointsToPath;\n\nGeoJSON.geometryToLayer = geometryToLayer;\nGeoJSON.coordsToLatLng = coordsToLatLng;\nGeoJSON.coordsToLatLngs = coordsToLatLngs;\nGeoJSON.latLngToCoords = latLngToCoords;\nGeoJSON.latLngsToCoords = latLngsToCoords;\nGeoJSON.getFeature = getFeature;\nGeoJSON.asFeature = asFeature;\n\n/*\n * L.Handler.BoxZoom is used to add shift-drag zoom interaction to the map\n * (zoom to a selected bounding box), enabled by default.\n */\n\n// @namespace Map\n// @section Interaction Options\nMap.mergeOptions({\n\t// @option boxZoom: Boolean = true\n\t// Whether the map can be zoomed to a rectangular area specified by\n\t// dragging the mouse while pressing the shift key.\n\tboxZoom: true\n});\n\nvar BoxZoom = Handler.extend({\n\tinitialize: function (map) {\n\t\tthis._map = map;\n\t\tthis._container = map._container;\n\t\tthis._pane = map._panes.overlayPane;\n\t\tthis._resetStateTimeout = 0;\n\t\tmap.on('unload', this._destroy, this);\n\t},\n\n\taddHooks: function () {\n\t\ton(this._container, 'mousedown', this._onMouseDown, this);\n\t},\n\n\tremoveHooks: function () {\n\t\toff(this._container, 'mousedown', this._onMouseDown, this);\n\t},\n\n\tmoved: function () {\n\t\treturn this._moved;\n\t},\n\n\t_destroy: function () {\n\t\tremove(this._pane);\n\t\tdelete this._pane;\n\t},\n\n\t_resetState: function () {\n\t\tthis._resetStateTimeout = 0;\n\t\tthis._moved = false;\n\t},\n\n\t_clearDeferredResetState: function () {\n\t\tif (this._resetStateTimeout !== 0) {\n\t\t\tclearTimeout(this._resetStateTimeout);\n\t\t\tthis._resetStateTimeout = 0;\n\t\t}\n\t},\n\n\t_onMouseDown: function (e) {\n\t\tif (!e.shiftKey || ((e.which !== 1) && (e.button !== 1))) { return false; }\n\n\t\t// Clear the deferred resetState if it hasn't executed yet, otherwise it\n\t\t// will interrupt the interaction and orphan a box element in the container.\n\t\tthis._clearDeferredResetState();\n\t\tthis._resetState();\n\n\t\tdisableTextSelection();\n\t\tdisableImageDrag();\n\n\t\tthis._startPoint = this._map.mouseEventToContainerPoint(e);\n\n\t\ton(document, {\n\t\t\tcontextmenu: stop,\n\t\t\tmousemove: this._onMouseMove,\n\t\t\tmouseup: this._onMouseUp,\n\t\t\tkeydown: this._onKeyDown\n\t\t}, this);\n\t},\n\n\t_onMouseMove: function (e) {\n\t\tif (!this._moved) {\n\t\t\tthis._moved = true;\n\n\t\t\tthis._box = create$1('div', 'leaflet-zoom-box', this._container);\n\t\t\taddClass(this._container, 'leaflet-crosshair');\n\n\t\t\tthis._map.fire('boxzoomstart');\n\t\t}\n\n\t\tthis._point = this._map.mouseEventToContainerPoint(e);\n\n\t\tvar bounds = new Bounds(this._point, this._startPoint),\n\t\t size = bounds.getSize();\n\n\t\tsetPosition(this._box, bounds.min);\n\n\t\tthis._box.style.width = size.x + 'px';\n\t\tthis._box.style.height = size.y + 'px';\n\t},\n\n\t_finish: function () {\n\t\tif (this._moved) {\n\t\t\tremove(this._box);\n\t\t\tremoveClass(this._container, 'leaflet-crosshair');\n\t\t}\n\n\t\tenableTextSelection();\n\t\tenableImageDrag();\n\n\t\toff(document, {\n\t\t\tcontextmenu: stop,\n\t\t\tmousemove: this._onMouseMove,\n\t\t\tmouseup: this._onMouseUp,\n\t\t\tkeydown: this._onKeyDown\n\t\t}, this);\n\t},\n\n\t_onMouseUp: function (e) {\n\t\tif ((e.which !== 1) && (e.button !== 1)) { return; }\n\n\t\tthis._finish();\n\n\t\tif (!this._moved) { return; }\n\t\t// Postpone to next JS tick so internal click event handling\n\t\t// still see it as \"moved\".\n\t\tthis._clearDeferredResetState();\n\t\tthis._resetStateTimeout = setTimeout(bind(this._resetState, this), 0);\n\n\t\tvar bounds = new LatLngBounds(\n\t\t this._map.containerPointToLatLng(this._startPoint),\n\t\t this._map.containerPointToLatLng(this._point));\n\n\t\tthis._map\n\t\t\t.fitBounds(bounds)\n\t\t\t.fire('boxzoomend', {boxZoomBounds: bounds});\n\t},\n\n\t_onKeyDown: function (e) {\n\t\tif (e.keyCode === 27) {\n\t\t\tthis._finish();\n\t\t}\n\t}\n});\n\n// @section Handlers\n// @property boxZoom: Handler\n// Box (shift-drag with mouse) zoom handler.\nMap.addInitHook('addHandler', 'boxZoom', BoxZoom);\n\n/*\n * L.Handler.DoubleClickZoom is used to handle double-click zoom on the map, enabled by default.\n */\n\n// @namespace Map\n// @section Interaction Options\n\nMap.mergeOptions({\n\t// @option doubleClickZoom: Boolean|String = true\n\t// Whether the map can be zoomed in by double clicking on it and\n\t// zoomed out by double clicking while holding shift. If passed\n\t// `'center'`, double-click zoom will zoom to the center of the\n\t// view regardless of where the mouse was.\n\tdoubleClickZoom: true\n});\n\nvar DoubleClickZoom = Handler.extend({\n\taddHooks: function () {\n\t\tthis._map.on('dblclick', this._onDoubleClick, this);\n\t},\n\n\tremoveHooks: function () {\n\t\tthis._map.off('dblclick', this._onDoubleClick, this);\n\t},\n\n\t_onDoubleClick: function (e) {\n\t\tvar map = this._map,\n\t\t oldZoom = map.getZoom(),\n\t\t delta = map.options.zoomDelta,\n\t\t zoom = e.originalEvent.shiftKey ? oldZoom - delta : oldZoom + delta;\n\n\t\tif (map.options.doubleClickZoom === 'center') {\n\t\t\tmap.setZoom(zoom);\n\t\t} else {\n\t\t\tmap.setZoomAround(e.containerPoint, zoom);\n\t\t}\n\t}\n});\n\n// @section Handlers\n//\n// Map properties include interaction handlers that allow you to control\n// interaction behavior in runtime, enabling or disabling certain features such\n// as dragging or touch zoom (see `Handler` methods). For example:\n//\n// ```js\n// map.doubleClickZoom.disable();\n// ```\n//\n// @property doubleClickZoom: Handler\n// Double click zoom handler.\nMap.addInitHook('addHandler', 'doubleClickZoom', DoubleClickZoom);\n\n/*\n * L.Handler.MapDrag is used to make the map draggable (with panning inertia), enabled by default.\n */\n\n// @namespace Map\n// @section Interaction Options\nMap.mergeOptions({\n\t// @option dragging: Boolean = true\n\t// Whether the map be draggable with mouse/touch or not.\n\tdragging: true,\n\n\t// @section Panning Inertia Options\n\t// @option inertia: Boolean = *\n\t// If enabled, panning of the map will have an inertia effect where\n\t// the map builds momentum while dragging and continues moving in\n\t// the same direction for some time. Feels especially nice on touch\n\t// devices. Enabled by default unless running on old Android devices.\n\tinertia: !android23,\n\n\t// @option inertiaDeceleration: Number = 3000\n\t// The rate with which the inertial movement slows down, in pixels/second².\n\tinertiaDeceleration: 3400, // px/s^2\n\n\t// @option inertiaMaxSpeed: Number = Infinity\n\t// Max speed of the inertial movement, in pixels/second.\n\tinertiaMaxSpeed: Infinity, // px/s\n\n\t// @option easeLinearity: Number = 0.2\n\teaseLinearity: 0.2,\n\n\t// TODO refactor, move to CRS\n\t// @option worldCopyJump: Boolean = false\n\t// With this option enabled, the map tracks when you pan to another \"copy\"\n\t// of the world and seamlessly jumps to the original one so that all overlays\n\t// like markers and vector layers are still visible.\n\tworldCopyJump: false,\n\n\t// @option maxBoundsViscosity: Number = 0.0\n\t// If `maxBounds` is set, this option will control how solid the bounds\n\t// are when dragging the map around. The default value of `0.0` allows the\n\t// user to drag outside the bounds at normal speed, higher values will\n\t// slow down map dragging outside bounds, and `1.0` makes the bounds fully\n\t// solid, preventing the user from dragging outside the bounds.\n\tmaxBoundsViscosity: 0.0\n});\n\nvar Drag = Handler.extend({\n\taddHooks: function () {\n\t\tif (!this._draggable) {\n\t\t\tvar map = this._map;\n\n\t\t\tthis._draggable = new Draggable(map._mapPane, map._container);\n\n\t\t\tthis._draggable.on({\n\t\t\t\tdragstart: this._onDragStart,\n\t\t\t\tdrag: this._onDrag,\n\t\t\t\tdragend: this._onDragEnd\n\t\t\t}, this);\n\n\t\t\tthis._draggable.on('predrag', this._onPreDragLimit, this);\n\t\t\tif (map.options.worldCopyJump) {\n\t\t\t\tthis._draggable.on('predrag', this._onPreDragWrap, this);\n\t\t\t\tmap.on('zoomend', this._onZoomEnd, this);\n\n\t\t\t\tmap.whenReady(this._onZoomEnd, this);\n\t\t\t}\n\t\t}\n\t\taddClass(this._map._container, 'leaflet-grab leaflet-touch-drag');\n\t\tthis._draggable.enable();\n\t\tthis._positions = [];\n\t\tthis._times = [];\n\t},\n\n\tremoveHooks: function () {\n\t\tremoveClass(this._map._container, 'leaflet-grab');\n\t\tremoveClass(this._map._container, 'leaflet-touch-drag');\n\t\tthis._draggable.disable();\n\t},\n\n\tmoved: function () {\n\t\treturn this._draggable && this._draggable._moved;\n\t},\n\n\tmoving: function () {\n\t\treturn this._draggable && this._draggable._moving;\n\t},\n\n\t_onDragStart: function () {\n\t\tvar map = this._map;\n\n\t\tmap._stop();\n\t\tif (this._map.options.maxBounds && this._map.options.maxBoundsViscosity) {\n\t\t\tvar bounds = toLatLngBounds(this._map.options.maxBounds);\n\n\t\t\tthis._offsetLimit = toBounds(\n\t\t\t\tthis._map.latLngToContainerPoint(bounds.getNorthWest()).multiplyBy(-1),\n\t\t\t\tthis._map.latLngToContainerPoint(bounds.getSouthEast()).multiplyBy(-1)\n\t\t\t\t\t.add(this._map.getSize()));\n\n\t\t\tthis._viscosity = Math.min(1.0, Math.max(0.0, this._map.options.maxBoundsViscosity));\n\t\t} else {\n\t\t\tthis._offsetLimit = null;\n\t\t}\n\n\t\tmap\n\t\t .fire('movestart')\n\t\t .fire('dragstart');\n\n\t\tif (map.options.inertia) {\n\t\t\tthis._positions = [];\n\t\t\tthis._times = [];\n\t\t}\n\t},\n\n\t_onDrag: function (e) {\n\t\tif (this._map.options.inertia) {\n\t\t\tvar time = this._lastTime = +new Date(),\n\t\t\t pos = this._lastPos = this._draggable._absPos || this._draggable._newPos;\n\n\t\t\tthis._positions.push(pos);\n\t\t\tthis._times.push(time);\n\n\t\t\tthis._prunePositions(time);\n\t\t}\n\n\t\tthis._map\n\t\t .fire('move', e)\n\t\t .fire('drag', e);\n\t},\n\n\t_prunePositions: function (time) {\n\t\twhile (this._positions.length > 1 && time - this._times[0] > 50) {\n\t\t\tthis._positions.shift();\n\t\t\tthis._times.shift();\n\t\t}\n\t},\n\n\t_onZoomEnd: function () {\n\t\tvar pxCenter = this._map.getSize().divideBy(2),\n\t\t pxWorldCenter = this._map.latLngToLayerPoint([0, 0]);\n\n\t\tthis._initialWorldOffset = pxWorldCenter.subtract(pxCenter).x;\n\t\tthis._worldWidth = this._map.getPixelWorldBounds().getSize().x;\n\t},\n\n\t_viscousLimit: function (value, threshold) {\n\t\treturn value - (value - threshold) * this._viscosity;\n\t},\n\n\t_onPreDragLimit: function () {\n\t\tif (!this._viscosity || !this._offsetLimit) { return; }\n\n\t\tvar offset = this._draggable._newPos.subtract(this._draggable._startPos);\n\n\t\tvar limit = this._offsetLimit;\n\t\tif (offset.x < limit.min.x) { offset.x = this._viscousLimit(offset.x, limit.min.x); }\n\t\tif (offset.y < limit.min.y) { offset.y = this._viscousLimit(offset.y, limit.min.y); }\n\t\tif (offset.x > limit.max.x) { offset.x = this._viscousLimit(offset.x, limit.max.x); }\n\t\tif (offset.y > limit.max.y) { offset.y = this._viscousLimit(offset.y, limit.max.y); }\n\n\t\tthis._draggable._newPos = this._draggable._startPos.add(offset);\n\t},\n\n\t_onPreDragWrap: function () {\n\t\t// TODO refactor to be able to adjust map pane position after zoom\n\t\tvar worldWidth = this._worldWidth,\n\t\t halfWidth = Math.round(worldWidth / 2),\n\t\t dx = this._initialWorldOffset,\n\t\t x = this._draggable._newPos.x,\n\t\t newX1 = (x - halfWidth + dx) % worldWidth + halfWidth - dx,\n\t\t newX2 = (x + halfWidth + dx) % worldWidth - halfWidth - dx,\n\t\t newX = Math.abs(newX1 + dx) < Math.abs(newX2 + dx) ? newX1 : newX2;\n\n\t\tthis._draggable._absPos = this._draggable._newPos.clone();\n\t\tthis._draggable._newPos.x = newX;\n\t},\n\n\t_onDragEnd: function (e) {\n\t\tvar map = this._map,\n\t\t options = map.options,\n\n\t\t noInertia = !options.inertia || this._times.length < 2;\n\n\t\tmap.fire('dragend', e);\n\n\t\tif (noInertia) {\n\t\t\tmap.fire('moveend');\n\n\t\t} else {\n\t\t\tthis._prunePositions(+new Date());\n\n\t\t\tvar direction = this._lastPos.subtract(this._positions[0]),\n\t\t\t duration = (this._lastTime - this._times[0]) / 1000,\n\t\t\t ease = options.easeLinearity,\n\n\t\t\t speedVector = direction.multiplyBy(ease / duration),\n\t\t\t speed = speedVector.distanceTo([0, 0]),\n\n\t\t\t limitedSpeed = Math.min(options.inertiaMaxSpeed, speed),\n\t\t\t limitedSpeedVector = speedVector.multiplyBy(limitedSpeed / speed),\n\n\t\t\t decelerationDuration = limitedSpeed / (options.inertiaDeceleration * ease),\n\t\t\t offset = limitedSpeedVector.multiplyBy(-decelerationDuration / 2).round();\n\n\t\t\tif (!offset.x && !offset.y) {\n\t\t\t\tmap.fire('moveend');\n\n\t\t\t} else {\n\t\t\t\toffset = map._limitOffset(offset, map.options.maxBounds);\n\n\t\t\t\trequestAnimFrame(function () {\n\t\t\t\t\tmap.panBy(offset, {\n\t\t\t\t\t\tduration: decelerationDuration,\n\t\t\t\t\t\teaseLinearity: ease,\n\t\t\t\t\t\tnoMoveStart: true,\n\t\t\t\t\t\tanimate: true\n\t\t\t\t\t});\n\t\t\t\t});\n\t\t\t}\n\t\t}\n\t}\n});\n\n// @section Handlers\n// @property dragging: Handler\n// Map dragging handler (by both mouse and touch).\nMap.addInitHook('addHandler', 'dragging', Drag);\n\n/*\n * L.Map.Keyboard is handling keyboard interaction with the map, enabled by default.\n */\n\n// @namespace Map\n// @section Keyboard Navigation Options\nMap.mergeOptions({\n\t// @option keyboard: Boolean = true\n\t// Makes the map focusable and allows users to navigate the map with keyboard\n\t// arrows and `+`/`-` keys.\n\tkeyboard: true,\n\n\t// @option keyboardPanDelta: Number = 80\n\t// Amount of pixels to pan when pressing an arrow key.\n\tkeyboardPanDelta: 80\n});\n\nvar Keyboard = Handler.extend({\n\n\tkeyCodes: {\n\t\tleft: [37],\n\t\tright: [39],\n\t\tdown: [40],\n\t\tup: [38],\n\t\tzoomIn: [187, 107, 61, 171],\n\t\tzoomOut: [189, 109, 54, 173]\n\t},\n\n\tinitialize: function (map) {\n\t\tthis._map = map;\n\n\t\tthis._setPanDelta(map.options.keyboardPanDelta);\n\t\tthis._setZoomDelta(map.options.zoomDelta);\n\t},\n\n\taddHooks: function () {\n\t\tvar container = this._map._container;\n\n\t\t// make the container focusable by tabbing\n\t\tif (container.tabIndex <= 0) {\n\t\t\tcontainer.tabIndex = '0';\n\t\t}\n\n\t\ton(container, {\n\t\t\tfocus: this._onFocus,\n\t\t\tblur: this._onBlur,\n\t\t\tmousedown: this._onMouseDown\n\t\t}, this);\n\n\t\tthis._map.on({\n\t\t\tfocus: this._addHooks,\n\t\t\tblur: this._removeHooks\n\t\t}, this);\n\t},\n\n\tremoveHooks: function () {\n\t\tthis._removeHooks();\n\n\t\toff(this._map._container, {\n\t\t\tfocus: this._onFocus,\n\t\t\tblur: this._onBlur,\n\t\t\tmousedown: this._onMouseDown\n\t\t}, this);\n\n\t\tthis._map.off({\n\t\t\tfocus: this._addHooks,\n\t\t\tblur: this._removeHooks\n\t\t}, this);\n\t},\n\n\t_onMouseDown: function () {\n\t\tif (this._focused) { return; }\n\n\t\tvar body = document.body,\n\t\t docEl = document.documentElement,\n\t\t top = body.scrollTop || docEl.scrollTop,\n\t\t left = body.scrollLeft || docEl.scrollLeft;\n\n\t\tthis._map._container.focus();\n\n\t\twindow.scrollTo(left, top);\n\t},\n\n\t_onFocus: function () {\n\t\tthis._focused = true;\n\t\tthis._map.fire('focus');\n\t},\n\n\t_onBlur: function () {\n\t\tthis._focused = false;\n\t\tthis._map.fire('blur');\n\t},\n\n\t_setPanDelta: function (panDelta) {\n\t\tvar keys = this._panKeys = {},\n\t\t codes = this.keyCodes,\n\t\t i, len;\n\n\t\tfor (i = 0, len = codes.left.length; i < len; i++) {\n\t\t\tkeys[codes.left[i]] = [-1 * panDelta, 0];\n\t\t}\n\t\tfor (i = 0, len = codes.right.length; i < len; i++) {\n\t\t\tkeys[codes.right[i]] = [panDelta, 0];\n\t\t}\n\t\tfor (i = 0, len = codes.down.length; i < len; i++) {\n\t\t\tkeys[codes.down[i]] = [0, panDelta];\n\t\t}\n\t\tfor (i = 0, len = codes.up.length; i < len; i++) {\n\t\t\tkeys[codes.up[i]] = [0, -1 * panDelta];\n\t\t}\n\t},\n\n\t_setZoomDelta: function (zoomDelta) {\n\t\tvar keys = this._zoomKeys = {},\n\t\t codes = this.keyCodes,\n\t\t i, len;\n\n\t\tfor (i = 0, len = codes.zoomIn.length; i < len; i++) {\n\t\t\tkeys[codes.zoomIn[i]] = zoomDelta;\n\t\t}\n\t\tfor (i = 0, len = codes.zoomOut.length; i < len; i++) {\n\t\t\tkeys[codes.zoomOut[i]] = -zoomDelta;\n\t\t}\n\t},\n\n\t_addHooks: function () {\n\t\ton(document, 'keydown', this._onKeyDown, this);\n\t},\n\n\t_removeHooks: function () {\n\t\toff(document, 'keydown', this._onKeyDown, this);\n\t},\n\n\t_onKeyDown: function (e) {\n\t\tif (e.altKey || e.ctrlKey || e.metaKey) { return; }\n\n\t\tvar key = e.keyCode,\n\t\t map = this._map,\n\t\t offset;\n\n\t\tif (key in this._panKeys) {\n\n\t\t\tif (map._panAnim && map._panAnim._inProgress) { return; }\n\n\t\t\toffset = this._panKeys[key];\n\t\t\tif (e.shiftKey) {\n\t\t\t\toffset = toPoint(offset).multiplyBy(3);\n\t\t\t}\n\n\t\t\tmap.panBy(offset);\n\n\t\t\tif (map.options.maxBounds) {\n\t\t\t\tmap.panInsideBounds(map.options.maxBounds);\n\t\t\t}\n\n\t\t} else if (key in this._zoomKeys) {\n\t\t\tmap.setZoom(map.getZoom() + (e.shiftKey ? 3 : 1) * this._zoomKeys[key]);\n\n\t\t} else if (key === 27 && map._popup && map._popup.options.closeOnEscapeKey) {\n\t\t\tmap.closePopup();\n\n\t\t} else {\n\t\t\treturn;\n\t\t}\n\n\t\tstop(e);\n\t}\n});\n\n// @section Handlers\n// @section Handlers\n// @property keyboard: Handler\n// Keyboard navigation handler.\nMap.addInitHook('addHandler', 'keyboard', Keyboard);\n\n/*\n * L.Handler.ScrollWheelZoom is used by L.Map to enable mouse scroll wheel zoom on the map.\n */\n\n// @namespace Map\n// @section Interaction Options\nMap.mergeOptions({\n\t// @section Mousewheel options\n\t// @option scrollWheelZoom: Boolean|String = true\n\t// Whether the map can be zoomed by using the mouse wheel. If passed `'center'`,\n\t// it will zoom to the center of the view regardless of where the mouse was.\n\tscrollWheelZoom: true,\n\n\t// @option wheelDebounceTime: Number = 40\n\t// Limits the rate at which a wheel can fire (in milliseconds). By default\n\t// user can't zoom via wheel more often than once per 40 ms.\n\twheelDebounceTime: 40,\n\n\t// @option wheelPxPerZoomLevel: Number = 60\n\t// How many scroll pixels (as reported by [L.DomEvent.getWheelDelta](#domevent-getwheeldelta))\n\t// mean a change of one full zoom level. Smaller values will make wheel-zooming\n\t// faster (and vice versa).\n\twheelPxPerZoomLevel: 60\n});\n\nvar ScrollWheelZoom = Handler.extend({\n\taddHooks: function () {\n\t\ton(this._map._container, 'mousewheel', this._onWheelScroll, this);\n\n\t\tthis._delta = 0;\n\t},\n\n\tremoveHooks: function () {\n\t\toff(this._map._container, 'mousewheel', this._onWheelScroll, this);\n\t},\n\n\t_onWheelScroll: function (e) {\n\t\tvar delta = getWheelDelta(e);\n\n\t\tvar debounce = this._map.options.wheelDebounceTime;\n\n\t\tthis._delta += delta;\n\t\tthis._lastMousePos = this._map.mouseEventToContainerPoint(e);\n\n\t\tif (!this._startTime) {\n\t\t\tthis._startTime = +new Date();\n\t\t}\n\n\t\tvar left = Math.max(debounce - (+new Date() - this._startTime), 0);\n\n\t\tclearTimeout(this._timer);\n\t\tthis._timer = setTimeout(bind(this._performZoom, this), left);\n\n\t\tstop(e);\n\t},\n\n\t_performZoom: function () {\n\t\tvar map = this._map,\n\t\t zoom = map.getZoom(),\n\t\t snap = this._map.options.zoomSnap || 0;\n\n\t\tmap._stop(); // stop panning and fly animations if any\n\n\t\t// map the delta with a sigmoid function to -4..4 range leaning on -1..1\n\t\tvar d2 = this._delta / (this._map.options.wheelPxPerZoomLevel * 4),\n\t\t d3 = 4 * Math.log(2 / (1 + Math.exp(-Math.abs(d2)))) / Math.LN2,\n\t\t d4 = snap ? Math.ceil(d3 / snap) * snap : d3,\n\t\t delta = map._limitZoom(zoom + (this._delta > 0 ? d4 : -d4)) - zoom;\n\n\t\tthis._delta = 0;\n\t\tthis._startTime = null;\n\n\t\tif (!delta) { return; }\n\n\t\tif (map.options.scrollWheelZoom === 'center') {\n\t\t\tmap.setZoom(zoom + delta);\n\t\t} else {\n\t\t\tmap.setZoomAround(this._lastMousePos, zoom + delta);\n\t\t}\n\t}\n});\n\n// @section Handlers\n// @property scrollWheelZoom: Handler\n// Scroll wheel zoom handler.\nMap.addInitHook('addHandler', 'scrollWheelZoom', ScrollWheelZoom);\n\n/*\n * L.Map.Tap is used to enable mobile hacks like quick taps and long hold.\n */\n\n// @namespace Map\n// @section Interaction Options\nMap.mergeOptions({\n\t// @section Touch interaction options\n\t// @option tap: Boolean = true\n\t// Enables mobile hacks for supporting instant taps (fixing 200ms click\n\t// delay on iOS/Android) and touch holds (fired as `contextmenu` events).\n\ttap: true,\n\n\t// @option tapTolerance: Number = 15\n\t// The max number of pixels a user can shift his finger during touch\n\t// for it to be considered a valid tap.\n\ttapTolerance: 15\n});\n\nvar Tap = Handler.extend({\n\taddHooks: function () {\n\t\ton(this._map._container, 'touchstart', this._onDown, this);\n\t},\n\n\tremoveHooks: function () {\n\t\toff(this._map._container, 'touchstart', this._onDown, this);\n\t},\n\n\t_onDown: function (e) {\n\t\tif (!e.touches) { return; }\n\n\t\tpreventDefault(e);\n\n\t\tthis._fireClick = true;\n\n\t\t// don't simulate click or track longpress if more than 1 touch\n\t\tif (e.touches.length > 1) {\n\t\t\tthis._fireClick = false;\n\t\t\tclearTimeout(this._holdTimeout);\n\t\t\treturn;\n\t\t}\n\n\t\tvar first = e.touches[0],\n\t\t el = first.target;\n\n\t\tthis._startPos = this._newPos = new Point(first.clientX, first.clientY);\n\n\t\t// if touching a link, highlight it\n\t\tif (el.tagName && el.tagName.toLowerCase() === 'a') {\n\t\t\taddClass(el, 'leaflet-active');\n\t\t}\n\n\t\t// simulate long hold but setting a timeout\n\t\tthis._holdTimeout = setTimeout(bind(function () {\n\t\t\tif (this._isTapValid()) {\n\t\t\t\tthis._fireClick = false;\n\t\t\t\tthis._onUp();\n\t\t\t\tthis._simulateEvent('contextmenu', first);\n\t\t\t}\n\t\t}, this), 1000);\n\n\t\tthis._simulateEvent('mousedown', first);\n\n\t\ton(document, {\n\t\t\ttouchmove: this._onMove,\n\t\t\ttouchend: this._onUp\n\t\t}, this);\n\t},\n\n\t_onUp: function (e) {\n\t\tclearTimeout(this._holdTimeout);\n\n\t\toff(document, {\n\t\t\ttouchmove: this._onMove,\n\t\t\ttouchend: this._onUp\n\t\t}, this);\n\n\t\tif (this._fireClick && e && e.changedTouches) {\n\n\t\t\tvar first = e.changedTouches[0],\n\t\t\t el = first.target;\n\n\t\t\tif (el && el.tagName && el.tagName.toLowerCase() === 'a') {\n\t\t\t\tremoveClass(el, 'leaflet-active');\n\t\t\t}\n\n\t\t\tthis._simulateEvent('mouseup', first);\n\n\t\t\t// simulate click if the touch didn't move too much\n\t\t\tif (this._isTapValid()) {\n\t\t\t\tthis._simulateEvent('click', first);\n\t\t\t}\n\t\t}\n\t},\n\n\t_isTapValid: function () {\n\t\treturn this._newPos.distanceTo(this._startPos) <= this._map.options.tapTolerance;\n\t},\n\n\t_onMove: function (e) {\n\t\tvar first = e.touches[0];\n\t\tthis._newPos = new Point(first.clientX, first.clientY);\n\t\tthis._simulateEvent('mousemove', first);\n\t},\n\n\t_simulateEvent: function (type, e) {\n\t\tvar simulatedEvent = document.createEvent('MouseEvents');\n\n\t\tsimulatedEvent._simulated = true;\n\t\te.target._simulatedClick = true;\n\n\t\tsimulatedEvent.initMouseEvent(\n\t\t type, true, true, window, 1,\n\t\t e.screenX, e.screenY,\n\t\t e.clientX, e.clientY,\n\t\t false, false, false, false, 0, null);\n\n\t\te.target.dispatchEvent(simulatedEvent);\n\t}\n});\n\n// @section Handlers\n// @property tap: Handler\n// Mobile touch hacks (quick tap and touch hold) handler.\nif (touch && !pointer) {\n\tMap.addInitHook('addHandler', 'tap', Tap);\n}\n\n/*\n * L.Handler.TouchZoom is used by L.Map to add pinch zoom on supported mobile browsers.\n */\n\n// @namespace Map\n// @section Interaction Options\nMap.mergeOptions({\n\t// @section Touch interaction options\n\t// @option touchZoom: Boolean|String = *\n\t// Whether the map can be zoomed by touch-dragging with two fingers. If\n\t// passed `'center'`, it will zoom to the center of the view regardless of\n\t// where the touch events (fingers) were. Enabled for touch-capable web\n\t// browsers except for old Androids.\n\ttouchZoom: touch && !android23,\n\n\t// @option bounceAtZoomLimits: Boolean = true\n\t// Set it to false if you don't want the map to zoom beyond min/max zoom\n\t// and then bounce back when pinch-zooming.\n\tbounceAtZoomLimits: true\n});\n\nvar TouchZoom = Handler.extend({\n\taddHooks: function () {\n\t\taddClass(this._map._container, 'leaflet-touch-zoom');\n\t\ton(this._map._container, 'touchstart', this._onTouchStart, this);\n\t},\n\n\tremoveHooks: function () {\n\t\tremoveClass(this._map._container, 'leaflet-touch-zoom');\n\t\toff(this._map._container, 'touchstart', this._onTouchStart, this);\n\t},\n\n\t_onTouchStart: function (e) {\n\t\tvar map = this._map;\n\t\tif (!e.touches || e.touches.length !== 2 || map._animatingZoom || this._zooming) { return; }\n\n\t\tvar p1 = map.mouseEventToContainerPoint(e.touches[0]),\n\t\t p2 = map.mouseEventToContainerPoint(e.touches[1]);\n\n\t\tthis._centerPoint = map.getSize()._divideBy(2);\n\t\tthis._startLatLng = map.containerPointToLatLng(this._centerPoint);\n\t\tif (map.options.touchZoom !== 'center') {\n\t\t\tthis._pinchStartLatLng = map.containerPointToLatLng(p1.add(p2)._divideBy(2));\n\t\t}\n\n\t\tthis._startDist = p1.distanceTo(p2);\n\t\tthis._startZoom = map.getZoom();\n\n\t\tthis._moved = false;\n\t\tthis._zooming = true;\n\n\t\tmap._stop();\n\n\t\ton(document, 'touchmove', this._onTouchMove, this);\n\t\ton(document, 'touchend', this._onTouchEnd, this);\n\n\t\tpreventDefault(e);\n\t},\n\n\t_onTouchMove: function (e) {\n\t\tif (!e.touches || e.touches.length !== 2 || !this._zooming) { return; }\n\n\t\tvar map = this._map,\n\t\t p1 = map.mouseEventToContainerPoint(e.touches[0]),\n\t\t p2 = map.mouseEventToContainerPoint(e.touches[1]),\n\t\t scale = p1.distanceTo(p2) / this._startDist;\n\n\t\tthis._zoom = map.getScaleZoom(scale, this._startZoom);\n\n\t\tif (!map.options.bounceAtZoomLimits && (\n\t\t\t(this._zoom < map.getMinZoom() && scale < 1) ||\n\t\t\t(this._zoom > map.getMaxZoom() && scale > 1))) {\n\t\t\tthis._zoom = map._limitZoom(this._zoom);\n\t\t}\n\n\t\tif (map.options.touchZoom === 'center') {\n\t\t\tthis._center = this._startLatLng;\n\t\t\tif (scale === 1) { return; }\n\t\t} else {\n\t\t\t// Get delta from pinch to center, so centerLatLng is delta applied to initial pinchLatLng\n\t\t\tvar delta = p1._add(p2)._divideBy(2)._subtract(this._centerPoint);\n\t\t\tif (scale === 1 && delta.x === 0 && delta.y === 0) { return; }\n\t\t\tthis._center = map.unproject(map.project(this._pinchStartLatLng, this._zoom).subtract(delta), this._zoom);\n\t\t}\n\n\t\tif (!this._moved) {\n\t\t\tmap._moveStart(true, false);\n\t\t\tthis._moved = true;\n\t\t}\n\n\t\tcancelAnimFrame(this._animRequest);\n\n\t\tvar moveFn = bind(map._move, map, this._center, this._zoom, {pinch: true, round: false});\n\t\tthis._animRequest = requestAnimFrame(moveFn, this, true);\n\n\t\tpreventDefault(e);\n\t},\n\n\t_onTouchEnd: function () {\n\t\tif (!this._moved || !this._zooming) {\n\t\t\tthis._zooming = false;\n\t\t\treturn;\n\t\t}\n\n\t\tthis._zooming = false;\n\t\tcancelAnimFrame(this._animRequest);\n\n\t\toff(document, 'touchmove', this._onTouchMove);\n\t\toff(document, 'touchend', this._onTouchEnd);\n\n\t\t// Pinch updates GridLayers' levels only when zoomSnap is off, so zoomSnap becomes noUpdate.\n\t\tif (this._map.options.zoomAnimation) {\n\t\t\tthis._map._animateZoom(this._center, this._map._limitZoom(this._zoom), true, this._map.options.zoomSnap);\n\t\t} else {\n\t\t\tthis._map._resetView(this._center, this._map._limitZoom(this._zoom));\n\t\t}\n\t}\n});\n\n// @section Handlers\n// @property touchZoom: Handler\n// Touch zoom handler.\nMap.addInitHook('addHandler', 'touchZoom', TouchZoom);\n\nMap.BoxZoom = BoxZoom;\nMap.DoubleClickZoom = DoubleClickZoom;\nMap.Drag = Drag;\nMap.Keyboard = Keyboard;\nMap.ScrollWheelZoom = ScrollWheelZoom;\nMap.Tap = Tap;\nMap.TouchZoom = TouchZoom;\n\n// misc\r\n\r\nvar oldL = window.L;\r\nfunction noConflict() {\r\n\twindow.L = oldL;\r\n\treturn this;\r\n}\r\n\r\n// Always export us to window global (see #2364)\r\nwindow.L = exports;\r\n\r\nObject.freeze = freeze;\n\nexports.version = version;\nexports.noConflict = noConflict;\nexports.Control = Control;\nexports.control = control;\nexports.Browser = Browser;\nexports.Evented = Evented;\nexports.Mixin = Mixin;\nexports.Util = Util;\nexports.Class = Class;\nexports.Handler = Handler;\nexports.extend = extend;\nexports.bind = bind;\nexports.stamp = stamp;\nexports.setOptions = setOptions;\nexports.DomEvent = DomEvent;\nexports.DomUtil = DomUtil;\nexports.PosAnimation = PosAnimation;\nexports.Draggable = Draggable;\nexports.LineUtil = LineUtil;\nexports.PolyUtil = PolyUtil;\nexports.Point = Point;\nexports.point = toPoint;\nexports.Bounds = Bounds;\nexports.bounds = toBounds;\nexports.Transformation = Transformation;\nexports.transformation = toTransformation;\nexports.Projection = index;\nexports.LatLng = LatLng;\nexports.latLng = toLatLng;\nexports.LatLngBounds = LatLngBounds;\nexports.latLngBounds = toLatLngBounds;\nexports.CRS = CRS;\nexports.GeoJSON = GeoJSON;\nexports.geoJSON = geoJSON;\nexports.geoJson = geoJson;\nexports.Layer = Layer;\nexports.LayerGroup = LayerGroup;\nexports.layerGroup = layerGroup;\nexports.FeatureGroup = FeatureGroup;\nexports.featureGroup = featureGroup;\nexports.ImageOverlay = ImageOverlay;\nexports.imageOverlay = imageOverlay;\nexports.VideoOverlay = VideoOverlay;\nexports.videoOverlay = videoOverlay;\nexports.DivOverlay = DivOverlay;\nexports.Popup = Popup;\nexports.popup = popup;\nexports.Tooltip = Tooltip;\nexports.tooltip = tooltip;\nexports.Icon = Icon;\nexports.icon = icon;\nexports.DivIcon = DivIcon;\nexports.divIcon = divIcon;\nexports.Marker = Marker;\nexports.marker = marker;\nexports.TileLayer = TileLayer;\nexports.tileLayer = tileLayer;\nexports.GridLayer = GridLayer;\nexports.gridLayer = gridLayer;\nexports.SVG = SVG;\nexports.svg = svg$1;\nexports.Renderer = Renderer;\nexports.Canvas = Canvas;\nexports.canvas = canvas$1;\nexports.Path = Path;\nexports.CircleMarker = CircleMarker;\nexports.circleMarker = circleMarker;\nexports.Circle = Circle;\nexports.circle = circle;\nexports.Polyline = Polyline;\nexports.polyline = polyline;\nexports.Polygon = Polygon;\nexports.polygon = polygon;\nexports.Rectangle = Rectangle;\nexports.rectangle = rectangle;\nexports.Map = Map;\nexports.map = createMap;\n\n})));\n//# sourceMappingURL=leaflet-src.js.map\n\n\n//# sourceURL=webpack:///./node_modules/leaflet/dist/leaflet-src.js?");
/***/ }),
/***/ "./node_modules/lodash/lodash.js":
/*!***************************************!*\
!*** ./node_modules/lodash/lodash.js ***!
\***************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("/* WEBPACK VAR INJECTION */(function(global, module) {var __WEBPACK_AMD_DEFINE_RESULT__;/**\n * @license\n * Lodash <https://lodash.com/>\n * Copyright JS Foundation and other contributors <https://js.foundation/>\n * Released under MIT license <https://lodash.com/license>\n * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>\n * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n */\n;(function() {\n\n /** Used as a safe reference for `undefined` in pre-ES5 environments. */\n var undefined;\n\n /** Used as the semantic version number. */\n var VERSION = '4.17.4';\n\n /** Used as the size to enable large array optimizations. */\n var LARGE_ARRAY_SIZE = 200;\n\n /** Error message constants. */\n var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',\n FUNC_ERROR_TEXT = 'Expected a function';\n\n /** Used to stand-in for `undefined` hash values. */\n var HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n /** Used as the maximum memoize cache size. */\n var MAX_MEMOIZE_SIZE = 500;\n\n /** Used as the internal argument placeholder. */\n var PLACEHOLDER = '__lodash_placeholder__';\n\n /** Used to compose bitmasks for cloning. */\n var CLONE_DEEP_FLAG = 1,\n CLONE_FLAT_FLAG = 2,\n CLONE_SYMBOLS_FLAG = 4;\n\n /** Used to compose bitmasks for value comparisons. */\n var COMPARE_PARTIAL_FLAG = 1,\n COMPARE_UNORDERED_FLAG = 2;\n\n /** Used to compose bitmasks for function metadata. */\n var WRAP_BIND_FLAG = 1,\n WRAP_BIND_KEY_FLAG = 2,\n WRAP_CURRY_BOUND_FLAG = 4,\n WRAP_CURRY_FLAG = 8,\n WRAP_CURRY_RIGHT_FLAG = 16,\n WRAP_PARTIAL_FLAG = 32,\n WRAP_PARTIAL_RIGHT_FLAG = 64,\n WRAP_ARY_FLAG = 128,\n WRAP_REARG_FLAG = 256,\n WRAP_FLIP_FLAG = 512;\n\n /** Used as default options for `_.truncate`. */\n var DEFAULT_TRUNC_LENGTH = 30,\n DEFAULT_TRUNC_OMISSION = '...';\n\n /** Used to detect hot functions by number of calls within a span of milliseconds. */\n var HOT_COUNT = 800,\n HOT_SPAN = 16;\n\n /** Used to indicate the type of lazy iteratees. */\n var LAZY_FILTER_FLAG = 1,\n LAZY_MAP_FLAG = 2,\n LAZY_WHILE_FLAG = 3;\n\n /** Used as references for various `Number` constants. */\n var INFINITY = 1 / 0,\n MAX_SAFE_INTEGER = 9007199254740991,\n MAX_INTEGER = 1.7976931348623157e+308,\n NAN = 0 / 0;\n\n /** Used as references for the maximum length and index of an array. */\n var MAX_ARRAY_LENGTH = 4294967295,\n MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,\n HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;\n\n /** Used to associate wrap methods with their bit flags. */\n var wrapFlags = [\n ['ary', WRAP_ARY_FLAG],\n ['bind', WRAP_BIND_FLAG],\n ['bindKey', WRAP_BIND_KEY_FLAG],\n ['curry', WRAP_CURRY_FLAG],\n ['curryRight', WRAP_CURRY_RIGHT_FLAG],\n ['flip', WRAP_FLIP_FLAG],\n ['partial', WRAP_PARTIAL_FLAG],\n ['partialRight', WRAP_PARTIAL_RIGHT_FLAG],\n ['rearg', WRAP_REARG_FLAG]\n ];\n\n /** `Object#toString` result references. */\n var argsTag = '[object Arguments]',\n arrayTag = '[object Array]',\n asyncTag = '[object AsyncFunction]',\n boolTag = '[object Boolean]',\n dateTag = '[object Date]',\n domExcTag = '[object DOMException]',\n errorTag = '[object Error]',\n funcTag = '[object Function]',\n genTag = '[object GeneratorFunction]',\n mapTag = '[object Map]',\n numberTag = '[object Number]',\n nullTag = '[object Null]',\n objectTag = '[object Object]',\n promiseTag = '[object Promise]',\n proxyTag = '[object Proxy]',\n regexpTag = '[object RegExp]',\n setTag = '[object Set]',\n stringTag = '[object String]',\n symbolTag = '[object Symbol]',\n undefinedTag = '[object Undefined]',\n weakMapTag = '[object WeakMap]',\n weakSetTag = '[object WeakSet]';\n\n var arrayBufferTag = '[object ArrayBuffer]',\n dataViewTag = '[object DataView]',\n float32Tag = '[object Float32Array]',\n float64Tag = '[object Float64Array]',\n int8Tag = '[object Int8Array]',\n int16Tag = '[object Int16Array]',\n int32Tag = '[object Int32Array]',\n uint8Tag = '[object Uint8Array]',\n uint8ClampedTag = '[object Uint8ClampedArray]',\n uint16Tag = '[object Uint16Array]',\n uint32Tag = '[object Uint32Array]';\n\n /** Used to match empty string literals in compiled template source. */\n var reEmptyStringLeading = /\\b__p \\+= '';/g,\n reEmptyStringMiddle = /\\b(__p \\+=) '' \\+/g,\n reEmptyStringTrailing = /(__e\\(.*?\\)|\\b__t\\)) \\+\\n'';/g;\n\n /** Used to match HTML entities and HTML characters. */\n var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,\n reUnescapedHtml = /[&<>\"']/g,\n reHasEscapedHtml = RegExp(reEscapedHtml.source),\n reHasUnescapedHtml = RegExp(reUnescapedHtml.source);\n\n /** Used to match template delimiters. */\n var reEscape = /<%-([\\s\\S]+?)%>/g,\n reEvaluate = /<%([\\s\\S]+?)%>/g,\n reInterpolate = /<%=([\\s\\S]+?)%>/g;\n\n /** Used to match property names within property paths. */\n var reIsDeepProp = /\\.|\\[(?:[^[\\]]*|([\"'])(?:(?!\\1)[^\\\\]|\\\\.)*?\\1)\\]/,\n reIsPlainProp = /^\\w*$/,\n reLeadingDot = /^\\./,\n rePropName = /[^.[\\]]+|\\[(?:(-?\\d+(?:\\.\\d+)?)|([\"'])((?:(?!\\2)[^\\\\]|\\\\.)*?)\\2)\\]|(?=(?:\\.|\\[\\])(?:\\.|\\[\\]|$))/g;\n\n /**\n * Used to match `RegExp`\n * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).\n */\n var reRegExpChar = /[\\\\^$.*+?()[\\]{}|]/g,\n reHasRegExpChar = RegExp(reRegExpChar.source);\n\n /** Used to match leading and trailing whitespace. */\n var reTrim = /^\\s+|\\s+$/g,\n reTrimStart = /^\\s+/,\n reTrimEnd = /\\s+$/;\n\n /** Used to match wrap detail comments. */\n var reWrapComment = /\\{(?:\\n\\/\\* \\[wrapped with .+\\] \\*\\/)?\\n?/,\n reWrapDetails = /\\{\\n\\/\\* \\[wrapped with (.+)\\] \\*/,\n reSplitDetails = /,? & /;\n\n /** Used to match words composed of alphanumeric characters. */\n var reAsciiWord = /[^\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\x7f]+/g;\n\n /** Used to match backslashes in property paths. */\n var reEscapeChar = /\\\\(\\\\)?/g;\n\n /**\n * Used to match\n * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).\n */\n var reEsTemplate = /\\$\\{([^\\\\}]*(?:\\\\.[^\\\\}]*)*)\\}/g;\n\n /** Used to match `RegExp` flags from their coerced string values. */\n var reFlags = /\\w*$/;\n\n /** Used to detect bad signed hexadecimal string values. */\n var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;\n\n /** Used to detect binary string values. */\n var reIsBinary = /^0b[01]+$/i;\n\n /** Used to detect host constructors (Safari). */\n var reIsHostCtor = /^\\[object .+?Constructor\\]$/;\n\n /** Used to detect octal string values. */\n var reIsOctal = /^0o[0-7]+$/i;\n\n /** Used to detect unsigned integer values. */\n var reIsUint = /^(?:0|[1-9]\\d*)$/;\n\n /** Used to match Latin Unicode letters (excluding mathematical operators). */\n var reLatin = /[\\xc0-\\xd6\\xd8-\\xf6\\xf8-\\xff\\u0100-\\u017f]/g;\n\n /** Used to ensure capturing order of template delimiters. */\n var reNoMatch = /($^)/;\n\n /** Used to match unescaped characters in compiled string literals. */\n var reUnescapedString = /['\\n\\r\\u2028\\u2029\\\\]/g;\n\n /** Used to compose unicode character classes. */\n var rsAstralRange = '\\\\ud800-\\\\udfff',\n rsComboMarksRange = '\\\\u0300-\\\\u036f',\n reComboHalfMarksRange = '\\\\ufe20-\\\\ufe2f',\n rsComboSymbolsRange = '\\\\u20d0-\\\\u20ff',\n rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,\n rsDingbatRange = '\\\\u2700-\\\\u27bf',\n rsLowerRange = 'a-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xff',\n rsMathOpRange = '\\\\xac\\\\xb1\\\\xd7\\\\xf7',\n rsNonCharRange = '\\\\x00-\\\\x2f\\\\x3a-\\\\x40\\\\x5b-\\\\x60\\\\x7b-\\\\xbf',\n rsPunctuationRange = '\\\\u2000-\\\\u206f',\n rsSpaceRange = ' \\\\t\\\\x0b\\\\f\\\\xa0\\\\ufeff\\\\n\\\\r\\\\u2028\\\\u2029\\\\u1680\\\\u180e\\\\u2000\\\\u2001\\\\u2002\\\\u2003\\\\u2004\\\\u2005\\\\u2006\\\\u2007\\\\u2008\\\\u2009\\\\u200a\\\\u202f\\\\u205f\\\\u3000',\n rsUpperRange = 'A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde',\n rsVarRange = '\\\\ufe0e\\\\ufe0f',\n rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;\n\n /** Used to compose unicode capture groups. */\n var rsApos = \"['\\u2019]\",\n rsAstral = '[' + rsAstralRange + ']',\n rsBreak = '[' + rsBreakRange + ']',\n rsCombo = '[' + rsComboRange + ']',\n rsDigits = '\\\\d+',\n rsDingbat = '[' + rsDingbatRange + ']',\n rsLower = '[' + rsLowerRange + ']',\n rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',\n rsFitz = '\\\\ud83c[\\\\udffb-\\\\udfff]',\n rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',\n rsNonAstral = '[^' + rsAstralRange + ']',\n rsRegional = '(?:\\\\ud83c[\\\\udde6-\\\\uddff]){2}',\n rsSurrPair = '[\\\\ud800-\\\\udbff][\\\\udc00-\\\\udfff]',\n rsUpper = '[' + rsUpperRange + ']',\n rsZWJ = '\\\\u200d';\n\n /** Used to compose unicode regexes. */\n var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',\n rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',\n rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',\n rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',\n reOptMod = rsModifier + '?',\n rsOptVar = '[' + rsVarRange + ']?',\n rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',\n rsOrdLower = '\\\\d*(?:(?:1st|2nd|3rd|(?![123])\\\\dth)\\\\b)',\n rsOrdUpper = '\\\\d*(?:(?:1ST|2ND|3RD|(?![123])\\\\dTH)\\\\b)',\n rsSeq = rsOptVar + reOptMod + rsOptJoin,\n rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,\n rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';\n\n /** Used to match apostrophes. */\n var reApos = RegExp(rsApos, 'g');\n\n /**\n * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and\n * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).\n */\n var reComboMark = RegExp(rsCombo, 'g');\n\n /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */\n var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');\n\n /** Used to match complex or compound words. */\n var reUnicodeWord = RegExp([\n rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',\n rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',\n rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,\n rsUpper + '+' + rsOptContrUpper,\n rsOrdUpper,\n rsOrdLower,\n rsDigits,\n rsEmoji\n ].join('|'), 'g');\n\n /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */\n var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');\n\n /** Used to detect strings that need a more robust regexp to match words. */\n var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;\n\n /** Used to assign default `context` object properties. */\n var contextProps = [\n 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',\n 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',\n 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',\n 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',\n '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'\n ];\n\n /** Used to make template sourceURLs easier to identify. */\n var templateCounter = -1;\n\n /** Used to identify `toStringTag` values of typed arrays. */\n var typedArrayTags = {};\n typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =\n typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =\n typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =\n typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =\n typedArrayTags[uint32Tag] = true;\n typedArrayTags[argsTag] = typedArrayTags[arrayTag] =\n typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =\n typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =\n typedArrayTags[errorTag] = typedArrayTags[funcTag] =\n typedArrayTags[mapTag] = typedArrayTags[numberTag] =\n typedArrayTags[objectTag] = typedArrayTags[regexpTag] =\n typedArrayTags[setTag] = typedArrayTags[stringTag] =\n typedArrayTags[weakMapTag] = false;\n\n /** Used to identify `toStringTag` values supported by `_.clone`. */\n var cloneableTags = {};\n cloneableTags[argsTag] = cloneableTags[arrayTag] =\n cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =\n cloneableTags[boolTag] = cloneableTags[dateTag] =\n cloneableTags[float32Tag] = cloneableTags[float64Tag] =\n cloneableTags[int8Tag] = cloneableTags[int16Tag] =\n cloneableTags[int32Tag] = cloneableTags[mapTag] =\n cloneableTags[numberTag] = cloneableTags[objectTag] =\n cloneableTags[regexpTag] = cloneableTags[setTag] =\n cloneableTags[stringTag] = cloneableTags[symbolTag] =\n cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =\n cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;\n cloneableTags[errorTag] = cloneableTags[funcTag] =\n cloneableTags[weakMapTag] = false;\n\n /** Used to map Latin Unicode letters to basic Latin letters. */\n var deburredLetters = {\n // Latin-1 Supplement block.\n '\\xc0': 'A', '\\xc1': 'A', '\\xc2': 'A', '\\xc3': 'A', '\\xc4': 'A', '\\xc5': 'A',\n '\\xe0': 'a', '\\xe1': 'a', '\\xe2': 'a', '\\xe3': 'a', '\\xe4': 'a', '\\xe5': 'a',\n '\\xc7': 'C', '\\xe7': 'c',\n '\\xd0': 'D', '\\xf0': 'd',\n '\\xc8': 'E', '\\xc9': 'E', '\\xca': 'E', '\\xcb': 'E',\n '\\xe8': 'e', '\\xe9': 'e', '\\xea': 'e', '\\xeb': 'e',\n '\\xcc': 'I', '\\xcd': 'I', '\\xce': 'I', '\\xcf': 'I',\n '\\xec': 'i', '\\xed': 'i', '\\xee': 'i', '\\xef': 'i',\n '\\xd1': 'N', '\\xf1': 'n',\n '\\xd2': 'O', '\\xd3': 'O', '\\xd4': 'O', '\\xd5': 'O', '\\xd6': 'O', '\\xd8': 'O',\n '\\xf2': 'o', '\\xf3': 'o', '\\xf4': 'o', '\\xf5': 'o', '\\xf6': 'o', '\\xf8': 'o',\n '\\xd9': 'U', '\\xda': 'U', '\\xdb': 'U', '\\xdc': 'U',\n '\\xf9': 'u', '\\xfa': 'u', '\\xfb': 'u', '\\xfc': 'u',\n '\\xdd': 'Y', '\\xfd': 'y', '\\xff': 'y',\n '\\xc6': 'Ae', '\\xe6': 'ae',\n '\\xde': 'Th', '\\xfe': 'th',\n '\\xdf': 'ss',\n // Latin Extended-A block.\n '\\u0100': 'A', '\\u0102': 'A', '\\u0104': 'A',\n '\\u0101': 'a', '\\u0103': 'a', '\\u0105': 'a',\n '\\u0106': 'C', '\\u0108': 'C', '\\u010a': 'C', '\\u010c': 'C',\n '\\u0107': 'c', '\\u0109': 'c', '\\u010b': 'c', '\\u010d': 'c',\n '\\u010e': 'D', '\\u0110': 'D', '\\u010f': 'd', '\\u0111': 'd',\n '\\u0112': 'E', '\\u0114': 'E', '\\u0116': 'E', '\\u0118': 'E', '\\u011a': 'E',\n '\\u0113': 'e', '\\u0115': 'e', '\\u0117': 'e', '\\u0119': 'e', '\\u011b': 'e',\n '\\u011c': 'G', '\\u011e': 'G', '\\u0120': 'G', '\\u0122': 'G',\n '\\u011d': 'g', '\\u011f': 'g', '\\u0121': 'g', '\\u0123': 'g',\n '\\u0124': 'H', '\\u0126': 'H', '\\u0125': 'h', '\\u0127': 'h',\n '\\u0128': 'I', '\\u012a': 'I', '\\u012c': 'I', '\\u012e': 'I', '\\u0130': 'I',\n '\\u0129': 'i', '\\u012b': 'i', '\\u012d': 'i', '\\u012f': 'i', '\\u0131': 'i',\n '\\u0134': 'J', '\\u0135': 'j',\n '\\u0136': 'K', '\\u0137': 'k', '\\u0138': 'k',\n '\\u0139': 'L', '\\u013b': 'L', '\\u013d': 'L', '\\u013f': 'L', '\\u0141': 'L',\n '\\u013a': 'l', '\\u013c': 'l', '\\u013e': 'l', '\\u0140': 'l', '\\u0142': 'l',\n '\\u0143': 'N', '\\u0145': 'N', '\\u0147': 'N', '\\u014a': 'N',\n '\\u0144': 'n', '\\u0146': 'n', '\\u0148': 'n', '\\u014b': 'n',\n '\\u014c': 'O', '\\u014e': 'O', '\\u0150': 'O',\n '\\u014d': 'o', '\\u014f': 'o', '\\u0151': 'o',\n '\\u0154': 'R', '\\u0156': 'R', '\\u0158': 'R',\n '\\u0155': 'r', '\\u0157': 'r', '\\u0159': 'r',\n '\\u015a': 'S', '\\u015c': 'S', '\\u015e': 'S', '\\u0160': 'S',\n '\\u015b': 's', '\\u015d': 's', '\\u015f': 's', '\\u0161': 's',\n '\\u0162': 'T', '\\u0164': 'T', '\\u0166': 'T',\n '\\u0163': 't', '\\u0165': 't', '\\u0167': 't',\n '\\u0168': 'U', '\\u016a': 'U', '\\u016c': 'U', '\\u016e': 'U', '\\u0170': 'U', '\\u0172': 'U',\n '\\u0169': 'u', '\\u016b': 'u', '\\u016d': 'u', '\\u016f': 'u', '\\u0171': 'u', '\\u0173': 'u',\n '\\u0174': 'W', '\\u0175': 'w',\n '\\u0176': 'Y', '\\u0177': 'y', '\\u0178': 'Y',\n '\\u0179': 'Z', '\\u017b': 'Z', '\\u017d': 'Z',\n '\\u017a': 'z', '\\u017c': 'z', '\\u017e': 'z',\n '\\u0132': 'IJ', '\\u0133': 'ij',\n '\\u0152': 'Oe', '\\u0153': 'oe',\n '\\u0149': \"'n\", '\\u017f': 's'\n };\n\n /** Used to map characters to HTML entities. */\n var htmlEscapes = {\n '&': '&amp;',\n '<': '&lt;',\n '>': '&gt;',\n '\"': '&quot;',\n \"'\": '&#39;'\n };\n\n /** Used to map HTML entities to characters. */\n var htmlUnescapes = {\n '&amp;': '&',\n '&lt;': '<',\n '&gt;': '>',\n '&quot;': '\"',\n '&#39;': \"'\"\n };\n\n /** Used to escape characters for inclusion in compiled string literals. */\n var stringEscapes = {\n '\\\\': '\\\\',\n \"'\": \"'\",\n '\\n': 'n',\n '\\r': 'r',\n '\\u2028': 'u2028',\n '\\u2029': 'u2029'\n };\n\n /** Built-in method references without a dependency on `root`. */\n var freeParseFloat = parseFloat,\n freeParseInt = parseInt;\n\n /** Detect free variable `global` from Node.js. */\n var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;\n\n /** Detect free variable `self`. */\n var freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n /** Used as a reference to the global object. */\n var root = freeGlobal || freeSelf || Function('return this')();\n\n /** Detect free variable `exports`. */\n var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports;\n\n /** Detect free variable `module`. */\n var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;\n\n /** Detect the popular CommonJS extension `module.exports`. */\n var moduleExports = freeModule && freeModule.exports === freeExports;\n\n /** Detect free variable `process` from Node.js. */\n var freeProcess = moduleExports && freeGlobal.process;\n\n /** Used to access faster Node.js helpers. */\n var nodeUtil = (function() {\n try {\n return freeProcess && freeProcess.binding && freeProcess.binding('util');\n } catch (e) {}\n }());\n\n /* Node.js helper references. */\n var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,\n nodeIsDate = nodeUtil && nodeUtil.isDate,\n nodeIsMap = nodeUtil && nodeUtil.isMap,\n nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,\n nodeIsSet = nodeUtil && nodeUtil.isSet,\n nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * Adds the key-value `pair` to `map`.\n *\n * @private\n * @param {Object} map The map to modify.\n * @param {Array} pair The key-value pair to add.\n * @returns {Object} Returns `map`.\n */\n function addMapEntry(map, pair) {\n // Don't return `map.set` because it's not chainable in IE 11.\n map.set(pair[0], pair[1]);\n return map;\n }\n\n /**\n * Adds `value` to `set`.\n *\n * @private\n * @param {Object} set The set to modify.\n * @param {*} value The value to add.\n * @returns {Object} Returns `set`.\n */\n function addSetEntry(set, value) {\n // Don't return `set.add` because it's not chainable in IE 11.\n set.add(value);\n return set;\n }\n\n /**\n * A faster alternative to `Function#apply`, this function invokes `func`\n * with the `this` binding of `thisArg` and the arguments of `args`.\n *\n * @private\n * @param {Function} func The function to invoke.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {Array} args The arguments to invoke `func` with.\n * @returns {*} Returns the result of `func`.\n */\n function apply(func, thisArg, args) {\n switch (args.length) {\n case 0: return func.call(thisArg);\n case 1: return func.call(thisArg, args[0]);\n case 2: return func.call(thisArg, args[0], args[1]);\n case 3: return func.call(thisArg, args[0], args[1], args[2]);\n }\n return func.apply(thisArg, args);\n }\n\n /**\n * A specialized version of `baseAggregator` for arrays.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform keys.\n * @param {Object} accumulator The initial aggregated object.\n * @returns {Function} Returns `accumulator`.\n */\n function arrayAggregator(array, setter, iteratee, accumulator) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n var value = array[index];\n setter(accumulator, value, iteratee(value), array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.forEach` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\n function arrayEach(array, iteratee) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (iteratee(array[index], index, array) === false) {\n break;\n }\n }\n return array;\n }\n\n /**\n * A specialized version of `_.forEachRight` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\n function arrayEachRight(array, iteratee) {\n var length = array == null ? 0 : array.length;\n\n while (length--) {\n if (iteratee(array[length], length, array) === false) {\n break;\n }\n }\n return array;\n }\n\n /**\n * A specialized version of `_.every` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n */\n function arrayEvery(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (!predicate(array[index], index, array)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * A specialized version of `_.filter` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\n function arrayFilter(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result[resIndex++] = value;\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `_.includes` for arrays without support for\n * specifying an index to search from.\n *\n * @private\n * @param {Array} [array] The array to inspect.\n * @param {*} target The value to search for.\n * @returns {boolean} Returns `true` if `target` is found, else `false`.\n */\n function arrayIncludes(array, value) {\n var length = array == null ? 0 : array.length;\n return !!length && baseIndexOf(array, value, 0) > -1;\n }\n\n /**\n * This function is like `arrayIncludes` except that it accepts a comparator.\n *\n * @private\n * @param {Array} [array] The array to inspect.\n * @param {*} target The value to search for.\n * @param {Function} comparator The comparator invoked per element.\n * @returns {boolean} Returns `true` if `target` is found, else `false`.\n */\n function arrayIncludesWith(array, value, comparator) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (comparator(value, array[index])) {\n return true;\n }\n }\n return false;\n }\n\n /**\n * A specialized version of `_.map` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n */\n function arrayMap(array, iteratee) {\n var index = -1,\n length = array == null ? 0 : array.length,\n result = Array(length);\n\n while (++index < length) {\n result[index] = iteratee(array[index], index, array);\n }\n return result;\n }\n\n /**\n * Appends the elements of `values` to `array`.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to append.\n * @returns {Array} Returns `array`.\n */\n function arrayPush(array, values) {\n var index = -1,\n length = values.length,\n offset = array.length;\n\n while (++index < length) {\n array[offset + index] = values[index];\n }\n return array;\n }\n\n /**\n * A specialized version of `_.reduce` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the first element of `array` as\n * the initial value.\n * @returns {*} Returns the accumulated value.\n */\n function arrayReduce(array, iteratee, accumulator, initAccum) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n if (initAccum && length) {\n accumulator = array[++index];\n }\n while (++index < length) {\n accumulator = iteratee(accumulator, array[index], index, array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.reduceRight` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the last element of `array` as\n * the initial value.\n * @returns {*} Returns the accumulated value.\n */\n function arrayReduceRight(array, iteratee, accumulator, initAccum) {\n var length = array == null ? 0 : array.length;\n if (initAccum && length) {\n accumulator = array[--length];\n }\n while (length--) {\n accumulator = iteratee(accumulator, array[length], length, array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.some` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\n function arraySome(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (predicate(array[index], index, array)) {\n return true;\n }\n }\n return false;\n }\n\n /**\n * Gets the size of an ASCII `string`.\n *\n * @private\n * @param {string} string The string inspect.\n * @returns {number} Returns the string size.\n */\n var asciiSize = baseProperty('length');\n\n /**\n * Converts an ASCII `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function asciiToArray(string) {\n return string.split('');\n }\n\n /**\n * Splits an ASCII `string` into an array of its words.\n *\n * @private\n * @param {string} The string to inspect.\n * @returns {Array} Returns the words of `string`.\n */\n function asciiWords(string) {\n return string.match(reAsciiWord) || [];\n }\n\n /**\n * The base implementation of methods like `_.findKey` and `_.findLastKey`,\n * without support for iteratee shorthands, which iterates over `collection`\n * using `eachFunc`.\n *\n * @private\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} predicate The function invoked per iteration.\n * @param {Function} eachFunc The function to iterate over `collection`.\n * @returns {*} Returns the found element or its key, else `undefined`.\n */\n function baseFindKey(collection, predicate, eachFunc) {\n var result;\n eachFunc(collection, function(value, key, collection) {\n if (predicate(value, key, collection)) {\n result = key;\n return false;\n }\n });\n return result;\n }\n\n /**\n * The base implementation of `_.findIndex` and `_.findLastIndex` without\n * support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} predicate The function invoked per iteration.\n * @param {number} fromIndex The index to search from.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseFindIndex(array, predicate, fromIndex, fromRight) {\n var length = array.length,\n index = fromIndex + (fromRight ? 1 : -1);\n\n while ((fromRight ? index-- : ++index < length)) {\n if (predicate(array[index], index, array)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * The base implementation of `_.indexOf` without `fromIndex` bounds checks.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseIndexOf(array, value, fromIndex) {\n return value === value\n ? strictIndexOf(array, value, fromIndex)\n : baseFindIndex(array, baseIsNaN, fromIndex);\n }\n\n /**\n * This function is like `baseIndexOf` except that it accepts a comparator.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @param {Function} comparator The comparator invoked per element.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseIndexOfWith(array, value, fromIndex, comparator) {\n var index = fromIndex - 1,\n length = array.length;\n\n while (++index < length) {\n if (comparator(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * The base implementation of `_.isNaN` without support for number objects.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n */\n function baseIsNaN(value) {\n return value !== value;\n }\n\n /**\n * The base implementation of `_.mean` and `_.meanBy` without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {number} Returns the mean.\n */\n function baseMean(array, iteratee) {\n var length = array == null ? 0 : array.length;\n return length ? (baseSum(array, iteratee) / length) : NAN;\n }\n\n /**\n * The base implementation of `_.property` without support for deep paths.\n *\n * @private\n * @param {string} key The key of the property to get.\n * @returns {Function} Returns the new accessor function.\n */\n function baseProperty(key) {\n return function(object) {\n return object == null ? undefined : object[key];\n };\n }\n\n /**\n * The base implementation of `_.propertyOf` without support for deep paths.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Function} Returns the new accessor function.\n */\n function basePropertyOf(object) {\n return function(key) {\n return object == null ? undefined : object[key];\n };\n }\n\n /**\n * The base implementation of `_.reduce` and `_.reduceRight`, without support\n * for iteratee shorthands, which iterates over `collection` using `eachFunc`.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} accumulator The initial value.\n * @param {boolean} initAccum Specify using the first or last element of\n * `collection` as the initial value.\n * @param {Function} eachFunc The function to iterate over `collection`.\n * @returns {*} Returns the accumulated value.\n */\n function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {\n eachFunc(collection, function(value, index, collection) {\n accumulator = initAccum\n ? (initAccum = false, value)\n : iteratee(accumulator, value, index, collection);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.sortBy` which uses `comparer` to define the\n * sort order of `array` and replaces criteria objects with their corresponding\n * values.\n *\n * @private\n * @param {Array} array The array to sort.\n * @param {Function} comparer The function to define sort order.\n * @returns {Array} Returns `array`.\n */\n function baseSortBy(array, comparer) {\n var length = array.length;\n\n array.sort(comparer);\n while (length--) {\n array[length] = array[length].value;\n }\n return array;\n }\n\n /**\n * The base implementation of `_.sum` and `_.sumBy` without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {number} Returns the sum.\n */\n function baseSum(array, iteratee) {\n var result,\n index = -1,\n length = array.length;\n\n while (++index < length) {\n var current = iteratee(array[index]);\n if (current !== undefined) {\n result = result === undefined ? current : (result + current);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.times` without support for iteratee shorthands\n * or max array length checks.\n *\n * @private\n * @param {number} n The number of times to invoke `iteratee`.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the array of results.\n */\n function baseTimes(n, iteratee) {\n var index = -1,\n result = Array(n);\n\n while (++index < n) {\n result[index] = iteratee(index);\n }\n return result;\n }\n\n /**\n * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array\n * of key-value pairs for `object` corresponding to the property names of `props`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} props The property names to get values for.\n * @returns {Object} Returns the key-value pairs.\n */\n function baseToPairs(object, props) {\n return arrayMap(props, function(key) {\n return [key, object[key]];\n });\n }\n\n /**\n * The base implementation of `_.unary` without support for storing metadata.\n *\n * @private\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n */\n function baseUnary(func) {\n return function(value) {\n return func(value);\n };\n }\n\n /**\n * The base implementation of `_.values` and `_.valuesIn` which creates an\n * array of `object` property values corresponding to the property names\n * of `props`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} props The property names to get values for.\n * @returns {Object} Returns the array of property values.\n */\n function baseValues(object, props) {\n return arrayMap(props, function(key) {\n return object[key];\n });\n }\n\n /**\n * Checks if a `cache` value for `key` exists.\n *\n * @private\n * @param {Object} cache The cache to query.\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function cacheHas(cache, key) {\n return cache.has(key);\n }\n\n /**\n * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol\n * that is not found in the character symbols.\n *\n * @private\n * @param {Array} strSymbols The string symbols to inspect.\n * @param {Array} chrSymbols The character symbols to find.\n * @returns {number} Returns the index of the first unmatched string symbol.\n */\n function charsStartIndex(strSymbols, chrSymbols) {\n var index = -1,\n length = strSymbols.length;\n\n while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}\n return index;\n }\n\n /**\n * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol\n * that is not found in the character symbols.\n *\n * @private\n * @param {Array} strSymbols The string symbols to inspect.\n * @param {Array} chrSymbols The character symbols to find.\n * @returns {number} Returns the index of the last unmatched string symbol.\n */\n function charsEndIndex(strSymbols, chrSymbols) {\n var index = strSymbols.length;\n\n while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}\n return index;\n }\n\n /**\n * Gets the number of `placeholder` occurrences in `array`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} placeholder The placeholder to search for.\n * @returns {number} Returns the placeholder count.\n */\n function countHolders(array, placeholder) {\n var length = array.length,\n result = 0;\n\n while (length--) {\n if (array[length] === placeholder) {\n ++result;\n }\n }\n return result;\n }\n\n /**\n * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A\n * letters to basic Latin letters.\n *\n * @private\n * @param {string} letter The matched letter to deburr.\n * @returns {string} Returns the deburred letter.\n */\n var deburrLetter = basePropertyOf(deburredLetters);\n\n /**\n * Used by `_.escape` to convert characters to HTML entities.\n *\n * @private\n * @param {string} chr The matched character to escape.\n * @returns {string} Returns the escaped character.\n */\n var escapeHtmlChar = basePropertyOf(htmlEscapes);\n\n /**\n * Used by `_.template` to escape characters for inclusion in compiled string literals.\n *\n * @private\n * @param {string} chr The matched character to escape.\n * @returns {string} Returns the escaped character.\n */\n function escapeStringChar(chr) {\n return '\\\\' + stringEscapes[chr];\n }\n\n /**\n * Gets the value at `key` of `object`.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\n function getValue(object, key) {\n return object == null ? undefined : object[key];\n }\n\n /**\n * Checks if `string` contains Unicode symbols.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {boolean} Returns `true` if a symbol is found, else `false`.\n */\n function hasUnicode(string) {\n return reHasUnicode.test(string);\n }\n\n /**\n * Checks if `string` contains a word composed of Unicode symbols.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {boolean} Returns `true` if a word is found, else `false`.\n */\n function hasUnicodeWord(string) {\n return reHasUnicodeWord.test(string);\n }\n\n /**\n * Converts `iterator` to an array.\n *\n * @private\n * @param {Object} iterator The iterator to convert.\n * @returns {Array} Returns the converted array.\n */\n function iteratorToArray(iterator) {\n var data,\n result = [];\n\n while (!(data = iterator.next()).done) {\n result.push(data.value);\n }\n return result;\n }\n\n /**\n * Converts `map` to its key-value pairs.\n *\n * @private\n * @param {Object} map The map to convert.\n * @returns {Array} Returns the key-value pairs.\n */\n function mapToArray(map) {\n var index = -1,\n result = Array(map.size);\n\n map.forEach(function(value, key) {\n result[++index] = [key, value];\n });\n return result;\n }\n\n /**\n * Creates a unary function that invokes `func` with its argument transformed.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {Function} transform The argument transform.\n * @returns {Function} Returns the new function.\n */\n function overArg(func, transform) {\n return function(arg) {\n return func(transform(arg));\n };\n }\n\n /**\n * Replaces all `placeholder` elements in `array` with an internal placeholder\n * and returns an array of their indexes.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {*} placeholder The placeholder to replace.\n * @returns {Array} Returns the new array of placeholder indexes.\n */\n function replaceHolders(array, placeholder) {\n var index = -1,\n length = array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (value === placeholder || value === PLACEHOLDER) {\n array[index] = PLACEHOLDER;\n result[resIndex++] = index;\n }\n }\n return result;\n }\n\n /**\n * Converts `set` to an array of its values.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the values.\n */\n function setToArray(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = value;\n });\n return result;\n }\n\n /**\n * Converts `set` to its value-value pairs.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the value-value pairs.\n */\n function setToPairs(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = [value, value];\n });\n return result;\n }\n\n /**\n * A specialized version of `_.indexOf` which performs strict equality\n * comparisons of values, i.e. `===`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function strictIndexOf(array, value, fromIndex) {\n var index = fromIndex - 1,\n length = array.length;\n\n while (++index < length) {\n if (array[index] === value) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * A specialized version of `_.lastIndexOf` which performs strict equality\n * comparisons of values, i.e. `===`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function strictLastIndexOf(array, value, fromIndex) {\n var index = fromIndex + 1;\n while (index--) {\n if (array[index] === value) {\n return index;\n }\n }\n return index;\n }\n\n /**\n * Gets the number of symbols in `string`.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {number} Returns the string size.\n */\n function stringSize(string) {\n return hasUnicode(string)\n ? unicodeSize(string)\n : asciiSize(string);\n }\n\n /**\n * Converts `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function stringToArray(string) {\n return hasUnicode(string)\n ? unicodeToArray(string)\n : asciiToArray(string);\n }\n\n /**\n * Used by `_.unescape` to convert HTML entities to characters.\n *\n * @private\n * @param {string} chr The matched character to unescape.\n * @returns {string} Returns the unescaped character.\n */\n var unescapeHtmlChar = basePropertyOf(htmlUnescapes);\n\n /**\n * Gets the size of a Unicode `string`.\n *\n * @private\n * @param {string} string The string inspect.\n * @returns {number} Returns the string size.\n */\n function unicodeSize(string) {\n var result = reUnicode.lastIndex = 0;\n while (reUnicode.test(string)) {\n ++result;\n }\n return result;\n }\n\n /**\n * Converts a Unicode `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function unicodeToArray(string) {\n return string.match(reUnicode) || [];\n }\n\n /**\n * Splits a Unicode `string` into an array of its words.\n *\n * @private\n * @param {string} The string to inspect.\n * @returns {Array} Returns the words of `string`.\n */\n function unicodeWords(string) {\n return string.match(reUnicodeWord) || [];\n }\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * Create a new pristine `lodash` function using the `context` object.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Util\n * @param {Object} [context=root] The context object.\n * @returns {Function} Returns a new `lodash` function.\n * @example\n *\n * _.mixin({ 'foo': _.constant('foo') });\n *\n * var lodash = _.runInContext();\n * lodash.mixin({ 'bar': lodash.constant('bar') });\n *\n * _.isFunction(_.foo);\n * // => true\n * _.isFunction(_.bar);\n * // => false\n *\n * lodash.isFunction(lodash.foo);\n * // => false\n * lodash.isFunction(lodash.bar);\n * // => true\n *\n * // Create a suped-up `defer` in Node.js.\n * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;\n */\n var runInContext = (function runInContext(context) {\n context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));\n\n /** Built-in constructor references. */\n var Array = context.Array,\n Date = context.Date,\n Error = context.Error,\n Function = context.Function,\n Math = context.Math,\n Object = context.Object,\n RegExp = context.RegExp,\n String = context.String,\n TypeError = context.TypeError;\n\n /** Used for built-in method references. */\n var arrayProto = Array.prototype,\n funcProto = Function.prototype,\n objectProto = Object.prototype;\n\n /** Used to detect overreaching core-js shims. */\n var coreJsData = context['__core-js_shared__'];\n\n /** Used to resolve the decompiled source of functions. */\n var funcToString = funcProto.toString;\n\n /** Used to check objects for own properties. */\n var hasOwnProperty = objectProto.hasOwnProperty;\n\n /** Used to generate unique IDs. */\n var idCounter = 0;\n\n /** Used to detect methods masquerading as native. */\n var maskSrcKey = (function() {\n var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');\n return uid ? ('Symbol(src)_1.' + uid) : '';\n }());\n\n /**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\n var nativeObjectToString = objectProto.toString;\n\n /** Used to infer the `Object` constructor. */\n var objectCtorString = funcToString.call(Object);\n\n /** Used to restore the original `_` reference in `_.noConflict`. */\n var oldDash = root._;\n\n /** Used to detect if a method is native. */\n var reIsNative = RegExp('^' +\n funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\\\$&')\n .replace(/hasOwnProperty|(function).*?(?=\\\\\\()| for .+?(?=\\\\\\])/g, '$1.*?') + '$'\n );\n\n /** Built-in value references. */\n var Buffer = moduleExports ? context.Buffer : undefined,\n Symbol = context.Symbol,\n Uint8Array = context.Uint8Array,\n allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,\n getPrototype = overArg(Object.getPrototypeOf, Object),\n objectCreate = Object.create,\n propertyIsEnumerable = objectProto.propertyIsEnumerable,\n splice = arrayProto.splice,\n spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,\n symIterator = Symbol ? Symbol.iterator : undefined,\n symToStringTag = Symbol ? Symbol.toStringTag : undefined;\n\n var defineProperty = (function() {\n try {\n var func = getNative(Object, 'defineProperty');\n func({}, '', {});\n return func;\n } catch (e) {}\n }());\n\n /** Mocked built-ins. */\n var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,\n ctxNow = Date && Date.now !== root.Date.now && Date.now,\n ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;\n\n /* Built-in method references for those with the same name as other `lodash` methods. */\n var nativeCeil = Math.ceil,\n nativeFloor = Math.floor,\n nativeGetSymbols = Object.getOwnPropertySymbols,\n nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,\n nativeIsFinite = context.isFinite,\n nativeJoin = arrayProto.join,\n nativeKeys = overArg(Object.keys, Object),\n nativeMax = Math.max,\n nativeMin = Math.min,\n nativeNow = Date.now,\n nativeParseInt = context.parseInt,\n nativeRandom = Math.random,\n nativeReverse = arrayProto.reverse;\n\n /* Built-in method references that are verified to be native. */\n var DataView = getNative(context, 'DataView'),\n Map = getNative(context, 'Map'),\n Promise = getNative(context, 'Promise'),\n Set = getNative(context, 'Set'),\n WeakMap = getNative(context, 'WeakMap'),\n nativeCreate = getNative(Object, 'create');\n\n /** Used to store function metadata. */\n var metaMap = WeakMap && new WeakMap;\n\n /** Used to lookup unminified function names. */\n var realNames = {};\n\n /** Used to detect maps, sets, and weakmaps. */\n var dataViewCtorString = toSource(DataView),\n mapCtorString = toSource(Map),\n promiseCtorString = toSource(Promise),\n setCtorString = toSource(Set),\n weakMapCtorString = toSource(WeakMap);\n\n /** Used to convert symbols to primitives and strings. */\n var symbolProto = Symbol ? Symbol.prototype : undefined,\n symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,\n symbolToString = symbolProto ? symbolProto.toString : undefined;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a `lodash` object which wraps `value` to enable implicit method\n * chain sequences. Methods that operate on and return arrays, collections,\n * and functions can be chained together. Methods that retrieve a single value\n * or may return a primitive value will automatically end the chain sequence\n * and return the unwrapped value. Otherwise, the value must be unwrapped\n * with `_#value`.\n *\n * Explicit chain sequences, which must be unwrapped with `_#value`, may be\n * enabled using `_.chain`.\n *\n * The execution of chained methods is lazy, that is, it's deferred until\n * `_#value` is implicitly or explicitly called.\n *\n * Lazy evaluation allows several methods to support shortcut fusion.\n * Shortcut fusion is an optimization to merge iteratee calls; this avoids\n * the creation of intermediate arrays and can greatly reduce the number of\n * iteratee executions. Sections of a chain sequence qualify for shortcut\n * fusion if the section is applied to an array and iteratees accept only\n * one argument. The heuristic for whether a section qualifies for shortcut\n * fusion is subject to change.\n *\n * Chaining is supported in custom builds as long as the `_#value` method is\n * directly or indirectly included in the build.\n *\n * In addition to lodash methods, wrappers have `Array` and `String` methods.\n *\n * The wrapper `Array` methods are:\n * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`\n *\n * The wrapper `String` methods are:\n * `replace` and `split`\n *\n * The wrapper methods that support shortcut fusion are:\n * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,\n * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,\n * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`\n *\n * The chainable wrapper methods are:\n * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,\n * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,\n * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,\n * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,\n * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,\n * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,\n * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,\n * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,\n * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,\n * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,\n * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,\n * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,\n * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,\n * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,\n * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,\n * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,\n * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,\n * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,\n * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,\n * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,\n * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,\n * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,\n * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,\n * `zipObject`, `zipObjectDeep`, and `zipWith`\n *\n * The wrapper methods that are **not** chainable by default are:\n * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,\n * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,\n * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,\n * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,\n * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,\n * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,\n * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,\n * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,\n * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,\n * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,\n * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,\n * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,\n * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,\n * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,\n * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,\n * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,\n * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,\n * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,\n * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,\n * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,\n * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,\n * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,\n * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,\n * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,\n * `upperFirst`, `value`, and `words`\n *\n * @name _\n * @constructor\n * @category Seq\n * @param {*} value The value to wrap in a `lodash` instance.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var wrapped = _([1, 2, 3]);\n *\n * // Returns an unwrapped value.\n * wrapped.reduce(_.add);\n * // => 6\n *\n * // Returns a wrapped value.\n * var squares = wrapped.map(square);\n *\n * _.isArray(squares);\n * // => false\n *\n * _.isArray(squares.value());\n * // => true\n */\n function lodash(value) {\n if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {\n if (value instanceof LodashWrapper) {\n return value;\n }\n if (hasOwnProperty.call(value, '__wrapped__')) {\n return wrapperClone(value);\n }\n }\n return new LodashWrapper(value);\n }\n\n /**\n * The base implementation of `_.create` without support for assigning\n * properties to the created object.\n *\n * @private\n * @param {Object} proto The object to inherit from.\n * @returns {Object} Returns the new object.\n */\n var baseCreate = (function() {\n function object() {}\n return function(proto) {\n if (!isObject(proto)) {\n return {};\n }\n if (objectCreate) {\n return objectCreate(proto);\n }\n object.prototype = proto;\n var result = new object;\n object.prototype = undefined;\n return result;\n };\n }());\n\n /**\n * The function whose prototype chain sequence wrappers inherit from.\n *\n * @private\n */\n function baseLodash() {\n // No operation performed.\n }\n\n /**\n * The base constructor for creating `lodash` wrapper objects.\n *\n * @private\n * @param {*} value The value to wrap.\n * @param {boolean} [chainAll] Enable explicit method chain sequences.\n */\n function LodashWrapper(value, chainAll) {\n this.__wrapped__ = value;\n this.__actions__ = [];\n this.__chain__ = !!chainAll;\n this.__index__ = 0;\n this.__values__ = undefined;\n }\n\n /**\n * By default, the template delimiters used by lodash are like those in\n * embedded Ruby (ERB) as well as ES2015 template strings. Change the\n * following template settings to use alternative delimiters.\n *\n * @static\n * @memberOf _\n * @type {Object}\n */\n lodash.templateSettings = {\n\n /**\n * Used to detect `data` property values to be HTML-escaped.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'escape': reEscape,\n\n /**\n * Used to detect code to be evaluated.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'evaluate': reEvaluate,\n\n /**\n * Used to detect `data` property values to inject.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'interpolate': reInterpolate,\n\n /**\n * Used to reference the data object in the template text.\n *\n * @memberOf _.templateSettings\n * @type {string}\n */\n 'variable': '',\n\n /**\n * Used to import variables into the compiled template.\n *\n * @memberOf _.templateSettings\n * @type {Object}\n */\n 'imports': {\n\n /**\n * A reference to the `lodash` function.\n *\n * @memberOf _.templateSettings.imports\n * @type {Function}\n */\n '_': lodash\n }\n };\n\n // Ensure wrappers are instances of `baseLodash`.\n lodash.prototype = baseLodash.prototype;\n lodash.prototype.constructor = lodash;\n\n LodashWrapper.prototype = baseCreate(baseLodash.prototype);\n LodashWrapper.prototype.constructor = LodashWrapper;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.\n *\n * @private\n * @constructor\n * @param {*} value The value to wrap.\n */\n function LazyWrapper(value) {\n this.__wrapped__ = value;\n this.__actions__ = [];\n this.__dir__ = 1;\n this.__filtered__ = false;\n this.__iteratees__ = [];\n this.__takeCount__ = MAX_ARRAY_LENGTH;\n this.__views__ = [];\n }\n\n /**\n * Creates a clone of the lazy wrapper object.\n *\n * @private\n * @name clone\n * @memberOf LazyWrapper\n * @returns {Object} Returns the cloned `LazyWrapper` object.\n */\n function lazyClone() {\n var result = new LazyWrapper(this.__wrapped__);\n result.__actions__ = copyArray(this.__actions__);\n result.__dir__ = this.__dir__;\n result.__filtered__ = this.__filtered__;\n result.__iteratees__ = copyArray(this.__iteratees__);\n result.__takeCount__ = this.__takeCount__;\n result.__views__ = copyArray(this.__views__);\n return result;\n }\n\n /**\n * Reverses the direction of lazy iteration.\n *\n * @private\n * @name reverse\n * @memberOf LazyWrapper\n * @returns {Object} Returns the new reversed `LazyWrapper` object.\n */\n function lazyReverse() {\n if (this.__filtered__) {\n var result = new LazyWrapper(this);\n result.__dir__ = -1;\n result.__filtered__ = true;\n } else {\n result = this.clone();\n result.__dir__ *= -1;\n }\n return result;\n }\n\n /**\n * Extracts the unwrapped value from its lazy wrapper.\n *\n * @private\n * @name value\n * @memberOf LazyWrapper\n * @returns {*} Returns the unwrapped value.\n */\n function lazyValue() {\n var array = this.__wrapped__.value(),\n dir = this.__dir__,\n isArr = isArray(array),\n isRight = dir < 0,\n arrLength = isArr ? array.length : 0,\n view = getView(0, arrLength, this.__views__),\n start = view.start,\n end = view.end,\n length = end - start,\n index = isRight ? end : (start - 1),\n iteratees = this.__iteratees__,\n iterLength = iteratees.length,\n resIndex = 0,\n takeCount = nativeMin(length, this.__takeCount__);\n\n if (!isArr || (!isRight && arrLength == length && takeCount == length)) {\n return baseWrapperValue(array, this.__actions__);\n }\n var result = [];\n\n outer:\n while (length-- && resIndex < takeCount) {\n index += dir;\n\n var iterIndex = -1,\n value = array[index];\n\n while (++iterIndex < iterLength) {\n var data = iteratees[iterIndex],\n iteratee = data.iteratee,\n type = data.type,\n computed = iteratee(value);\n\n if (type == LAZY_MAP_FLAG) {\n value = computed;\n } else if (!computed) {\n if (type == LAZY_FILTER_FLAG) {\n continue outer;\n } else {\n break outer;\n }\n }\n }\n result[resIndex++] = value;\n }\n return result;\n }\n\n // Ensure `LazyWrapper` is an instance of `baseLodash`.\n LazyWrapper.prototype = baseCreate(baseLodash.prototype);\n LazyWrapper.prototype.constructor = LazyWrapper;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a hash object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function Hash(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the hash.\n *\n * @private\n * @name clear\n * @memberOf Hash\n */\n function hashClear() {\n this.__data__ = nativeCreate ? nativeCreate(null) : {};\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the hash.\n *\n * @private\n * @name delete\n * @memberOf Hash\n * @param {Object} hash The hash to modify.\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function hashDelete(key) {\n var result = this.has(key) && delete this.__data__[key];\n this.size -= result ? 1 : 0;\n return result;\n }\n\n /**\n * Gets the hash value for `key`.\n *\n * @private\n * @name get\n * @memberOf Hash\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function hashGet(key) {\n var data = this.__data__;\n if (nativeCreate) {\n var result = data[key];\n return result === HASH_UNDEFINED ? undefined : result;\n }\n return hasOwnProperty.call(data, key) ? data[key] : undefined;\n }\n\n /**\n * Checks if a hash value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Hash\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function hashHas(key) {\n var data = this.__data__;\n return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);\n }\n\n /**\n * Sets the hash `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Hash\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the hash instance.\n */\n function hashSet(key, value) {\n var data = this.__data__;\n this.size += this.has(key) ? 0 : 1;\n data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;\n return this;\n }\n\n // Add methods to `Hash`.\n Hash.prototype.clear = hashClear;\n Hash.prototype['delete'] = hashDelete;\n Hash.prototype.get = hashGet;\n Hash.prototype.has = hashHas;\n Hash.prototype.set = hashSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an list cache object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function ListCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the list cache.\n *\n * @private\n * @name clear\n * @memberOf ListCache\n */\n function listCacheClear() {\n this.__data__ = [];\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the list cache.\n *\n * @private\n * @name delete\n * @memberOf ListCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function listCacheDelete(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n return false;\n }\n var lastIndex = data.length - 1;\n if (index == lastIndex) {\n data.pop();\n } else {\n splice.call(data, index, 1);\n }\n --this.size;\n return true;\n }\n\n /**\n * Gets the list cache value for `key`.\n *\n * @private\n * @name get\n * @memberOf ListCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function listCacheGet(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n return index < 0 ? undefined : data[index][1];\n }\n\n /**\n * Checks if a list cache value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf ListCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function listCacheHas(key) {\n return assocIndexOf(this.__data__, key) > -1;\n }\n\n /**\n * Sets the list cache `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf ListCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the list cache instance.\n */\n function listCacheSet(key, value) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n ++this.size;\n data.push([key, value]);\n } else {\n data[index][1] = value;\n }\n return this;\n }\n\n // Add methods to `ListCache`.\n ListCache.prototype.clear = listCacheClear;\n ListCache.prototype['delete'] = listCacheDelete;\n ListCache.prototype.get = listCacheGet;\n ListCache.prototype.has = listCacheHas;\n ListCache.prototype.set = listCacheSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a map cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function MapCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the map.\n *\n * @private\n * @name clear\n * @memberOf MapCache\n */\n function mapCacheClear() {\n this.size = 0;\n this.__data__ = {\n 'hash': new Hash,\n 'map': new (Map || ListCache),\n 'string': new Hash\n };\n }\n\n /**\n * Removes `key` and its value from the map.\n *\n * @private\n * @name delete\n * @memberOf MapCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function mapCacheDelete(key) {\n var result = getMapData(this, key)['delete'](key);\n this.size -= result ? 1 : 0;\n return result;\n }\n\n /**\n * Gets the map value for `key`.\n *\n * @private\n * @name get\n * @memberOf MapCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function mapCacheGet(key) {\n return getMapData(this, key).get(key);\n }\n\n /**\n * Checks if a map value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf MapCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function mapCacheHas(key) {\n return getMapData(this, key).has(key);\n }\n\n /**\n * Sets the map `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf MapCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the map cache instance.\n */\n function mapCacheSet(key, value) {\n var data = getMapData(this, key),\n size = data.size;\n\n data.set(key, value);\n this.size += data.size == size ? 0 : 1;\n return this;\n }\n\n // Add methods to `MapCache`.\n MapCache.prototype.clear = mapCacheClear;\n MapCache.prototype['delete'] = mapCacheDelete;\n MapCache.prototype.get = mapCacheGet;\n MapCache.prototype.has = mapCacheHas;\n MapCache.prototype.set = mapCacheSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n *\n * Creates an array cache object to store unique values.\n *\n * @private\n * @constructor\n * @param {Array} [values] The values to cache.\n */\n function SetCache(values) {\n var index = -1,\n length = values == null ? 0 : values.length;\n\n this.__data__ = new MapCache;\n while (++index < length) {\n this.add(values[index]);\n }\n }\n\n /**\n * Adds `value` to the array cache.\n *\n * @private\n * @name add\n * @memberOf SetCache\n * @alias push\n * @param {*} value The value to cache.\n * @returns {Object} Returns the cache instance.\n */\n function setCacheAdd(value) {\n this.__data__.set(value, HASH_UNDEFINED);\n return this;\n }\n\n /**\n * Checks if `value` is in the array cache.\n *\n * @private\n * @name has\n * @memberOf SetCache\n * @param {*} value The value to search for.\n * @returns {number} Returns `true` if `value` is found, else `false`.\n */\n function setCacheHas(value) {\n return this.__data__.has(value);\n }\n\n // Add methods to `SetCache`.\n SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;\n SetCache.prototype.has = setCacheHas;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a stack cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function Stack(entries) {\n var data = this.__data__ = new ListCache(entries);\n this.size = data.size;\n }\n\n /**\n * Removes all key-value entries from the stack.\n *\n * @private\n * @name clear\n * @memberOf Stack\n */\n function stackClear() {\n this.__data__ = new ListCache;\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the stack.\n *\n * @private\n * @name delete\n * @memberOf Stack\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function stackDelete(key) {\n var data = this.__data__,\n result = data['delete'](key);\n\n this.size = data.size;\n return result;\n }\n\n /**\n * Gets the stack value for `key`.\n *\n * @private\n * @name get\n * @memberOf Stack\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function stackGet(key) {\n return this.__data__.get(key);\n }\n\n /**\n * Checks if a stack value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Stack\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function stackHas(key) {\n return this.__data__.has(key);\n }\n\n /**\n * Sets the stack `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Stack\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the stack cache instance.\n */\n function stackSet(key, value) {\n var data = this.__data__;\n if (data instanceof ListCache) {\n var pairs = data.__data__;\n if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {\n pairs.push([key, value]);\n this.size = ++data.size;\n return this;\n }\n data = this.__data__ = new MapCache(pairs);\n }\n data.set(key, value);\n this.size = data.size;\n return this;\n }\n\n // Add methods to `Stack`.\n Stack.prototype.clear = stackClear;\n Stack.prototype['delete'] = stackDelete;\n Stack.prototype.get = stackGet;\n Stack.prototype.has = stackHas;\n Stack.prototype.set = stackSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an array of the enumerable property names of the array-like `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @param {boolean} inherited Specify returning inherited property names.\n * @returns {Array} Returns the array of property names.\n */\n function arrayLikeKeys(value, inherited) {\n var isArr = isArray(value),\n isArg = !isArr && isArguments(value),\n isBuff = !isArr && !isArg && isBuffer(value),\n isType = !isArr && !isArg && !isBuff && isTypedArray(value),\n skipIndexes = isArr || isArg || isBuff || isType,\n result = skipIndexes ? baseTimes(value.length, String) : [],\n length = result.length;\n\n for (var key in value) {\n if ((inherited || hasOwnProperty.call(value, key)) &&\n !(skipIndexes && (\n // Safari 9 has enumerable `arguments.length` in strict mode.\n key == 'length' ||\n // Node.js 0.10 has enumerable non-index properties on buffers.\n (isBuff && (key == 'offset' || key == 'parent')) ||\n // PhantomJS 2 has enumerable non-index properties on typed arrays.\n (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||\n // Skip index properties.\n isIndex(key, length)\n ))) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `_.sample` for arrays.\n *\n * @private\n * @param {Array} array The array to sample.\n * @returns {*} Returns the random element.\n */\n function arraySample(array) {\n var length = array.length;\n return length ? array[baseRandom(0, length - 1)] : undefined;\n }\n\n /**\n * A specialized version of `_.sampleSize` for arrays.\n *\n * @private\n * @param {Array} array The array to sample.\n * @param {number} n The number of elements to sample.\n * @returns {Array} Returns the random elements.\n */\n function arraySampleSize(array, n) {\n return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));\n }\n\n /**\n * A specialized version of `_.shuffle` for arrays.\n *\n * @private\n * @param {Array} array The array to shuffle.\n * @returns {Array} Returns the new shuffled array.\n */\n function arrayShuffle(array) {\n return shuffleSelf(copyArray(array));\n }\n\n /**\n * This function is like `assignValue` except that it doesn't assign\n * `undefined` values.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function assignMergeValue(object, key, value) {\n if ((value !== undefined && !eq(object[key], value)) ||\n (value === undefined && !(key in object))) {\n baseAssignValue(object, key, value);\n }\n }\n\n /**\n * Assigns `value` to `key` of `object` if the existing value is not equivalent\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function assignValue(object, key, value) {\n var objValue = object[key];\n if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||\n (value === undefined && !(key in object))) {\n baseAssignValue(object, key, value);\n }\n }\n\n /**\n * Gets the index at which the `key` is found in `array` of key-value pairs.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} key The key to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function assocIndexOf(array, key) {\n var length = array.length;\n while (length--) {\n if (eq(array[length][0], key)) {\n return length;\n }\n }\n return -1;\n }\n\n /**\n * Aggregates elements of `collection` on `accumulator` with keys transformed\n * by `iteratee` and values set by `setter`.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform keys.\n * @param {Object} accumulator The initial aggregated object.\n * @returns {Function} Returns `accumulator`.\n */\n function baseAggregator(collection, setter, iteratee, accumulator) {\n baseEach(collection, function(value, key, collection) {\n setter(accumulator, value, iteratee(value), collection);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.assign` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\n function baseAssign(object, source) {\n return object && copyObject(source, keys(source), object);\n }\n\n /**\n * The base implementation of `_.assignIn` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\n function baseAssignIn(object, source) {\n return object && copyObject(source, keysIn(source), object);\n }\n\n /**\n * The base implementation of `assignValue` and `assignMergeValue` without\n * value checks.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function baseAssignValue(object, key, value) {\n if (key == '__proto__' && defineProperty) {\n defineProperty(object, key, {\n 'configurable': true,\n 'enumerable': true,\n 'value': value,\n 'writable': true\n });\n } else {\n object[key] = value;\n }\n }\n\n /**\n * The base implementation of `_.at` without support for individual paths.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {string[]} paths The property paths to pick.\n * @returns {Array} Returns the picked elements.\n */\n function baseAt(object, paths) {\n var index = -1,\n length = paths.length,\n result = Array(length),\n skip = object == null;\n\n while (++index < length) {\n result[index] = skip ? undefined : get(object, paths[index]);\n }\n return result;\n }\n\n /**\n * The base implementation of `_.clamp` which doesn't coerce arguments.\n *\n * @private\n * @param {number} number The number to clamp.\n * @param {number} [lower] The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the clamped number.\n */\n function baseClamp(number, lower, upper) {\n if (number === number) {\n if (upper !== undefined) {\n number = number <= upper ? number : upper;\n }\n if (lower !== undefined) {\n number = number >= lower ? number : lower;\n }\n }\n return number;\n }\n\n /**\n * The base implementation of `_.clone` and `_.cloneDeep` which tracks\n * traversed objects.\n *\n * @private\n * @param {*} value The value to clone.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Deep clone\n * 2 - Flatten inherited properties\n * 4 - Clone symbols\n * @param {Function} [customizer] The function to customize cloning.\n * @param {string} [key] The key of `value`.\n * @param {Object} [object] The parent object of `value`.\n * @param {Object} [stack] Tracks traversed objects and their clone counterparts.\n * @returns {*} Returns the cloned value.\n */\n function baseClone(value, bitmask, customizer, key, object, stack) {\n var result,\n isDeep = bitmask & CLONE_DEEP_FLAG,\n isFlat = bitmask & CLONE_FLAT_FLAG,\n isFull = bitmask & CLONE_SYMBOLS_FLAG;\n\n if (customizer) {\n result = object ? customizer(value, key, object, stack) : customizer(value);\n }\n if (result !== undefined) {\n return result;\n }\n if (!isObject(value)) {\n return value;\n }\n var isArr = isArray(value);\n if (isArr) {\n result = initCloneArray(value);\n if (!isDeep) {\n return copyArray(value, result);\n }\n } else {\n var tag = getTag(value),\n isFunc = tag == funcTag || tag == genTag;\n\n if (isBuffer(value)) {\n return cloneBuffer(value, isDeep);\n }\n if (tag == objectTag || tag == argsTag || (isFunc && !object)) {\n result = (isFlat || isFunc) ? {} : initCloneObject(value);\n if (!isDeep) {\n return isFlat\n ? copySymbolsIn(value, baseAssignIn(result, value))\n : copySymbols(value, baseAssign(result, value));\n }\n } else {\n if (!cloneableTags[tag]) {\n return object ? value : {};\n }\n result = initCloneByTag(value, tag, baseClone, isDeep);\n }\n }\n // Check for circular references and return its corresponding clone.\n stack || (stack = new Stack);\n var stacked = stack.get(value);\n if (stacked) {\n return stacked;\n }\n stack.set(value, result);\n\n var keysFunc = isFull\n ? (isFlat ? getAllKeysIn : getAllKeys)\n : (isFlat ? keysIn : keys);\n\n var props = isArr ? undefined : keysFunc(value);\n arrayEach(props || value, function(subValue, key) {\n if (props) {\n key = subValue;\n subValue = value[key];\n }\n // Recursively populate clone (susceptible to call stack limits).\n assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));\n });\n return result;\n }\n\n /**\n * The base implementation of `_.conforms` which doesn't clone `source`.\n *\n * @private\n * @param {Object} source The object of property predicates to conform to.\n * @returns {Function} Returns the new spec function.\n */\n function baseConforms(source) {\n var props = keys(source);\n return function(object) {\n return baseConformsTo(object, source, props);\n };\n }\n\n /**\n * The base implementation of `_.conformsTo` which accepts `props` to check.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property predicates to conform to.\n * @returns {boolean} Returns `true` if `object` conforms, else `false`.\n */\n function baseConformsTo(object, source, props) {\n var length = props.length;\n if (object == null) {\n return !length;\n }\n object = Object(object);\n while (length--) {\n var key = props[length],\n predicate = source[key],\n value = object[key];\n\n if ((value === undefined && !(key in object)) || !predicate(value)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * The base implementation of `_.delay` and `_.defer` which accepts `args`\n * to provide to `func`.\n *\n * @private\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @param {Array} args The arguments to provide to `func`.\n * @returns {number|Object} Returns the timer id or timeout object.\n */\n function baseDelay(func, wait, args) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return setTimeout(function() { func.apply(undefined, args); }, wait);\n }\n\n /**\n * The base implementation of methods like `_.difference` without support\n * for excluding multiple arrays or iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Array} values The values to exclude.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n */\n function baseDifference(array, values, iteratee, comparator) {\n var index = -1,\n includes = arrayIncludes,\n isCommon = true,\n length = array.length,\n result = [],\n valuesLength = values.length;\n\n if (!length) {\n return result;\n }\n if (iteratee) {\n values = arrayMap(values, baseUnary(iteratee));\n }\n if (comparator) {\n includes = arrayIncludesWith;\n isCommon = false;\n }\n else if (values.length >= LARGE_ARRAY_SIZE) {\n includes = cacheHas;\n isCommon = false;\n values = new SetCache(values);\n }\n outer:\n while (++index < length) {\n var value = array[index],\n computed = iteratee == null ? value : iteratee(value);\n\n value = (comparator || value !== 0) ? value : 0;\n if (isCommon && computed === computed) {\n var valuesIndex = valuesLength;\n while (valuesIndex--) {\n if (values[valuesIndex] === computed) {\n continue outer;\n }\n }\n result.push(value);\n }\n else if (!includes(values, computed, comparator)) {\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.forEach` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\n var baseEach = createBaseEach(baseForOwn);\n\n /**\n * The base implementation of `_.forEachRight` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\n var baseEachRight = createBaseEach(baseForOwnRight, true);\n\n /**\n * The base implementation of `_.every` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`\n */\n function baseEvery(collection, predicate) {\n var result = true;\n baseEach(collection, function(value, index, collection) {\n result = !!predicate(value, index, collection);\n return result;\n });\n return result;\n }\n\n /**\n * The base implementation of methods like `_.max` and `_.min` which accepts a\n * `comparator` to determine the extremum value.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The iteratee invoked per iteration.\n * @param {Function} comparator The comparator used to compare values.\n * @returns {*} Returns the extremum value.\n */\n function baseExtremum(array, iteratee, comparator) {\n var index = -1,\n length = array.length;\n\n while (++index < length) {\n var value = array[index],\n current = iteratee(value);\n\n if (current != null && (computed === undefined\n ? (current === current && !isSymbol(current))\n : comparator(current, computed)\n )) {\n var computed = current,\n result = value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.fill` without an iteratee call guard.\n *\n * @private\n * @param {Array} array The array to fill.\n * @param {*} value The value to fill `array` with.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns `array`.\n */\n function baseFill(array, value, start, end) {\n var length = array.length;\n\n start = toInteger(start);\n if (start < 0) {\n start = -start > length ? 0 : (length + start);\n }\n end = (end === undefined || end > length) ? length : toInteger(end);\n if (end < 0) {\n end += length;\n }\n end = start > end ? 0 : toLength(end);\n while (start < end) {\n array[start++] = value;\n }\n return array;\n }\n\n /**\n * The base implementation of `_.filter` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\n function baseFilter(collection, predicate) {\n var result = [];\n baseEach(collection, function(value, index, collection) {\n if (predicate(value, index, collection)) {\n result.push(value);\n }\n });\n return result;\n }\n\n /**\n * The base implementation of `_.flatten` with support for restricting flattening.\n *\n * @private\n * @param {Array} array The array to flatten.\n * @param {number} depth The maximum recursion depth.\n * @param {boolean} [predicate=isFlattenable] The function invoked per iteration.\n * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.\n * @param {Array} [result=[]] The initial result value.\n * @returns {Array} Returns the new flattened array.\n */\n function baseFlatten(array, depth, predicate, isStrict, result) {\n var index = -1,\n length = array.length;\n\n predicate || (predicate = isFlattenable);\n result || (result = []);\n\n while (++index < length) {\n var value = array[index];\n if (depth > 0 && predicate(value)) {\n if (depth > 1) {\n // Recursively flatten arrays (susceptible to call stack limits).\n baseFlatten(value, depth - 1, predicate, isStrict, result);\n } else {\n arrayPush(result, value);\n }\n } else if (!isStrict) {\n result[result.length] = value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `baseForOwn` which iterates over `object`\n * properties returned by `keysFunc` and invokes `iteratee` for each property.\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @returns {Object} Returns `object`.\n */\n var baseFor = createBaseFor();\n\n /**\n * This function is like `baseFor` except that it iterates over properties\n * in the opposite order.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @returns {Object} Returns `object`.\n */\n var baseForRight = createBaseFor(true);\n\n /**\n * The base implementation of `_.forOwn` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Object} Returns `object`.\n */\n function baseForOwn(object, iteratee) {\n return object && baseFor(object, iteratee, keys);\n }\n\n /**\n * The base implementation of `_.forOwnRight` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Object} Returns `object`.\n */\n function baseForOwnRight(object, iteratee) {\n return object && baseForRight(object, iteratee, keys);\n }\n\n /**\n * The base implementation of `_.functions` which creates an array of\n * `object` function property names filtered from `props`.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Array} props The property names to filter.\n * @returns {Array} Returns the function names.\n */\n function baseFunctions(object, props) {\n return arrayFilter(props, function(key) {\n return isFunction(object[key]);\n });\n }\n\n /**\n * The base implementation of `_.get` without support for default values.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @returns {*} Returns the resolved value.\n */\n function baseGet(object, path) {\n path = castPath(path, object);\n\n var index = 0,\n length = path.length;\n\n while (object != null && index < length) {\n object = object[toKey(path[index++])];\n }\n return (index && index == length) ? object : undefined;\n }\n\n /**\n * The base implementation of `getAllKeys` and `getAllKeysIn` which uses\n * `keysFunc` and `symbolsFunc` to get the enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @param {Function} symbolsFunc The function to get the symbols of `object`.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function baseGetAllKeys(object, keysFunc, symbolsFunc) {\n var result = keysFunc(object);\n return isArray(object) ? result : arrayPush(result, symbolsFunc(object));\n }\n\n /**\n * The base implementation of `getTag` without fallbacks for buggy environments.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\n function baseGetTag(value) {\n if (value == null) {\n return value === undefined ? undefinedTag : nullTag;\n }\n return (symToStringTag && symToStringTag in Object(value))\n ? getRawTag(value)\n : objectToString(value);\n }\n\n /**\n * The base implementation of `_.gt` which doesn't coerce arguments.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than `other`,\n * else `false`.\n */\n function baseGt(value, other) {\n return value > other;\n }\n\n /**\n * The base implementation of `_.has` without support for deep paths.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {Array|string} key The key to check.\n * @returns {boolean} Returns `true` if `key` exists, else `false`.\n */\n function baseHas(object, key) {\n return object != null && hasOwnProperty.call(object, key);\n }\n\n /**\n * The base implementation of `_.hasIn` without support for deep paths.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {Array|string} key The key to check.\n * @returns {boolean} Returns `true` if `key` exists, else `false`.\n */\n function baseHasIn(object, key) {\n return object != null && key in Object(object);\n }\n\n /**\n * The base implementation of `_.inRange` which doesn't coerce arguments.\n *\n * @private\n * @param {number} number The number to check.\n * @param {number} start The start of the range.\n * @param {number} end The end of the range.\n * @returns {boolean} Returns `true` if `number` is in the range, else `false`.\n */\n function baseInRange(number, start, end) {\n return number >= nativeMin(start, end) && number < nativeMax(start, end);\n }\n\n /**\n * The base implementation of methods like `_.intersection`, without support\n * for iteratee shorthands, that accepts an array of arrays to inspect.\n *\n * @private\n * @param {Array} arrays The arrays to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of shared values.\n */\n function baseIntersection(arrays, iteratee, comparator) {\n var includes = comparator ? arrayIncludesWith : arrayIncludes,\n length = arrays[0].length,\n othLength = arrays.length,\n othIndex = othLength,\n caches = Array(othLength),\n maxLength = Infinity,\n result = [];\n\n while (othIndex--) {\n var array = arrays[othIndex];\n if (othIndex && iteratee) {\n array = arrayMap(array, baseUnary(iteratee));\n }\n maxLength = nativeMin(array.length, maxLength);\n caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))\n ? new SetCache(othIndex && array)\n : undefined;\n }\n array = arrays[0];\n\n var index = -1,\n seen = caches[0];\n\n outer:\n while (++index < length && result.length < maxLength) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n value = (comparator || value !== 0) ? value : 0;\n if (!(seen\n ? cacheHas(seen, computed)\n : includes(result, computed, comparator)\n )) {\n othIndex = othLength;\n while (--othIndex) {\n var cache = caches[othIndex];\n if (!(cache\n ? cacheHas(cache, computed)\n : includes(arrays[othIndex], computed, comparator))\n ) {\n continue outer;\n }\n }\n if (seen) {\n seen.push(computed);\n }\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.invert` and `_.invertBy` which inverts\n * `object` with values transformed by `iteratee` and set by `setter`.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform values.\n * @param {Object} accumulator The initial inverted object.\n * @returns {Function} Returns `accumulator`.\n */\n function baseInverter(object, setter, iteratee, accumulator) {\n baseForOwn(object, function(value, key, object) {\n setter(accumulator, iteratee(value), key, object);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.invoke` without support for individual\n * method arguments.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the method to invoke.\n * @param {Array} args The arguments to invoke the method with.\n * @returns {*} Returns the result of the invoked method.\n */\n function baseInvoke(object, path, args) {\n path = castPath(path, object);\n object = parent(object, path);\n var func = object == null ? object : object[toKey(last(path))];\n return func == null ? undefined : apply(func, object, args);\n }\n\n /**\n * The base implementation of `_.isArguments`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n */\n function baseIsArguments(value) {\n return isObjectLike(value) && baseGetTag(value) == argsTag;\n }\n\n /**\n * The base implementation of `_.isArrayBuffer` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.\n */\n function baseIsArrayBuffer(value) {\n return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;\n }\n\n /**\n * The base implementation of `_.isDate` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a date object, else `false`.\n */\n function baseIsDate(value) {\n return isObjectLike(value) && baseGetTag(value) == dateTag;\n }\n\n /**\n * The base implementation of `_.isEqual` which supports partial comparisons\n * and tracks traversed objects.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Unordered comparison\n * 2 - Partial comparison\n * @param {Function} [customizer] The function to customize comparisons.\n * @param {Object} [stack] Tracks traversed `value` and `other` objects.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n */\n function baseIsEqual(value, other, bitmask, customizer, stack) {\n if (value === other) {\n return true;\n }\n if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {\n return value !== value && other !== other;\n }\n return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);\n }\n\n /**\n * A specialized version of `baseIsEqual` for arrays and objects which performs\n * deep comparisons and tracks traversed objects enabling objects with circular\n * references to be compared.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} [stack] Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {\n var objIsArr = isArray(object),\n othIsArr = isArray(other),\n objTag = objIsArr ? arrayTag : getTag(object),\n othTag = othIsArr ? arrayTag : getTag(other);\n\n objTag = objTag == argsTag ? objectTag : objTag;\n othTag = othTag == argsTag ? objectTag : othTag;\n\n var objIsObj = objTag == objectTag,\n othIsObj = othTag == objectTag,\n isSameTag = objTag == othTag;\n\n if (isSameTag && isBuffer(object)) {\n if (!isBuffer(other)) {\n return false;\n }\n objIsArr = true;\n objIsObj = false;\n }\n if (isSameTag && !objIsObj) {\n stack || (stack = new Stack);\n return (objIsArr || isTypedArray(object))\n ? equalArrays(object, other, bitmask, customizer, equalFunc, stack)\n : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);\n }\n if (!(bitmask & COMPARE_PARTIAL_FLAG)) {\n var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),\n othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');\n\n if (objIsWrapped || othIsWrapped) {\n var objUnwrapped = objIsWrapped ? object.value() : object,\n othUnwrapped = othIsWrapped ? other.value() : other;\n\n stack || (stack = new Stack);\n return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);\n }\n }\n if (!isSameTag) {\n return false;\n }\n stack || (stack = new Stack);\n return equalObjects(object, other, bitmask, customizer, equalFunc, stack);\n }\n\n /**\n * The base implementation of `_.isMap` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a map, else `false`.\n */\n function baseIsMap(value) {\n return isObjectLike(value) && getTag(value) == mapTag;\n }\n\n /**\n * The base implementation of `_.isMatch` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @param {Array} matchData The property names, values, and compare flags to match.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n */\n function baseIsMatch(object, source, matchData, customizer) {\n var index = matchData.length,\n length = index,\n noCustomizer = !customizer;\n\n if (object == null) {\n return !length;\n }\n object = Object(object);\n while (index--) {\n var data = matchData[index];\n if ((noCustomizer && data[2])\n ? data[1] !== object[data[0]]\n : !(data[0] in object)\n ) {\n return false;\n }\n }\n while (++index < length) {\n data = matchData[index];\n var key = data[0],\n objValue = object[key],\n srcValue = data[1];\n\n if (noCustomizer && data[2]) {\n if (objValue === undefined && !(key in object)) {\n return false;\n }\n } else {\n var stack = new Stack;\n if (customizer) {\n var result = customizer(objValue, srcValue, key, object, source, stack);\n }\n if (!(result === undefined\n ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)\n : result\n )) {\n return false;\n }\n }\n }\n return true;\n }\n\n /**\n * The base implementation of `_.isNative` without bad shim checks.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n */\n function baseIsNative(value) {\n if (!isObject(value) || isMasked(value)) {\n return false;\n }\n var pattern = isFunction(value) ? reIsNative : reIsHostCtor;\n return pattern.test(toSource(value));\n }\n\n /**\n * The base implementation of `_.isRegExp` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.\n */\n function baseIsRegExp(value) {\n return isObjectLike(value) && baseGetTag(value) == regexpTag;\n }\n\n /**\n * The base implementation of `_.isSet` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a set, else `false`.\n */\n function baseIsSet(value) {\n return isObjectLike(value) && getTag(value) == setTag;\n }\n\n /**\n * The base implementation of `_.isTypedArray` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n */\n function baseIsTypedArray(value) {\n return isObjectLike(value) &&\n isLength(value.length) && !!typedArrayTags[baseGetTag(value)];\n }\n\n /**\n * The base implementation of `_.iteratee`.\n *\n * @private\n * @param {*} [value=_.identity] The value to convert to an iteratee.\n * @returns {Function} Returns the iteratee.\n */\n function baseIteratee(value) {\n // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.\n // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.\n if (typeof value == 'function') {\n return value;\n }\n if (value == null) {\n return identity;\n }\n if (typeof value == 'object') {\n return isArray(value)\n ? baseMatchesProperty(value[0], value[1])\n : baseMatches(value);\n }\n return property(value);\n }\n\n /**\n * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function baseKeys(object) {\n if (!isPrototype(object)) {\n return nativeKeys(object);\n }\n var result = [];\n for (var key in Object(object)) {\n if (hasOwnProperty.call(object, key) && key != 'constructor') {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function baseKeysIn(object) {\n if (!isObject(object)) {\n return nativeKeysIn(object);\n }\n var isProto = isPrototype(object),\n result = [];\n\n for (var key in object) {\n if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.lt` which doesn't coerce arguments.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than `other`,\n * else `false`.\n */\n function baseLt(value, other) {\n return value < other;\n }\n\n /**\n * The base implementation of `_.map` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n */\n function baseMap(collection, iteratee) {\n var index = -1,\n result = isArrayLike(collection) ? Array(collection.length) : [];\n\n baseEach(collection, function(value, key, collection) {\n result[++index] = iteratee(value, key, collection);\n });\n return result;\n }\n\n /**\n * The base implementation of `_.matches` which doesn't clone `source`.\n *\n * @private\n * @param {Object} source The object of property values to match.\n * @returns {Function} Returns the new spec function.\n */\n function baseMatches(source) {\n var matchData = getMatchData(source);\n if (matchData.length == 1 && matchData[0][2]) {\n return matchesStrictComparable(matchData[0][0], matchData[0][1]);\n }\n return function(object) {\n return object === source || baseIsMatch(object, source, matchData);\n };\n }\n\n /**\n * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.\n *\n * @private\n * @param {string} path The path of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n */\n function baseMatchesProperty(path, srcValue) {\n if (isKey(path) && isStrictComparable(srcValue)) {\n return matchesStrictComparable(toKey(path), srcValue);\n }\n return function(object) {\n var objValue = get(object, path);\n return (objValue === undefined && objValue === srcValue)\n ? hasIn(object, path)\n : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);\n };\n }\n\n /**\n * The base implementation of `_.merge` without support for multiple sources.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @param {number} srcIndex The index of `source`.\n * @param {Function} [customizer] The function to customize merged values.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n */\n function baseMerge(object, source, srcIndex, customizer, stack) {\n if (object === source) {\n return;\n }\n baseFor(source, function(srcValue, key) {\n if (isObject(srcValue)) {\n stack || (stack = new Stack);\n baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);\n }\n else {\n var newValue = customizer\n ? customizer(object[key], srcValue, (key + ''), object, source, stack)\n : undefined;\n\n if (newValue === undefined) {\n newValue = srcValue;\n }\n assignMergeValue(object, key, newValue);\n }\n }, keysIn);\n }\n\n /**\n * A specialized version of `baseMerge` for arrays and objects which performs\n * deep merges and tracks traversed objects enabling objects with circular\n * references to be merged.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @param {string} key The key of the value to merge.\n * @param {number} srcIndex The index of `source`.\n * @param {Function} mergeFunc The function to merge values.\n * @param {Function} [customizer] The function to customize assigned values.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n */\n function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {\n var objValue = object[key],\n srcValue = source[key],\n stacked = stack.get(srcValue);\n\n if (stacked) {\n assignMergeValue(object, key, stacked);\n return;\n }\n var newValue = customizer\n ? customizer(objValue, srcValue, (key + ''), object, source, stack)\n : undefined;\n\n var isCommon = newValue === undefined;\n\n if (isCommon) {\n var isArr = isArray(srcValue),\n isBuff = !isArr && isBuffer(srcValue),\n isTyped = !isArr && !isBuff && isTypedArray(srcValue);\n\n newValue = srcValue;\n if (isArr || isBuff || isTyped) {\n if (isArray(objValue)) {\n newValue = objValue;\n }\n else if (isArrayLikeObject(objValue)) {\n newValue = copyArray(objValue);\n }\n else if (isBuff) {\n isCommon = false;\n newValue = cloneBuffer(srcValue, true);\n }\n else if (isTyped) {\n isCommon = false;\n newValue = cloneTypedArray(srcValue, true);\n }\n else {\n newValue = [];\n }\n }\n else if (isPlainObject(srcValue) || isArguments(srcValue)) {\n newValue = objValue;\n if (isArguments(objValue)) {\n newValue = toPlainObject(objValue);\n }\n else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) {\n newValue = initCloneObject(srcValue);\n }\n }\n else {\n isCommon = false;\n }\n }\n if (isCommon) {\n // Recursively merge objects and arrays (susceptible to call stack limits).\n stack.set(srcValue, newValue);\n mergeFunc(newValue, srcValue, srcIndex, customizer, stack);\n stack['delete'](srcValue);\n }\n assignMergeValue(object, key, newValue);\n }\n\n /**\n * The base implementation of `_.nth` which doesn't coerce arguments.\n *\n * @private\n * @param {Array} array The array to query.\n * @param {number} n The index of the element to return.\n * @returns {*} Returns the nth element of `array`.\n */\n function baseNth(array, n) {\n var length = array.length;\n if (!length) {\n return;\n }\n n += n < 0 ? length : 0;\n return isIndex(n, length) ? array[n] : undefined;\n }\n\n /**\n * The base implementation of `_.orderBy` without param guards.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.\n * @param {string[]} orders The sort orders of `iteratees`.\n * @returns {Array} Returns the new sorted array.\n */\n function baseOrderBy(collection, iteratees, orders) {\n var index = -1;\n iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee()));\n\n var result = baseMap(collection, function(value, key, collection) {\n var criteria = arrayMap(iteratees, function(iteratee) {\n return iteratee(value);\n });\n return { 'criteria': criteria, 'index': ++index, 'value': value };\n });\n\n return baseSortBy(result, function(object, other) {\n return compareMultiple(object, other, orders);\n });\n }\n\n /**\n * The base implementation of `_.pick` without support for individual\n * property identifiers.\n *\n * @private\n * @param {Object} object The source object.\n * @param {string[]} paths The property paths to pick.\n * @returns {Object} Returns the new object.\n */\n function basePick(object, paths) {\n return basePickBy(object, paths, function(value, path) {\n return hasIn(object, path);\n });\n }\n\n /**\n * The base implementation of `_.pickBy` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The source object.\n * @param {string[]} paths The property paths to pick.\n * @param {Function} predicate The function invoked per property.\n * @returns {Object} Returns the new object.\n */\n function basePickBy(object, paths, predicate) {\n var index = -1,\n length = paths.length,\n result = {};\n\n while (++index < length) {\n var path = paths[index],\n value = baseGet(object, path);\n\n if (predicate(value, path)) {\n baseSet(result, castPath(path, object), value);\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `baseProperty` which supports deep paths.\n *\n * @private\n * @param {Array|string} path The path of the property to get.\n * @returns {Function} Returns the new accessor function.\n */\n function basePropertyDeep(path) {\n return function(object) {\n return baseGet(object, path);\n };\n }\n\n /**\n * The base implementation of `_.pullAllBy` without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns `array`.\n */\n function basePullAll(array, values, iteratee, comparator) {\n var indexOf = comparator ? baseIndexOfWith : baseIndexOf,\n index = -1,\n length = values.length,\n seen = array;\n\n if (array === values) {\n values = copyArray(values);\n }\n if (iteratee) {\n seen = arrayMap(array, baseUnary(iteratee));\n }\n while (++index < length) {\n var fromIndex = 0,\n value = values[index],\n computed = iteratee ? iteratee(value) : value;\n\n while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {\n if (seen !== array) {\n splice.call(seen, fromIndex, 1);\n }\n splice.call(array, fromIndex, 1);\n }\n }\n return array;\n }\n\n /**\n * The base implementation of `_.pullAt` without support for individual\n * indexes or capturing the removed elements.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {number[]} indexes The indexes of elements to remove.\n * @returns {Array} Returns `array`.\n */\n function basePullAt(array, indexes) {\n var length = array ? indexes.length : 0,\n lastIndex = length - 1;\n\n while (length--) {\n var index = indexes[length];\n if (length == lastIndex || index !== previous) {\n var previous = index;\n if (isIndex(index)) {\n splice.call(array, index, 1);\n } else {\n baseUnset(array, index);\n }\n }\n }\n return array;\n }\n\n /**\n * The base implementation of `_.random` without support for returning\n * floating-point numbers.\n *\n * @private\n * @param {number} lower The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the random number.\n */\n function baseRandom(lower, upper) {\n return lower + nativeFloor(nativeRandom() * (upper - lower + 1));\n }\n\n /**\n * The base implementation of `_.range` and `_.rangeRight` which doesn't\n * coerce arguments.\n *\n * @private\n * @param {number} start The start of the range.\n * @param {number} end The end of the range.\n * @param {number} step The value to increment or decrement by.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Array} Returns the range of numbers.\n */\n function baseRange(start, end, step, fromRight) {\n var index = -1,\n length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),\n result = Array(length);\n\n while (length--) {\n result[fromRight ? length : ++index] = start;\n start += step;\n }\n return result;\n }\n\n /**\n * The base implementation of `_.repeat` which doesn't coerce arguments.\n *\n * @private\n * @param {string} string The string to repeat.\n * @param {number} n The number of times to repeat the string.\n * @returns {string} Returns the repeated string.\n */\n function baseRepeat(string, n) {\n var result = '';\n if (!string || n < 1 || n > MAX_SAFE_INTEGER) {\n return result;\n }\n // Leverage the exponentiation by squaring algorithm for a faster repeat.\n // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.\n do {\n if (n % 2) {\n result += string;\n }\n n = nativeFloor(n / 2);\n if (n) {\n string += string;\n }\n } while (n);\n\n return result;\n }\n\n /**\n * The base implementation of `_.rest` which doesn't validate or coerce arguments.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @returns {Function} Returns the new function.\n */\n function baseRest(func, start) {\n return setToString(overRest(func, start, identity), func + '');\n }\n\n /**\n * The base implementation of `_.sample`.\n *\n * @private\n * @param {Array|Object} collection The collection to sample.\n * @returns {*} Returns the random element.\n */\n function baseSample(collection) {\n return arraySample(values(collection));\n }\n\n /**\n * The base implementation of `_.sampleSize` without param guards.\n *\n * @private\n * @param {Array|Object} collection The collection to sample.\n * @param {number} n The number of elements to sample.\n * @returns {Array} Returns the random elements.\n */\n function baseSampleSize(collection, n) {\n var array = values(collection);\n return shuffleSelf(array, baseClamp(n, 0, array.length));\n }\n\n /**\n * The base implementation of `_.set`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @param {Function} [customizer] The function to customize path creation.\n * @returns {Object} Returns `object`.\n */\n function baseSet(object, path, value, customizer) {\n if (!isObject(object)) {\n return object;\n }\n path = castPath(path, object);\n\n var index = -1,\n length = path.length,\n lastIndex = length - 1,\n nested = object;\n\n while (nested != null && ++index < length) {\n var key = toKey(path[index]),\n newValue = value;\n\n if (index != lastIndex) {\n var objValue = nested[key];\n newValue = customizer ? customizer(objValue, key, nested) : undefined;\n if (newValue === undefined) {\n newValue = isObject(objValue)\n ? objValue\n : (isIndex(path[index + 1]) ? [] : {});\n }\n }\n assignValue(nested, key, newValue);\n nested = nested[key];\n }\n return object;\n }\n\n /**\n * The base implementation of `setData` without support for hot loop shorting.\n *\n * @private\n * @param {Function} func The function to associate metadata with.\n * @param {*} data The metadata.\n * @returns {Function} Returns `func`.\n */\n var baseSetData = !metaMap ? identity : function(func, data) {\n metaMap.set(func, data);\n return func;\n };\n\n /**\n * The base implementation of `setToString` without support for hot loop shorting.\n *\n * @private\n * @param {Function} func The function to modify.\n * @param {Function} string The `toString` result.\n * @returns {Function} Returns `func`.\n */\n var baseSetToString = !defineProperty ? identity : function(func, string) {\n return defineProperty(func, 'toString', {\n 'configurable': true,\n 'enumerable': false,\n 'value': constant(string),\n 'writable': true\n });\n };\n\n /**\n * The base implementation of `_.shuffle`.\n *\n * @private\n * @param {Array|Object} collection The collection to shuffle.\n * @returns {Array} Returns the new shuffled array.\n */\n function baseShuffle(collection) {\n return shuffleSelf(values(collection));\n }\n\n /**\n * The base implementation of `_.slice` without an iteratee call guard.\n *\n * @private\n * @param {Array} array The array to slice.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the slice of `array`.\n */\n function baseSlice(array, start, end) {\n var index = -1,\n length = array.length;\n\n if (start < 0) {\n start = -start > length ? 0 : (length + start);\n }\n end = end > length ? length : end;\n if (end < 0) {\n end += length;\n }\n length = start > end ? 0 : ((end - start) >>> 0);\n start >>>= 0;\n\n var result = Array(length);\n while (++index < length) {\n result[index] = array[index + start];\n }\n return result;\n }\n\n /**\n * The base implementation of `_.some` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\n function baseSome(collection, predicate) {\n var result;\n\n baseEach(collection, function(value, index, collection) {\n result = predicate(value, index, collection);\n return !result;\n });\n return !!result;\n }\n\n /**\n * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which\n * performs a binary search of `array` to determine the index at which `value`\n * should be inserted into `array` in order to maintain its sort order.\n *\n * @private\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {boolean} [retHighest] Specify returning the highest qualified index.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n */\n function baseSortedIndex(array, value, retHighest) {\n var low = 0,\n high = array == null ? low : array.length;\n\n if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {\n while (low < high) {\n var mid = (low + high) >>> 1,\n computed = array[mid];\n\n if (computed !== null && !isSymbol(computed) &&\n (retHighest ? (computed <= value) : (computed < value))) {\n low = mid + 1;\n } else {\n high = mid;\n }\n }\n return high;\n }\n return baseSortedIndexBy(array, value, identity, retHighest);\n }\n\n /**\n * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`\n * which invokes `iteratee` for `value` and each element of `array` to compute\n * their sort ranking. The iteratee is invoked with one argument; (value).\n *\n * @private\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} iteratee The iteratee invoked per element.\n * @param {boolean} [retHighest] Specify returning the highest qualified index.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n */\n function baseSortedIndexBy(array, value, iteratee, retHighest) {\n value = iteratee(value);\n\n var low = 0,\n high = array == null ? 0 : array.length,\n valIsNaN = value !== value,\n valIsNull = value === null,\n valIsSymbol = isSymbol(value),\n valIsUndefined = value === undefined;\n\n while (low < high) {\n var mid = nativeFloor((low + high) / 2),\n computed = iteratee(array[mid]),\n othIsDefined = computed !== undefined,\n othIsNull = computed === null,\n othIsReflexive = computed === computed,\n othIsSymbol = isSymbol(computed);\n\n if (valIsNaN) {\n var setLow = retHighest || othIsReflexive;\n } else if (valIsUndefined) {\n setLow = othIsReflexive && (retHighest || othIsDefined);\n } else if (valIsNull) {\n setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);\n } else if (valIsSymbol) {\n setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);\n } else if (othIsNull || othIsSymbol) {\n setLow = false;\n } else {\n setLow = retHighest ? (computed <= value) : (computed < value);\n }\n if (setLow) {\n low = mid + 1;\n } else {\n high = mid;\n }\n }\n return nativeMin(high, MAX_ARRAY_INDEX);\n }\n\n /**\n * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without\n * support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n */\n function baseSortedUniq(array, iteratee) {\n var index = -1,\n length = array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n if (!index || !eq(computed, seen)) {\n var seen = computed;\n result[resIndex++] = value === 0 ? 0 : value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.toNumber` which doesn't ensure correct\n * conversions of binary, hexadecimal, or octal string values.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n */\n function baseToNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n return +value;\n }\n\n /**\n * The base implementation of `_.toString` which doesn't convert nullish\n * values to empty strings.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {string} Returns the string.\n */\n function baseToString(value) {\n // Exit early for strings to avoid a performance hit in some environments.\n if (typeof value == 'string') {\n return value;\n }\n if (isArray(value)) {\n // Recursively convert values (susceptible to call stack limits).\n return arrayMap(value, baseToString) + '';\n }\n if (isSymbol(value)) {\n return symbolToString ? symbolToString.call(value) : '';\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n }\n\n /**\n * The base implementation of `_.uniqBy` without support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n */\n function baseUniq(array, iteratee, comparator) {\n var index = -1,\n includes = arrayIncludes,\n length = array.length,\n isCommon = true,\n result = [],\n seen = result;\n\n if (comparator) {\n isCommon = false;\n includes = arrayIncludesWith;\n }\n else if (length >= LARGE_ARRAY_SIZE) {\n var set = iteratee ? null : createSet(array);\n if (set) {\n return setToArray(set);\n }\n isCommon = false;\n includes = cacheHas;\n seen = new SetCache;\n }\n else {\n seen = iteratee ? [] : result;\n }\n outer:\n while (++index < length) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n value = (comparator || value !== 0) ? value : 0;\n if (isCommon && computed === computed) {\n var seenIndex = seen.length;\n while (seenIndex--) {\n if (seen[seenIndex] === computed) {\n continue outer;\n }\n }\n if (iteratee) {\n seen.push(computed);\n }\n result.push(value);\n }\n else if (!includes(seen, computed, comparator)) {\n if (seen !== result) {\n seen.push(computed);\n }\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.unset`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The property path to unset.\n * @returns {boolean} Returns `true` if the property is deleted, else `false`.\n */\n function baseUnset(object, path) {\n path = castPath(path, object);\n object = parent(object, path);\n return object == null || delete object[toKey(last(path))];\n }\n\n /**\n * The base implementation of `_.update`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to update.\n * @param {Function} updater The function to produce the updated value.\n * @param {Function} [customizer] The function to customize path creation.\n * @returns {Object} Returns `object`.\n */\n function baseUpdate(object, path, updater, customizer) {\n return baseSet(object, path, updater(baseGet(object, path)), customizer);\n }\n\n /**\n * The base implementation of methods like `_.dropWhile` and `_.takeWhile`\n * without support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to query.\n * @param {Function} predicate The function invoked per iteration.\n * @param {boolean} [isDrop] Specify dropping elements instead of taking them.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Array} Returns the slice of `array`.\n */\n function baseWhile(array, predicate, isDrop, fromRight) {\n var length = array.length,\n index = fromRight ? length : -1;\n\n while ((fromRight ? index-- : ++index < length) &&\n predicate(array[index], index, array)) {}\n\n return isDrop\n ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))\n : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));\n }\n\n /**\n * The base implementation of `wrapperValue` which returns the result of\n * performing a sequence of actions on the unwrapped `value`, where each\n * successive action is supplied the return value of the previous.\n *\n * @private\n * @param {*} value The unwrapped value.\n * @param {Array} actions Actions to perform to resolve the unwrapped value.\n * @returns {*} Returns the resolved value.\n */\n function baseWrapperValue(value, actions) {\n var result = value;\n if (result instanceof LazyWrapper) {\n result = result.value();\n }\n return arrayReduce(actions, function(result, action) {\n return action.func.apply(action.thisArg, arrayPush([result], action.args));\n }, result);\n }\n\n /**\n * The base implementation of methods like `_.xor`, without support for\n * iteratee shorthands, that accepts an array of arrays to inspect.\n *\n * @private\n * @param {Array} arrays The arrays to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of values.\n */\n function baseXor(arrays, iteratee, comparator) {\n var length = arrays.length;\n if (length < 2) {\n return length ? baseUniq(arrays[0]) : [];\n }\n var index = -1,\n result = Array(length);\n\n while (++index < length) {\n var array = arrays[index],\n othIndex = -1;\n\n while (++othIndex < length) {\n if (othIndex != index) {\n result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);\n }\n }\n }\n return baseUniq(baseFlatten(result, 1), iteratee, comparator);\n }\n\n /**\n * This base implementation of `_.zipObject` which assigns values using `assignFunc`.\n *\n * @private\n * @param {Array} props The property identifiers.\n * @param {Array} values The property values.\n * @param {Function} assignFunc The function to assign values.\n * @returns {Object} Returns the new object.\n */\n function baseZipObject(props, values, assignFunc) {\n var index = -1,\n length = props.length,\n valsLength = values.length,\n result = {};\n\n while (++index < length) {\n var value = index < valsLength ? values[index] : undefined;\n assignFunc(result, props[index], value);\n }\n return result;\n }\n\n /**\n * Casts `value` to an empty array if it's not an array like object.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Array|Object} Returns the cast array-like object.\n */\n function castArrayLikeObject(value) {\n return isArrayLikeObject(value) ? value : [];\n }\n\n /**\n * Casts `value` to `identity` if it's not a function.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Function} Returns cast function.\n */\n function castFunction(value) {\n return typeof value == 'function' ? value : identity;\n }\n\n /**\n * Casts `value` to a path array if it's not one.\n *\n * @private\n * @param {*} value The value to inspect.\n * @param {Object} [object] The object to query keys on.\n * @returns {Array} Returns the cast property path array.\n */\n function castPath(value, object) {\n if (isArray(value)) {\n return value;\n }\n return isKey(value, object) ? [value] : stringToPath(toString(value));\n }\n\n /**\n * A `baseRest` alias which can be replaced with `identity` by module\n * replacement plugins.\n *\n * @private\n * @type {Function}\n * @param {Function} func The function to apply a rest parameter to.\n * @returns {Function} Returns the new function.\n */\n var castRest = baseRest;\n\n /**\n * Casts `array` to a slice if it's needed.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {number} start The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the cast slice.\n */\n function castSlice(array, start, end) {\n var length = array.length;\n end = end === undefined ? length : end;\n return (!start && end >= length) ? array : baseSlice(array, start, end);\n }\n\n /**\n * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).\n *\n * @private\n * @param {number|Object} id The timer id or timeout object of the timer to clear.\n */\n var clearTimeout = ctxClearTimeout || function(id) {\n return root.clearTimeout(id);\n };\n\n /**\n * Creates a clone of `buffer`.\n *\n * @private\n * @param {Buffer} buffer The buffer to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Buffer} Returns the cloned buffer.\n */\n function cloneBuffer(buffer, isDeep) {\n if (isDeep) {\n return buffer.slice();\n }\n var length = buffer.length,\n result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);\n\n buffer.copy(result);\n return result;\n }\n\n /**\n * Creates a clone of `arrayBuffer`.\n *\n * @private\n * @param {ArrayBuffer} arrayBuffer The array buffer to clone.\n * @returns {ArrayBuffer} Returns the cloned array buffer.\n */\n function cloneArrayBuffer(arrayBuffer) {\n var result = new arrayBuffer.constructor(arrayBuffer.byteLength);\n new Uint8Array(result).set(new Uint8Array(arrayBuffer));\n return result;\n }\n\n /**\n * Creates a clone of `dataView`.\n *\n * @private\n * @param {Object} dataView The data view to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned data view.\n */\n function cloneDataView(dataView, isDeep) {\n var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;\n return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);\n }\n\n /**\n * Creates a clone of `map`.\n *\n * @private\n * @param {Object} map The map to clone.\n * @param {Function} cloneFunc The function to clone values.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned map.\n */\n function cloneMap(map, isDeep, cloneFunc) {\n var array = isDeep ? cloneFunc(mapToArray(map), CLONE_DEEP_FLAG) : mapToArray(map);\n return arrayReduce(array, addMapEntry, new map.constructor);\n }\n\n /**\n * Creates a clone of `regexp`.\n *\n * @private\n * @param {Object} regexp The regexp to clone.\n * @returns {Object} Returns the cloned regexp.\n */\n function cloneRegExp(regexp) {\n var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));\n result.lastIndex = regexp.lastIndex;\n return result;\n }\n\n /**\n * Creates a clone of `set`.\n *\n * @private\n * @param {Object} set The set to clone.\n * @param {Function} cloneFunc The function to clone values.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned set.\n */\n function cloneSet(set, isDeep, cloneFunc) {\n var array = isDeep ? cloneFunc(setToArray(set), CLONE_DEEP_FLAG) : setToArray(set);\n return arrayReduce(array, addSetEntry, new set.constructor);\n }\n\n /**\n * Creates a clone of the `symbol` object.\n *\n * @private\n * @param {Object} symbol The symbol object to clone.\n * @returns {Object} Returns the cloned symbol object.\n */\n function cloneSymbol(symbol) {\n return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};\n }\n\n /**\n * Creates a clone of `typedArray`.\n *\n * @private\n * @param {Object} typedArray The typed array to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned typed array.\n */\n function cloneTypedArray(typedArray, isDeep) {\n var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;\n return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);\n }\n\n /**\n * Compares values to sort them in ascending order.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {number} Returns the sort order indicator for `value`.\n */\n function compareAscending(value, other) {\n if (value !== other) {\n var valIsDefined = value !== undefined,\n valIsNull = value === null,\n valIsReflexive = value === value,\n valIsSymbol = isSymbol(value);\n\n var othIsDefined = other !== undefined,\n othIsNull = other === null,\n othIsReflexive = other === other,\n othIsSymbol = isSymbol(other);\n\n if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||\n (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||\n (valIsNull && othIsDefined && othIsReflexive) ||\n (!valIsDefined && othIsReflexive) ||\n !valIsReflexive) {\n return 1;\n }\n if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||\n (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||\n (othIsNull && valIsDefined && valIsReflexive) ||\n (!othIsDefined && valIsReflexive) ||\n !othIsReflexive) {\n return -1;\n }\n }\n return 0;\n }\n\n /**\n * Used by `_.orderBy` to compare multiple properties of a value to another\n * and stable sort them.\n *\n * If `orders` is unspecified, all values are sorted in ascending order. Otherwise,\n * specify an order of \"desc\" for descending or \"asc\" for ascending sort order\n * of corresponding values.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {boolean[]|string[]} orders The order to sort by for each property.\n * @returns {number} Returns the sort order indicator for `object`.\n */\n function compareMultiple(object, other, orders) {\n var index = -1,\n objCriteria = object.criteria,\n othCriteria = other.criteria,\n length = objCriteria.length,\n ordersLength = orders.length;\n\n while (++index < length) {\n var result = compareAscending(objCriteria[index], othCriteria[index]);\n if (result) {\n if (index >= ordersLength) {\n return result;\n }\n var order = orders[index];\n return result * (order == 'desc' ? -1 : 1);\n }\n }\n // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications\n // that causes it, under certain circumstances, to provide the same value for\n // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247\n // for more details.\n //\n // This also ensures a stable sort in V8 and other engines.\n // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.\n return object.index - other.index;\n }\n\n /**\n * Creates an array that is the composition of partially applied arguments,\n * placeholders, and provided arguments into a single array of arguments.\n *\n * @private\n * @param {Array} args The provided arguments.\n * @param {Array} partials The arguments to prepend to those provided.\n * @param {Array} holders The `partials` placeholder indexes.\n * @params {boolean} [isCurried] Specify composing for a curried function.\n * @returns {Array} Returns the new array of composed arguments.\n */\n function composeArgs(args, partials, holders, isCurried) {\n var argsIndex = -1,\n argsLength = args.length,\n holdersLength = holders.length,\n leftIndex = -1,\n leftLength = partials.length,\n rangeLength = nativeMax(argsLength - holdersLength, 0),\n result = Array(leftLength + rangeLength),\n isUncurried = !isCurried;\n\n while (++leftIndex < leftLength) {\n result[leftIndex] = partials[leftIndex];\n }\n while (++argsIndex < holdersLength) {\n if (isUncurried || argsIndex < argsLength) {\n result[holders[argsIndex]] = args[argsIndex];\n }\n }\n while (rangeLength--) {\n result[leftIndex++] = args[argsIndex++];\n }\n return result;\n }\n\n /**\n * This function is like `composeArgs` except that the arguments composition\n * is tailored for `_.partialRight`.\n *\n * @private\n * @param {Array} args The provided arguments.\n * @param {Array} partials The arguments to append to those provided.\n * @param {Array} holders The `partials` placeholder indexes.\n * @params {boolean} [isCurried] Specify composing for a curried function.\n * @returns {Array} Returns the new array of composed arguments.\n */\n function composeArgsRight(args, partials, holders, isCurried) {\n var argsIndex = -1,\n argsLength = args.length,\n holdersIndex = -1,\n holdersLength = holders.length,\n rightIndex = -1,\n rightLength = partials.length,\n rangeLength = nativeMax(argsLength - holdersLength, 0),\n result = Array(rangeLength + rightLength),\n isUncurried = !isCurried;\n\n while (++argsIndex < rangeLength) {\n result[argsIndex] = args[argsIndex];\n }\n var offset = argsIndex;\n while (++rightIndex < rightLength) {\n result[offset + rightIndex] = partials[rightIndex];\n }\n while (++holdersIndex < holdersLength) {\n if (isUncurried || argsIndex < argsLength) {\n result[offset + holders[holdersIndex]] = args[argsIndex++];\n }\n }\n return result;\n }\n\n /**\n * Copies the values of `source` to `array`.\n *\n * @private\n * @param {Array} source The array to copy values from.\n * @param {Array} [array=[]] The array to copy values to.\n * @returns {Array} Returns `array`.\n */\n function copyArray(source, array) {\n var index = -1,\n length = source.length;\n\n array || (array = Array(length));\n while (++index < length) {\n array[index] = source[index];\n }\n return array;\n }\n\n /**\n * Copies properties of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy properties from.\n * @param {Array} props The property identifiers to copy.\n * @param {Object} [object={}] The object to copy properties to.\n * @param {Function} [customizer] The function to customize copied values.\n * @returns {Object} Returns `object`.\n */\n function copyObject(source, props, object, customizer) {\n var isNew = !object;\n object || (object = {});\n\n var index = -1,\n length = props.length;\n\n while (++index < length) {\n var key = props[index];\n\n var newValue = customizer\n ? customizer(object[key], source[key], key, object, source)\n : undefined;\n\n if (newValue === undefined) {\n newValue = source[key];\n }\n if (isNew) {\n baseAssignValue(object, key, newValue);\n } else {\n assignValue(object, key, newValue);\n }\n }\n return object;\n }\n\n /**\n * Copies own symbols of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\n function copySymbols(source, object) {\n return copyObject(source, getSymbols(source), object);\n }\n\n /**\n * Copies own and inherited symbols of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\n function copySymbolsIn(source, object) {\n return copyObject(source, getSymbolsIn(source), object);\n }\n\n /**\n * Creates a function like `_.groupBy`.\n *\n * @private\n * @param {Function} setter The function to set accumulator values.\n * @param {Function} [initializer] The accumulator object initializer.\n * @returns {Function} Returns the new aggregator function.\n */\n function createAggregator(setter, initializer) {\n return function(collection, iteratee) {\n var func = isArray(collection) ? arrayAggregator : baseAggregator,\n accumulator = initializer ? initializer() : {};\n\n return func(collection, setter, getIteratee(iteratee, 2), accumulator);\n };\n }\n\n /**\n * Creates a function like `_.assign`.\n *\n * @private\n * @param {Function} assigner The function to assign values.\n * @returns {Function} Returns the new assigner function.\n */\n function createAssigner(assigner) {\n return baseRest(function(object, sources) {\n var index = -1,\n length = sources.length,\n customizer = length > 1 ? sources[length - 1] : undefined,\n guard = length > 2 ? sources[2] : undefined;\n\n customizer = (assigner.length > 3 && typeof customizer == 'function')\n ? (length--, customizer)\n : undefined;\n\n if (guard && isIterateeCall(sources[0], sources[1], guard)) {\n customizer = length < 3 ? undefined : customizer;\n length = 1;\n }\n object = Object(object);\n while (++index < length) {\n var source = sources[index];\n if (source) {\n assigner(object, source, index, customizer);\n }\n }\n return object;\n });\n }\n\n /**\n * Creates a `baseEach` or `baseEachRight` function.\n *\n * @private\n * @param {Function} eachFunc The function to iterate over a collection.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new base function.\n */\n function createBaseEach(eachFunc, fromRight) {\n return function(collection, iteratee) {\n if (collection == null) {\n return collection;\n }\n if (!isArrayLike(collection)) {\n return eachFunc(collection, iteratee);\n }\n var length = collection.length,\n index = fromRight ? length : -1,\n iterable = Object(collection);\n\n while ((fromRight ? index-- : ++index < length)) {\n if (iteratee(iterable[index], index, iterable) === false) {\n break;\n }\n }\n return collection;\n };\n }\n\n /**\n * Creates a base function for methods like `_.forIn` and `_.forOwn`.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new base function.\n */\n function createBaseFor(fromRight) {\n return function(object, iteratee, keysFunc) {\n var index = -1,\n iterable = Object(object),\n props = keysFunc(object),\n length = props.length;\n\n while (length--) {\n var key = props[fromRight ? length : ++index];\n if (iteratee(iterable[key], key, iterable) === false) {\n break;\n }\n }\n return object;\n };\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with the optional `this`\n * binding of `thisArg`.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createBind(func, bitmask, thisArg) {\n var isBind = bitmask & WRAP_BIND_FLAG,\n Ctor = createCtor(func);\n\n function wrapper() {\n var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n return fn.apply(isBind ? thisArg : this, arguments);\n }\n return wrapper;\n }\n\n /**\n * Creates a function like `_.lowerFirst`.\n *\n * @private\n * @param {string} methodName The name of the `String` case method to use.\n * @returns {Function} Returns the new case function.\n */\n function createCaseFirst(methodName) {\n return function(string) {\n string = toString(string);\n\n var strSymbols = hasUnicode(string)\n ? stringToArray(string)\n : undefined;\n\n var chr = strSymbols\n ? strSymbols[0]\n : string.charAt(0);\n\n var trailing = strSymbols\n ? castSlice(strSymbols, 1).join('')\n : string.slice(1);\n\n return chr[methodName]() + trailing;\n };\n }\n\n /**\n * Creates a function like `_.camelCase`.\n *\n * @private\n * @param {Function} callback The function to combine each word.\n * @returns {Function} Returns the new compounder function.\n */\n function createCompounder(callback) {\n return function(string) {\n return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');\n };\n }\n\n /**\n * Creates a function that produces an instance of `Ctor` regardless of\n * whether it was invoked as part of a `new` expression or by `call` or `apply`.\n *\n * @private\n * @param {Function} Ctor The constructor to wrap.\n * @returns {Function} Returns the new wrapped function.\n */\n function createCtor(Ctor) {\n return function() {\n // Use a `switch` statement to work with class constructors. See\n // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist\n // for more details.\n var args = arguments;\n switch (args.length) {\n case 0: return new Ctor;\n case 1: return new Ctor(args[0]);\n case 2: return new Ctor(args[0], args[1]);\n case 3: return new Ctor(args[0], args[1], args[2]);\n case 4: return new Ctor(args[0], args[1], args[2], args[3]);\n case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);\n case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);\n case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);\n }\n var thisBinding = baseCreate(Ctor.prototype),\n result = Ctor.apply(thisBinding, args);\n\n // Mimic the constructor's `return` behavior.\n // See https://es5.github.io/#x13.2.2 for more details.\n return isObject(result) ? result : thisBinding;\n };\n }\n\n /**\n * Creates a function that wraps `func` to enable currying.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {number} arity The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createCurry(func, bitmask, arity) {\n var Ctor = createCtor(func);\n\n function wrapper() {\n var length = arguments.length,\n args = Array(length),\n index = length,\n placeholder = getHolder(wrapper);\n\n while (index--) {\n args[index] = arguments[index];\n }\n var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)\n ? []\n : replaceHolders(args, placeholder);\n\n length -= holders.length;\n if (length < arity) {\n return createRecurry(\n func, bitmask, createHybrid, wrapper.placeholder, undefined,\n args, holders, undefined, undefined, arity - length);\n }\n var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n return apply(fn, this, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a `_.find` or `_.findLast` function.\n *\n * @private\n * @param {Function} findIndexFunc The function to find the collection index.\n * @returns {Function} Returns the new find function.\n */\n function createFind(findIndexFunc) {\n return function(collection, predicate, fromIndex) {\n var iterable = Object(collection);\n if (!isArrayLike(collection)) {\n var iteratee = getIteratee(predicate, 3);\n collection = keys(collection);\n predicate = function(key) { return iteratee(iterable[key], key, iterable); };\n }\n var index = findIndexFunc(collection, predicate, fromIndex);\n return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;\n };\n }\n\n /**\n * Creates a `_.flow` or `_.flowRight` function.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new flow function.\n */\n function createFlow(fromRight) {\n return flatRest(function(funcs) {\n var length = funcs.length,\n index = length,\n prereq = LodashWrapper.prototype.thru;\n\n if (fromRight) {\n funcs.reverse();\n }\n while (index--) {\n var func = funcs[index];\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n if (prereq && !wrapper && getFuncName(func) == 'wrapper') {\n var wrapper = new LodashWrapper([], true);\n }\n }\n index = wrapper ? index : length;\n while (++index < length) {\n func = funcs[index];\n\n var funcName = getFuncName(func),\n data = funcName == 'wrapper' ? getData(func) : undefined;\n\n if (data && isLaziable(data[0]) &&\n data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&\n !data[4].length && data[9] == 1\n ) {\n wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);\n } else {\n wrapper = (func.length == 1 && isLaziable(func))\n ? wrapper[funcName]()\n : wrapper.thru(func);\n }\n }\n return function() {\n var args = arguments,\n value = args[0];\n\n if (wrapper && args.length == 1 && isArray(value)) {\n return wrapper.plant(value).value();\n }\n var index = 0,\n result = length ? funcs[index].apply(this, args) : value;\n\n while (++index < length) {\n result = funcs[index].call(this, result);\n }\n return result;\n };\n });\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with optional `this`\n * binding of `thisArg`, partial application, and currying.\n *\n * @private\n * @param {Function|string} func The function or method name to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to prepend to those provided to\n * the new function.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [partialsRight] The arguments to append to those provided\n * to the new function.\n * @param {Array} [holdersRight] The `partialsRight` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {\n var isAry = bitmask & WRAP_ARY_FLAG,\n isBind = bitmask & WRAP_BIND_FLAG,\n isBindKey = bitmask & WRAP_BIND_KEY_FLAG,\n isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),\n isFlip = bitmask & WRAP_FLIP_FLAG,\n Ctor = isBindKey ? undefined : createCtor(func);\n\n function wrapper() {\n var length = arguments.length,\n args = Array(length),\n index = length;\n\n while (index--) {\n args[index] = arguments[index];\n }\n if (isCurried) {\n var placeholder = getHolder(wrapper),\n holdersCount = countHolders(args, placeholder);\n }\n if (partials) {\n args = composeArgs(args, partials, holders, isCurried);\n }\n if (partialsRight) {\n args = composeArgsRight(args, partialsRight, holdersRight, isCurried);\n }\n length -= holdersCount;\n if (isCurried && length < arity) {\n var newHolders = replaceHolders(args, placeholder);\n return createRecurry(\n func, bitmask, createHybrid, wrapper.placeholder, thisArg,\n args, newHolders, argPos, ary, arity - length\n );\n }\n var thisBinding = isBind ? thisArg : this,\n fn = isBindKey ? thisBinding[func] : func;\n\n length = args.length;\n if (argPos) {\n args = reorder(args, argPos);\n } else if (isFlip && length > 1) {\n args.reverse();\n }\n if (isAry && ary < length) {\n args.length = ary;\n }\n if (this && this !== root && this instanceof wrapper) {\n fn = Ctor || createCtor(fn);\n }\n return fn.apply(thisBinding, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a function like `_.invertBy`.\n *\n * @private\n * @param {Function} setter The function to set accumulator values.\n * @param {Function} toIteratee The function to resolve iteratees.\n * @returns {Function} Returns the new inverter function.\n */\n function createInverter(setter, toIteratee) {\n return function(object, iteratee) {\n return baseInverter(object, setter, toIteratee(iteratee), {});\n };\n }\n\n /**\n * Creates a function that performs a mathematical operation on two values.\n *\n * @private\n * @param {Function} operator The function to perform the operation.\n * @param {number} [defaultValue] The value used for `undefined` arguments.\n * @returns {Function} Returns the new mathematical operation function.\n */\n function createMathOperation(operator, defaultValue) {\n return function(value, other) {\n var result;\n if (value === undefined && other === undefined) {\n return defaultValue;\n }\n if (value !== undefined) {\n result = value;\n }\n if (other !== undefined) {\n if (result === undefined) {\n return other;\n }\n if (typeof value == 'string' || typeof other == 'string') {\n value = baseToString(value);\n other = baseToString(other);\n } else {\n value = baseToNumber(value);\n other = baseToNumber(other);\n }\n result = operator(value, other);\n }\n return result;\n };\n }\n\n /**\n * Creates a function like `_.over`.\n *\n * @private\n * @param {Function} arrayFunc The function to iterate over iteratees.\n * @returns {Function} Returns the new over function.\n */\n function createOver(arrayFunc) {\n return flatRest(function(iteratees) {\n iteratees = arrayMap(iteratees, baseUnary(getIteratee()));\n return baseRest(function(args) {\n var thisArg = this;\n return arrayFunc(iteratees, function(iteratee) {\n return apply(iteratee, thisArg, args);\n });\n });\n });\n }\n\n /**\n * Creates the padding for `string` based on `length`. The `chars` string\n * is truncated if the number of characters exceeds `length`.\n *\n * @private\n * @param {number} length The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padding for `string`.\n */\n function createPadding(length, chars) {\n chars = chars === undefined ? ' ' : baseToString(chars);\n\n var charsLength = chars.length;\n if (charsLength < 2) {\n return charsLength ? baseRepeat(chars, length) : chars;\n }\n var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));\n return hasUnicode(chars)\n ? castSlice(stringToArray(result), 0, length).join('')\n : result.slice(0, length);\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with the `this` binding\n * of `thisArg` and `partials` prepended to the arguments it receives.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {Array} partials The arguments to prepend to those provided to\n * the new function.\n * @returns {Function} Returns the new wrapped function.\n */\n function createPartial(func, bitmask, thisArg, partials) {\n var isBind = bitmask & WRAP_BIND_FLAG,\n Ctor = createCtor(func);\n\n function wrapper() {\n var argsIndex = -1,\n argsLength = arguments.length,\n leftIndex = -1,\n leftLength = partials.length,\n args = Array(leftLength + argsLength),\n fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n\n while (++leftIndex < leftLength) {\n args[leftIndex] = partials[leftIndex];\n }\n while (argsLength--) {\n args[leftIndex++] = arguments[++argsIndex];\n }\n return apply(fn, isBind ? thisArg : this, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a `_.range` or `_.rangeRight` function.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new range function.\n */\n function createRange(fromRight) {\n return function(start, end, step) {\n if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {\n end = step = undefined;\n }\n // Ensure the sign of `-0` is preserved.\n start = toFinite(start);\n if (end === undefined) {\n end = start;\n start = 0;\n } else {\n end = toFinite(end);\n }\n step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);\n return baseRange(start, end, step, fromRight);\n };\n }\n\n /**\n * Creates a function that performs a relational operation on two values.\n *\n * @private\n * @param {Function} operator The function to perform the operation.\n * @returns {Function} Returns the new relational operation function.\n */\n function createRelationalOperation(operator) {\n return function(value, other) {\n if (!(typeof value == 'string' && typeof other == 'string')) {\n value = toNumber(value);\n other = toNumber(other);\n }\n return operator(value, other);\n };\n }\n\n /**\n * Creates a function that wraps `func` to continue currying.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {Function} wrapFunc The function to create the `func` wrapper.\n * @param {*} placeholder The placeholder value.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to prepend to those provided to\n * the new function.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {\n var isCurry = bitmask & WRAP_CURRY_FLAG,\n newHolders = isCurry ? holders : undefined,\n newHoldersRight = isCurry ? undefined : holders,\n newPartials = isCurry ? partials : undefined,\n newPartialsRight = isCurry ? undefined : partials;\n\n bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);\n bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);\n\n if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {\n bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);\n }\n var newData = [\n func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,\n newHoldersRight, argPos, ary, arity\n ];\n\n var result = wrapFunc.apply(undefined, newData);\n if (isLaziable(func)) {\n setData(result, newData);\n }\n result.placeholder = placeholder;\n return setWrapToString(result, func, bitmask);\n }\n\n /**\n * Creates a function like `_.round`.\n *\n * @private\n * @param {string} methodName The name of the `Math` method to use when rounding.\n * @returns {Function} Returns the new round function.\n */\n function createRound(methodName) {\n var func = Math[methodName];\n return function(number, precision) {\n number = toNumber(number);\n precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);\n if (precision) {\n // Shift with exponential notation to avoid floating-point issues.\n // See [MDN](https://mdn.io/round#Examples) for more details.\n var pair = (toString(number) + 'e').split('e'),\n value = func(pair[0] + 'e' + (+pair[1] + precision));\n\n pair = (toString(value) + 'e').split('e');\n return +(pair[0] + 'e' + (+pair[1] - precision));\n }\n return func(number);\n };\n }\n\n /**\n * Creates a set object of `values`.\n *\n * @private\n * @param {Array} values The values to add to the set.\n * @returns {Object} Returns the new set.\n */\n var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {\n return new Set(values);\n };\n\n /**\n * Creates a `_.toPairs` or `_.toPairsIn` function.\n *\n * @private\n * @param {Function} keysFunc The function to get the keys of a given object.\n * @returns {Function} Returns the new pairs function.\n */\n function createToPairs(keysFunc) {\n return function(object) {\n var tag = getTag(object);\n if (tag == mapTag) {\n return mapToArray(object);\n }\n if (tag == setTag) {\n return setToPairs(object);\n }\n return baseToPairs(object, keysFunc(object));\n };\n }\n\n /**\n * Creates a function that either curries or invokes `func` with optional\n * `this` binding and partially applied arguments.\n *\n * @private\n * @param {Function|string} func The function or method name to wrap.\n * @param {number} bitmask The bitmask flags.\n * 1 - `_.bind`\n * 2 - `_.bindKey`\n * 4 - `_.curry` or `_.curryRight` of a bound function\n * 8 - `_.curry`\n * 16 - `_.curryRight`\n * 32 - `_.partial`\n * 64 - `_.partialRight`\n * 128 - `_.rearg`\n * 256 - `_.ary`\n * 512 - `_.flip`\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to be partially applied.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {\n var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;\n if (!isBindKey && typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n var length = partials ? partials.length : 0;\n if (!length) {\n bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);\n partials = holders = undefined;\n }\n ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);\n arity = arity === undefined ? arity : toInteger(arity);\n length -= holders ? holders.length : 0;\n\n if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {\n var partialsRight = partials,\n holdersRight = holders;\n\n partials = holders = undefined;\n }\n var data = isBindKey ? undefined : getData(func);\n\n var newData = [\n func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,\n argPos, ary, arity\n ];\n\n if (data) {\n mergeData(newData, data);\n }\n func = newData[0];\n bitmask = newData[1];\n thisArg = newData[2];\n partials = newData[3];\n holders = newData[4];\n arity = newData[9] = newData[9] === undefined\n ? (isBindKey ? 0 : func.length)\n : nativeMax(newData[9] - length, 0);\n\n if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {\n bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);\n }\n if (!bitmask || bitmask == WRAP_BIND_FLAG) {\n var result = createBind(func, bitmask, thisArg);\n } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {\n result = createCurry(func, bitmask, arity);\n } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {\n result = createPartial(func, bitmask, thisArg, partials);\n } else {\n result = createHybrid.apply(undefined, newData);\n }\n var setter = data ? baseSetData : setData;\n return setWrapToString(setter(result, newData), func, bitmask);\n }\n\n /**\n * Used by `_.defaults` to customize its `_.assignIn` use to assign properties\n * of source objects to the destination object for all destination properties\n * that resolve to `undefined`.\n *\n * @private\n * @param {*} objValue The destination value.\n * @param {*} srcValue The source value.\n * @param {string} key The key of the property to assign.\n * @param {Object} object The parent object of `objValue`.\n * @returns {*} Returns the value to assign.\n */\n function customDefaultsAssignIn(objValue, srcValue, key, object) {\n if (objValue === undefined ||\n (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {\n return srcValue;\n }\n return objValue;\n }\n\n /**\n * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source\n * objects into destination objects that are passed thru.\n *\n * @private\n * @param {*} objValue The destination value.\n * @param {*} srcValue The source value.\n * @param {string} key The key of the property to merge.\n * @param {Object} object The parent object of `objValue`.\n * @param {Object} source The parent object of `srcValue`.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n * @returns {*} Returns the value to assign.\n */\n function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {\n if (isObject(objValue) && isObject(srcValue)) {\n // Recursively merge objects and arrays (susceptible to call stack limits).\n stack.set(srcValue, objValue);\n baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);\n stack['delete'](srcValue);\n }\n return objValue;\n }\n\n /**\n * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain\n * objects.\n *\n * @private\n * @param {*} value The value to inspect.\n * @param {string} key The key of the property to inspect.\n * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.\n */\n function customOmitClone(value) {\n return isPlainObject(value) ? undefined : value;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for arrays with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Array} array The array to compare.\n * @param {Array} other The other array to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `array` and `other` objects.\n * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.\n */\n function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n arrLength = array.length,\n othLength = other.length;\n\n if (arrLength != othLength && !(isPartial && othLength > arrLength)) {\n return false;\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(array);\n if (stacked && stack.get(other)) {\n return stacked == other;\n }\n var index = -1,\n result = true,\n seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;\n\n stack.set(array, other);\n stack.set(other, array);\n\n // Ignore non-index properties.\n while (++index < arrLength) {\n var arrValue = array[index],\n othValue = other[index];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, arrValue, index, other, array, stack)\n : customizer(arrValue, othValue, index, array, other, stack);\n }\n if (compared !== undefined) {\n if (compared) {\n continue;\n }\n result = false;\n break;\n }\n // Recursively compare arrays (susceptible to call stack limits).\n if (seen) {\n if (!arraySome(other, function(othValue, othIndex) {\n if (!cacheHas(seen, othIndex) &&\n (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {\n return seen.push(othIndex);\n }\n })) {\n result = false;\n break;\n }\n } else if (!(\n arrValue === othValue ||\n equalFunc(arrValue, othValue, bitmask, customizer, stack)\n )) {\n result = false;\n break;\n }\n }\n stack['delete'](array);\n stack['delete'](other);\n return result;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for comparing objects of\n * the same `toStringTag`.\n *\n * **Note:** This function only supports comparing values with tags of\n * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {string} tag The `toStringTag` of the objects to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {\n switch (tag) {\n case dataViewTag:\n if ((object.byteLength != other.byteLength) ||\n (object.byteOffset != other.byteOffset)) {\n return false;\n }\n object = object.buffer;\n other = other.buffer;\n\n case arrayBufferTag:\n if ((object.byteLength != other.byteLength) ||\n !equalFunc(new Uint8Array(object), new Uint8Array(other))) {\n return false;\n }\n return true;\n\n case boolTag:\n case dateTag:\n case numberTag:\n // Coerce booleans to `1` or `0` and dates to milliseconds.\n // Invalid dates are coerced to `NaN`.\n return eq(+object, +other);\n\n case errorTag:\n return object.name == other.name && object.message == other.message;\n\n case regexpTag:\n case stringTag:\n // Coerce regexes to strings and treat strings, primitives and objects,\n // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring\n // for more details.\n return object == (other + '');\n\n case mapTag:\n var convert = mapToArray;\n\n case setTag:\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG;\n convert || (convert = setToArray);\n\n if (object.size != other.size && !isPartial) {\n return false;\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(object);\n if (stacked) {\n return stacked == other;\n }\n bitmask |= COMPARE_UNORDERED_FLAG;\n\n // Recursively compare objects (susceptible to call stack limits).\n stack.set(object, other);\n var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);\n stack['delete'](object);\n return result;\n\n case symbolTag:\n if (symbolValueOf) {\n return symbolValueOf.call(object) == symbolValueOf.call(other);\n }\n }\n return false;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for objects with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n objProps = getAllKeys(object),\n objLength = objProps.length,\n othProps = getAllKeys(other),\n othLength = othProps.length;\n\n if (objLength != othLength && !isPartial) {\n return false;\n }\n var index = objLength;\n while (index--) {\n var key = objProps[index];\n if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {\n return false;\n }\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(object);\n if (stacked && stack.get(other)) {\n return stacked == other;\n }\n var result = true;\n stack.set(object, other);\n stack.set(other, object);\n\n var skipCtor = isPartial;\n while (++index < objLength) {\n key = objProps[index];\n var objValue = object[key],\n othValue = other[key];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, objValue, key, other, object, stack)\n : customizer(objValue, othValue, key, object, other, stack);\n }\n // Recursively compare objects (susceptible to call stack limits).\n if (!(compared === undefined\n ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))\n : compared\n )) {\n result = false;\n break;\n }\n skipCtor || (skipCtor = key == 'constructor');\n }\n if (result && !skipCtor) {\n var objCtor = object.constructor,\n othCtor = other.constructor;\n\n // Non `Object` object instances with different constructors are not equal.\n if (objCtor != othCtor &&\n ('constructor' in object && 'constructor' in other) &&\n !(typeof objCtor == 'function' && objCtor instanceof objCtor &&\n typeof othCtor == 'function' && othCtor instanceof othCtor)) {\n result = false;\n }\n }\n stack['delete'](object);\n stack['delete'](other);\n return result;\n }\n\n /**\n * A specialized version of `baseRest` which flattens the rest array.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @returns {Function} Returns the new function.\n */\n function flatRest(func) {\n return setToString(overRest(func, undefined, flatten), func + '');\n }\n\n /**\n * Creates an array of own enumerable property names and symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function getAllKeys(object) {\n return baseGetAllKeys(object, keys, getSymbols);\n }\n\n /**\n * Creates an array of own and inherited enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function getAllKeysIn(object) {\n return baseGetAllKeys(object, keysIn, getSymbolsIn);\n }\n\n /**\n * Gets metadata for `func`.\n *\n * @private\n * @param {Function} func The function to query.\n * @returns {*} Returns the metadata for `func`.\n */\n var getData = !metaMap ? noop : function(func) {\n return metaMap.get(func);\n };\n\n /**\n * Gets the name of `func`.\n *\n * @private\n * @param {Function} func The function to query.\n * @returns {string} Returns the function name.\n */\n function getFuncName(func) {\n var result = (func.name + ''),\n array = realNames[result],\n length = hasOwnProperty.call(realNames, result) ? array.length : 0;\n\n while (length--) {\n var data = array[length],\n otherFunc = data.func;\n if (otherFunc == null || otherFunc == func) {\n return data.name;\n }\n }\n return result;\n }\n\n /**\n * Gets the argument placeholder value for `func`.\n *\n * @private\n * @param {Function} func The function to inspect.\n * @returns {*} Returns the placeholder value.\n */\n function getHolder(func) {\n var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;\n return object.placeholder;\n }\n\n /**\n * Gets the appropriate \"iteratee\" function. If `_.iteratee` is customized,\n * this function returns the custom method, otherwise it returns `baseIteratee`.\n * If arguments are provided, the chosen function is invoked with them and\n * its result is returned.\n *\n * @private\n * @param {*} [value] The value to convert to an iteratee.\n * @param {number} [arity] The arity of the created iteratee.\n * @returns {Function} Returns the chosen function or its result.\n */\n function getIteratee() {\n var result = lodash.iteratee || iteratee;\n result = result === iteratee ? baseIteratee : result;\n return arguments.length ? result(arguments[0], arguments[1]) : result;\n }\n\n /**\n * Gets the data for `map`.\n *\n * @private\n * @param {Object} map The map to query.\n * @param {string} key The reference key.\n * @returns {*} Returns the map data.\n */\n function getMapData(map, key) {\n var data = map.__data__;\n return isKeyable(key)\n ? data[typeof key == 'string' ? 'string' : 'hash']\n : data.map;\n }\n\n /**\n * Gets the property names, values, and compare flags of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the match data of `object`.\n */\n function getMatchData(object) {\n var result = keys(object),\n length = result.length;\n\n while (length--) {\n var key = result[length],\n value = object[key];\n\n result[length] = [key, value, isStrictComparable(value)];\n }\n return result;\n }\n\n /**\n * Gets the native function at `key` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the method to get.\n * @returns {*} Returns the function if it's native, else `undefined`.\n */\n function getNative(object, key) {\n var value = getValue(object, key);\n return baseIsNative(value) ? value : undefined;\n }\n\n /**\n * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the raw `toStringTag`.\n */\n function getRawTag(value) {\n var isOwn = hasOwnProperty.call(value, symToStringTag),\n tag = value[symToStringTag];\n\n try {\n value[symToStringTag] = undefined;\n var unmasked = true;\n } catch (e) {}\n\n var result = nativeObjectToString.call(value);\n if (unmasked) {\n if (isOwn) {\n value[symToStringTag] = tag;\n } else {\n delete value[symToStringTag];\n }\n }\n return result;\n }\n\n /**\n * Creates an array of the own enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\n var getSymbols = !nativeGetSymbols ? stubArray : function(object) {\n if (object == null) {\n return [];\n }\n object = Object(object);\n return arrayFilter(nativeGetSymbols(object), function(symbol) {\n return propertyIsEnumerable.call(object, symbol);\n });\n };\n\n /**\n * Creates an array of the own and inherited enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\n var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {\n var result = [];\n while (object) {\n arrayPush(result, getSymbols(object));\n object = getPrototype(object);\n }\n return result;\n };\n\n /**\n * Gets the `toStringTag` of `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\n var getTag = baseGetTag;\n\n // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.\n if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||\n (Map && getTag(new Map) != mapTag) ||\n (Promise && getTag(Promise.resolve()) != promiseTag) ||\n (Set && getTag(new Set) != setTag) ||\n (WeakMap && getTag(new WeakMap) != weakMapTag)) {\n getTag = function(value) {\n var result = baseGetTag(value),\n Ctor = result == objectTag ? value.constructor : undefined,\n ctorString = Ctor ? toSource(Ctor) : '';\n\n if (ctorString) {\n switch (ctorString) {\n case dataViewCtorString: return dataViewTag;\n case mapCtorString: return mapTag;\n case promiseCtorString: return promiseTag;\n case setCtorString: return setTag;\n case weakMapCtorString: return weakMapTag;\n }\n }\n return result;\n };\n }\n\n /**\n * Gets the view, applying any `transforms` to the `start` and `end` positions.\n *\n * @private\n * @param {number} start The start of the view.\n * @param {number} end The end of the view.\n * @param {Array} transforms The transformations to apply to the view.\n * @returns {Object} Returns an object containing the `start` and `end`\n * positions of the view.\n */\n function getView(start, end, transforms) {\n var index = -1,\n length = transforms.length;\n\n while (++index < length) {\n var data = transforms[index],\n size = data.size;\n\n switch (data.type) {\n case 'drop': start += size; break;\n case 'dropRight': end -= size; break;\n case 'take': end = nativeMin(end, start + size); break;\n case 'takeRight': start = nativeMax(start, end - size); break;\n }\n }\n return { 'start': start, 'end': end };\n }\n\n /**\n * Extracts wrapper details from the `source` body comment.\n *\n * @private\n * @param {string} source The source to inspect.\n * @returns {Array} Returns the wrapper details.\n */\n function getWrapDetails(source) {\n var match = source.match(reWrapDetails);\n return match ? match[1].split(reSplitDetails) : [];\n }\n\n /**\n * Checks if `path` exists on `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @param {Function} hasFunc The function to check properties.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n */\n function hasPath(object, path, hasFunc) {\n path = castPath(path, object);\n\n var index = -1,\n length = path.length,\n result = false;\n\n while (++index < length) {\n var key = toKey(path[index]);\n if (!(result = object != null && hasFunc(object, key))) {\n break;\n }\n object = object[key];\n }\n if (result || ++index != length) {\n return result;\n }\n length = object == null ? 0 : object.length;\n return !!length && isLength(length) && isIndex(key, length) &&\n (isArray(object) || isArguments(object));\n }\n\n /**\n * Initializes an array clone.\n *\n * @private\n * @param {Array} array The array to clone.\n * @returns {Array} Returns the initialized clone.\n */\n function initCloneArray(array) {\n var length = array.length,\n result = array.constructor(length);\n\n // Add properties assigned by `RegExp#exec`.\n if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {\n result.index = array.index;\n result.input = array.input;\n }\n return result;\n }\n\n /**\n * Initializes an object clone.\n *\n * @private\n * @param {Object} object The object to clone.\n * @returns {Object} Returns the initialized clone.\n */\n function initCloneObject(object) {\n return (typeof object.constructor == 'function' && !isPrototype(object))\n ? baseCreate(getPrototype(object))\n : {};\n }\n\n /**\n * Initializes an object clone based on its `toStringTag`.\n *\n * **Note:** This function only supports cloning values with tags of\n * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.\n *\n * @private\n * @param {Object} object The object to clone.\n * @param {string} tag The `toStringTag` of the object to clone.\n * @param {Function} cloneFunc The function to clone values.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the initialized clone.\n */\n function initCloneByTag(object, tag, cloneFunc, isDeep) {\n var Ctor = object.constructor;\n switch (tag) {\n case arrayBufferTag:\n return cloneArrayBuffer(object);\n\n case boolTag:\n case dateTag:\n return new Ctor(+object);\n\n case dataViewTag:\n return cloneDataView(object, isDeep);\n\n case float32Tag: case float64Tag:\n case int8Tag: case int16Tag: case int32Tag:\n case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:\n return cloneTypedArray(object, isDeep);\n\n case mapTag:\n return cloneMap(object, isDeep, cloneFunc);\n\n case numberTag:\n case stringTag:\n return new Ctor(object);\n\n case regexpTag:\n return cloneRegExp(object);\n\n case setTag:\n return cloneSet(object, isDeep, cloneFunc);\n\n case symbolTag:\n return cloneSymbol(object);\n }\n }\n\n /**\n * Inserts wrapper `details` in a comment at the top of the `source` body.\n *\n * @private\n * @param {string} source The source to modify.\n * @returns {Array} details The details to insert.\n * @returns {string} Returns the modified source.\n */\n function insertWrapDetails(source, details) {\n var length = details.length;\n if (!length) {\n return source;\n }\n var lastIndex = length - 1;\n details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];\n details = details.join(length > 2 ? ', ' : ' ');\n return source.replace(reWrapComment, '{\\n/* [wrapped with ' + details + '] */\\n');\n }\n\n /**\n * Checks if `value` is a flattenable `arguments` object or array.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is flattenable, else `false`.\n */\n function isFlattenable(value) {\n return isArray(value) || isArguments(value) ||\n !!(spreadableSymbol && value && value[spreadableSymbol]);\n }\n\n /**\n * Checks if `value` is a valid array-like index.\n *\n * @private\n * @param {*} value The value to check.\n * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.\n * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.\n */\n function isIndex(value, length) {\n length = length == null ? MAX_SAFE_INTEGER : length;\n return !!length &&\n (typeof value == 'number' || reIsUint.test(value)) &&\n (value > -1 && value % 1 == 0 && value < length);\n }\n\n /**\n * Checks if the given arguments are from an iteratee call.\n *\n * @private\n * @param {*} value The potential iteratee value argument.\n * @param {*} index The potential iteratee index or key argument.\n * @param {*} object The potential iteratee object argument.\n * @returns {boolean} Returns `true` if the arguments are from an iteratee call,\n * else `false`.\n */\n function isIterateeCall(value, index, object) {\n if (!isObject(object)) {\n return false;\n }\n var type = typeof index;\n if (type == 'number'\n ? (isArrayLike(object) && isIndex(index, object.length))\n : (type == 'string' && index in object)\n ) {\n return eq(object[index], value);\n }\n return false;\n }\n\n /**\n * Checks if `value` is a property name and not a property path.\n *\n * @private\n * @param {*} value The value to check.\n * @param {Object} [object] The object to query keys on.\n * @returns {boolean} Returns `true` if `value` is a property name, else `false`.\n */\n function isKey(value, object) {\n if (isArray(value)) {\n return false;\n }\n var type = typeof value;\n if (type == 'number' || type == 'symbol' || type == 'boolean' ||\n value == null || isSymbol(value)) {\n return true;\n }\n return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||\n (object != null && value in Object(object));\n }\n\n /**\n * Checks if `value` is suitable for use as unique object key.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is suitable, else `false`.\n */\n function isKeyable(value) {\n var type = typeof value;\n return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')\n ? (value !== '__proto__')\n : (value === null);\n }\n\n /**\n * Checks if `func` has a lazy counterpart.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` has a lazy counterpart,\n * else `false`.\n */\n function isLaziable(func) {\n var funcName = getFuncName(func),\n other = lodash[funcName];\n\n if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {\n return false;\n }\n if (func === other) {\n return true;\n }\n var data = getData(other);\n return !!data && func === data[0];\n }\n\n /**\n * Checks if `func` has its source masked.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` is masked, else `false`.\n */\n function isMasked(func) {\n return !!maskSrcKey && (maskSrcKey in func);\n }\n\n /**\n * Checks if `func` is capable of being masked.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `func` is maskable, else `false`.\n */\n var isMaskable = coreJsData ? isFunction : stubFalse;\n\n /**\n * Checks if `value` is likely a prototype object.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.\n */\n function isPrototype(value) {\n var Ctor = value && value.constructor,\n proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;\n\n return value === proto;\n }\n\n /**\n * Checks if `value` is suitable for strict equality comparisons, i.e. `===`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` if suitable for strict\n * equality comparisons, else `false`.\n */\n function isStrictComparable(value) {\n return value === value && !isObject(value);\n }\n\n /**\n * A specialized version of `matchesProperty` for source values suitable\n * for strict equality comparisons, i.e. `===`.\n *\n * @private\n * @param {string} key The key of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n */\n function matchesStrictComparable(key, srcValue) {\n return function(object) {\n if (object == null) {\n return false;\n }\n return object[key] === srcValue &&\n (srcValue !== undefined || (key in Object(object)));\n };\n }\n\n /**\n * A specialized version of `_.memoize` which clears the memoized function's\n * cache when it exceeds `MAX_MEMOIZE_SIZE`.\n *\n * @private\n * @param {Function} func The function to have its output memoized.\n * @returns {Function} Returns the new memoized function.\n */\n function memoizeCapped(func) {\n var result = memoize(func, function(key) {\n if (cache.size === MAX_MEMOIZE_SIZE) {\n cache.clear();\n }\n return key;\n });\n\n var cache = result.cache;\n return result;\n }\n\n /**\n * Merges the function metadata of `source` into `data`.\n *\n * Merging metadata reduces the number of wrappers used to invoke a function.\n * This is possible because methods like `_.bind`, `_.curry`, and `_.partial`\n * may be applied regardless of execution order. Methods like `_.ary` and\n * `_.rearg` modify function arguments, making the order in which they are\n * executed important, preventing the merging of metadata. However, we make\n * an exception for a safe combined case where curried functions have `_.ary`\n * and or `_.rearg` applied.\n *\n * @private\n * @param {Array} data The destination metadata.\n * @param {Array} source The source metadata.\n * @returns {Array} Returns `data`.\n */\n function mergeData(data, source) {\n var bitmask = data[1],\n srcBitmask = source[1],\n newBitmask = bitmask | srcBitmask,\n isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);\n\n var isCombo =\n ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||\n ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||\n ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));\n\n // Exit early if metadata can't be merged.\n if (!(isCommon || isCombo)) {\n return data;\n }\n // Use source `thisArg` if available.\n if (srcBitmask & WRAP_BIND_FLAG) {\n data[2] = source[2];\n // Set when currying a bound function.\n newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;\n }\n // Compose partial arguments.\n var value = source[3];\n if (value) {\n var partials = data[3];\n data[3] = partials ? composeArgs(partials, value, source[4]) : value;\n data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];\n }\n // Compose partial right arguments.\n value = source[5];\n if (value) {\n partials = data[5];\n data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;\n data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];\n }\n // Use source `argPos` if available.\n value = source[7];\n if (value) {\n data[7] = value;\n }\n // Use source `ary` if it's smaller.\n if (srcBitmask & WRAP_ARY_FLAG) {\n data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);\n }\n // Use source `arity` if one is not provided.\n if (data[9] == null) {\n data[9] = source[9];\n }\n // Use source `func` and merge bitmasks.\n data[0] = source[0];\n data[1] = newBitmask;\n\n return data;\n }\n\n /**\n * This function is like\n * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * except that it includes inherited enumerable properties.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function nativeKeysIn(object) {\n var result = [];\n if (object != null) {\n for (var key in Object(object)) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * Converts `value` to a string using `Object.prototype.toString`.\n *\n * @private\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n */\n function objectToString(value) {\n return nativeObjectToString.call(value);\n }\n\n /**\n * A specialized version of `baseRest` which transforms the rest array.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @param {Function} transform The rest array transform.\n * @returns {Function} Returns the new function.\n */\n function overRest(func, start, transform) {\n start = nativeMax(start === undefined ? (func.length - 1) : start, 0);\n return function() {\n var args = arguments,\n index = -1,\n length = nativeMax(args.length - start, 0),\n array = Array(length);\n\n while (++index < length) {\n array[index] = args[start + index];\n }\n index = -1;\n var otherArgs = Array(start + 1);\n while (++index < start) {\n otherArgs[index] = args[index];\n }\n otherArgs[start] = transform(array);\n return apply(func, this, otherArgs);\n };\n }\n\n /**\n * Gets the parent value at `path` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} path The path to get the parent value of.\n * @returns {*} Returns the parent value.\n */\n function parent(object, path) {\n return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));\n }\n\n /**\n * Reorder `array` according to the specified indexes where the element at\n * the first index is assigned as the first element, the element at\n * the second index is assigned as the second element, and so on.\n *\n * @private\n * @param {Array} array The array to reorder.\n * @param {Array} indexes The arranged array indexes.\n * @returns {Array} Returns `array`.\n */\n function reorder(array, indexes) {\n var arrLength = array.length,\n length = nativeMin(indexes.length, arrLength),\n oldArray = copyArray(array);\n\n while (length--) {\n var index = indexes[length];\n array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;\n }\n return array;\n }\n\n /**\n * Sets metadata for `func`.\n *\n * **Note:** If this function becomes hot, i.e. is invoked a lot in a short\n * period of time, it will trip its breaker and transition to an identity\n * function to avoid garbage collection pauses in V8. See\n * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)\n * for more details.\n *\n * @private\n * @param {Function} func The function to associate metadata with.\n * @param {*} data The metadata.\n * @returns {Function} Returns `func`.\n */\n var setData = shortOut(baseSetData);\n\n /**\n * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).\n *\n * @private\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @returns {number|Object} Returns the timer id or timeout object.\n */\n var setTimeout = ctxSetTimeout || function(func, wait) {\n return root.setTimeout(func, wait);\n };\n\n /**\n * Sets the `toString` method of `func` to return `string`.\n *\n * @private\n * @param {Function} func The function to modify.\n * @param {Function} string The `toString` result.\n * @returns {Function} Returns `func`.\n */\n var setToString = shortOut(baseSetToString);\n\n /**\n * Sets the `toString` method of `wrapper` to mimic the source of `reference`\n * with wrapper details in a comment at the top of the source body.\n *\n * @private\n * @param {Function} wrapper The function to modify.\n * @param {Function} reference The reference function.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @returns {Function} Returns `wrapper`.\n */\n function setWrapToString(wrapper, reference, bitmask) {\n var source = (reference + '');\n return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));\n }\n\n /**\n * Creates a function that'll short out and invoke `identity` instead\n * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`\n * milliseconds.\n *\n * @private\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new shortable function.\n */\n function shortOut(func) {\n var count = 0,\n lastCalled = 0;\n\n return function() {\n var stamp = nativeNow(),\n remaining = HOT_SPAN - (stamp - lastCalled);\n\n lastCalled = stamp;\n if (remaining > 0) {\n if (++count >= HOT_COUNT) {\n return arguments[0];\n }\n } else {\n count = 0;\n }\n return func.apply(undefined, arguments);\n };\n }\n\n /**\n * A specialized version of `_.shuffle` which mutates and sets the size of `array`.\n *\n * @private\n * @param {Array} array The array to shuffle.\n * @param {number} [size=array.length] The size of `array`.\n * @returns {Array} Returns `array`.\n */\n function shuffleSelf(array, size) {\n var index = -1,\n length = array.length,\n lastIndex = length - 1;\n\n size = size === undefined ? length : size;\n while (++index < size) {\n var rand = baseRandom(index, lastIndex),\n value = array[rand];\n\n array[rand] = array[index];\n array[index] = value;\n }\n array.length = size;\n return array;\n }\n\n /**\n * Converts `string` to a property path array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the property path array.\n */\n var stringToPath = memoizeCapped(function(string) {\n var result = [];\n if (reLeadingDot.test(string)) {\n result.push('');\n }\n string.replace(rePropName, function(match, number, quote, string) {\n result.push(quote ? string.replace(reEscapeChar, '$1') : (number || match));\n });\n return result;\n });\n\n /**\n * Converts `value` to a string key if it's not a string or symbol.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {string|symbol} Returns the key.\n */\n function toKey(value) {\n if (typeof value == 'string' || isSymbol(value)) {\n return value;\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n }\n\n /**\n * Converts `func` to its source code.\n *\n * @private\n * @param {Function} func The function to convert.\n * @returns {string} Returns the source code.\n */\n function toSource(func) {\n if (func != null) {\n try {\n return funcToString.call(func);\n } catch (e) {}\n try {\n return (func + '');\n } catch (e) {}\n }\n return '';\n }\n\n /**\n * Updates wrapper `details` based on `bitmask` flags.\n *\n * @private\n * @returns {Array} details The details to modify.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @returns {Array} Returns `details`.\n */\n function updateWrapDetails(details, bitmask) {\n arrayEach(wrapFlags, function(pair) {\n var value = '_.' + pair[0];\n if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {\n details.push(value);\n }\n });\n return details.sort();\n }\n\n /**\n * Creates a clone of `wrapper`.\n *\n * @private\n * @param {Object} wrapper The wrapper to clone.\n * @returns {Object} Returns the cloned wrapper.\n */\n function wrapperClone(wrapper) {\n if (wrapper instanceof LazyWrapper) {\n return wrapper.clone();\n }\n var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);\n result.__actions__ = copyArray(wrapper.__actions__);\n result.__index__ = wrapper.__index__;\n result.__values__ = wrapper.__values__;\n return result;\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an array of elements split into groups the length of `size`.\n * If `array` can't be split evenly, the final chunk will be the remaining\n * elements.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to process.\n * @param {number} [size=1] The length of each chunk\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the new array of chunks.\n * @example\n *\n * _.chunk(['a', 'b', 'c', 'd'], 2);\n * // => [['a', 'b'], ['c', 'd']]\n *\n * _.chunk(['a', 'b', 'c', 'd'], 3);\n * // => [['a', 'b', 'c'], ['d']]\n */\n function chunk(array, size, guard) {\n if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {\n size = 1;\n } else {\n size = nativeMax(toInteger(size), 0);\n }\n var length = array == null ? 0 : array.length;\n if (!length || size < 1) {\n return [];\n }\n var index = 0,\n resIndex = 0,\n result = Array(nativeCeil(length / size));\n\n while (index < length) {\n result[resIndex++] = baseSlice(array, index, (index += size));\n }\n return result;\n }\n\n /**\n * Creates an array with all falsey values removed. The values `false`, `null`,\n * `0`, `\"\"`, `undefined`, and `NaN` are falsey.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to compact.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.compact([0, 1, false, 2, '', 3]);\n * // => [1, 2, 3]\n */\n function compact(array) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (value) {\n result[resIndex++] = value;\n }\n }\n return result;\n }\n\n /**\n * Creates a new array concatenating `array` with any additional arrays\n * and/or values.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to concatenate.\n * @param {...*} [values] The values to concatenate.\n * @returns {Array} Returns the new concatenated array.\n * @example\n *\n * var array = [1];\n * var other = _.concat(array, 2, [3], [[4]]);\n *\n * console.log(other);\n * // => [1, 2, 3, [4]]\n *\n * console.log(array);\n * // => [1]\n */\n function concat() {\n var length = arguments.length;\n if (!length) {\n return [];\n }\n var args = Array(length - 1),\n array = arguments[0],\n index = length;\n\n while (index--) {\n args[index - 1] = arguments[index];\n }\n return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));\n }\n\n /**\n * Creates an array of `array` values not included in the other given arrays\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. The order and references of result values are\n * determined by the first array.\n *\n * **Note:** Unlike `_.pullAll`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.without, _.xor\n * @example\n *\n * _.difference([2, 1], [2, 3]);\n * // => [1]\n */\n var difference = baseRest(function(array, values) {\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))\n : [];\n });\n\n /**\n * This method is like `_.difference` except that it accepts `iteratee` which\n * is invoked for each element of `array` and `values` to generate the criterion\n * by which they're compared. The order and references of result values are\n * determined by the first array. The iteratee is invoked with one argument:\n * (value).\n *\n * **Note:** Unlike `_.pullAllBy`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');\n * // => [{ 'x': 2 }]\n */\n var differenceBy = baseRest(function(array, values) {\n var iteratee = last(values);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))\n : [];\n });\n\n /**\n * This method is like `_.difference` except that it accepts `comparator`\n * which is invoked to compare elements of `array` to `values`. The order and\n * references of result values are determined by the first array. The comparator\n * is invoked with two arguments: (arrVal, othVal).\n *\n * **Note:** Unlike `_.pullAllWith`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n *\n * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);\n * // => [{ 'x': 2, 'y': 1 }]\n */\n var differenceWith = baseRest(function(array, values) {\n var comparator = last(values);\n if (isArrayLikeObject(comparator)) {\n comparator = undefined;\n }\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)\n : [];\n });\n\n /**\n * Creates a slice of `array` with `n` elements dropped from the beginning.\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to drop.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.drop([1, 2, 3]);\n * // => [2, 3]\n *\n * _.drop([1, 2, 3], 2);\n * // => [3]\n *\n * _.drop([1, 2, 3], 5);\n * // => []\n *\n * _.drop([1, 2, 3], 0);\n * // => [1, 2, 3]\n */\n function drop(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n return baseSlice(array, n < 0 ? 0 : n, length);\n }\n\n /**\n * Creates a slice of `array` with `n` elements dropped from the end.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to drop.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.dropRight([1, 2, 3]);\n * // => [1, 2]\n *\n * _.dropRight([1, 2, 3], 2);\n * // => [1]\n *\n * _.dropRight([1, 2, 3], 5);\n * // => []\n *\n * _.dropRight([1, 2, 3], 0);\n * // => [1, 2, 3]\n */\n function dropRight(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n n = length - n;\n return baseSlice(array, 0, n < 0 ? 0 : n);\n }\n\n /**\n * Creates a slice of `array` excluding elements dropped from the end.\n * Elements are dropped until `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.dropRightWhile(users, function(o) { return !o.active; });\n * // => objects for ['barney']\n *\n * // The `_.matches` iteratee shorthand.\n * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });\n * // => objects for ['barney', 'fred']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.dropRightWhile(users, ['active', false]);\n * // => objects for ['barney']\n *\n * // The `_.property` iteratee shorthand.\n * _.dropRightWhile(users, 'active');\n * // => objects for ['barney', 'fred', 'pebbles']\n */\n function dropRightWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), true, true)\n : [];\n }\n\n /**\n * Creates a slice of `array` excluding elements dropped from the beginning.\n * Elements are dropped until `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.dropWhile(users, function(o) { return !o.active; });\n * // => objects for ['pebbles']\n *\n * // The `_.matches` iteratee shorthand.\n * _.dropWhile(users, { 'user': 'barney', 'active': false });\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.dropWhile(users, ['active', false]);\n * // => objects for ['pebbles']\n *\n * // The `_.property` iteratee shorthand.\n * _.dropWhile(users, 'active');\n * // => objects for ['barney', 'fred', 'pebbles']\n */\n function dropWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), true)\n : [];\n }\n\n /**\n * Fills elements of `array` with `value` from `start` up to, but not\n * including, `end`.\n *\n * **Note:** This method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Array\n * @param {Array} array The array to fill.\n * @param {*} value The value to fill `array` with.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _.fill(array, 'a');\n * console.log(array);\n * // => ['a', 'a', 'a']\n *\n * _.fill(Array(3), 2);\n * // => [2, 2, 2]\n *\n * _.fill([4, 6, 8, 10], '*', 1, 3);\n * // => [4, '*', '*', 10]\n */\n function fill(array, value, start, end) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {\n start = 0;\n end = length;\n }\n return baseFill(array, value, start, end);\n }\n\n /**\n * This method is like `_.find` except that it returns the index of the first\n * element `predicate` returns truthy for instead of the element itself.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {number} Returns the index of the found element, else `-1`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.findIndex(users, function(o) { return o.user == 'barney'; });\n * // => 0\n *\n * // The `_.matches` iteratee shorthand.\n * _.findIndex(users, { 'user': 'fred', 'active': false });\n * // => 1\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findIndex(users, ['active', false]);\n * // => 0\n *\n * // The `_.property` iteratee shorthand.\n * _.findIndex(users, 'active');\n * // => 2\n */\n function findIndex(array, predicate, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = fromIndex == null ? 0 : toInteger(fromIndex);\n if (index < 0) {\n index = nativeMax(length + index, 0);\n }\n return baseFindIndex(array, getIteratee(predicate, 3), index);\n }\n\n /**\n * This method is like `_.findIndex` except that it iterates over elements\n * of `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=array.length-1] The index to search from.\n * @returns {number} Returns the index of the found element, else `-1`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });\n * // => 2\n *\n * // The `_.matches` iteratee shorthand.\n * _.findLastIndex(users, { 'user': 'barney', 'active': true });\n * // => 0\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findLastIndex(users, ['active', false]);\n * // => 2\n *\n * // The `_.property` iteratee shorthand.\n * _.findLastIndex(users, 'active');\n * // => 0\n */\n function findLastIndex(array, predicate, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = length - 1;\n if (fromIndex !== undefined) {\n index = toInteger(fromIndex);\n index = fromIndex < 0\n ? nativeMax(length + index, 0)\n : nativeMin(index, length - 1);\n }\n return baseFindIndex(array, getIteratee(predicate, 3), index, true);\n }\n\n /**\n * Flattens `array` a single level deep.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * _.flatten([1, [2, [3, [4]], 5]]);\n * // => [1, 2, [3, [4]], 5]\n */\n function flatten(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseFlatten(array, 1) : [];\n }\n\n /**\n * Recursively flattens `array`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * _.flattenDeep([1, [2, [3, [4]], 5]]);\n * // => [1, 2, 3, 4, 5]\n */\n function flattenDeep(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseFlatten(array, INFINITY) : [];\n }\n\n /**\n * Recursively flatten `array` up to `depth` times.\n *\n * @static\n * @memberOf _\n * @since 4.4.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @param {number} [depth=1] The maximum recursion depth.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * var array = [1, [2, [3, [4]], 5]];\n *\n * _.flattenDepth(array, 1);\n * // => [1, 2, [3, [4]], 5]\n *\n * _.flattenDepth(array, 2);\n * // => [1, 2, 3, [4], 5]\n */\n function flattenDepth(array, depth) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n depth = depth === undefined ? 1 : toInteger(depth);\n return baseFlatten(array, depth);\n }\n\n /**\n * The inverse of `_.toPairs`; this method returns an object composed\n * from key-value `pairs`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} pairs The key-value pairs.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.fromPairs([['a', 1], ['b', 2]]);\n * // => { 'a': 1, 'b': 2 }\n */\n function fromPairs(pairs) {\n var index = -1,\n length = pairs == null ? 0 : pairs.length,\n result = {};\n\n while (++index < length) {\n var pair = pairs[index];\n result[pair[0]] = pair[1];\n }\n return result;\n }\n\n /**\n * Gets the first element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @alias first\n * @category Array\n * @param {Array} array The array to query.\n * @returns {*} Returns the first element of `array`.\n * @example\n *\n * _.head([1, 2, 3]);\n * // => 1\n *\n * _.head([]);\n * // => undefined\n */\n function head(array) {\n return (array && array.length) ? array[0] : undefined;\n }\n\n /**\n * Gets the index at which the first occurrence of `value` is found in `array`\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. If `fromIndex` is negative, it's used as the\n * offset from the end of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.indexOf([1, 2, 1, 2], 2);\n * // => 1\n *\n * // Search from the `fromIndex`.\n * _.indexOf([1, 2, 1, 2], 2, 2);\n * // => 3\n */\n function indexOf(array, value, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = fromIndex == null ? 0 : toInteger(fromIndex);\n if (index < 0) {\n index = nativeMax(length + index, 0);\n }\n return baseIndexOf(array, value, index);\n }\n\n /**\n * Gets all but the last element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.initial([1, 2, 3]);\n * // => [1, 2]\n */\n function initial(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseSlice(array, 0, -1) : [];\n }\n\n /**\n * Creates an array of unique values that are included in all given arrays\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. The order and references of result values are\n * determined by the first array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * _.intersection([2, 1], [2, 3]);\n * // => [2]\n */\n var intersection = baseRest(function(arrays) {\n var mapped = arrayMap(arrays, castArrayLikeObject);\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped)\n : [];\n });\n\n /**\n * This method is like `_.intersection` except that it accepts `iteratee`\n * which is invoked for each element of each `arrays` to generate the criterion\n * by which they're compared. The order and references of result values are\n * determined by the first array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [2.1]\n *\n * // The `_.property` iteratee shorthand.\n * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }]\n */\n var intersectionBy = baseRest(function(arrays) {\n var iteratee = last(arrays),\n mapped = arrayMap(arrays, castArrayLikeObject);\n\n if (iteratee === last(mapped)) {\n iteratee = undefined;\n } else {\n mapped.pop();\n }\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped, getIteratee(iteratee, 2))\n : [];\n });\n\n /**\n * This method is like `_.intersection` except that it accepts `comparator`\n * which is invoked to compare elements of `arrays`. The order and references\n * of result values are determined by the first array. The comparator is\n * invoked with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.intersectionWith(objects, others, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }]\n */\n var intersectionWith = baseRest(function(arrays) {\n var comparator = last(arrays),\n mapped = arrayMap(arrays, castArrayLikeObject);\n\n comparator = typeof comparator == 'function' ? comparator : undefined;\n if (comparator) {\n mapped.pop();\n }\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped, undefined, comparator)\n : [];\n });\n\n /**\n * Converts all elements in `array` into a string separated by `separator`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to convert.\n * @param {string} [separator=','] The element separator.\n * @returns {string} Returns the joined string.\n * @example\n *\n * _.join(['a', 'b', 'c'], '~');\n * // => 'a~b~c'\n */\n function join(array, separator) {\n return array == null ? '' : nativeJoin.call(array, separator);\n }\n\n /**\n * Gets the last element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {*} Returns the last element of `array`.\n * @example\n *\n * _.last([1, 2, 3]);\n * // => 3\n */\n function last(array) {\n var length = array == null ? 0 : array.length;\n return length ? array[length - 1] : undefined;\n }\n\n /**\n * This method is like `_.indexOf` except that it iterates over elements of\n * `array` from right to left.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=array.length-1] The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.lastIndexOf([1, 2, 1, 2], 2);\n * // => 3\n *\n * // Search from the `fromIndex`.\n * _.lastIndexOf([1, 2, 1, 2], 2, 2);\n * // => 1\n */\n function lastIndexOf(array, value, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = length;\n if (fromIndex !== undefined) {\n index = toInteger(fromIndex);\n index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);\n }\n return value === value\n ? strictLastIndexOf(array, value, index)\n : baseFindIndex(array, baseIsNaN, index, true);\n }\n\n /**\n * Gets the element at index `n` of `array`. If `n` is negative, the nth\n * element from the end is returned.\n *\n * @static\n * @memberOf _\n * @since 4.11.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=0] The index of the element to return.\n * @returns {*} Returns the nth element of `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'd'];\n *\n * _.nth(array, 1);\n * // => 'b'\n *\n * _.nth(array, -2);\n * // => 'c';\n */\n function nth(array, n) {\n return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;\n }\n\n /**\n * Removes all given values from `array` using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`\n * to remove elements from an array by predicate.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {...*} [values] The values to remove.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'a', 'b', 'c'];\n *\n * _.pull(array, 'a', 'c');\n * console.log(array);\n * // => ['b', 'b']\n */\n var pull = baseRest(pullAll);\n\n /**\n * This method is like `_.pull` except that it accepts an array of values to remove.\n *\n * **Note:** Unlike `_.difference`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'a', 'b', 'c'];\n *\n * _.pullAll(array, ['a', 'c']);\n * console.log(array);\n * // => ['b', 'b']\n */\n function pullAll(array, values) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values)\n : array;\n }\n\n /**\n * This method is like `_.pullAll` except that it accepts `iteratee` which is\n * invoked for each element of `array` and `values` to generate the criterion\n * by which they're compared. The iteratee is invoked with one argument: (value).\n *\n * **Note:** Unlike `_.differenceBy`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];\n *\n * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');\n * console.log(array);\n * // => [{ 'x': 2 }]\n */\n function pullAllBy(array, values, iteratee) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values, getIteratee(iteratee, 2))\n : array;\n }\n\n /**\n * This method is like `_.pullAll` except that it accepts `comparator` which\n * is invoked to compare elements of `array` to `values`. The comparator is\n * invoked with two arguments: (arrVal, othVal).\n *\n * **Note:** Unlike `_.differenceWith`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];\n *\n * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);\n * console.log(array);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]\n */\n function pullAllWith(array, values, comparator) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values, undefined, comparator)\n : array;\n }\n\n /**\n * Removes elements from `array` corresponding to `indexes` and returns an\n * array of removed elements.\n *\n * **Note:** Unlike `_.at`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {...(number|number[])} [indexes] The indexes of elements to remove.\n * @returns {Array} Returns the new array of removed elements.\n * @example\n *\n * var array = ['a', 'b', 'c', 'd'];\n * var pulled = _.pullAt(array, [1, 3]);\n *\n * console.log(array);\n * // => ['a', 'c']\n *\n * console.log(pulled);\n * // => ['b', 'd']\n */\n var pullAt = flatRest(function(array, indexes) {\n var length = array == null ? 0 : array.length,\n result = baseAt(array, indexes);\n\n basePullAt(array, arrayMap(indexes, function(index) {\n return isIndex(index, length) ? +index : index;\n }).sort(compareAscending));\n\n return result;\n });\n\n /**\n * Removes all elements from `array` that `predicate` returns truthy for\n * and returns an array of the removed elements. The predicate is invoked\n * with three arguments: (value, index, array).\n *\n * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`\n * to pull elements from an array by value.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new array of removed elements.\n * @example\n *\n * var array = [1, 2, 3, 4];\n * var evens = _.remove(array, function(n) {\n * return n % 2 == 0;\n * });\n *\n * console.log(array);\n * // => [1, 3]\n *\n * console.log(evens);\n * // => [2, 4]\n */\n function remove(array, predicate) {\n var result = [];\n if (!(array && array.length)) {\n return result;\n }\n var index = -1,\n indexes = [],\n length = array.length;\n\n predicate = getIteratee(predicate, 3);\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result.push(value);\n indexes.push(index);\n }\n }\n basePullAt(array, indexes);\n return result;\n }\n\n /**\n * Reverses `array` so that the first element becomes the last, the second\n * element becomes the second to last, and so on.\n *\n * **Note:** This method mutates `array` and is based on\n * [`Array#reverse`](https://mdn.io/Array/reverse).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _.reverse(array);\n * // => [3, 2, 1]\n *\n * console.log(array);\n * // => [3, 2, 1]\n */\n function reverse(array) {\n return array == null ? array : nativeReverse.call(array);\n }\n\n /**\n * Creates a slice of `array` from `start` up to, but not including, `end`.\n *\n * **Note:** This method is used instead of\n * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are\n * returned.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to slice.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the slice of `array`.\n */\n function slice(array, start, end) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {\n start = 0;\n end = length;\n }\n else {\n start = start == null ? 0 : toInteger(start);\n end = end === undefined ? length : toInteger(end);\n }\n return baseSlice(array, start, end);\n }\n\n /**\n * Uses a binary search to determine the lowest index at which `value`\n * should be inserted into `array` in order to maintain its sort order.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * _.sortedIndex([30, 50], 40);\n * // => 1\n */\n function sortedIndex(array, value) {\n return baseSortedIndex(array, value);\n }\n\n /**\n * This method is like `_.sortedIndex` except that it accepts `iteratee`\n * which is invoked for `value` and each element of `array` to compute their\n * sort ranking. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * var objects = [{ 'x': 4 }, { 'x': 5 }];\n *\n * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });\n * // => 0\n *\n * // The `_.property` iteratee shorthand.\n * _.sortedIndexBy(objects, { 'x': 4 }, 'x');\n * // => 0\n */\n function sortedIndexBy(array, value, iteratee) {\n return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));\n }\n\n /**\n * This method is like `_.indexOf` except that it performs a binary\n * search on a sorted `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.sortedIndexOf([4, 5, 5, 5, 6], 5);\n * // => 1\n */\n function sortedIndexOf(array, value) {\n var length = array == null ? 0 : array.length;\n if (length) {\n var index = baseSortedIndex(array, value);\n if (index < length && eq(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * This method is like `_.sortedIndex` except that it returns the highest\n * index at which `value` should be inserted into `array` in order to\n * maintain its sort order.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * _.sortedLastIndex([4, 5, 5, 5, 6], 5);\n * // => 4\n */\n function sortedLastIndex(array, value) {\n return baseSortedIndex(array, value, true);\n }\n\n /**\n * This method is like `_.sortedLastIndex` except that it accepts `iteratee`\n * which is invoked for `value` and each element of `array` to compute their\n * sort ranking. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * var objects = [{ 'x': 4 }, { 'x': 5 }];\n *\n * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });\n * // => 1\n *\n * // The `_.property` iteratee shorthand.\n * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');\n * // => 1\n */\n function sortedLastIndexBy(array, value, iteratee) {\n return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);\n }\n\n /**\n * This method is like `_.lastIndexOf` except that it performs a binary\n * search on a sorted `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);\n * // => 3\n */\n function sortedLastIndexOf(array, value) {\n var length = array == null ? 0 : array.length;\n if (length) {\n var index = baseSortedIndex(array, value, true) - 1;\n if (eq(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * This method is like `_.uniq` except that it's designed and optimized\n * for sorted arrays.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.sortedUniq([1, 1, 2]);\n * // => [1, 2]\n */\n function sortedUniq(array) {\n return (array && array.length)\n ? baseSortedUniq(array)\n : [];\n }\n\n /**\n * This method is like `_.uniqBy` except that it's designed and optimized\n * for sorted arrays.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);\n * // => [1.1, 2.3]\n */\n function sortedUniqBy(array, iteratee) {\n return (array && array.length)\n ? baseSortedUniq(array, getIteratee(iteratee, 2))\n : [];\n }\n\n /**\n * Gets all but the first element of `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.tail([1, 2, 3]);\n * // => [2, 3]\n */\n function tail(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseSlice(array, 1, length) : [];\n }\n\n /**\n * Creates a slice of `array` with `n` elements taken from the beginning.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to take.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.take([1, 2, 3]);\n * // => [1]\n *\n * _.take([1, 2, 3], 2);\n * // => [1, 2]\n *\n * _.take([1, 2, 3], 5);\n * // => [1, 2, 3]\n *\n * _.take([1, 2, 3], 0);\n * // => []\n */\n function take(array, n, guard) {\n if (!(array && array.length)) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n return baseSlice(array, 0, n < 0 ? 0 : n);\n }\n\n /**\n * Creates a slice of `array` with `n` elements taken from the end.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to take.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.takeRight([1, 2, 3]);\n * // => [3]\n *\n * _.takeRight([1, 2, 3], 2);\n * // => [2, 3]\n *\n * _.takeRight([1, 2, 3], 5);\n * // => [1, 2, 3]\n *\n * _.takeRight([1, 2, 3], 0);\n * // => []\n */\n function takeRight(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n n = length - n;\n return baseSlice(array, n < 0 ? 0 : n, length);\n }\n\n /**\n * Creates a slice of `array` with elements taken from the end. Elements are\n * taken until `predicate` returns falsey. The predicate is invoked with\n * three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.takeRightWhile(users, function(o) { return !o.active; });\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.matches` iteratee shorthand.\n * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });\n * // => objects for ['pebbles']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.takeRightWhile(users, ['active', false]);\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.property` iteratee shorthand.\n * _.takeRightWhile(users, 'active');\n * // => []\n */\n function takeRightWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), false, true)\n : [];\n }\n\n /**\n * Creates a slice of `array` with elements taken from the beginning. Elements\n * are taken until `predicate` returns falsey. The predicate is invoked with\n * three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.takeWhile(users, function(o) { return !o.active; });\n * // => objects for ['barney', 'fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.takeWhile(users, { 'user': 'barney', 'active': false });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.takeWhile(users, ['active', false]);\n * // => objects for ['barney', 'fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.takeWhile(users, 'active');\n * // => []\n */\n function takeWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3))\n : [];\n }\n\n /**\n * Creates an array of unique values, in order, from all given arrays using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * _.union([2], [1, 2]);\n * // => [2, 1]\n */\n var union = baseRest(function(arrays) {\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));\n });\n\n /**\n * This method is like `_.union` except that it accepts `iteratee` which is\n * invoked for each element of each `arrays` to generate the criterion by\n * which uniqueness is computed. Result values are chosen from the first\n * array in which the value occurs. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * _.unionBy([2.1], [1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\n var unionBy = baseRest(function(arrays) {\n var iteratee = last(arrays);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));\n });\n\n /**\n * This method is like `_.union` except that it accepts `comparator` which\n * is invoked to compare elements of `arrays`. Result values are chosen from\n * the first array in which the value occurs. The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.unionWith(objects, others, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]\n */\n var unionWith = baseRest(function(arrays) {\n var comparator = last(arrays);\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);\n });\n\n /**\n * Creates a duplicate-free version of an array, using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons, in which only the first occurrence of each element\n * is kept. The order of result values is determined by the order they occur\n * in the array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniq([2, 1, 2]);\n * // => [2, 1]\n */\n function uniq(array) {\n return (array && array.length) ? baseUniq(array) : [];\n }\n\n /**\n * This method is like `_.uniq` except that it accepts `iteratee` which is\n * invoked for each element in `array` to generate the criterion by which\n * uniqueness is computed. The order of result values is determined by the\n * order they occur in the array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniqBy([2.1, 1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\n function uniqBy(array, iteratee) {\n return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];\n }\n\n /**\n * This method is like `_.uniq` except that it accepts `comparator` which\n * is invoked to compare elements of `array`. The order of result values is\n * determined by the order they occur in the array.The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.uniqWith(objects, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]\n */\n function uniqWith(array, comparator) {\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return (array && array.length) ? baseUniq(array, undefined, comparator) : [];\n }\n\n /**\n * This method is like `_.zip` except that it accepts an array of grouped\n * elements and creates an array regrouping the elements to their pre-zip\n * configuration.\n *\n * @static\n * @memberOf _\n * @since 1.2.0\n * @category Array\n * @param {Array} array The array of grouped elements to process.\n * @returns {Array} Returns the new array of regrouped elements.\n * @example\n *\n * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);\n * // => [['a', 1, true], ['b', 2, false]]\n *\n * _.unzip(zipped);\n * // => [['a', 'b'], [1, 2], [true, false]]\n */\n function unzip(array) {\n if (!(array && array.length)) {\n return [];\n }\n var length = 0;\n array = arrayFilter(array, function(group) {\n if (isArrayLikeObject(group)) {\n length = nativeMax(group.length, length);\n return true;\n }\n });\n return baseTimes(length, function(index) {\n return arrayMap(array, baseProperty(index));\n });\n }\n\n /**\n * This method is like `_.unzip` except that it accepts `iteratee` to specify\n * how regrouped values should be combined. The iteratee is invoked with the\n * elements of each group: (...group).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Array\n * @param {Array} array The array of grouped elements to process.\n * @param {Function} [iteratee=_.identity] The function to combine\n * regrouped values.\n * @returns {Array} Returns the new array of regrouped elements.\n * @example\n *\n * var zipped = _.zip([1, 2], [10, 20], [100, 200]);\n * // => [[1, 10, 100], [2, 20, 200]]\n *\n * _.unzipWith(zipped, _.add);\n * // => [3, 30, 300]\n */\n function unzipWith(array, iteratee) {\n if (!(array && array.length)) {\n return [];\n }\n var result = unzip(array);\n if (iteratee == null) {\n return result;\n }\n return arrayMap(result, function(group) {\n return apply(iteratee, undefined, group);\n });\n }\n\n /**\n * Creates an array excluding all given values using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * **Note:** Unlike `_.pull`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...*} [values] The values to exclude.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.difference, _.xor\n * @example\n *\n * _.without([2, 1, 2, 3], 1, 2);\n * // => [3]\n */\n var without = baseRest(function(array, values) {\n return isArrayLikeObject(array)\n ? baseDifference(array, values)\n : [];\n });\n\n /**\n * Creates an array of unique values that is the\n * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)\n * of the given arrays. The order of result values is determined by the order\n * they occur in the arrays.\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.difference, _.without\n * @example\n *\n * _.xor([2, 1], [2, 3]);\n * // => [1, 3]\n */\n var xor = baseRest(function(arrays) {\n return baseXor(arrayFilter(arrays, isArrayLikeObject));\n });\n\n /**\n * This method is like `_.xor` except that it accepts `iteratee` which is\n * invoked for each element of each `arrays` to generate the criterion by\n * which by which they're compared. The order of result values is determined\n * by the order they occur in the arrays. The iteratee is invoked with one\n * argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [1.2, 3.4]\n *\n * // The `_.property` iteratee shorthand.\n * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 2 }]\n */\n var xorBy = baseRest(function(arrays) {\n var iteratee = last(arrays);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));\n });\n\n /**\n * This method is like `_.xor` except that it accepts `comparator` which is\n * invoked to compare elements of `arrays`. The order of result values is\n * determined by the order they occur in the arrays. The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.xorWith(objects, others, _.isEqual);\n * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]\n */\n var xorWith = baseRest(function(arrays) {\n var comparator = last(arrays);\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);\n });\n\n /**\n * Creates an array of grouped elements, the first of which contains the\n * first elements of the given arrays, the second of which contains the\n * second elements of the given arrays, and so on.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to process.\n * @returns {Array} Returns the new array of grouped elements.\n * @example\n *\n * _.zip(['a', 'b'], [1, 2], [true, false]);\n * // => [['a', 1, true], ['b', 2, false]]\n */\n var zip = baseRest(unzip);\n\n /**\n * This method is like `_.fromPairs` except that it accepts two arrays,\n * one of property identifiers and one of corresponding values.\n *\n * @static\n * @memberOf _\n * @since 0.4.0\n * @category Array\n * @param {Array} [props=[]] The property identifiers.\n * @param {Array} [values=[]] The property values.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.zipObject(['a', 'b'], [1, 2]);\n * // => { 'a': 1, 'b': 2 }\n */\n function zipObject(props, values) {\n return baseZipObject(props || [], values || [], assignValue);\n }\n\n /**\n * This method is like `_.zipObject` except that it supports property paths.\n *\n * @static\n * @memberOf _\n * @since 4.1.0\n * @category Array\n * @param {Array} [props=[]] The property identifiers.\n * @param {Array} [values=[]] The property values.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);\n * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }\n */\n function zipObjectDeep(props, values) {\n return baseZipObject(props || [], values || [], baseSet);\n }\n\n /**\n * This method is like `_.zip` except that it accepts `iteratee` to specify\n * how grouped values should be combined. The iteratee is invoked with the\n * elements of each group: (...group).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Array\n * @param {...Array} [arrays] The arrays to process.\n * @param {Function} [iteratee=_.identity] The function to combine\n * grouped values.\n * @returns {Array} Returns the new array of grouped elements.\n * @example\n *\n * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {\n * return a + b + c;\n * });\n * // => [111, 222]\n */\n var zipWith = baseRest(function(arrays) {\n var length = arrays.length,\n iteratee = length > 1 ? arrays[length - 1] : undefined;\n\n iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;\n return unzipWith(arrays, iteratee);\n });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a `lodash` wrapper instance that wraps `value` with explicit method\n * chain sequences enabled. The result of such sequences must be unwrapped\n * with `_#value`.\n *\n * @static\n * @memberOf _\n * @since 1.3.0\n * @category Seq\n * @param {*} value The value to wrap.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'pebbles', 'age': 1 }\n * ];\n *\n * var youngest = _\n * .chain(users)\n * .sortBy('age')\n * .map(function(o) {\n * return o.user + ' is ' + o.age;\n * })\n * .head()\n * .value();\n * // => 'pebbles is 1'\n */\n function chain(value) {\n var result = lodash(value);\n result.__chain__ = true;\n return result;\n }\n\n /**\n * This method invokes `interceptor` and returns `value`. The interceptor\n * is invoked with one argument; (value). The purpose of this method is to\n * \"tap into\" a method chain sequence in order to modify intermediate results.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @param {*} value The value to provide to `interceptor`.\n * @param {Function} interceptor The function to invoke.\n * @returns {*} Returns `value`.\n * @example\n *\n * _([1, 2, 3])\n * .tap(function(array) {\n * // Mutate input array.\n * array.pop();\n * })\n * .reverse()\n * .value();\n * // => [2, 1]\n */\n function tap(value, interceptor) {\n interceptor(value);\n return value;\n }\n\n /**\n * This method is like `_.tap` except that it returns the result of `interceptor`.\n * The purpose of this method is to \"pass thru\" values replacing intermediate\n * results in a method chain sequence.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Seq\n * @param {*} value The value to provide to `interceptor`.\n * @param {Function} interceptor The function to invoke.\n * @returns {*} Returns the result of `interceptor`.\n * @example\n *\n * _(' abc ')\n * .chain()\n * .trim()\n * .thru(function(value) {\n * return [value];\n * })\n * .value();\n * // => ['abc']\n */\n function thru(value, interceptor) {\n return interceptor(value);\n }\n\n /**\n * This method is the wrapper version of `_.at`.\n *\n * @name at\n * @memberOf _\n * @since 1.0.0\n * @category Seq\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };\n *\n * _(object).at(['a[0].b.c', 'a[1]']).value();\n * // => [3, 4]\n */\n var wrapperAt = flatRest(function(paths) {\n var length = paths.length,\n start = length ? paths[0] : 0,\n value = this.__wrapped__,\n interceptor = function(object) { return baseAt(object, paths); };\n\n if (length > 1 || this.__actions__.length ||\n !(value instanceof LazyWrapper) || !isIndex(start)) {\n return this.thru(interceptor);\n }\n value = value.slice(start, +start + (length ? 1 : 0));\n value.__actions__.push({\n 'func': thru,\n 'args': [interceptor],\n 'thisArg': undefined\n });\n return new LodashWrapper(value, this.__chain__).thru(function(array) {\n if (length && !array.length) {\n array.push(undefined);\n }\n return array;\n });\n });\n\n /**\n * Creates a `lodash` wrapper instance with explicit method chain sequences enabled.\n *\n * @name chain\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 }\n * ];\n *\n * // A sequence without explicit chaining.\n * _(users).head();\n * // => { 'user': 'barney', 'age': 36 }\n *\n * // A sequence with explicit chaining.\n * _(users)\n * .chain()\n * .head()\n * .pick('user')\n * .value();\n * // => { 'user': 'barney' }\n */\n function wrapperChain() {\n return chain(this);\n }\n\n /**\n * Executes the chain sequence and returns the wrapped result.\n *\n * @name commit\n * @memberOf _\n * @since 3.2.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var array = [1, 2];\n * var wrapped = _(array).push(3);\n *\n * console.log(array);\n * // => [1, 2]\n *\n * wrapped = wrapped.commit();\n * console.log(array);\n * // => [1, 2, 3]\n *\n * wrapped.last();\n * // => 3\n *\n * console.log(array);\n * // => [1, 2, 3]\n */\n function wrapperCommit() {\n return new LodashWrapper(this.value(), this.__chain__);\n }\n\n /**\n * Gets the next value on a wrapped object following the\n * [iterator protocol](https://mdn.io/iteration_protocols#iterator).\n *\n * @name next\n * @memberOf _\n * @since 4.0.0\n * @category Seq\n * @returns {Object} Returns the next iterator value.\n * @example\n *\n * var wrapped = _([1, 2]);\n *\n * wrapped.next();\n * // => { 'done': false, 'value': 1 }\n *\n * wrapped.next();\n * // => { 'done': false, 'value': 2 }\n *\n * wrapped.next();\n * // => { 'done': true, 'value': undefined }\n */\n function wrapperNext() {\n if (this.__values__ === undefined) {\n this.__values__ = toArray(this.value());\n }\n var done = this.__index__ >= this.__values__.length,\n value = done ? undefined : this.__values__[this.__index__++];\n\n return { 'done': done, 'value': value };\n }\n\n /**\n * Enables the wrapper to be iterable.\n *\n * @name Symbol.iterator\n * @memberOf _\n * @since 4.0.0\n * @category Seq\n * @returns {Object} Returns the wrapper object.\n * @example\n *\n * var wrapped = _([1, 2]);\n *\n * wrapped[Symbol.iterator]() === wrapped;\n * // => true\n *\n * Array.from(wrapped);\n * // => [1, 2]\n */\n function wrapperToIterator() {\n return this;\n }\n\n /**\n * Creates a clone of the chain sequence planting `value` as the wrapped value.\n *\n * @name plant\n * @memberOf _\n * @since 3.2.0\n * @category Seq\n * @param {*} value The value to plant.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var wrapped = _([1, 2]).map(square);\n * var other = wrapped.plant([3, 4]);\n *\n * other.value();\n * // => [9, 16]\n *\n * wrapped.value();\n * // => [1, 4]\n */\n function wrapperPlant(value) {\n var result,\n parent = this;\n\n while (parent instanceof baseLodash) {\n var clone = wrapperClone(parent);\n clone.__index__ = 0;\n clone.__values__ = undefined;\n if (result) {\n previous.__wrapped__ = clone;\n } else {\n result = clone;\n }\n var previous = clone;\n parent = parent.__wrapped__;\n }\n previous.__wrapped__ = value;\n return result;\n }\n\n /**\n * This method is the wrapper version of `_.reverse`.\n *\n * **Note:** This method mutates the wrapped array.\n *\n * @name reverse\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _(array).reverse().value()\n * // => [3, 2, 1]\n *\n * console.log(array);\n * // => [3, 2, 1]\n */\n function wrapperReverse() {\n var value = this.__wrapped__;\n if (value instanceof LazyWrapper) {\n var wrapped = value;\n if (this.__actions__.length) {\n wrapped = new LazyWrapper(this);\n }\n wrapped = wrapped.reverse();\n wrapped.__actions__.push({\n 'func': thru,\n 'args': [reverse],\n 'thisArg': undefined\n });\n return new LodashWrapper(wrapped, this.__chain__);\n }\n return this.thru(reverse);\n }\n\n /**\n * Executes the chain sequence to resolve the unwrapped value.\n *\n * @name value\n * @memberOf _\n * @since 0.1.0\n * @alias toJSON, valueOf\n * @category Seq\n * @returns {*} Returns the resolved unwrapped value.\n * @example\n *\n * _([1, 2, 3]).value();\n * // => [1, 2, 3]\n */\n function wrapperValue() {\n return baseWrapperValue(this.__wrapped__, this.__actions__);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The corresponding value of\n * each key is the number of times the key was returned by `iteratee`. The\n * iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * _.countBy([6.1, 4.2, 6.3], Math.floor);\n * // => { '4': 1, '6': 2 }\n *\n * // The `_.property` iteratee shorthand.\n * _.countBy(['one', 'two', 'three'], 'length');\n * // => { '3': 2, '5': 1 }\n */\n var countBy = createAggregator(function(result, value, key) {\n if (hasOwnProperty.call(result, key)) {\n ++result[key];\n } else {\n baseAssignValue(result, key, 1);\n }\n });\n\n /**\n * Checks if `predicate` returns truthy for **all** elements of `collection`.\n * Iteration is stopped once `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * **Note:** This method returns `true` for\n * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because\n * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of\n * elements of empty collections.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n * @example\n *\n * _.every([true, 1, null, 'yes'], Boolean);\n * // => false\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.every(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.every(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.every(users, 'active');\n * // => false\n */\n function every(collection, predicate, guard) {\n var func = isArray(collection) ? arrayEvery : baseEvery;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Iterates over elements of `collection`, returning an array of all elements\n * `predicate` returns truthy for. The predicate is invoked with three\n * arguments: (value, index|key, collection).\n *\n * **Note:** Unlike `_.remove`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n * @see _.reject\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * _.filter(users, function(o) { return !o.active; });\n * // => objects for ['fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.filter(users, { 'age': 36, 'active': true });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.filter(users, ['active', false]);\n * // => objects for ['fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.filter(users, 'active');\n * // => objects for ['barney']\n */\n function filter(collection, predicate) {\n var func = isArray(collection) ? arrayFilter : baseFilter;\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Iterates over elements of `collection`, returning the first element\n * `predicate` returns truthy for. The predicate is invoked with three\n * arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {*} Returns the matched element, else `undefined`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false },\n * { 'user': 'pebbles', 'age': 1, 'active': true }\n * ];\n *\n * _.find(users, function(o) { return o.age < 40; });\n * // => object for 'barney'\n *\n * // The `_.matches` iteratee shorthand.\n * _.find(users, { 'age': 1, 'active': true });\n * // => object for 'pebbles'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.find(users, ['active', false]);\n * // => object for 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.find(users, 'active');\n * // => object for 'barney'\n */\n var find = createFind(findIndex);\n\n /**\n * This method is like `_.find` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=collection.length-1] The index to search from.\n * @returns {*} Returns the matched element, else `undefined`.\n * @example\n *\n * _.findLast([1, 2, 3, 4], function(n) {\n * return n % 2 == 1;\n * });\n * // => 3\n */\n var findLast = createFind(findLastIndex);\n\n /**\n * Creates a flattened array of values by running each element in `collection`\n * thru `iteratee` and flattening the mapped results. The iteratee is invoked\n * with three arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [n, n];\n * }\n *\n * _.flatMap([1, 2], duplicate);\n * // => [1, 1, 2, 2]\n */\n function flatMap(collection, iteratee) {\n return baseFlatten(map(collection, iteratee), 1);\n }\n\n /**\n * This method is like `_.flatMap` except that it recursively flattens the\n * mapped results.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [[[n, n]]];\n * }\n *\n * _.flatMapDeep([1, 2], duplicate);\n * // => [1, 1, 2, 2]\n */\n function flatMapDeep(collection, iteratee) {\n return baseFlatten(map(collection, iteratee), INFINITY);\n }\n\n /**\n * This method is like `_.flatMap` except that it recursively flattens the\n * mapped results up to `depth` times.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {number} [depth=1] The maximum recursion depth.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [[[n, n]]];\n * }\n *\n * _.flatMapDepth([1, 2], duplicate, 2);\n * // => [[1, 1], [2, 2]]\n */\n function flatMapDepth(collection, iteratee, depth) {\n depth = depth === undefined ? 1 : toInteger(depth);\n return baseFlatten(map(collection, iteratee), depth);\n }\n\n /**\n * Iterates over elements of `collection` and invokes `iteratee` for each element.\n * The iteratee is invoked with three arguments: (value, index|key, collection).\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * **Note:** As with other \"Collections\" methods, objects with a \"length\"\n * property are iterated like arrays. To avoid this behavior use `_.forIn`\n * or `_.forOwn` for object iteration.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @alias each\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n * @see _.forEachRight\n * @example\n *\n * _.forEach([1, 2], function(value) {\n * console.log(value);\n * });\n * // => Logs `1` then `2`.\n *\n * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a' then 'b' (iteration order is not guaranteed).\n */\n function forEach(collection, iteratee) {\n var func = isArray(collection) ? arrayEach : baseEach;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.forEach` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @alias eachRight\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n * @see _.forEach\n * @example\n *\n * _.forEachRight([1, 2], function(value) {\n * console.log(value);\n * });\n * // => Logs `2` then `1`.\n */\n function forEachRight(collection, iteratee) {\n var func = isArray(collection) ? arrayEachRight : baseEachRight;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The order of grouped values\n * is determined by the order they occur in `collection`. The corresponding\n * value of each key is an array of elements responsible for generating the\n * key. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * _.groupBy([6.1, 4.2, 6.3], Math.floor);\n * // => { '4': [4.2], '6': [6.1, 6.3] }\n *\n * // The `_.property` iteratee shorthand.\n * _.groupBy(['one', 'two', 'three'], 'length');\n * // => { '3': ['one', 'two'], '5': ['three'] }\n */\n var groupBy = createAggregator(function(result, value, key) {\n if (hasOwnProperty.call(result, key)) {\n result[key].push(value);\n } else {\n baseAssignValue(result, key, [value]);\n }\n });\n\n /**\n * Checks if `value` is in `collection`. If `collection` is a string, it's\n * checked for a substring of `value`, otherwise\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * is used for equality comparisons. If `fromIndex` is negative, it's used as\n * the offset from the end of `collection`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object|string} collection The collection to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=0] The index to search from.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.\n * @returns {boolean} Returns `true` if `value` is found, else `false`.\n * @example\n *\n * _.includes([1, 2, 3], 1);\n * // => true\n *\n * _.includes([1, 2, 3], 1, 2);\n * // => false\n *\n * _.includes({ 'a': 1, 'b': 2 }, 1);\n * // => true\n *\n * _.includes('abcd', 'bc');\n * // => true\n */\n function includes(collection, value, fromIndex, guard) {\n collection = isArrayLike(collection) ? collection : values(collection);\n fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;\n\n var length = collection.length;\n if (fromIndex < 0) {\n fromIndex = nativeMax(length + fromIndex, 0);\n }\n return isString(collection)\n ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)\n : (!!length && baseIndexOf(collection, value, fromIndex) > -1);\n }\n\n /**\n * Invokes the method at `path` of each element in `collection`, returning\n * an array of the results of each invoked method. Any additional arguments\n * are provided to each invoked method. If `path` is a function, it's invoked\n * for, and `this` bound to, each element in `collection`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Array|Function|string} path The path of the method to invoke or\n * the function invoked per iteration.\n * @param {...*} [args] The arguments to invoke each method with.\n * @returns {Array} Returns the array of results.\n * @example\n *\n * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');\n * // => [[1, 5, 7], [1, 2, 3]]\n *\n * _.invokeMap([123, 456], String.prototype.split, '');\n * // => [['1', '2', '3'], ['4', '5', '6']]\n */\n var invokeMap = baseRest(function(collection, path, args) {\n var index = -1,\n isFunc = typeof path == 'function',\n result = isArrayLike(collection) ? Array(collection.length) : [];\n\n baseEach(collection, function(value) {\n result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);\n });\n return result;\n });\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The corresponding value of\n * each key is the last element responsible for generating the key. The\n * iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * var array = [\n * { 'dir': 'left', 'code': 97 },\n * { 'dir': 'right', 'code': 100 }\n * ];\n *\n * _.keyBy(array, function(o) {\n * return String.fromCharCode(o.code);\n * });\n * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }\n *\n * _.keyBy(array, 'dir');\n * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }\n */\n var keyBy = createAggregator(function(result, value, key) {\n baseAssignValue(result, key, value);\n });\n\n /**\n * Creates an array of values by running each element in `collection` thru\n * `iteratee`. The iteratee is invoked with three arguments:\n * (value, index|key, collection).\n *\n * Many lodash methods are guarded to work as iteratees for methods like\n * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.\n *\n * The guarded methods are:\n * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,\n * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,\n * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,\n * `template`, `trim`, `trimEnd`, `trimStart`, and `words`\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * _.map([4, 8], square);\n * // => [16, 64]\n *\n * _.map({ 'a': 4, 'b': 8 }, square);\n * // => [16, 64] (iteration order is not guaranteed)\n *\n * var users = [\n * { 'user': 'barney' },\n * { 'user': 'fred' }\n * ];\n *\n * // The `_.property` iteratee shorthand.\n * _.map(users, 'user');\n * // => ['barney', 'fred']\n */\n function map(collection, iteratee) {\n var func = isArray(collection) ? arrayMap : baseMap;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.sortBy` except that it allows specifying the sort\n * orders of the iteratees to sort by. If `orders` is unspecified, all values\n * are sorted in ascending order. Otherwise, specify an order of \"desc\" for\n * descending or \"asc\" for ascending sort order of corresponding values.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @param {string[]} [orders] The sort orders of `iteratees`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 34 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'barney', 'age': 36 }\n * ];\n *\n * // Sort by `user` in ascending order and by `age` in descending order.\n * _.orderBy(users, ['user', 'age'], ['asc', 'desc']);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]\n */\n function orderBy(collection, iteratees, orders, guard) {\n if (collection == null) {\n return [];\n }\n if (!isArray(iteratees)) {\n iteratees = iteratees == null ? [] : [iteratees];\n }\n orders = guard ? undefined : orders;\n if (!isArray(orders)) {\n orders = orders == null ? [] : [orders];\n }\n return baseOrderBy(collection, iteratees, orders);\n }\n\n /**\n * Creates an array of elements split into two groups, the first of which\n * contains elements `predicate` returns truthy for, the second of which\n * contains elements `predicate` returns falsey for. The predicate is\n * invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the array of grouped elements.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': true },\n * { 'user': 'pebbles', 'age': 1, 'active': false }\n * ];\n *\n * _.partition(users, function(o) { return o.active; });\n * // => objects for [['fred'], ['barney', 'pebbles']]\n *\n * // The `_.matches` iteratee shorthand.\n * _.partition(users, { 'age': 1, 'active': false });\n * // => objects for [['pebbles'], ['barney', 'fred']]\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.partition(users, ['active', false]);\n * // => objects for [['barney', 'pebbles'], ['fred']]\n *\n * // The `_.property` iteratee shorthand.\n * _.partition(users, 'active');\n * // => objects for [['fred'], ['barney', 'pebbles']]\n */\n var partition = createAggregator(function(result, value, key) {\n result[key ? 0 : 1].push(value);\n }, function() { return [[], []]; });\n\n /**\n * Reduces `collection` to a value which is the accumulated result of running\n * each element in `collection` thru `iteratee`, where each successive\n * invocation is supplied the return value of the previous. If `accumulator`\n * is not given, the first element of `collection` is used as the initial\n * value. The iteratee is invoked with four arguments:\n * (accumulator, value, index|key, collection).\n *\n * Many lodash methods are guarded to work as iteratees for methods like\n * `_.reduce`, `_.reduceRight`, and `_.transform`.\n *\n * The guarded methods are:\n * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,\n * and `sortBy`\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @returns {*} Returns the accumulated value.\n * @see _.reduceRight\n * @example\n *\n * _.reduce([1, 2], function(sum, n) {\n * return sum + n;\n * }, 0);\n * // => 3\n *\n * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {\n * (result[value] || (result[value] = [])).push(key);\n * return result;\n * }, {});\n * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)\n */\n function reduce(collection, iteratee, accumulator) {\n var func = isArray(collection) ? arrayReduce : baseReduce,\n initAccum = arguments.length < 3;\n\n return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);\n }\n\n /**\n * This method is like `_.reduce` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @returns {*} Returns the accumulated value.\n * @see _.reduce\n * @example\n *\n * var array = [[0, 1], [2, 3], [4, 5]];\n *\n * _.reduceRight(array, function(flattened, other) {\n * return flattened.concat(other);\n * }, []);\n * // => [4, 5, 2, 3, 0, 1]\n */\n function reduceRight(collection, iteratee, accumulator) {\n var func = isArray(collection) ? arrayReduceRight : baseReduce,\n initAccum = arguments.length < 3;\n\n return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);\n }\n\n /**\n * The opposite of `_.filter`; this method returns the elements of `collection`\n * that `predicate` does **not** return truthy for.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n * @see _.filter\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': true }\n * ];\n *\n * _.reject(users, function(o) { return !o.active; });\n * // => objects for ['fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.reject(users, { 'age': 40, 'active': true });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.reject(users, ['active', false]);\n * // => objects for ['fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.reject(users, 'active');\n * // => objects for ['barney']\n */\n function reject(collection, predicate) {\n var func = isArray(collection) ? arrayFilter : baseFilter;\n return func(collection, negate(getIteratee(predicate, 3)));\n }\n\n /**\n * Gets a random element from `collection`.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to sample.\n * @returns {*} Returns the random element.\n * @example\n *\n * _.sample([1, 2, 3, 4]);\n * // => 2\n */\n function sample(collection) {\n var func = isArray(collection) ? arraySample : baseSample;\n return func(collection);\n }\n\n /**\n * Gets `n` random elements at unique keys from `collection` up to the\n * size of `collection`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to sample.\n * @param {number} [n=1] The number of elements to sample.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the random elements.\n * @example\n *\n * _.sampleSize([1, 2, 3], 2);\n * // => [3, 1]\n *\n * _.sampleSize([1, 2, 3], 4);\n * // => [2, 3, 1]\n */\n function sampleSize(collection, n, guard) {\n if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {\n n = 1;\n } else {\n n = toInteger(n);\n }\n var func = isArray(collection) ? arraySampleSize : baseSampleSize;\n return func(collection, n);\n }\n\n /**\n * Creates an array of shuffled values, using a version of the\n * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to shuffle.\n * @returns {Array} Returns the new shuffled array.\n * @example\n *\n * _.shuffle([1, 2, 3, 4]);\n * // => [4, 1, 3, 2]\n */\n function shuffle(collection) {\n var func = isArray(collection) ? arrayShuffle : baseShuffle;\n return func(collection);\n }\n\n /**\n * Gets the size of `collection` by returning its length for array-like\n * values or the number of own enumerable string keyed properties for objects.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object|string} collection The collection to inspect.\n * @returns {number} Returns the collection size.\n * @example\n *\n * _.size([1, 2, 3]);\n * // => 3\n *\n * _.size({ 'a': 1, 'b': 2 });\n * // => 2\n *\n * _.size('pebbles');\n * // => 7\n */\n function size(collection) {\n if (collection == null) {\n return 0;\n }\n if (isArrayLike(collection)) {\n return isString(collection) ? stringSize(collection) : collection.length;\n }\n var tag = getTag(collection);\n if (tag == mapTag || tag == setTag) {\n return collection.size;\n }\n return baseKeys(collection).length;\n }\n\n /**\n * Checks if `predicate` returns truthy for **any** element of `collection`.\n * Iteration is stopped once `predicate` returns truthy. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n * @example\n *\n * _.some([null, 0, 'yes', false], Boolean);\n * // => true\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.some(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.some(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.some(users, 'active');\n * // => true\n */\n function some(collection, predicate, guard) {\n var func = isArray(collection) ? arraySome : baseSome;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Creates an array of elements, sorted in ascending order by the results of\n * running each element in a collection thru each iteratee. This method\n * performs a stable sort, that is, it preserves the original sort order of\n * equal elements. The iteratees are invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {...(Function|Function[])} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'barney', 'age': 34 }\n * ];\n *\n * _.sortBy(users, [function(o) { return o.user; }]);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]\n *\n * _.sortBy(users, ['user', 'age']);\n * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]]\n */\n var sortBy = baseRest(function(collection, iteratees) {\n if (collection == null) {\n return [];\n }\n var length = iteratees.length;\n if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {\n iteratees = [];\n } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {\n iteratees = [iteratees[0]];\n }\n return baseOrderBy(collection, baseFlatten(iteratees, 1), []);\n });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Gets the timestamp of the number of milliseconds that have elapsed since\n * the Unix epoch (1 January 1970 00:00:00 UTC).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Date\n * @returns {number} Returns the timestamp.\n * @example\n *\n * _.defer(function(stamp) {\n * console.log(_.now() - stamp);\n * }, _.now());\n * // => Logs the number of milliseconds it took for the deferred invocation.\n */\n var now = ctxNow || function() {\n return root.Date.now();\n };\n\n /*------------------------------------------------------------------------*/\n\n /**\n * The opposite of `_.before`; this method creates a function that invokes\n * `func` once it's called `n` or more times.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {number} n The number of calls before `func` is invoked.\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * var saves = ['profile', 'settings'];\n *\n * var done = _.after(saves.length, function() {\n * console.log('done saving!');\n * });\n *\n * _.forEach(saves, function(type) {\n * asyncSave({ 'type': type, 'complete': done });\n * });\n * // => Logs 'done saving!' after the two async saves have completed.\n */\n function after(n, func) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n n = toInteger(n);\n return function() {\n if (--n < 1) {\n return func.apply(this, arguments);\n }\n };\n }\n\n /**\n * Creates a function that invokes `func`, with up to `n` arguments,\n * ignoring any additional arguments.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to cap arguments for.\n * @param {number} [n=func.length] The arity cap.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new capped function.\n * @example\n *\n * _.map(['6', '8', '10'], _.ary(parseInt, 1));\n * // => [6, 8, 10]\n */\n function ary(func, n, guard) {\n n = guard ? undefined : n;\n n = (func && n == null) ? func.length : n;\n return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);\n }\n\n /**\n * Creates a function that invokes `func`, with the `this` binding and arguments\n * of the created function, while it's called less than `n` times. Subsequent\n * calls to the created function return the result of the last `func` invocation.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {number} n The number of calls at which `func` is no longer invoked.\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * jQuery(element).on('click', _.before(5, addContactToList));\n * // => Allows adding up to 4 contacts to the list.\n */\n function before(n, func) {\n var result;\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n n = toInteger(n);\n return function() {\n if (--n > 0) {\n result = func.apply(this, arguments);\n }\n if (n <= 1) {\n func = undefined;\n }\n return result;\n };\n }\n\n /**\n * Creates a function that invokes `func` with the `this` binding of `thisArg`\n * and `partials` prepended to the arguments it receives.\n *\n * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,\n * may be used as a placeholder for partially applied arguments.\n *\n * **Note:** Unlike native `Function#bind`, this method doesn't set the \"length\"\n * property of bound functions.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to bind.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new bound function.\n * @example\n *\n * function greet(greeting, punctuation) {\n * return greeting + ' ' + this.user + punctuation;\n * }\n *\n * var object = { 'user': 'fred' };\n *\n * var bound = _.bind(greet, object, 'hi');\n * bound('!');\n * // => 'hi fred!'\n *\n * // Bound with placeholders.\n * var bound = _.bind(greet, object, _, '!');\n * bound('hi');\n * // => 'hi fred!'\n */\n var bind = baseRest(function(func, thisArg, partials) {\n var bitmask = WRAP_BIND_FLAG;\n if (partials.length) {\n var holders = replaceHolders(partials, getHolder(bind));\n bitmask |= WRAP_PARTIAL_FLAG;\n }\n return createWrap(func, bitmask, thisArg, partials, holders);\n });\n\n /**\n * Creates a function that invokes the method at `object[key]` with `partials`\n * prepended to the arguments it receives.\n *\n * This method differs from `_.bind` by allowing bound functions to reference\n * methods that may be redefined or don't yet exist. See\n * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)\n * for more details.\n *\n * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * @static\n * @memberOf _\n * @since 0.10.0\n * @category Function\n * @param {Object} object The object to invoke the method on.\n * @param {string} key The key of the method.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new bound function.\n * @example\n *\n * var object = {\n * 'user': 'fred',\n * 'greet': function(greeting, punctuation) {\n * return greeting + ' ' + this.user + punctuation;\n * }\n * };\n *\n * var bound = _.bindKey(object, 'greet', 'hi');\n * bound('!');\n * // => 'hi fred!'\n *\n * object.greet = function(greeting, punctuation) {\n * return greeting + 'ya ' + this.user + punctuation;\n * };\n *\n * bound('!');\n * // => 'hiya fred!'\n *\n * // Bound with placeholders.\n * var bound = _.bindKey(object, 'greet', _, '!');\n * bound('hi');\n * // => 'hiya fred!'\n */\n var bindKey = baseRest(function(object, key, partials) {\n var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;\n if (partials.length) {\n var holders = replaceHolders(partials, getHolder(bindKey));\n bitmask |= WRAP_PARTIAL_FLAG;\n }\n return createWrap(key, bitmask, object, partials, holders);\n });\n\n /**\n * Creates a function that accepts arguments of `func` and either invokes\n * `func` returning its result, if at least `arity` number of arguments have\n * been provided, or returns a function that accepts the remaining `func`\n * arguments, and so on. The arity of `func` may be specified if `func.length`\n * is not sufficient.\n *\n * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,\n * may be used as a placeholder for provided arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of curried functions.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Function\n * @param {Function} func The function to curry.\n * @param {number} [arity=func.length] The arity of `func`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new curried function.\n * @example\n *\n * var abc = function(a, b, c) {\n * return [a, b, c];\n * };\n *\n * var curried = _.curry(abc);\n *\n * curried(1)(2)(3);\n * // => [1, 2, 3]\n *\n * curried(1, 2)(3);\n * // => [1, 2, 3]\n *\n * curried(1, 2, 3);\n * // => [1, 2, 3]\n *\n * // Curried with placeholders.\n * curried(1)(_, 3)(2);\n * // => [1, 2, 3]\n */\n function curry(func, arity, guard) {\n arity = guard ? undefined : arity;\n var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);\n result.placeholder = curry.placeholder;\n return result;\n }\n\n /**\n * This method is like `_.curry` except that arguments are applied to `func`\n * in the manner of `_.partialRight` instead of `_.partial`.\n *\n * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for provided arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of curried functions.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to curry.\n * @param {number} [arity=func.length] The arity of `func`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new curried function.\n * @example\n *\n * var abc = function(a, b, c) {\n * return [a, b, c];\n * };\n *\n * var curried = _.curryRight(abc);\n *\n * curried(3)(2)(1);\n * // => [1, 2, 3]\n *\n * curried(2, 3)(1);\n * // => [1, 2, 3]\n *\n * curried(1, 2, 3);\n * // => [1, 2, 3]\n *\n * // Curried with placeholders.\n * curried(3)(1, _)(2);\n * // => [1, 2, 3]\n */\n function curryRight(func, arity, guard) {\n arity = guard ? undefined : arity;\n var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);\n result.placeholder = curryRight.placeholder;\n return result;\n }\n\n /**\n * Creates a debounced function that delays invoking `func` until after `wait`\n * milliseconds have elapsed since the last time the debounced function was\n * invoked. The debounced function comes with a `cancel` method to cancel\n * delayed `func` invocations and a `flush` method to immediately invoke them.\n * Provide `options` to indicate whether `func` should be invoked on the\n * leading and/or trailing edge of the `wait` timeout. The `func` is invoked\n * with the last arguments provided to the debounced function. Subsequent\n * calls to the debounced function return the result of the last `func`\n * invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the debounced function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.debounce` and `_.throttle`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to debounce.\n * @param {number} [wait=0] The number of milliseconds to delay.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=false]\n * Specify invoking on the leading edge of the timeout.\n * @param {number} [options.maxWait]\n * The maximum time `func` is allowed to be delayed before it's invoked.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new debounced function.\n * @example\n *\n * // Avoid costly calculations while the window size is in flux.\n * jQuery(window).on('resize', _.debounce(calculateLayout, 150));\n *\n * // Invoke `sendMail` when clicked, debouncing subsequent calls.\n * jQuery(element).on('click', _.debounce(sendMail, 300, {\n * 'leading': true,\n * 'trailing': false\n * }));\n *\n * // Ensure `batchLog` is invoked once after 1 second of debounced calls.\n * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });\n * var source = new EventSource('/stream');\n * jQuery(source).on('message', debounced);\n *\n * // Cancel the trailing debounced invocation.\n * jQuery(window).on('popstate', debounced.cancel);\n */\n function debounce(func, wait, options) {\n var lastArgs,\n lastThis,\n maxWait,\n result,\n timerId,\n lastCallTime,\n lastInvokeTime = 0,\n leading = false,\n maxing = false,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n wait = toNumber(wait) || 0;\n if (isObject(options)) {\n leading = !!options.leading;\n maxing = 'maxWait' in options;\n maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n\n function invokeFunc(time) {\n var args = lastArgs,\n thisArg = lastThis;\n\n lastArgs = lastThis = undefined;\n lastInvokeTime = time;\n result = func.apply(thisArg, args);\n return result;\n }\n\n function leadingEdge(time) {\n // Reset any `maxWait` timer.\n lastInvokeTime = time;\n // Start the timer for the trailing edge.\n timerId = setTimeout(timerExpired, wait);\n // Invoke the leading edge.\n return leading ? invokeFunc(time) : result;\n }\n\n function remainingWait(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime,\n result = wait - timeSinceLastCall;\n\n return maxing ? nativeMin(result, maxWait - timeSinceLastInvoke) : result;\n }\n\n function shouldInvoke(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime;\n\n // Either this is the first call, activity has stopped and we're at the\n // trailing edge, the system time has gone backwards and we're treating\n // it as the trailing edge, or we've hit the `maxWait` limit.\n return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||\n (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));\n }\n\n function timerExpired() {\n var time = now();\n if (shouldInvoke(time)) {\n return trailingEdge(time);\n }\n // Restart the timer.\n timerId = setTimeout(timerExpired, remainingWait(time));\n }\n\n function trailingEdge(time) {\n timerId = undefined;\n\n // Only invoke if we have `lastArgs` which means `func` has been\n // debounced at least once.\n if (trailing && lastArgs) {\n return invokeFunc(time);\n }\n lastArgs = lastThis = undefined;\n return result;\n }\n\n function cancel() {\n if (timerId !== undefined) {\n clearTimeout(timerId);\n }\n lastInvokeTime = 0;\n lastArgs = lastCallTime = lastThis = timerId = undefined;\n }\n\n function flush() {\n return timerId === undefined ? result : trailingEdge(now());\n }\n\n function debounced() {\n var time = now(),\n isInvoking = shouldInvoke(time);\n\n lastArgs = arguments;\n lastThis = this;\n lastCallTime = time;\n\n if (isInvoking) {\n if (timerId === undefined) {\n return leadingEdge(lastCallTime);\n }\n if (maxing) {\n // Handle invocations in a tight loop.\n timerId = setTimeout(timerExpired, wait);\n return invokeFunc(lastCallTime);\n }\n }\n if (timerId === undefined) {\n timerId = setTimeout(timerExpired, wait);\n }\n return result;\n }\n debounced.cancel = cancel;\n debounced.flush = flush;\n return debounced;\n }\n\n /**\n * Defers invoking the `func` until the current call stack has cleared. Any\n * additional arguments are provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to defer.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {number} Returns the timer id.\n * @example\n *\n * _.defer(function(text) {\n * console.log(text);\n * }, 'deferred');\n * // => Logs 'deferred' after one millisecond.\n */\n var defer = baseRest(function(func, args) {\n return baseDelay(func, 1, args);\n });\n\n /**\n * Invokes `func` after `wait` milliseconds. Any additional arguments are\n * provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {number} Returns the timer id.\n * @example\n *\n * _.delay(function(text) {\n * console.log(text);\n * }, 1000, 'later');\n * // => Logs 'later' after one second.\n */\n var delay = baseRest(function(func, wait, args) {\n return baseDelay(func, toNumber(wait) || 0, args);\n });\n\n /**\n * Creates a function that invokes `func` with arguments reversed.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to flip arguments for.\n * @returns {Function} Returns the new flipped function.\n * @example\n *\n * var flipped = _.flip(function() {\n * return _.toArray(arguments);\n * });\n *\n * flipped('a', 'b', 'c', 'd');\n * // => ['d', 'c', 'b', 'a']\n */\n function flip(func) {\n return createWrap(func, WRAP_FLIP_FLAG);\n }\n\n /**\n * Creates a function that memoizes the result of `func`. If `resolver` is\n * provided, it determines the cache key for storing the result based on the\n * arguments provided to the memoized function. By default, the first argument\n * provided to the memoized function is used as the map cache key. The `func`\n * is invoked with the `this` binding of the memoized function.\n *\n * **Note:** The cache is exposed as the `cache` property on the memoized\n * function. Its creation may be customized by replacing the `_.memoize.Cache`\n * constructor with one whose instances implement the\n * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)\n * method interface of `clear`, `delete`, `get`, `has`, and `set`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to have its output memoized.\n * @param {Function} [resolver] The function to resolve the cache key.\n * @returns {Function} Returns the new memoized function.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n * var other = { 'c': 3, 'd': 4 };\n *\n * var values = _.memoize(_.values);\n * values(object);\n * // => [1, 2]\n *\n * values(other);\n * // => [3, 4]\n *\n * object.a = 2;\n * values(object);\n * // => [1, 2]\n *\n * // Modify the result cache.\n * values.cache.set(object, ['a', 'b']);\n * values(object);\n * // => ['a', 'b']\n *\n * // Replace `_.memoize.Cache`.\n * _.memoize.Cache = WeakMap;\n */\n function memoize(func, resolver) {\n if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n var memoized = function() {\n var args = arguments,\n key = resolver ? resolver.apply(this, args) : args[0],\n cache = memoized.cache;\n\n if (cache.has(key)) {\n return cache.get(key);\n }\n var result = func.apply(this, args);\n memoized.cache = cache.set(key, result) || cache;\n return result;\n };\n memoized.cache = new (memoize.Cache || MapCache);\n return memoized;\n }\n\n // Expose `MapCache`.\n memoize.Cache = MapCache;\n\n /**\n * Creates a function that negates the result of the predicate `func`. The\n * `func` predicate is invoked with the `this` binding and arguments of the\n * created function.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} predicate The predicate to negate.\n * @returns {Function} Returns the new negated function.\n * @example\n *\n * function isEven(n) {\n * return n % 2 == 0;\n * }\n *\n * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));\n * // => [1, 3, 5]\n */\n function negate(predicate) {\n if (typeof predicate != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return function() {\n var args = arguments;\n switch (args.length) {\n case 0: return !predicate.call(this);\n case 1: return !predicate.call(this, args[0]);\n case 2: return !predicate.call(this, args[0], args[1]);\n case 3: return !predicate.call(this, args[0], args[1], args[2]);\n }\n return !predicate.apply(this, args);\n };\n }\n\n /**\n * Creates a function that is restricted to invoking `func` once. Repeat calls\n * to the function return the value of the first invocation. The `func` is\n * invoked with the `this` binding and arguments of the created function.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * var initialize = _.once(createApplication);\n * initialize();\n * initialize();\n * // => `createApplication` is invoked once\n */\n function once(func) {\n return before(2, func);\n }\n\n /**\n * Creates a function that invokes `func` with its arguments transformed.\n *\n * @static\n * @since 4.0.0\n * @memberOf _\n * @category Function\n * @param {Function} func The function to wrap.\n * @param {...(Function|Function[])} [transforms=[_.identity]]\n * The argument transforms.\n * @returns {Function} Returns the new function.\n * @example\n *\n * function doubled(n) {\n * return n * 2;\n * }\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var func = _.overArgs(function(x, y) {\n * return [x, y];\n * }, [square, doubled]);\n *\n * func(9, 3);\n * // => [81, 6]\n *\n * func(10, 5);\n * // => [100, 10]\n */\n var overArgs = castRest(function(func, transforms) {\n transforms = (transforms.length == 1 && isArray(transforms[0]))\n ? arrayMap(transforms[0], baseUnary(getIteratee()))\n : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));\n\n var funcsLength = transforms.length;\n return baseRest(function(args) {\n var index = -1,\n length = nativeMin(args.length, funcsLength);\n\n while (++index < length) {\n args[index] = transforms[index].call(this, args[index]);\n }\n return apply(func, this, args);\n });\n });\n\n /**\n * Creates a function that invokes `func` with `partials` prepended to the\n * arguments it receives. This method is like `_.bind` except it does **not**\n * alter the `this` binding.\n *\n * The `_.partial.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of partially\n * applied functions.\n *\n * @static\n * @memberOf _\n * @since 0.2.0\n * @category Function\n * @param {Function} func The function to partially apply arguments to.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new partially applied function.\n * @example\n *\n * function greet(greeting, name) {\n * return greeting + ' ' + name;\n * }\n *\n * var sayHelloTo = _.partial(greet, 'hello');\n * sayHelloTo('fred');\n * // => 'hello fred'\n *\n * // Partially applied with placeholders.\n * var greetFred = _.partial(greet, _, 'fred');\n * greetFred('hi');\n * // => 'hi fred'\n */\n var partial = baseRest(function(func, partials) {\n var holders = replaceHolders(partials, getHolder(partial));\n return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);\n });\n\n /**\n * This method is like `_.partial` except that partially applied arguments\n * are appended to the arguments it receives.\n *\n * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of partially\n * applied functions.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Function\n * @param {Function} func The function to partially apply arguments to.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new partially applied function.\n * @example\n *\n * function greet(greeting, name) {\n * return greeting + ' ' + name;\n * }\n *\n * var greetFred = _.partialRight(greet, 'fred');\n * greetFred('hi');\n * // => 'hi fred'\n *\n * // Partially applied with placeholders.\n * var sayHelloTo = _.partialRight(greet, 'hello', _);\n * sayHelloTo('fred');\n * // => 'hello fred'\n */\n var partialRight = baseRest(function(func, partials) {\n var holders = replaceHolders(partials, getHolder(partialRight));\n return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);\n });\n\n /**\n * Creates a function that invokes `func` with arguments arranged according\n * to the specified `indexes` where the argument value at the first index is\n * provided as the first argument, the argument value at the second index is\n * provided as the second argument, and so on.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to rearrange arguments for.\n * @param {...(number|number[])} indexes The arranged argument indexes.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var rearged = _.rearg(function(a, b, c) {\n * return [a, b, c];\n * }, [2, 0, 1]);\n *\n * rearged('b', 'c', 'a')\n * // => ['a', 'b', 'c']\n */\n var rearg = flatRest(function(func, indexes) {\n return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);\n });\n\n /**\n * Creates a function that invokes `func` with the `this` binding of the\n * created function and arguments from `start` and beyond provided as\n * an array.\n *\n * **Note:** This method is based on the\n * [rest parameter](https://mdn.io/rest_parameters).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var say = _.rest(function(what, names) {\n * return what + ' ' + _.initial(names).join(', ') +\n * (_.size(names) > 1 ? ', & ' : '') + _.last(names);\n * });\n *\n * say('hello', 'fred', 'barney', 'pebbles');\n * // => 'hello fred, barney, & pebbles'\n */\n function rest(func, start) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n start = start === undefined ? start : toInteger(start);\n return baseRest(func, start);\n }\n\n /**\n * Creates a function that invokes `func` with the `this` binding of the\n * create function and an array of arguments much like\n * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).\n *\n * **Note:** This method is based on the\n * [spread operator](https://mdn.io/spread_operator).\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Function\n * @param {Function} func The function to spread arguments over.\n * @param {number} [start=0] The start position of the spread.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var say = _.spread(function(who, what) {\n * return who + ' says ' + what;\n * });\n *\n * say(['fred', 'hello']);\n * // => 'fred says hello'\n *\n * var numbers = Promise.all([\n * Promise.resolve(40),\n * Promise.resolve(36)\n * ]);\n *\n * numbers.then(_.spread(function(x, y) {\n * return x + y;\n * }));\n * // => a Promise of 76\n */\n function spread(func, start) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n start = start == null ? 0 : nativeMax(toInteger(start), 0);\n return baseRest(function(args) {\n var array = args[start],\n otherArgs = castSlice(args, 0, start);\n\n if (array) {\n arrayPush(otherArgs, array);\n }\n return apply(func, this, otherArgs);\n });\n }\n\n /**\n * Creates a throttled function that only invokes `func` at most once per\n * every `wait` milliseconds. The throttled function comes with a `cancel`\n * method to cancel delayed `func` invocations and a `flush` method to\n * immediately invoke them. Provide `options` to indicate whether `func`\n * should be invoked on the leading and/or trailing edge of the `wait`\n * timeout. The `func` is invoked with the last arguments provided to the\n * throttled function. Subsequent calls to the throttled function return the\n * result of the last `func` invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the throttled function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.throttle` and `_.debounce`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to throttle.\n * @param {number} [wait=0] The number of milliseconds to throttle invocations to.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=true]\n * Specify invoking on the leading edge of the timeout.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new throttled function.\n * @example\n *\n * // Avoid excessively updating the position while scrolling.\n * jQuery(window).on('scroll', _.throttle(updatePosition, 100));\n *\n * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.\n * var throttled = _.throttle(renewToken, 300000, { 'trailing': false });\n * jQuery(element).on('click', throttled);\n *\n * // Cancel the trailing throttled invocation.\n * jQuery(window).on('popstate', throttled.cancel);\n */\n function throttle(func, wait, options) {\n var leading = true,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n if (isObject(options)) {\n leading = 'leading' in options ? !!options.leading : leading;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n return debounce(func, wait, {\n 'leading': leading,\n 'maxWait': wait,\n 'trailing': trailing\n });\n }\n\n /**\n * Creates a function that accepts up to one argument, ignoring any\n * additional arguments.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n * @example\n *\n * _.map(['6', '8', '10'], _.unary(parseInt));\n * // => [6, 8, 10]\n */\n function unary(func) {\n return ary(func, 1);\n }\n\n /**\n * Creates a function that provides `value` to `wrapper` as its first\n * argument. Any additional arguments provided to the function are appended\n * to those provided to the `wrapper`. The wrapper is invoked with the `this`\n * binding of the created function.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {*} value The value to wrap.\n * @param {Function} [wrapper=identity] The wrapper function.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var p = _.wrap(_.escape, function(func, text) {\n * return '<p>' + func(text) + '</p>';\n * });\n *\n * p('fred, barney, & pebbles');\n * // => '<p>fred, barney, &amp; pebbles</p>'\n */\n function wrap(value, wrapper) {\n return partial(castFunction(wrapper), value);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Casts `value` as an array if it's not one.\n *\n * @static\n * @memberOf _\n * @since 4.4.0\n * @category Lang\n * @param {*} value The value to inspect.\n * @returns {Array} Returns the cast array.\n * @example\n *\n * _.castArray(1);\n * // => [1]\n *\n * _.castArray({ 'a': 1 });\n * // => [{ 'a': 1 }]\n *\n * _.castArray('abc');\n * // => ['abc']\n *\n * _.castArray(null);\n * // => [null]\n *\n * _.castArray(undefined);\n * // => [undefined]\n *\n * _.castArray();\n * // => []\n *\n * var array = [1, 2, 3];\n * console.log(_.castArray(array) === array);\n * // => true\n */\n function castArray() {\n if (!arguments.length) {\n return [];\n }\n var value = arguments[0];\n return isArray(value) ? value : [value];\n }\n\n /**\n * Creates a shallow clone of `value`.\n *\n * **Note:** This method is loosely based on the\n * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)\n * and supports cloning arrays, array buffers, booleans, date objects, maps,\n * numbers, `Object` objects, regexes, sets, strings, symbols, and typed\n * arrays. The own enumerable properties of `arguments` objects are cloned\n * as plain objects. An empty object is returned for uncloneable values such\n * as error objects, functions, DOM nodes, and WeakMaps.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to clone.\n * @returns {*} Returns the cloned value.\n * @see _.cloneDeep\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var shallow = _.clone(objects);\n * console.log(shallow[0] === objects[0]);\n * // => true\n */\n function clone(value) {\n return baseClone(value, CLONE_SYMBOLS_FLAG);\n }\n\n /**\n * This method is like `_.clone` except that it accepts `customizer` which\n * is invoked to produce the cloned value. If `customizer` returns `undefined`,\n * cloning is handled by the method instead. The `customizer` is invoked with\n * up to four arguments; (value [, index|key, object, stack]).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to clone.\n * @param {Function} [customizer] The function to customize cloning.\n * @returns {*} Returns the cloned value.\n * @see _.cloneDeepWith\n * @example\n *\n * function customizer(value) {\n * if (_.isElement(value)) {\n * return value.cloneNode(false);\n * }\n * }\n *\n * var el = _.cloneWith(document.body, customizer);\n *\n * console.log(el === document.body);\n * // => false\n * console.log(el.nodeName);\n * // => 'BODY'\n * console.log(el.childNodes.length);\n * // => 0\n */\n function cloneWith(value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);\n }\n\n /**\n * This method is like `_.clone` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @returns {*} Returns the deep cloned value.\n * @see _.clone\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var deep = _.cloneDeep(objects);\n * console.log(deep[0] === objects[0]);\n * // => false\n */\n function cloneDeep(value) {\n return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);\n }\n\n /**\n * This method is like `_.cloneWith` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @param {Function} [customizer] The function to customize cloning.\n * @returns {*} Returns the deep cloned value.\n * @see _.cloneWith\n * @example\n *\n * function customizer(value) {\n * if (_.isElement(value)) {\n * return value.cloneNode(true);\n * }\n * }\n *\n * var el = _.cloneDeepWith(document.body, customizer);\n *\n * console.log(el === document.body);\n * // => false\n * console.log(el.nodeName);\n * // => 'BODY'\n * console.log(el.childNodes.length);\n * // => 20\n */\n function cloneDeepWith(value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);\n }\n\n /**\n * Checks if `object` conforms to `source` by invoking the predicate\n * properties of `source` with the corresponding property values of `object`.\n *\n * **Note:** This method is equivalent to `_.conforms` when `source` is\n * partially applied.\n *\n * @static\n * @memberOf _\n * @since 4.14.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property predicates to conform to.\n * @returns {boolean} Returns `true` if `object` conforms, else `false`.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n *\n * _.conformsTo(object, { 'b': function(n) { return n > 1; } });\n * // => true\n *\n * _.conformsTo(object, { 'b': function(n) { return n > 2; } });\n * // => false\n */\n function conformsTo(object, source) {\n return source == null || baseConformsTo(object, source, keys(source));\n }\n\n /**\n * Performs a\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * comparison between two values to determine if they are equivalent.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.eq(object, object);\n * // => true\n *\n * _.eq(object, other);\n * // => false\n *\n * _.eq('a', 'a');\n * // => true\n *\n * _.eq('a', Object('a'));\n * // => false\n *\n * _.eq(NaN, NaN);\n * // => true\n */\n function eq(value, other) {\n return value === other || (value !== value && other !== other);\n }\n\n /**\n * Checks if `value` is greater than `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than `other`,\n * else `false`.\n * @see _.lt\n * @example\n *\n * _.gt(3, 1);\n * // => true\n *\n * _.gt(3, 3);\n * // => false\n *\n * _.gt(1, 3);\n * // => false\n */\n var gt = createRelationalOperation(baseGt);\n\n /**\n * Checks if `value` is greater than or equal to `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than or equal to\n * `other`, else `false`.\n * @see _.lte\n * @example\n *\n * _.gte(3, 1);\n * // => true\n *\n * _.gte(3, 3);\n * // => true\n *\n * _.gte(1, 3);\n * // => false\n */\n var gte = createRelationalOperation(function(value, other) {\n return value >= other;\n });\n\n /**\n * Checks if `value` is likely an `arguments` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n * else `false`.\n * @example\n *\n * _.isArguments(function() { return arguments; }());\n * // => true\n *\n * _.isArguments([1, 2, 3]);\n * // => false\n */\n var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {\n return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&\n !propertyIsEnumerable.call(value, 'callee');\n };\n\n /**\n * Checks if `value` is classified as an `Array` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array, else `false`.\n * @example\n *\n * _.isArray([1, 2, 3]);\n * // => true\n *\n * _.isArray(document.body.children);\n * // => false\n *\n * _.isArray('abc');\n * // => false\n *\n * _.isArray(_.noop);\n * // => false\n */\n var isArray = Array.isArray;\n\n /**\n * Checks if `value` is classified as an `ArrayBuffer` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.\n * @example\n *\n * _.isArrayBuffer(new ArrayBuffer(2));\n * // => true\n *\n * _.isArrayBuffer(new Array(2));\n * // => false\n */\n var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;\n\n /**\n * Checks if `value` is array-like. A value is considered array-like if it's\n * not a function and has a `value.length` that's an integer greater than or\n * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is array-like, else `false`.\n * @example\n *\n * _.isArrayLike([1, 2, 3]);\n * // => true\n *\n * _.isArrayLike(document.body.children);\n * // => true\n *\n * _.isArrayLike('abc');\n * // => true\n *\n * _.isArrayLike(_.noop);\n * // => false\n */\n function isArrayLike(value) {\n return value != null && isLength(value.length) && !isFunction(value);\n }\n\n /**\n * This method is like `_.isArrayLike` except that it also checks if `value`\n * is an object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array-like object,\n * else `false`.\n * @example\n *\n * _.isArrayLikeObject([1, 2, 3]);\n * // => true\n *\n * _.isArrayLikeObject(document.body.children);\n * // => true\n *\n * _.isArrayLikeObject('abc');\n * // => false\n *\n * _.isArrayLikeObject(_.noop);\n * // => false\n */\n function isArrayLikeObject(value) {\n return isObjectLike(value) && isArrayLike(value);\n }\n\n /**\n * Checks if `value` is classified as a boolean primitive or object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a boolean, else `false`.\n * @example\n *\n * _.isBoolean(false);\n * // => true\n *\n * _.isBoolean(null);\n * // => false\n */\n function isBoolean(value) {\n return value === true || value === false ||\n (isObjectLike(value) && baseGetTag(value) == boolTag);\n }\n\n /**\n * Checks if `value` is a buffer.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.\n * @example\n *\n * _.isBuffer(new Buffer(2));\n * // => true\n *\n * _.isBuffer(new Uint8Array(2));\n * // => false\n */\n var isBuffer = nativeIsBuffer || stubFalse;\n\n /**\n * Checks if `value` is classified as a `Date` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a date object, else `false`.\n * @example\n *\n * _.isDate(new Date);\n * // => true\n *\n * _.isDate('Mon April 23 2012');\n * // => false\n */\n var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;\n\n /**\n * Checks if `value` is likely a DOM element.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.\n * @example\n *\n * _.isElement(document.body);\n * // => true\n *\n * _.isElement('<body>');\n * // => false\n */\n function isElement(value) {\n return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);\n }\n\n /**\n * Checks if `value` is an empty object, collection, map, or set.\n *\n * Objects are considered empty if they have no own enumerable string keyed\n * properties.\n *\n * Array-like values such as `arguments` objects, arrays, buffers, strings, or\n * jQuery-like collections are considered empty if they have a `length` of `0`.\n * Similarly, maps and sets are considered empty if they have a `size` of `0`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is empty, else `false`.\n * @example\n *\n * _.isEmpty(null);\n * // => true\n *\n * _.isEmpty(true);\n * // => true\n *\n * _.isEmpty(1);\n * // => true\n *\n * _.isEmpty([1, 2, 3]);\n * // => false\n *\n * _.isEmpty({ 'a': 1 });\n * // => false\n */\n function isEmpty(value) {\n if (value == null) {\n return true;\n }\n if (isArrayLike(value) &&\n (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||\n isBuffer(value) || isTypedArray(value) || isArguments(value))) {\n return !value.length;\n }\n var tag = getTag(value);\n if (tag == mapTag || tag == setTag) {\n return !value.size;\n }\n if (isPrototype(value)) {\n return !baseKeys(value).length;\n }\n for (var key in value) {\n if (hasOwnProperty.call(value, key)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * Performs a deep comparison between two values to determine if they are\n * equivalent.\n *\n * **Note:** This method supports comparing arrays, array buffers, booleans,\n * date objects, error objects, maps, numbers, `Object` objects, regexes,\n * sets, strings, symbols, and typed arrays. `Object` objects are compared\n * by their own, not inherited, enumerable properties. Functions and DOM\n * nodes are compared by strict equality, i.e. `===`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.isEqual(object, other);\n * // => true\n *\n * object === other;\n * // => false\n */\n function isEqual(value, other) {\n return baseIsEqual(value, other);\n }\n\n /**\n * This method is like `_.isEqual` except that it accepts `customizer` which\n * is invoked to compare values. If `customizer` returns `undefined`, comparisons\n * are handled by the method instead. The `customizer` is invoked with up to\n * six arguments: (objValue, othValue [, index|key, object, other, stack]).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * function isGreeting(value) {\n * return /^h(?:i|ello)$/.test(value);\n * }\n *\n * function customizer(objValue, othValue) {\n * if (isGreeting(objValue) && isGreeting(othValue)) {\n * return true;\n * }\n * }\n *\n * var array = ['hello', 'goodbye'];\n * var other = ['hi', 'goodbye'];\n *\n * _.isEqualWith(array, other, customizer);\n * // => true\n */\n function isEqualWith(value, other, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n var result = customizer ? customizer(value, other) : undefined;\n return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;\n }\n\n /**\n * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,\n * `SyntaxError`, `TypeError`, or `URIError` object.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an error object, else `false`.\n * @example\n *\n * _.isError(new Error);\n * // => true\n *\n * _.isError(Error);\n * // => false\n */\n function isError(value) {\n if (!isObjectLike(value)) {\n return false;\n }\n var tag = baseGetTag(value);\n return tag == errorTag || tag == domExcTag ||\n (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));\n }\n\n /**\n * Checks if `value` is a finite primitive number.\n *\n * **Note:** This method is based on\n * [`Number.isFinite`](https://mdn.io/Number/isFinite).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a finite number, else `false`.\n * @example\n *\n * _.isFinite(3);\n * // => true\n *\n * _.isFinite(Number.MIN_VALUE);\n * // => true\n *\n * _.isFinite(Infinity);\n * // => false\n *\n * _.isFinite('3');\n * // => false\n */\n function isFinite(value) {\n return typeof value == 'number' && nativeIsFinite(value);\n }\n\n /**\n * Checks if `value` is classified as a `Function` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a function, else `false`.\n * @example\n *\n * _.isFunction(_);\n * // => true\n *\n * _.isFunction(/abc/);\n * // => false\n */\n function isFunction(value) {\n if (!isObject(value)) {\n return false;\n }\n // The use of `Object#toString` avoids issues with the `typeof` operator\n // in Safari 9 which returns 'object' for typed arrays and other constructors.\n var tag = baseGetTag(value);\n return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;\n }\n\n /**\n * Checks if `value` is an integer.\n *\n * **Note:** This method is based on\n * [`Number.isInteger`](https://mdn.io/Number/isInteger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an integer, else `false`.\n * @example\n *\n * _.isInteger(3);\n * // => true\n *\n * _.isInteger(Number.MIN_VALUE);\n * // => false\n *\n * _.isInteger(Infinity);\n * // => false\n *\n * _.isInteger('3');\n * // => false\n */\n function isInteger(value) {\n return typeof value == 'number' && value == toInteger(value);\n }\n\n /**\n * Checks if `value` is a valid array-like length.\n *\n * **Note:** This method is loosely based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.\n * @example\n *\n * _.isLength(3);\n * // => true\n *\n * _.isLength(Number.MIN_VALUE);\n * // => false\n *\n * _.isLength(Infinity);\n * // => false\n *\n * _.isLength('3');\n * // => false\n */\n function isLength(value) {\n return typeof value == 'number' &&\n value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;\n }\n\n /**\n * Checks if `value` is the\n * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)\n * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an object, else `false`.\n * @example\n *\n * _.isObject({});\n * // => true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\n function isObject(value) {\n var type = typeof value;\n return value != null && (type == 'object' || type == 'function');\n }\n\n /**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\n function isObjectLike(value) {\n return value != null && typeof value == 'object';\n }\n\n /**\n * Checks if `value` is classified as a `Map` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a map, else `false`.\n * @example\n *\n * _.isMap(new Map);\n * // => true\n *\n * _.isMap(new WeakMap);\n * // => false\n */\n var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;\n\n /**\n * Performs a partial deep comparison between `object` and `source` to\n * determine if `object` contains equivalent property values.\n *\n * **Note:** This method is equivalent to `_.matches` when `source` is\n * partially applied.\n *\n * Partial comparisons will match empty array and empty object `source`\n * values against any array or object value, respectively. See `_.isEqual`\n * for a list of supported value comparisons.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n *\n * _.isMatch(object, { 'b': 2 });\n * // => true\n *\n * _.isMatch(object, { 'b': 1 });\n * // => false\n */\n function isMatch(object, source) {\n return object === source || baseIsMatch(object, source, getMatchData(source));\n }\n\n /**\n * This method is like `_.isMatch` except that it accepts `customizer` which\n * is invoked to compare values. If `customizer` returns `undefined`, comparisons\n * are handled by the method instead. The `customizer` is invoked with five\n * arguments: (objValue, srcValue, index|key, object, source).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n * @example\n *\n * function isGreeting(value) {\n * return /^h(?:i|ello)$/.test(value);\n * }\n *\n * function customizer(objValue, srcValue) {\n * if (isGreeting(objValue) && isGreeting(srcValue)) {\n * return true;\n * }\n * }\n *\n * var object = { 'greeting': 'hello' };\n * var source = { 'greeting': 'hi' };\n *\n * _.isMatchWith(object, source, customizer);\n * // => true\n */\n function isMatchWith(object, source, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseIsMatch(object, source, getMatchData(source), customizer);\n }\n\n /**\n * Checks if `value` is `NaN`.\n *\n * **Note:** This method is based on\n * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as\n * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for\n * `undefined` and other non-number values.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n * @example\n *\n * _.isNaN(NaN);\n * // => true\n *\n * _.isNaN(new Number(NaN));\n * // => true\n *\n * isNaN(undefined);\n * // => true\n *\n * _.isNaN(undefined);\n * // => false\n */\n function isNaN(value) {\n // An `NaN` primitive is the only value that is not equal to itself.\n // Perform the `toStringTag` check first to avoid errors with some\n // ActiveX objects in IE.\n return isNumber(value) && value != +value;\n }\n\n /**\n * Checks if `value` is a pristine native function.\n *\n * **Note:** This method can't reliably detect native functions in the presence\n * of the core-js package because core-js circumvents this kind of detection.\n * Despite multiple requests, the core-js maintainer has made it clear: any\n * attempt to fix the detection will be obstructed. As a result, we're left\n * with little choice but to throw an error. Unfortunately, this also affects\n * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),\n * which rely on core-js.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n * @example\n *\n * _.isNative(Array.prototype.push);\n * // => true\n *\n * _.isNative(_);\n * // => false\n */\n function isNative(value) {\n if (isMaskable(value)) {\n throw new Error(CORE_ERROR_TEXT);\n }\n return baseIsNative(value);\n }\n\n /**\n * Checks if `value` is `null`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `null`, else `false`.\n * @example\n *\n * _.isNull(null);\n * // => true\n *\n * _.isNull(void 0);\n * // => false\n */\n function isNull(value) {\n return value === null;\n }\n\n /**\n * Checks if `value` is `null` or `undefined`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is nullish, else `false`.\n * @example\n *\n * _.isNil(null);\n * // => true\n *\n * _.isNil(void 0);\n * // => true\n *\n * _.isNil(NaN);\n * // => false\n */\n function isNil(value) {\n return value == null;\n }\n\n /**\n * Checks if `value` is classified as a `Number` primitive or object.\n *\n * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are\n * classified as numbers, use the `_.isFinite` method.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a number, else `false`.\n * @example\n *\n * _.isNumber(3);\n * // => true\n *\n * _.isNumber(Number.MIN_VALUE);\n * // => true\n *\n * _.isNumber(Infinity);\n * // => true\n *\n * _.isNumber('3');\n * // => false\n */\n function isNumber(value) {\n return typeof value == 'number' ||\n (isObjectLike(value) && baseGetTag(value) == numberTag);\n }\n\n /**\n * Checks if `value` is a plain object, that is, an object created by the\n * `Object` constructor or one with a `[[Prototype]]` of `null`.\n *\n * @static\n * @memberOf _\n * @since 0.8.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a plain object, else `false`.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * _.isPlainObject(new Foo);\n * // => false\n *\n * _.isPlainObject([1, 2, 3]);\n * // => false\n *\n * _.isPlainObject({ 'x': 0, 'y': 0 });\n * // => true\n *\n * _.isPlainObject(Object.create(null));\n * // => true\n */\n function isPlainObject(value) {\n if (!isObjectLike(value) || baseGetTag(value) != objectTag) {\n return false;\n }\n var proto = getPrototype(value);\n if (proto === null) {\n return true;\n }\n var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;\n return typeof Ctor == 'function' && Ctor instanceof Ctor &&\n funcToString.call(Ctor) == objectCtorString;\n }\n\n /**\n * Checks if `value` is classified as a `RegExp` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.\n * @example\n *\n * _.isRegExp(/abc/);\n * // => true\n *\n * _.isRegExp('/abc/');\n * // => false\n */\n var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;\n\n /**\n * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754\n * double precision number which isn't the result of a rounded unsafe integer.\n *\n * **Note:** This method is based on\n * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.\n * @example\n *\n * _.isSafeInteger(3);\n * // => true\n *\n * _.isSafeInteger(Number.MIN_VALUE);\n * // => false\n *\n * _.isSafeInteger(Infinity);\n * // => false\n *\n * _.isSafeInteger('3');\n * // => false\n */\n function isSafeInteger(value) {\n return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;\n }\n\n /**\n * Checks if `value` is classified as a `Set` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a set, else `false`.\n * @example\n *\n * _.isSet(new Set);\n * // => true\n *\n * _.isSet(new WeakSet);\n * // => false\n */\n var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;\n\n /**\n * Checks if `value` is classified as a `String` primitive or object.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a string, else `false`.\n * @example\n *\n * _.isString('abc');\n * // => true\n *\n * _.isString(1);\n * // => false\n */\n function isString(value) {\n return typeof value == 'string' ||\n (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);\n }\n\n /**\n * Checks if `value` is classified as a `Symbol` primitive or object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.\n * @example\n *\n * _.isSymbol(Symbol.iterator);\n * // => true\n *\n * _.isSymbol('abc');\n * // => false\n */\n function isSymbol(value) {\n return typeof value == 'symbol' ||\n (isObjectLike(value) && baseGetTag(value) == symbolTag);\n }\n\n /**\n * Checks if `value` is classified as a typed array.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n * @example\n *\n * _.isTypedArray(new Uint8Array);\n * // => true\n *\n * _.isTypedArray([]);\n * // => false\n */\n var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;\n\n /**\n * Checks if `value` is `undefined`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.\n * @example\n *\n * _.isUndefined(void 0);\n * // => true\n *\n * _.isUndefined(null);\n * // => false\n */\n function isUndefined(value) {\n return value === undefined;\n }\n\n /**\n * Checks if `value` is classified as a `WeakMap` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a weak map, else `false`.\n * @example\n *\n * _.isWeakMap(new WeakMap);\n * // => true\n *\n * _.isWeakMap(new Map);\n * // => false\n */\n function isWeakMap(value) {\n return isObjectLike(value) && getTag(value) == weakMapTag;\n }\n\n /**\n * Checks if `value` is classified as a `WeakSet` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a weak set, else `false`.\n * @example\n *\n * _.isWeakSet(new WeakSet);\n * // => true\n *\n * _.isWeakSet(new Set);\n * // => false\n */\n function isWeakSet(value) {\n return isObjectLike(value) && baseGetTag(value) == weakSetTag;\n }\n\n /**\n * Checks if `value` is less than `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than `other`,\n * else `false`.\n * @see _.gt\n * @example\n *\n * _.lt(1, 3);\n * // => true\n *\n * _.lt(3, 3);\n * // => false\n *\n * _.lt(3, 1);\n * // => false\n */\n var lt = createRelationalOperation(baseLt);\n\n /**\n * Checks if `value` is less than or equal to `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than or equal to\n * `other`, else `false`.\n * @see _.gte\n * @example\n *\n * _.lte(1, 3);\n * // => true\n *\n * _.lte(3, 3);\n * // => true\n *\n * _.lte(3, 1);\n * // => false\n */\n var lte = createRelationalOperation(function(value, other) {\n return value <= other;\n });\n\n /**\n * Converts `value` to an array.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {Array} Returns the converted array.\n * @example\n *\n * _.toArray({ 'a': 1, 'b': 2 });\n * // => [1, 2]\n *\n * _.toArray('abc');\n * // => ['a', 'b', 'c']\n *\n * _.toArray(1);\n * // => []\n *\n * _.toArray(null);\n * // => []\n */\n function toArray(value) {\n if (!value) {\n return [];\n }\n if (isArrayLike(value)) {\n return isString(value) ? stringToArray(value) : copyArray(value);\n }\n if (symIterator && value[symIterator]) {\n return iteratorToArray(value[symIterator]());\n }\n var tag = getTag(value),\n func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);\n\n return func(value);\n }\n\n /**\n * Converts `value` to a finite number.\n *\n * @static\n * @memberOf _\n * @since 4.12.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted number.\n * @example\n *\n * _.toFinite(3.2);\n * // => 3.2\n *\n * _.toFinite(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toFinite(Infinity);\n * // => 1.7976931348623157e+308\n *\n * _.toFinite('3.2');\n * // => 3.2\n */\n function toFinite(value) {\n if (!value) {\n return value === 0 ? value : 0;\n }\n value = toNumber(value);\n if (value === INFINITY || value === -INFINITY) {\n var sign = (value < 0 ? -1 : 1);\n return sign * MAX_INTEGER;\n }\n return value === value ? value : 0;\n }\n\n /**\n * Converts `value` to an integer.\n *\n * **Note:** This method is loosely based on\n * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toInteger(3.2);\n * // => 3\n *\n * _.toInteger(Number.MIN_VALUE);\n * // => 0\n *\n * _.toInteger(Infinity);\n * // => 1.7976931348623157e+308\n *\n * _.toInteger('3.2');\n * // => 3\n */\n function toInteger(value) {\n var result = toFinite(value),\n remainder = result % 1;\n\n return result === result ? (remainder ? result - remainder : result) : 0;\n }\n\n /**\n * Converts `value` to an integer suitable for use as the length of an\n * array-like object.\n *\n * **Note:** This method is based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toLength(3.2);\n * // => 3\n *\n * _.toLength(Number.MIN_VALUE);\n * // => 0\n *\n * _.toLength(Infinity);\n * // => 4294967295\n *\n * _.toLength('3.2');\n * // => 3\n */\n function toLength(value) {\n return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;\n }\n\n /**\n * Converts `value` to a number.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n * @example\n *\n * _.toNumber(3.2);\n * // => 3.2\n *\n * _.toNumber(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toNumber(Infinity);\n * // => Infinity\n *\n * _.toNumber('3.2');\n * // => 3.2\n */\n function toNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n if (isObject(value)) {\n var other = typeof value.valueOf == 'function' ? value.valueOf() : value;\n value = isObject(other) ? (other + '') : other;\n }\n if (typeof value != 'string') {\n return value === 0 ? value : +value;\n }\n value = value.replace(reTrim, '');\n var isBinary = reIsBinary.test(value);\n return (isBinary || reIsOctal.test(value))\n ? freeParseInt(value.slice(2), isBinary ? 2 : 8)\n : (reIsBadHex.test(value) ? NAN : +value);\n }\n\n /**\n * Converts `value` to a plain object flattening inherited enumerable string\n * keyed properties of `value` to own properties of the plain object.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {Object} Returns the converted plain object.\n * @example\n *\n * function Foo() {\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.assign({ 'a': 1 }, new Foo);\n * // => { 'a': 1, 'b': 2 }\n *\n * _.assign({ 'a': 1 }, _.toPlainObject(new Foo));\n * // => { 'a': 1, 'b': 2, 'c': 3 }\n */\n function toPlainObject(value) {\n return copyObject(value, keysIn(value));\n }\n\n /**\n * Converts `value` to a safe integer. A safe integer can be compared and\n * represented correctly.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toSafeInteger(3.2);\n * // => 3\n *\n * _.toSafeInteger(Number.MIN_VALUE);\n * // => 0\n *\n * _.toSafeInteger(Infinity);\n * // => 9007199254740991\n *\n * _.toSafeInteger('3.2');\n * // => 3\n */\n function toSafeInteger(value) {\n return value\n ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)\n : (value === 0 ? value : 0);\n }\n\n /**\n * Converts `value` to a string. An empty string is returned for `null`\n * and `undefined` values. The sign of `-0` is preserved.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.toString(null);\n * // => ''\n *\n * _.toString(-0);\n * // => '-0'\n *\n * _.toString([1, 2, 3]);\n * // => '1,2,3'\n */\n function toString(value) {\n return value == null ? '' : baseToString(value);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Assigns own enumerable string keyed properties of source objects to the\n * destination object. Source objects are applied from left to right.\n * Subsequent sources overwrite property assignments of previous sources.\n *\n * **Note:** This method mutates `object` and is loosely based on\n * [`Object.assign`](https://mdn.io/Object/assign).\n *\n * @static\n * @memberOf _\n * @since 0.10.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.assignIn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * function Bar() {\n * this.c = 3;\n * }\n *\n * Foo.prototype.b = 2;\n * Bar.prototype.d = 4;\n *\n * _.assign({ 'a': 0 }, new Foo, new Bar);\n * // => { 'a': 1, 'c': 3 }\n */\n var assign = createAssigner(function(object, source) {\n if (isPrototype(source) || isArrayLike(source)) {\n copyObject(source, keys(source), object);\n return;\n }\n for (var key in source) {\n if (hasOwnProperty.call(source, key)) {\n assignValue(object, key, source[key]);\n }\n }\n });\n\n /**\n * This method is like `_.assign` except that it iterates over own and\n * inherited source properties.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias extend\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.assign\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * function Bar() {\n * this.c = 3;\n * }\n *\n * Foo.prototype.b = 2;\n * Bar.prototype.d = 4;\n *\n * _.assignIn({ 'a': 0 }, new Foo, new Bar);\n * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }\n */\n var assignIn = createAssigner(function(object, source) {\n copyObject(source, keysIn(source), object);\n });\n\n /**\n * This method is like `_.assignIn` except that it accepts `customizer`\n * which is invoked to produce the assigned values. If `customizer` returns\n * `undefined`, assignment is handled by the method instead. The `customizer`\n * is invoked with five arguments: (objValue, srcValue, key, object, source).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias extendWith\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @see _.assignWith\n * @example\n *\n * function customizer(objValue, srcValue) {\n * return _.isUndefined(objValue) ? srcValue : objValue;\n * }\n *\n * var defaults = _.partialRight(_.assignInWith, customizer);\n *\n * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {\n copyObject(source, keysIn(source), object, customizer);\n });\n\n /**\n * This method is like `_.assign` except that it accepts `customizer`\n * which is invoked to produce the assigned values. If `customizer` returns\n * `undefined`, assignment is handled by the method instead. The `customizer`\n * is invoked with five arguments: (objValue, srcValue, key, object, source).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @see _.assignInWith\n * @example\n *\n * function customizer(objValue, srcValue) {\n * return _.isUndefined(objValue) ? srcValue : objValue;\n * }\n *\n * var defaults = _.partialRight(_.assignWith, customizer);\n *\n * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var assignWith = createAssigner(function(object, source, srcIndex, customizer) {\n copyObject(source, keys(source), object, customizer);\n });\n\n /**\n * Creates an array of values corresponding to `paths` of `object`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Array} Returns the picked values.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };\n *\n * _.at(object, ['a[0].b.c', 'a[1]']);\n * // => [3, 4]\n */\n var at = flatRest(baseAt);\n\n /**\n * Creates an object that inherits from the `prototype` object. If a\n * `properties` object is given, its own enumerable string keyed properties\n * are assigned to the created object.\n *\n * @static\n * @memberOf _\n * @since 2.3.0\n * @category Object\n * @param {Object} prototype The object to inherit from.\n * @param {Object} [properties] The properties to assign to the object.\n * @returns {Object} Returns the new object.\n * @example\n *\n * function Shape() {\n * this.x = 0;\n * this.y = 0;\n * }\n *\n * function Circle() {\n * Shape.call(this);\n * }\n *\n * Circle.prototype = _.create(Shape.prototype, {\n * 'constructor': Circle\n * });\n *\n * var circle = new Circle;\n * circle instanceof Circle;\n * // => true\n *\n * circle instanceof Shape;\n * // => true\n */\n function create(prototype, properties) {\n var result = baseCreate(prototype);\n return properties == null ? result : baseAssign(result, properties);\n }\n\n /**\n * Assigns own and inherited enumerable string keyed properties of source\n * objects to the destination object for all destination properties that\n * resolve to `undefined`. Source objects are applied from left to right.\n * Once a property is set, additional values of the same property are ignored.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.defaultsDeep\n * @example\n *\n * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var defaults = baseRest(function(args) {\n args.push(undefined, customDefaultsAssignIn);\n return apply(assignInWith, undefined, args);\n });\n\n /**\n * This method is like `_.defaults` except that it recursively assigns\n * default properties.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 3.10.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.defaults\n * @example\n *\n * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });\n * // => { 'a': { 'b': 2, 'c': 3 } }\n */\n var defaultsDeep = baseRest(function(args) {\n args.push(undefined, customDefaultsMerge);\n return apply(mergeWith, undefined, args);\n });\n\n /**\n * This method is like `_.find` except that it returns the key of the first\n * element `predicate` returns truthy for instead of the element itself.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {string|undefined} Returns the key of the matched element,\n * else `undefined`.\n * @example\n *\n * var users = {\n * 'barney': { 'age': 36, 'active': true },\n * 'fred': { 'age': 40, 'active': false },\n * 'pebbles': { 'age': 1, 'active': true }\n * };\n *\n * _.findKey(users, function(o) { return o.age < 40; });\n * // => 'barney' (iteration order is not guaranteed)\n *\n * // The `_.matches` iteratee shorthand.\n * _.findKey(users, { 'age': 1, 'active': true });\n * // => 'pebbles'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findKey(users, ['active', false]);\n * // => 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.findKey(users, 'active');\n * // => 'barney'\n */\n function findKey(object, predicate) {\n return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);\n }\n\n /**\n * This method is like `_.findKey` except that it iterates over elements of\n * a collection in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {string|undefined} Returns the key of the matched element,\n * else `undefined`.\n * @example\n *\n * var users = {\n * 'barney': { 'age': 36, 'active': true },\n * 'fred': { 'age': 40, 'active': false },\n * 'pebbles': { 'age': 1, 'active': true }\n * };\n *\n * _.findLastKey(users, function(o) { return o.age < 40; });\n * // => returns 'pebbles' assuming `_.findKey` returns 'barney'\n *\n * // The `_.matches` iteratee shorthand.\n * _.findLastKey(users, { 'age': 36, 'active': true });\n * // => 'barney'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findLastKey(users, ['active', false]);\n * // => 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.findLastKey(users, 'active');\n * // => 'pebbles'\n */\n function findLastKey(object, predicate) {\n return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);\n }\n\n /**\n * Iterates over own and inherited enumerable string keyed properties of an\n * object and invokes `iteratee` for each property. The iteratee is invoked\n * with three arguments: (value, key, object). Iteratee functions may exit\n * iteration early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 0.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forInRight\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forIn(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).\n */\n function forIn(object, iteratee) {\n return object == null\n ? object\n : baseFor(object, getIteratee(iteratee, 3), keysIn);\n }\n\n /**\n * This method is like `_.forIn` except that it iterates over properties of\n * `object` in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forIn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forInRight(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.\n */\n function forInRight(object, iteratee) {\n return object == null\n ? object\n : baseForRight(object, getIteratee(iteratee, 3), keysIn);\n }\n\n /**\n * Iterates over own enumerable string keyed properties of an object and\n * invokes `iteratee` for each property. The iteratee is invoked with three\n * arguments: (value, key, object). Iteratee functions may exit iteration\n * early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 0.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forOwnRight\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forOwn(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a' then 'b' (iteration order is not guaranteed).\n */\n function forOwn(object, iteratee) {\n return object && baseForOwn(object, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.forOwn` except that it iterates over properties of\n * `object` in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forOwn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forOwnRight(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.\n */\n function forOwnRight(object, iteratee) {\n return object && baseForOwnRight(object, getIteratee(iteratee, 3));\n }\n\n /**\n * Creates an array of function property names from own enumerable properties\n * of `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns the function names.\n * @see _.functionsIn\n * @example\n *\n * function Foo() {\n * this.a = _.constant('a');\n * this.b = _.constant('b');\n * }\n *\n * Foo.prototype.c = _.constant('c');\n *\n * _.functions(new Foo);\n * // => ['a', 'b']\n */\n function functions(object) {\n return object == null ? [] : baseFunctions(object, keys(object));\n }\n\n /**\n * Creates an array of function property names from own and inherited\n * enumerable properties of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns the function names.\n * @see _.functions\n * @example\n *\n * function Foo() {\n * this.a = _.constant('a');\n * this.b = _.constant('b');\n * }\n *\n * Foo.prototype.c = _.constant('c');\n *\n * _.functionsIn(new Foo);\n * // => ['a', 'b', 'c']\n */\n function functionsIn(object) {\n return object == null ? [] : baseFunctions(object, keysIn(object));\n }\n\n /**\n * Gets the value at `path` of `object`. If the resolved value is\n * `undefined`, the `defaultValue` is returned in its place.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.get(object, 'a[0].b.c');\n * // => 3\n *\n * _.get(object, ['a', '0', 'b', 'c']);\n * // => 3\n *\n * _.get(object, 'a.b.c', 'default');\n * // => 'default'\n */\n function get(object, path, defaultValue) {\n var result = object == null ? undefined : baseGet(object, path);\n return result === undefined ? defaultValue : result;\n }\n\n /**\n * Checks if `path` is a direct property of `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n * @example\n *\n * var object = { 'a': { 'b': 2 } };\n * var other = _.create({ 'a': _.create({ 'b': 2 }) });\n *\n * _.has(object, 'a');\n * // => true\n *\n * _.has(object, 'a.b');\n * // => true\n *\n * _.has(object, ['a', 'b']);\n * // => true\n *\n * _.has(other, 'a');\n * // => false\n */\n function has(object, path) {\n return object != null && hasPath(object, path, baseHas);\n }\n\n /**\n * Checks if `path` is a direct or inherited property of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n * @example\n *\n * var object = _.create({ 'a': _.create({ 'b': 2 }) });\n *\n * _.hasIn(object, 'a');\n * // => true\n *\n * _.hasIn(object, 'a.b');\n * // => true\n *\n * _.hasIn(object, ['a', 'b']);\n * // => true\n *\n * _.hasIn(object, 'b');\n * // => false\n */\n function hasIn(object, path) {\n return object != null && hasPath(object, path, baseHasIn);\n }\n\n /**\n * Creates an object composed of the inverted keys and values of `object`.\n * If `object` contains duplicate values, subsequent values overwrite\n * property assignments of previous values.\n *\n * @static\n * @memberOf _\n * @since 0.7.0\n * @category Object\n * @param {Object} object The object to invert.\n * @returns {Object} Returns the new inverted object.\n * @example\n *\n * var object = { 'a': 1, 'b': 2, 'c': 1 };\n *\n * _.invert(object);\n * // => { '1': 'c', '2': 'b' }\n */\n var invert = createInverter(function(result, value, key) {\n result[value] = key;\n }, constant(identity));\n\n /**\n * This method is like `_.invert` except that the inverted object is generated\n * from the results of running each element of `object` thru `iteratee`. The\n * corresponding inverted value of each inverted key is an array of keys\n * responsible for generating the inverted value. The iteratee is invoked\n * with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.1.0\n * @category Object\n * @param {Object} object The object to invert.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Object} Returns the new inverted object.\n * @example\n *\n * var object = { 'a': 1, 'b': 2, 'c': 1 };\n *\n * _.invertBy(object);\n * // => { '1': ['a', 'c'], '2': ['b'] }\n *\n * _.invertBy(object, function(value) {\n * return 'group' + value;\n * });\n * // => { 'group1': ['a', 'c'], 'group2': ['b'] }\n */\n var invertBy = createInverter(function(result, value, key) {\n if (hasOwnProperty.call(result, value)) {\n result[value].push(key);\n } else {\n result[value] = [key];\n }\n }, getIteratee);\n\n /**\n * Invokes the method at `path` of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the method to invoke.\n * @param {...*} [args] The arguments to invoke the method with.\n * @returns {*} Returns the result of the invoked method.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };\n *\n * _.invoke(object, 'a[0].b.c.slice', 1, 3);\n * // => [2, 3]\n */\n var invoke = baseRest(baseInvoke);\n\n /**\n * Creates an array of the own enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects. See the\n * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * for more details.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keys(new Foo);\n * // => ['a', 'b'] (iteration order is not guaranteed)\n *\n * _.keys('hi');\n * // => ['0', '1']\n */\n function keys(object) {\n return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);\n }\n\n /**\n * Creates an array of the own and inherited enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keysIn(new Foo);\n * // => ['a', 'b', 'c'] (iteration order is not guaranteed)\n */\n function keysIn(object) {\n return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);\n }\n\n /**\n * The opposite of `_.mapValues`; this method creates an object with the\n * same values as `object` and keys generated by running each own enumerable\n * string keyed property of `object` thru `iteratee`. The iteratee is invoked\n * with three arguments: (value, key, object).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns the new mapped object.\n * @see _.mapValues\n * @example\n *\n * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {\n * return key + value;\n * });\n * // => { 'a1': 1, 'b2': 2 }\n */\n function mapKeys(object, iteratee) {\n var result = {};\n iteratee = getIteratee(iteratee, 3);\n\n baseForOwn(object, function(value, key, object) {\n baseAssignValue(result, iteratee(value, key, object), value);\n });\n return result;\n }\n\n /**\n * Creates an object with the same keys as `object` and values generated\n * by running each own enumerable string keyed property of `object` thru\n * `iteratee`. The iteratee is invoked with three arguments:\n * (value, key, object).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns the new mapped object.\n * @see _.mapKeys\n * @example\n *\n * var users = {\n * 'fred': { 'user': 'fred', 'age': 40 },\n * 'pebbles': { 'user': 'pebbles', 'age': 1 }\n * };\n *\n * _.mapValues(users, function(o) { return o.age; });\n * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)\n *\n * // The `_.property` iteratee shorthand.\n * _.mapValues(users, 'age');\n * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)\n */\n function mapValues(object, iteratee) {\n var result = {};\n iteratee = getIteratee(iteratee, 3);\n\n baseForOwn(object, function(value, key, object) {\n baseAssignValue(result, key, iteratee(value, key, object));\n });\n return result;\n }\n\n /**\n * This method is like `_.assign` except that it recursively merges own and\n * inherited enumerable string keyed properties of source objects into the\n * destination object. Source properties that resolve to `undefined` are\n * skipped if a destination value exists. Array and plain object properties\n * are merged recursively. Other objects and value types are overridden by\n * assignment. Source objects are applied from left to right. Subsequent\n * sources overwrite property assignments of previous sources.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {\n * 'a': [{ 'b': 2 }, { 'd': 4 }]\n * };\n *\n * var other = {\n * 'a': [{ 'c': 3 }, { 'e': 5 }]\n * };\n *\n * _.merge(object, other);\n * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }\n */\n var merge = createAssigner(function(object, source, srcIndex) {\n baseMerge(object, source, srcIndex);\n });\n\n /**\n * This method is like `_.merge` except that it accepts `customizer` which\n * is invoked to produce the merged values of the destination and source\n * properties. If `customizer` returns `undefined`, merging is handled by the\n * method instead. The `customizer` is invoked with six arguments:\n * (objValue, srcValue, key, object, source, stack).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} customizer The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * function customizer(objValue, srcValue) {\n * if (_.isArray(objValue)) {\n * return objValue.concat(srcValue);\n * }\n * }\n *\n * var object = { 'a': [1], 'b': [2] };\n * var other = { 'a': [3], 'b': [4] };\n *\n * _.mergeWith(object, other, customizer);\n * // => { 'a': [1, 3], 'b': [2, 4] }\n */\n var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {\n baseMerge(object, source, srcIndex, customizer);\n });\n\n /**\n * The opposite of `_.pick`; this method creates an object composed of the\n * own and inherited enumerable property paths of `object` that are not omitted.\n *\n * **Note:** This method is considerably slower than `_.pick`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The source object.\n * @param {...(string|string[])} [paths] The property paths to omit.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.omit(object, ['a', 'c']);\n * // => { 'b': '2' }\n */\n var omit = flatRest(function(object, paths) {\n var result = {};\n if (object == null) {\n return result;\n }\n var isDeep = false;\n paths = arrayMap(paths, function(path) {\n path = castPath(path, object);\n isDeep || (isDeep = path.length > 1);\n return path;\n });\n copyObject(object, getAllKeysIn(object), result);\n if (isDeep) {\n result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);\n }\n var length = paths.length;\n while (length--) {\n baseUnset(result, paths[length]);\n }\n return result;\n });\n\n /**\n * The opposite of `_.pickBy`; this method creates an object composed of\n * the own and inherited enumerable string keyed properties of `object` that\n * `predicate` doesn't return truthy for. The predicate is invoked with two\n * arguments: (value, key).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The source object.\n * @param {Function} [predicate=_.identity] The function invoked per property.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.omitBy(object, _.isNumber);\n * // => { 'b': '2' }\n */\n function omitBy(object, predicate) {\n return pickBy(object, negate(getIteratee(predicate)));\n }\n\n /**\n * Creates an object composed of the picked `object` properties.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The source object.\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.pick(object, ['a', 'c']);\n * // => { 'a': 1, 'c': 3 }\n */\n var pick = flatRest(function(object, paths) {\n return object == null ? {} : basePick(object, paths);\n });\n\n /**\n * Creates an object composed of the `object` properties `predicate` returns\n * truthy for. The predicate is invoked with two arguments: (value, key).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The source object.\n * @param {Function} [predicate=_.identity] The function invoked per property.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.pickBy(object, _.isNumber);\n * // => { 'a': 1, 'c': 3 }\n */\n function pickBy(object, predicate) {\n if (object == null) {\n return {};\n }\n var props = arrayMap(getAllKeysIn(object), function(prop) {\n return [prop];\n });\n predicate = getIteratee(predicate);\n return basePickBy(object, props, function(value, path) {\n return predicate(value, path[0]);\n });\n }\n\n /**\n * This method is like `_.get` except that if the resolved value is a\n * function it's invoked with the `this` binding of its parent object and\n * its result is returned.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to resolve.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };\n *\n * _.result(object, 'a[0].b.c1');\n * // => 3\n *\n * _.result(object, 'a[0].b.c2');\n * // => 4\n *\n * _.result(object, 'a[0].b.c3', 'default');\n * // => 'default'\n *\n * _.result(object, 'a[0].b.c3', _.constant('default'));\n * // => 'default'\n */\n function result(object, path, defaultValue) {\n path = castPath(path, object);\n\n var index = -1,\n length = path.length;\n\n // Ensure the loop is entered when path is empty.\n if (!length) {\n length = 1;\n object = undefined;\n }\n while (++index < length) {\n var value = object == null ? undefined : object[toKey(path[index])];\n if (value === undefined) {\n index = length;\n value = defaultValue;\n }\n object = isFunction(value) ? value.call(object) : value;\n }\n return object;\n }\n\n /**\n * Sets the value at `path` of `object`. If a portion of `path` doesn't exist,\n * it's created. Arrays are created for missing index properties while objects\n * are created for all other missing properties. Use `_.setWith` to customize\n * `path` creation.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.set(object, 'a[0].b.c', 4);\n * console.log(object.a[0].b.c);\n * // => 4\n *\n * _.set(object, ['x', '0', 'y', 'z'], 5);\n * console.log(object.x[0].y.z);\n * // => 5\n */\n function set(object, path, value) {\n return object == null ? object : baseSet(object, path, value);\n }\n\n /**\n * This method is like `_.set` except that it accepts `customizer` which is\n * invoked to produce the objects of `path`. If `customizer` returns `undefined`\n * path creation is handled by the method instead. The `customizer` is invoked\n * with three arguments: (nsValue, key, nsObject).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {};\n *\n * _.setWith(object, '[0][1]', 'a', Object);\n * // => { '0': { '1': 'a' } }\n */\n function setWith(object, path, value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return object == null ? object : baseSet(object, path, value, customizer);\n }\n\n /**\n * Creates an array of own enumerable string keyed-value pairs for `object`\n * which can be consumed by `_.fromPairs`. If `object` is a map or set, its\n * entries are returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias entries\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the key-value pairs.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.toPairs(new Foo);\n * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)\n */\n var toPairs = createToPairs(keys);\n\n /**\n * Creates an array of own and inherited enumerable string keyed-value pairs\n * for `object` which can be consumed by `_.fromPairs`. If `object` is a map\n * or set, its entries are returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias entriesIn\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the key-value pairs.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.toPairsIn(new Foo);\n * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)\n */\n var toPairsIn = createToPairs(keysIn);\n\n /**\n * An alternative to `_.reduce`; this method transforms `object` to a new\n * `accumulator` object which is the result of running each of its own\n * enumerable string keyed properties thru `iteratee`, with each invocation\n * potentially mutating the `accumulator` object. If `accumulator` is not\n * provided, a new object with the same `[[Prototype]]` will be used. The\n * iteratee is invoked with four arguments: (accumulator, value, key, object).\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 1.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The custom accumulator value.\n * @returns {*} Returns the accumulated value.\n * @example\n *\n * _.transform([2, 3, 4], function(result, n) {\n * result.push(n *= n);\n * return n % 2 == 0;\n * }, []);\n * // => [4, 9]\n *\n * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {\n * (result[value] || (result[value] = [])).push(key);\n * }, {});\n * // => { '1': ['a', 'c'], '2': ['b'] }\n */\n function transform(object, iteratee, accumulator) {\n var isArr = isArray(object),\n isArrLike = isArr || isBuffer(object) || isTypedArray(object);\n\n iteratee = getIteratee(iteratee, 4);\n if (accumulator == null) {\n var Ctor = object && object.constructor;\n if (isArrLike) {\n accumulator = isArr ? new Ctor : [];\n }\n else if (isObject(object)) {\n accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};\n }\n else {\n accumulator = {};\n }\n }\n (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {\n return iteratee(accumulator, value, index, object);\n });\n return accumulator;\n }\n\n /**\n * Removes the property at `path` of `object`.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to unset.\n * @returns {boolean} Returns `true` if the property is deleted, else `false`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 7 } }] };\n * _.unset(object, 'a[0].b.c');\n * // => true\n *\n * console.log(object);\n * // => { 'a': [{ 'b': {} }] };\n *\n * _.unset(object, ['a', '0', 'b', 'c']);\n * // => true\n *\n * console.log(object);\n * // => { 'a': [{ 'b': {} }] };\n */\n function unset(object, path) {\n return object == null ? true : baseUnset(object, path);\n }\n\n /**\n * This method is like `_.set` except that accepts `updater` to produce the\n * value to set. Use `_.updateWith` to customize `path` creation. The `updater`\n * is invoked with one argument: (value).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {Function} updater The function to produce the updated value.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.update(object, 'a[0].b.c', function(n) { return n * n; });\n * console.log(object.a[0].b.c);\n * // => 9\n *\n * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });\n * console.log(object.x[0].y.z);\n * // => 0\n */\n function update(object, path, updater) {\n return object == null ? object : baseUpdate(object, path, castFunction(updater));\n }\n\n /**\n * This method is like `_.update` except that it accepts `customizer` which is\n * invoked to produce the objects of `path`. If `customizer` returns `undefined`\n * path creation is handled by the method instead. The `customizer` is invoked\n * with three arguments: (nsValue, key, nsObject).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {Function} updater The function to produce the updated value.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {};\n *\n * _.updateWith(object, '[0][1]', _.constant('a'), Object);\n * // => { '0': { '1': 'a' } }\n */\n function updateWith(object, path, updater, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);\n }\n\n /**\n * Creates an array of the own enumerable string keyed property values of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property values.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.values(new Foo);\n * // => [1, 2] (iteration order is not guaranteed)\n *\n * _.values('hi');\n * // => ['h', 'i']\n */\n function values(object) {\n return object == null ? [] : baseValues(object, keys(object));\n }\n\n /**\n * Creates an array of the own and inherited enumerable string keyed property\n * values of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property values.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.valuesIn(new Foo);\n * // => [1, 2, 3] (iteration order is not guaranteed)\n */\n function valuesIn(object) {\n return object == null ? [] : baseValues(object, keysIn(object));\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Clamps `number` within the inclusive `lower` and `upper` bounds.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Number\n * @param {number} number The number to clamp.\n * @param {number} [lower] The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the clamped number.\n * @example\n *\n * _.clamp(-10, -5, 5);\n * // => -5\n *\n * _.clamp(10, -5, 5);\n * // => 5\n */\n function clamp(number, lower, upper) {\n if (upper === undefined) {\n upper = lower;\n lower = undefined;\n }\n if (upper !== undefined) {\n upper = toNumber(upper);\n upper = upper === upper ? upper : 0;\n }\n if (lower !== undefined) {\n lower = toNumber(lower);\n lower = lower === lower ? lower : 0;\n }\n return baseClamp(toNumber(number), lower, upper);\n }\n\n /**\n * Checks if `n` is between `start` and up to, but not including, `end`. If\n * `end` is not specified, it's set to `start` with `start` then set to `0`.\n * If `start` is greater than `end` the params are swapped to support\n * negative ranges.\n *\n * @static\n * @memberOf _\n * @since 3.3.0\n * @category Number\n * @param {number} number The number to check.\n * @param {number} [start=0] The start of the range.\n * @param {number} end The end of the range.\n * @returns {boolean} Returns `true` if `number` is in the range, else `false`.\n * @see _.range, _.rangeRight\n * @example\n *\n * _.inRange(3, 2, 4);\n * // => true\n *\n * _.inRange(4, 8);\n * // => true\n *\n * _.inRange(4, 2);\n * // => false\n *\n * _.inRange(2, 2);\n * // => false\n *\n * _.inRange(1.2, 2);\n * // => true\n *\n * _.inRange(5.2, 4);\n * // => false\n *\n * _.inRange(-3, -2, -6);\n * // => true\n */\n function inRange(number, start, end) {\n start = toFinite(start);\n if (end === undefined) {\n end = start;\n start = 0;\n } else {\n end = toFinite(end);\n }\n number = toNumber(number);\n return baseInRange(number, start, end);\n }\n\n /**\n * Produces a random number between the inclusive `lower` and `upper` bounds.\n * If only one argument is provided a number between `0` and the given number\n * is returned. If `floating` is `true`, or either `lower` or `upper` are\n * floats, a floating-point number is returned instead of an integer.\n *\n * **Note:** JavaScript follows the IEEE-754 standard for resolving\n * floating-point values which can produce unexpected results.\n *\n * @static\n * @memberOf _\n * @since 0.7.0\n * @category Number\n * @param {number} [lower=0] The lower bound.\n * @param {number} [upper=1] The upper bound.\n * @param {boolean} [floating] Specify returning a floating-point number.\n * @returns {number} Returns the random number.\n * @example\n *\n * _.random(0, 5);\n * // => an integer between 0 and 5\n *\n * _.random(5);\n * // => also an integer between 0 and 5\n *\n * _.random(5, true);\n * // => a floating-point number between 0 and 5\n *\n * _.random(1.2, 5.2);\n * // => a floating-point number between 1.2 and 5.2\n */\n function random(lower, upper, floating) {\n if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {\n upper = floating = undefined;\n }\n if (floating === undefined) {\n if (typeof upper == 'boolean') {\n floating = upper;\n upper = undefined;\n }\n else if (typeof lower == 'boolean') {\n floating = lower;\n lower = undefined;\n }\n }\n if (lower === undefined && upper === undefined) {\n lower = 0;\n upper = 1;\n }\n else {\n lower = toFinite(lower);\n if (upper === undefined) {\n upper = lower;\n lower = 0;\n } else {\n upper = toFinite(upper);\n }\n }\n if (lower > upper) {\n var temp = lower;\n lower = upper;\n upper = temp;\n }\n if (floating || lower % 1 || upper % 1) {\n var rand = nativeRandom();\n return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);\n }\n return baseRandom(lower, upper);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the camel cased string.\n * @example\n *\n * _.camelCase('Foo Bar');\n * // => 'fooBar'\n *\n * _.camelCase('--foo-bar--');\n * // => 'fooBar'\n *\n * _.camelCase('__FOO_BAR__');\n * // => 'fooBar'\n */\n var camelCase = createCompounder(function(result, word, index) {\n word = word.toLowerCase();\n return result + (index ? capitalize(word) : word);\n });\n\n /**\n * Converts the first character of `string` to upper case and the remaining\n * to lower case.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to capitalize.\n * @returns {string} Returns the capitalized string.\n * @example\n *\n * _.capitalize('FRED');\n * // => 'Fred'\n */\n function capitalize(string) {\n return upperFirst(toString(string).toLowerCase());\n }\n\n /**\n * Deburrs `string` by converting\n * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)\n * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)\n * letters to basic Latin letters and removing\n * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to deburr.\n * @returns {string} Returns the deburred string.\n * @example\n *\n * _.deburr('déjà vu');\n * // => 'deja vu'\n */\n function deburr(string) {\n string = toString(string);\n return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');\n }\n\n /**\n * Checks if `string` ends with the given target string.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {string} [target] The string to search for.\n * @param {number} [position=string.length] The position to search up to.\n * @returns {boolean} Returns `true` if `string` ends with `target`,\n * else `false`.\n * @example\n *\n * _.endsWith('abc', 'c');\n * // => true\n *\n * _.endsWith('abc', 'b');\n * // => false\n *\n * _.endsWith('abc', 'b', 2);\n * // => true\n */\n function endsWith(string, target, position) {\n string = toString(string);\n target = baseToString(target);\n\n var length = string.length;\n position = position === undefined\n ? length\n : baseClamp(toInteger(position), 0, length);\n\n var end = position;\n position -= target.length;\n return position >= 0 && string.slice(position, end) == target;\n }\n\n /**\n * Converts the characters \"&\", \"<\", \">\", '\"', and \"'\" in `string` to their\n * corresponding HTML entities.\n *\n * **Note:** No other characters are escaped. To escape additional\n * characters use a third-party library like [_he_](https://mths.be/he).\n *\n * Though the \">\" character is escaped for symmetry, characters like\n * \">\" and \"/\" don't need escaping in HTML and have no special meaning\n * unless they're part of a tag or unquoted attribute value. See\n * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)\n * (under \"semi-related fun fact\") for more details.\n *\n * When working with HTML you should always\n * [quote attribute values](http://wonko.com/post/html-escaping) to reduce\n * XSS vectors.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category String\n * @param {string} [string=''] The string to escape.\n * @returns {string} Returns the escaped string.\n * @example\n *\n * _.escape('fred, barney, & pebbles');\n * // => 'fred, barney, &amp; pebbles'\n */\n function escape(string) {\n string = toString(string);\n return (string && reHasUnescapedHtml.test(string))\n ? string.replace(reUnescapedHtml, escapeHtmlChar)\n : string;\n }\n\n /**\n * Escapes the `RegExp` special characters \"^\", \"$\", \"\\\", \".\", \"*\", \"+\",\n * \"?\", \"(\", \")\", \"[\", \"]\", \"{\", \"}\", and \"|\" in `string`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to escape.\n * @returns {string} Returns the escaped string.\n * @example\n *\n * _.escapeRegExp('[lodash](https://lodash.com/)');\n * // => '\\[lodash\\]\\(https://lodash\\.com/\\)'\n */\n function escapeRegExp(string) {\n string = toString(string);\n return (string && reHasRegExpChar.test(string))\n ? string.replace(reRegExpChar, '\\\\$&')\n : string;\n }\n\n /**\n * Converts `string` to\n * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the kebab cased string.\n * @example\n *\n * _.kebabCase('Foo Bar');\n * // => 'foo-bar'\n *\n * _.kebabCase('fooBar');\n * // => 'foo-bar'\n *\n * _.kebabCase('__FOO_BAR__');\n * // => 'foo-bar'\n */\n var kebabCase = createCompounder(function(result, word, index) {\n return result + (index ? '-' : '') + word.toLowerCase();\n });\n\n /**\n * Converts `string`, as space separated words, to lower case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the lower cased string.\n * @example\n *\n * _.lowerCase('--Foo-Bar--');\n * // => 'foo bar'\n *\n * _.lowerCase('fooBar');\n * // => 'foo bar'\n *\n * _.lowerCase('__FOO_BAR__');\n * // => 'foo bar'\n */\n var lowerCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + word.toLowerCase();\n });\n\n /**\n * Converts the first character of `string` to lower case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.lowerFirst('Fred');\n * // => 'fred'\n *\n * _.lowerFirst('FRED');\n * // => 'fRED'\n */\n var lowerFirst = createCaseFirst('toLowerCase');\n\n /**\n * Pads `string` on the left and right sides if it's shorter than `length`.\n * Padding characters are truncated if they can't be evenly divided by `length`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.pad('abc', 8);\n * // => ' abc '\n *\n * _.pad('abc', 8, '_-');\n * // => '_-abc_-_'\n *\n * _.pad('abc', 3);\n * // => 'abc'\n */\n function pad(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n if (!length || strLength >= length) {\n return string;\n }\n var mid = (length - strLength) / 2;\n return (\n createPadding(nativeFloor(mid), chars) +\n string +\n createPadding(nativeCeil(mid), chars)\n );\n }\n\n /**\n * Pads `string` on the right side if it's shorter than `length`. Padding\n * characters are truncated if they exceed `length`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.padEnd('abc', 6);\n * // => 'abc '\n *\n * _.padEnd('abc', 6, '_-');\n * // => 'abc_-_'\n *\n * _.padEnd('abc', 3);\n * // => 'abc'\n */\n function padEnd(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n return (length && strLength < length)\n ? (string + createPadding(length - strLength, chars))\n : string;\n }\n\n /**\n * Pads `string` on the left side if it's shorter than `length`. Padding\n * characters are truncated if they exceed `length`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.padStart('abc', 6);\n * // => ' abc'\n *\n * _.padStart('abc', 6, '_-');\n * // => '_-_abc'\n *\n * _.padStart('abc', 3);\n * // => 'abc'\n */\n function padStart(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n return (length && strLength < length)\n ? (createPadding(length - strLength, chars) + string)\n : string;\n }\n\n /**\n * Converts `string` to an integer of the specified radix. If `radix` is\n * `undefined` or `0`, a `radix` of `10` is used unless `value` is a\n * hexadecimal, in which case a `radix` of `16` is used.\n *\n * **Note:** This method aligns with the\n * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category String\n * @param {string} string The string to convert.\n * @param {number} [radix=10] The radix to interpret `value` by.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.parseInt('08');\n * // => 8\n *\n * _.map(['6', '08', '10'], _.parseInt);\n * // => [6, 8, 10]\n */\n function parseInt(string, radix, guard) {\n if (guard || radix == null) {\n radix = 0;\n } else if (radix) {\n radix = +radix;\n }\n return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);\n }\n\n /**\n * Repeats the given string `n` times.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to repeat.\n * @param {number} [n=1] The number of times to repeat the string.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {string} Returns the repeated string.\n * @example\n *\n * _.repeat('*', 3);\n * // => '***'\n *\n * _.repeat('abc', 2);\n * // => 'abcabc'\n *\n * _.repeat('abc', 0);\n * // => ''\n */\n function repeat(string, n, guard) {\n if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {\n n = 1;\n } else {\n n = toInteger(n);\n }\n return baseRepeat(toString(string), n);\n }\n\n /**\n * Replaces matches for `pattern` in `string` with `replacement`.\n *\n * **Note:** This method is based on\n * [`String#replace`](https://mdn.io/String/replace).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to modify.\n * @param {RegExp|string} pattern The pattern to replace.\n * @param {Function|string} replacement The match replacement.\n * @returns {string} Returns the modified string.\n * @example\n *\n * _.replace('Hi Fred', 'Fred', 'Barney');\n * // => 'Hi Barney'\n */\n function replace() {\n var args = arguments,\n string = toString(args[0]);\n\n return args.length < 3 ? string : string.replace(args[1], args[2]);\n }\n\n /**\n * Converts `string` to\n * [snake case](https://en.wikipedia.org/wiki/Snake_case).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the snake cased string.\n * @example\n *\n * _.snakeCase('Foo Bar');\n * // => 'foo_bar'\n *\n * _.snakeCase('fooBar');\n * // => 'foo_bar'\n *\n * _.snakeCase('--FOO-BAR--');\n * // => 'foo_bar'\n */\n var snakeCase = createCompounder(function(result, word, index) {\n return result + (index ? '_' : '') + word.toLowerCase();\n });\n\n /**\n * Splits `string` by `separator`.\n *\n * **Note:** This method is based on\n * [`String#split`](https://mdn.io/String/split).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to split.\n * @param {RegExp|string} separator The separator pattern to split by.\n * @param {number} [limit] The length to truncate results to.\n * @returns {Array} Returns the string segments.\n * @example\n *\n * _.split('a-b-c', '-', 2);\n * // => ['a', 'b']\n */\n function split(string, separator, limit) {\n if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {\n separator = limit = undefined;\n }\n limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;\n if (!limit) {\n return [];\n }\n string = toString(string);\n if (string && (\n typeof separator == 'string' ||\n (separator != null && !isRegExp(separator))\n )) {\n separator = baseToString(separator);\n if (!separator && hasUnicode(string)) {\n return castSlice(stringToArray(string), 0, limit);\n }\n }\n return string.split(separator, limit);\n }\n\n /**\n * Converts `string` to\n * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).\n *\n * @static\n * @memberOf _\n * @since 3.1.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the start cased string.\n * @example\n *\n * _.startCase('--foo-bar--');\n * // => 'Foo Bar'\n *\n * _.startCase('fooBar');\n * // => 'Foo Bar'\n *\n * _.startCase('__FOO_BAR__');\n * // => 'FOO BAR'\n */\n var startCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + upperFirst(word);\n });\n\n /**\n * Checks if `string` starts with the given target string.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {string} [target] The string to search for.\n * @param {number} [position=0] The position to search from.\n * @returns {boolean} Returns `true` if `string` starts with `target`,\n * else `false`.\n * @example\n *\n * _.startsWith('abc', 'a');\n * // => true\n *\n * _.startsWith('abc', 'b');\n * // => false\n *\n * _.startsWith('abc', 'b', 1);\n * // => true\n */\n function startsWith(string, target, position) {\n string = toString(string);\n position = position == null\n ? 0\n : baseClamp(toInteger(position), 0, string.length);\n\n target = baseToString(target);\n return string.slice(position, position + target.length) == target;\n }\n\n /**\n * Creates a compiled template function that can interpolate data properties\n * in \"interpolate\" delimiters, HTML-escape interpolated data properties in\n * \"escape\" delimiters, and execute JavaScript in \"evaluate\" delimiters. Data\n * properties may be accessed as free variables in the template. If a setting\n * object is given, it takes precedence over `_.templateSettings` values.\n *\n * **Note:** In the development build `_.template` utilizes\n * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)\n * for easier debugging.\n *\n * For more information on precompiling templates see\n * [lodash's custom builds documentation](https://lodash.com/custom-builds).\n *\n * For more information on Chrome extension sandboxes see\n * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category String\n * @param {string} [string=''] The template string.\n * @param {Object} [options={}] The options object.\n * @param {RegExp} [options.escape=_.templateSettings.escape]\n * The HTML \"escape\" delimiter.\n * @param {RegExp} [options.evaluate=_.templateSettings.evaluate]\n * The \"evaluate\" delimiter.\n * @param {Object} [options.imports=_.templateSettings.imports]\n * An object to import into the template as free variables.\n * @param {RegExp} [options.interpolate=_.templateSettings.interpolate]\n * The \"interpolate\" delimiter.\n * @param {string} [options.sourceURL='lodash.templateSources[n]']\n * The sourceURL of the compiled template.\n * @param {string} [options.variable='obj']\n * The data object variable name.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the compiled template function.\n * @example\n *\n * // Use the \"interpolate\" delimiter to create a compiled template.\n * var compiled = _.template('hello <%= user %>!');\n * compiled({ 'user': 'fred' });\n * // => 'hello fred!'\n *\n * // Use the HTML \"escape\" delimiter to escape data property values.\n * var compiled = _.template('<b><%- value %></b>');\n * compiled({ 'value': '<script>' });\n * // => '<b>&lt;script&gt;</b>'\n *\n * // Use the \"evaluate\" delimiter to execute JavaScript and generate HTML.\n * var compiled = _.template('<% _.forEach(users, function(user) { %><li><%- user %></li><% }); %>');\n * compiled({ 'users': ['fred', 'barney'] });\n * // => '<li>fred</li><li>barney</li>'\n *\n * // Use the internal `print` function in \"evaluate\" delimiters.\n * var compiled = _.template('<% print(\"hello \" + user); %>!');\n * compiled({ 'user': 'barney' });\n * // => 'hello barney!'\n *\n * // Use the ES template literal delimiter as an \"interpolate\" delimiter.\n * // Disable support by replacing the \"interpolate\" delimiter.\n * var compiled = _.template('hello ${ user }!');\n * compiled({ 'user': 'pebbles' });\n * // => 'hello pebbles!'\n *\n * // Use backslashes to treat delimiters as plain text.\n * var compiled = _.template('<%= \"\\\\<%- value %\\\\>\" %>');\n * compiled({ 'value': 'ignored' });\n * // => '<%- value %>'\n *\n * // Use the `imports` option to import `jQuery` as `jq`.\n * var text = '<% jq.each(users, function(user) { %><li><%- user %></li><% }); %>';\n * var compiled = _.template(text, { 'imports': { 'jq': jQuery } });\n * compiled({ 'users': ['fred', 'barney'] });\n * // => '<li>fred</li><li>barney</li>'\n *\n * // Use the `sourceURL` option to specify a custom sourceURL for the template.\n * var compiled = _.template('hello <%= user %>!', { 'sourceURL': '/basic/greeting.jst' });\n * compiled(data);\n * // => Find the source of \"greeting.jst\" under the Sources tab or Resources panel of the web inspector.\n *\n * // Use the `variable` option to ensure a with-statement isn't used in the compiled template.\n * var compiled = _.template('hi <%= data.user %>!', { 'variable': 'data' });\n * compiled.source;\n * // => function(data) {\n * // var __t, __p = '';\n * // __p += 'hi ' + ((__t = ( data.user )) == null ? '' : __t) + '!';\n * // return __p;\n * // }\n *\n * // Use custom template delimiters.\n * _.templateSettings.interpolate = /{{([\\s\\S]+?)}}/g;\n * var compiled = _.template('hello {{ user }}!');\n * compiled({ 'user': 'mustache' });\n * // => 'hello mustache!'\n *\n * // Use the `source` property to inline compiled templates for meaningful\n * // line numbers in error messages and stack traces.\n * fs.writeFileSync(path.join(process.cwd(), 'jst.js'), '\\\n * var JST = {\\\n * \"main\": ' + _.template(mainText).source + '\\\n * };\\\n * ');\n */\n function template(string, options, guard) {\n // Based on John Resig's `tmpl` implementation\n // (http://ejohn.org/blog/javascript-micro-templating/)\n // and Laura Doktorova's doT.js (https://github.com/olado/doT).\n var settings = lodash.templateSettings;\n\n if (guard && isIterateeCall(string, options, guard)) {\n options = undefined;\n }\n string = toString(string);\n options = assignInWith({}, options, settings, customDefaultsAssignIn);\n\n var imports = assignInWith({}, options.imports, settings.imports, customDefaultsAssignIn),\n importsKeys = keys(imports),\n importsValues = baseValues(imports, importsKeys);\n\n var isEscaping,\n isEvaluating,\n index = 0,\n interpolate = options.interpolate || reNoMatch,\n source = \"__p += '\";\n\n // Compile the regexp to match each delimiter.\n var reDelimiters = RegExp(\n (options.escape || reNoMatch).source + '|' +\n interpolate.source + '|' +\n (interpolate === reInterpolate ? reEsTemplate : reNoMatch).source + '|' +\n (options.evaluate || reNoMatch).source + '|$'\n , 'g');\n\n // Use a sourceURL for easier debugging.\n var sourceURL = '//# sourceURL=' +\n ('sourceURL' in options\n ? options.sourceURL\n : ('lodash.templateSources[' + (++templateCounter) + ']')\n ) + '\\n';\n\n string.replace(reDelimiters, function(match, escapeValue, interpolateValue, esTemplateValue, evaluateValue, offset) {\n interpolateValue || (interpolateValue = esTemplateValue);\n\n // Escape characters that can't be included in string literals.\n source += string.slice(index, offset).replace(reUnescapedString, escapeStringChar);\n\n // Replace delimiters with snippets.\n if (escapeValue) {\n isEscaping = true;\n source += \"' +\\n__e(\" + escapeValue + \") +\\n'\";\n }\n if (evaluateValue) {\n isEvaluating = true;\n source += \"';\\n\" + evaluateValue + \";\\n__p += '\";\n }\n if (interpolateValue) {\n source += \"' +\\n((__t = (\" + interpolateValue + \")) == null ? '' : __t) +\\n'\";\n }\n index = offset + match.length;\n\n // The JS engine embedded in Adobe products needs `match` returned in\n // order to produce the correct `offset` value.\n return match;\n });\n\n source += \"';\\n\";\n\n // If `variable` is not specified wrap a with-statement around the generated\n // code to add the data object to the top of the scope chain.\n var variable = options.variable;\n if (!variable) {\n source = 'with (obj) {\\n' + source + '\\n}\\n';\n }\n // Cleanup code by stripping empty strings.\n source = (isEvaluating ? source.replace(reEmptyStringLeading, '') : source)\n .replace(reEmptyStringMiddle, '$1')\n .replace(reEmptyStringTrailing, '$1;');\n\n // Frame code as the function body.\n source = 'function(' + (variable || 'obj') + ') {\\n' +\n (variable\n ? ''\n : 'obj || (obj = {});\\n'\n ) +\n \"var __t, __p = ''\" +\n (isEscaping\n ? ', __e = _.escape'\n : ''\n ) +\n (isEvaluating\n ? ', __j = Array.prototype.join;\\n' +\n \"function print() { __p += __j.call(arguments, '') }\\n\"\n : ';\\n'\n ) +\n source +\n 'return __p\\n}';\n\n var result = attempt(function() {\n return Function(importsKeys, sourceURL + 'return ' + source)\n .apply(undefined, importsValues);\n });\n\n // Provide the compiled function's source by its `toString` method or\n // the `source` property as a convenience for inlining compiled templates.\n result.source = source;\n if (isError(result)) {\n throw result;\n }\n return result;\n }\n\n /**\n * Converts `string`, as a whole, to lower case just like\n * [String#toLowerCase](https://mdn.io/toLowerCase).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the lower cased string.\n * @example\n *\n * _.toLower('--Foo-Bar--');\n * // => '--foo-bar--'\n *\n * _.toLower('fooBar');\n * // => 'foobar'\n *\n * _.toLower('__FOO_BAR__');\n * // => '__foo_bar__'\n */\n function toLower(value) {\n return toString(value).toLowerCase();\n }\n\n /**\n * Converts `string`, as a whole, to upper case just like\n * [String#toUpperCase](https://mdn.io/toUpperCase).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the upper cased string.\n * @example\n *\n * _.toUpper('--foo-bar--');\n * // => '--FOO-BAR--'\n *\n * _.toUpper('fooBar');\n * // => 'FOOBAR'\n *\n * _.toUpper('__foo_bar__');\n * // => '__FOO_BAR__'\n */\n function toUpper(value) {\n return toString(value).toUpperCase();\n }\n\n /**\n * Removes leading and trailing whitespace or specified characters from `string`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to trim.\n * @param {string} [chars=whitespace] The characters to trim.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {string} Returns the trimmed string.\n * @example\n *\n * _.trim(' abc ');\n * // => 'abc'\n *\n * _.trim('-_-abc-_-', '_-');\n * // => 'abc'\n *\n * _.map([' foo ', ' bar '], _.trim);\n * // => ['foo', 'bar']\n */\n function trim(string, chars, guard) {\n string = toString(string);\n if (string && (guard || chars === undefined)) {\n return string.replace(reTrim, '');\n }\n if (!string || !(chars = baseToString(chars))) {\n return string;\n }\n var strSymbols = stringToArray(string),\n chrSymbols = stringToArray(chars),\n start = charsStartIndex(strSymbols, chrSymbols),\n end = charsEndIndex(strSymbols, chrSymbols) + 1;\n\n return castSlice(strSymbols, start, end).join('');\n }\n\n /**\n * Removes trailing whitespace or specified characters from `string`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to trim.\n * @param {string} [chars=whitespace] The characters to trim.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {string} Returns the trimmed string.\n * @example\n *\n * _.trimEnd(' abc ');\n * // => ' abc'\n *\n * _.trimEnd('-_-abc-_-', '_-');\n * // => '-_-abc'\n */\n function trimEnd(string, chars, guard) {\n string = toString(string);\n if (string && (guard || chars === undefined)) {\n return string.replace(reTrimEnd, '');\n }\n if (!string || !(chars = baseToString(chars))) {\n return string;\n }\n var strSymbols = stringToArray(string),\n end = charsEndIndex(strSymbols, stringToArray(chars)) + 1;\n\n return castSlice(strSymbols, 0, end).join('');\n }\n\n /**\n * Removes leading whitespace or specified characters from `string`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to trim.\n * @param {string} [chars=whitespace] The characters to trim.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {string} Returns the trimmed string.\n * @example\n *\n * _.trimStart(' abc ');\n * // => 'abc '\n *\n * _.trimStart('-_-abc-_-', '_-');\n * // => 'abc-_-'\n */\n function trimStart(string, chars, guard) {\n string = toString(string);\n if (string && (guard || chars === undefined)) {\n return string.replace(reTrimStart, '');\n }\n if (!string || !(chars = baseToString(chars))) {\n return string;\n }\n var strSymbols = stringToArray(string),\n start = charsStartIndex(strSymbols, stringToArray(chars));\n\n return castSlice(strSymbols, start).join('');\n }\n\n /**\n * Truncates `string` if it's longer than the given maximum string length.\n * The last characters of the truncated string are replaced with the omission\n * string which defaults to \"...\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to truncate.\n * @param {Object} [options={}] The options object.\n * @param {number} [options.length=30] The maximum string length.\n * @param {string} [options.omission='...'] The string to indicate text is omitted.\n * @param {RegExp|string} [options.separator] The separator pattern to truncate to.\n * @returns {string} Returns the truncated string.\n * @example\n *\n * _.truncate('hi-diddly-ho there, neighborino');\n * // => 'hi-diddly-ho there, neighbo...'\n *\n * _.truncate('hi-diddly-ho there, neighborino', {\n * 'length': 24,\n * 'separator': ' '\n * });\n * // => 'hi-diddly-ho there,...'\n *\n * _.truncate('hi-diddly-ho there, neighborino', {\n * 'length': 24,\n * 'separator': /,? +/\n * });\n * // => 'hi-diddly-ho there...'\n *\n * _.truncate('hi-diddly-ho there, neighborino', {\n * 'omission': ' [...]'\n * });\n * // => 'hi-diddly-ho there, neig [...]'\n */\n function truncate(string, options) {\n var length = DEFAULT_TRUNC_LENGTH,\n omission = DEFAULT_TRUNC_OMISSION;\n\n if (isObject(options)) {\n var separator = 'separator' in options ? options.separator : separator;\n length = 'length' in options ? toInteger(options.length) : length;\n omission = 'omission' in options ? baseToString(options.omission) : omission;\n }\n string = toString(string);\n\n var strLength = string.length;\n if (hasUnicode(string)) {\n var strSymbols = stringToArray(string);\n strLength = strSymbols.length;\n }\n if (length >= strLength) {\n return string;\n }\n var end = length - stringSize(omission);\n if (end < 1) {\n return omission;\n }\n var result = strSymbols\n ? castSlice(strSymbols, 0, end).join('')\n : string.slice(0, end);\n\n if (separator === undefined) {\n return result + omission;\n }\n if (strSymbols) {\n end += (result.length - end);\n }\n if (isRegExp(separator)) {\n if (string.slice(end).search(separator)) {\n var match,\n substring = result;\n\n if (!separator.global) {\n separator = RegExp(separator.source, toString(reFlags.exec(separator)) + 'g');\n }\n separator.lastIndex = 0;\n while ((match = separator.exec(substring))) {\n var newEnd = match.index;\n }\n result = result.slice(0, newEnd === undefined ? end : newEnd);\n }\n } else if (string.indexOf(baseToString(separator), end) != end) {\n var index = result.lastIndexOf(separator);\n if (index > -1) {\n result = result.slice(0, index);\n }\n }\n return result + omission;\n }\n\n /**\n * The inverse of `_.escape`; this method converts the HTML entities\n * `&amp;`, `&lt;`, `&gt;`, `&quot;`, and `&#39;` in `string` to\n * their corresponding characters.\n *\n * **Note:** No other HTML entities are unescaped. To unescape additional\n * HTML entities use a third-party library like [_he_](https://mths.be/he).\n *\n * @static\n * @memberOf _\n * @since 0.6.0\n * @category String\n * @param {string} [string=''] The string to unescape.\n * @returns {string} Returns the unescaped string.\n * @example\n *\n * _.unescape('fred, barney, &amp; pebbles');\n * // => 'fred, barney, & pebbles'\n */\n function unescape(string) {\n string = toString(string);\n return (string && reHasEscapedHtml.test(string))\n ? string.replace(reEscapedHtml, unescapeHtmlChar)\n : string;\n }\n\n /**\n * Converts `string`, as space separated words, to upper case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the upper cased string.\n * @example\n *\n * _.upperCase('--foo-bar');\n * // => 'FOO BAR'\n *\n * _.upperCase('fooBar');\n * // => 'FOO BAR'\n *\n * _.upperCase('__foo_bar__');\n * // => 'FOO BAR'\n */\n var upperCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + word.toUpperCase();\n });\n\n /**\n * Converts the first character of `string` to upper case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.upperFirst('fred');\n * // => 'Fred'\n *\n * _.upperFirst('FRED');\n * // => 'FRED'\n */\n var upperFirst = createCaseFirst('toUpperCase');\n\n /**\n * Splits `string` into an array of its words.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {RegExp|string} [pattern] The pattern to match words.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the words of `string`.\n * @example\n *\n * _.words('fred, barney, & pebbles');\n * // => ['fred', 'barney', 'pebbles']\n *\n * _.words('fred, barney, & pebbles', /[^, ]+/g);\n * // => ['fred', 'barney', '&', 'pebbles']\n */\n function words(string, pattern, guard) {\n string = toString(string);\n pattern = guard ? undefined : pattern;\n\n if (pattern === undefined) {\n return hasUnicodeWord(string) ? unicodeWords(string) : asciiWords(string);\n }\n return string.match(pattern) || [];\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Attempts to invoke `func`, returning either the result or the caught error\n * object. Any additional arguments are provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Util\n * @param {Function} func The function to attempt.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {*} Returns the `func` result or error object.\n * @example\n *\n * // Avoid throwing errors for invalid selectors.\n * var elements = _.attempt(function(selector) {\n * return document.querySelectorAll(selector);\n * }, '>_>');\n *\n * if (_.isError(elements)) {\n * elements = [];\n * }\n */\n var attempt = baseRest(function(func, args) {\n try {\n return apply(func, undefined, args);\n } catch (e) {\n return isError(e) ? e : new Error(e);\n }\n });\n\n /**\n * Binds methods of an object to the object itself, overwriting the existing\n * method.\n *\n * **Note:** This method doesn't set the \"length\" property of bound functions.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Util\n * @param {Object} object The object to bind and assign the bound methods to.\n * @param {...(string|string[])} methodNames The object method names to bind.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var view = {\n * 'label': 'docs',\n * 'click': function() {\n * console.log('clicked ' + this.label);\n * }\n * };\n *\n * _.bindAll(view, ['click']);\n * jQuery(element).on('click', view.click);\n * // => Logs 'clicked docs' when clicked.\n */\n var bindAll = flatRest(function(object, methodNames) {\n arrayEach(methodNames, function(key) {\n key = toKey(key);\n baseAssignValue(object, key, bind(object[key], object));\n });\n return object;\n });\n\n /**\n * Creates a function that iterates over `pairs` and invokes the corresponding\n * function of the first predicate to return truthy. The predicate-function\n * pairs are invoked with the `this` binding and arguments of the created\n * function.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Util\n * @param {Array} pairs The predicate-function pairs.\n * @returns {Function} Returns the new composite function.\n * @example\n *\n * var func = _.cond([\n * [_.matches({ 'a': 1 }), _.constant('matches A')],\n * [_.conforms({ 'b': _.isNumber }), _.constant('matches B')],\n * [_.stubTrue, _.constant('no match')]\n * ]);\n *\n * func({ 'a': 1, 'b': 2 });\n * // => 'matches A'\n *\n * func({ 'a': 0, 'b': 1 });\n * // => 'matches B'\n *\n * func({ 'a': '1', 'b': '2' });\n * // => 'no match'\n */\n function cond(pairs) {\n var length = pairs == null ? 0 : pairs.length,\n toIteratee = getIteratee();\n\n pairs = !length ? [] : arrayMap(pairs, function(pair) {\n if (typeof pair[1] != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return [toIteratee(pair[0]), pair[1]];\n });\n\n return baseRest(function(args) {\n var index = -1;\n while (++index < length) {\n var pair = pairs[index];\n if (apply(pair[0], this, args)) {\n return apply(pair[1], this, args);\n }\n }\n });\n }\n\n /**\n * Creates a function that invokes the predicate properties of `source` with\n * the corresponding property values of a given object, returning `true` if\n * all predicates return truthy, else `false`.\n *\n * **Note:** The created function is equivalent to `_.conformsTo` with\n * `source` partially applied.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Util\n * @param {Object} source The object of property predicates to conform to.\n * @returns {Function} Returns the new spec function.\n * @example\n *\n * var objects = [\n * { 'a': 2, 'b': 1 },\n * { 'a': 1, 'b': 2 }\n * ];\n *\n * _.filter(objects, _.conforms({ 'b': function(n) { return n > 1; } }));\n * // => [{ 'a': 1, 'b': 2 }]\n */\n function conforms(source) {\n return baseConforms(baseClone(source, CLONE_DEEP_FLAG));\n }\n\n /**\n * Creates a function that returns `value`.\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Util\n * @param {*} value The value to return from the new function.\n * @returns {Function} Returns the new constant function.\n * @example\n *\n * var objects = _.times(2, _.constant({ 'a': 1 }));\n *\n * console.log(objects);\n * // => [{ 'a': 1 }, { 'a': 1 }]\n *\n * console.log(objects[0] === objects[1]);\n * // => true\n */\n function constant(value) {\n return function() {\n return value;\n };\n }\n\n /**\n * Checks `value` to determine whether a default value should be returned in\n * its place. The `defaultValue` is returned if `value` is `NaN`, `null`,\n * or `undefined`.\n *\n * @static\n * @memberOf _\n * @since 4.14.0\n * @category Util\n * @param {*} value The value to check.\n * @param {*} defaultValue The default value.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * _.defaultTo(1, 10);\n * // => 1\n *\n * _.defaultTo(undefined, 10);\n * // => 10\n */\n function defaultTo(value, defaultValue) {\n return (value == null || value !== value) ? defaultValue : value;\n }\n\n /**\n * Creates a function that returns the result of invoking the given functions\n * with the `this` binding of the created function, where each successive\n * invocation is supplied the return value of the previous.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Util\n * @param {...(Function|Function[])} [funcs] The functions to invoke.\n * @returns {Function} Returns the new composite function.\n * @see _.flowRight\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var addSquare = _.flow([_.add, square]);\n * addSquare(1, 2);\n * // => 9\n */\n var flow = createFlow();\n\n /**\n * This method is like `_.flow` except that it creates a function that\n * invokes the given functions from right to left.\n *\n * @static\n * @since 3.0.0\n * @memberOf _\n * @category Util\n * @param {...(Function|Function[])} [funcs] The functions to invoke.\n * @returns {Function} Returns the new composite function.\n * @see _.flow\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var addSquare = _.flowRight([square, _.add]);\n * addSquare(1, 2);\n * // => 9\n */\n var flowRight = createFlow(true);\n\n /**\n * This method returns the first argument it receives.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Util\n * @param {*} value Any value.\n * @returns {*} Returns `value`.\n * @example\n *\n * var object = { 'a': 1 };\n *\n * console.log(_.identity(object) === object);\n * // => true\n */\n function identity(value) {\n return value;\n }\n\n /**\n * Creates a function that invokes `func` with the arguments of the created\n * function. If `func` is a property name, the created function returns the\n * property value for a given element. If `func` is an array or object, the\n * created function returns `true` for elements that contain the equivalent\n * source properties, otherwise it returns `false`.\n *\n * @static\n * @since 4.0.0\n * @memberOf _\n * @category Util\n * @param {*} [func=_.identity] The value to convert to a callback.\n * @returns {Function} Returns the callback.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.filter(users, _.iteratee({ 'user': 'barney', 'active': true }));\n * // => [{ 'user': 'barney', 'age': 36, 'active': true }]\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.filter(users, _.iteratee(['user', 'fred']));\n * // => [{ 'user': 'fred', 'age': 40 }]\n *\n * // The `_.property` iteratee shorthand.\n * _.map(users, _.iteratee('user'));\n * // => ['barney', 'fred']\n *\n * // Create custom iteratee shorthands.\n * _.iteratee = _.wrap(_.iteratee, function(iteratee, func) {\n * return !_.isRegExp(func) ? iteratee(func) : function(string) {\n * return func.test(string);\n * };\n * });\n *\n * _.filter(['abc', 'def'], /ef/);\n * // => ['def']\n */\n function iteratee(func) {\n return baseIteratee(typeof func == 'function' ? func : baseClone(func, CLONE_DEEP_FLAG));\n }\n\n /**\n * Creates a function that performs a partial deep comparison between a given\n * object and `source`, returning `true` if the given object has equivalent\n * property values, else `false`.\n *\n * **Note:** The created function is equivalent to `_.isMatch` with `source`\n * partially applied.\n *\n * Partial comparisons will match empty array and empty object `source`\n * values against any array or object value, respectively. See `_.isEqual`\n * for a list of supported value comparisons.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Util\n * @param {Object} source The object of property values to match.\n * @returns {Function} Returns the new spec function.\n * @example\n *\n * var objects = [\n * { 'a': 1, 'b': 2, 'c': 3 },\n * { 'a': 4, 'b': 5, 'c': 6 }\n * ];\n *\n * _.filter(objects, _.matches({ 'a': 4, 'c': 6 }));\n * // => [{ 'a': 4, 'b': 5, 'c': 6 }]\n */\n function matches(source) {\n return baseMatches(baseClone(source, CLONE_DEEP_FLAG));\n }\n\n /**\n * Creates a function that performs a partial deep comparison between the\n * value at `path` of a given object to `srcValue`, returning `true` if the\n * object value is equivalent, else `false`.\n *\n * **Note:** Partial comparisons will match empty array and empty object\n * `srcValue` values against any array or object value, respectively. See\n * `_.isEqual` for a list of supported value comparisons.\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Util\n * @param {Array|string} path The path of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n * @example\n *\n * var objects = [\n * { 'a': 1, 'b': 2, 'c': 3 },\n * { 'a': 4, 'b': 5, 'c': 6 }\n * ];\n *\n * _.find(objects, _.matchesProperty('a', 4));\n * // => { 'a': 4, 'b': 5, 'c': 6 }\n */\n function matchesProperty(path, srcValue) {\n return baseMatchesProperty(path, baseClone(srcValue, CLONE_DEEP_FLAG));\n }\n\n /**\n * Creates a function that invokes the method at `path` of a given object.\n * Any additional arguments are provided to the invoked method.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Util\n * @param {Array|string} path The path of the method to invoke.\n * @param {...*} [args] The arguments to invoke the method with.\n * @returns {Function} Returns the new invoker function.\n * @example\n *\n * var objects = [\n * { 'a': { 'b': _.constant(2) } },\n * { 'a': { 'b': _.constant(1) } }\n * ];\n *\n * _.map(objects, _.method('a.b'));\n * // => [2, 1]\n *\n * _.map(objects, _.method(['a', 'b']));\n * // => [2, 1]\n */\n var method = baseRest(function(path, args) {\n return function(object) {\n return baseInvoke(object, path, args);\n };\n });\n\n /**\n * The opposite of `_.method`; this method creates a function that invokes\n * the method at a given path of `object`. Any additional arguments are\n * provided to the invoked method.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Util\n * @param {Object} object The object to query.\n * @param {...*} [args] The arguments to invoke the method with.\n * @returns {Function} Returns the new invoker function.\n * @example\n *\n * var array = _.times(3, _.constant),\n * object = { 'a': array, 'b': array, 'c': array };\n *\n * _.map(['a[2]', 'c[0]'], _.methodOf(object));\n * // => [2, 0]\n *\n * _.map([['a', '2'], ['c', '0']], _.methodOf(object));\n * // => [2, 0]\n */\n var methodOf = baseRest(function(object, args) {\n return function(path) {\n return baseInvoke(object, path, args);\n };\n });\n\n /**\n * Adds all own enumerable string keyed function properties of a source\n * object to the destination object. If `object` is a function, then methods\n * are added to its prototype as well.\n *\n * **Note:** Use `_.runInContext` to create a pristine `lodash` function to\n * avoid conflicts caused by modifying the original.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Util\n * @param {Function|Object} [object=lodash] The destination object.\n * @param {Object} source The object of functions to add.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.chain=true] Specify whether mixins are chainable.\n * @returns {Function|Object} Returns `object`.\n * @example\n *\n * function vowels(string) {\n * return _.filter(string, function(v) {\n * return /[aeiou]/i.test(v);\n * });\n * }\n *\n * _.mixin({ 'vowels': vowels });\n * _.vowels('fred');\n * // => ['e']\n *\n * _('fred').vowels().value();\n * // => ['e']\n *\n * _.mixin({ 'vowels': vowels }, { 'chain': false });\n * _('fred').vowels();\n * // => ['e']\n */\n function mixin(object, source, options) {\n var props = keys(source),\n methodNames = baseFunctions(source, props);\n\n if (options == null &&\n !(isObject(source) && (methodNames.length || !props.length))) {\n options = source;\n source = object;\n object = this;\n methodNames = baseFunctions(source, keys(source));\n }\n var chain = !(isObject(options) && 'chain' in options) || !!options.chain,\n isFunc = isFunction(object);\n\n arrayEach(methodNames, function(methodName) {\n var func = source[methodName];\n object[methodName] = func;\n if (isFunc) {\n object.prototype[methodName] = function() {\n var chainAll = this.__chain__;\n if (chain || chainAll) {\n var result = object(this.__wrapped__),\n actions = result.__actions__ = copyArray(this.__actions__);\n\n actions.push({ 'func': func, 'args': arguments, 'thisArg': object });\n result.__chain__ = chainAll;\n return result;\n }\n return func.apply(object, arrayPush([this.value()], arguments));\n };\n }\n });\n\n return object;\n }\n\n /**\n * Reverts the `_` variable to its previous value and returns a reference to\n * the `lodash` function.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Util\n * @returns {Function} Returns the `lodash` function.\n * @example\n *\n * var lodash = _.noConflict();\n */\n function noConflict() {\n if (root._ === this) {\n root._ = oldDash;\n }\n return this;\n }\n\n /**\n * This method returns `undefined`.\n *\n * @static\n * @memberOf _\n * @since 2.3.0\n * @category Util\n * @example\n *\n * _.times(2, _.noop);\n * // => [undefined, undefined]\n */\n function noop() {\n // No operation performed.\n }\n\n /**\n * Creates a function that gets the argument at index `n`. If `n` is negative,\n * the nth argument from the end is returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Util\n * @param {number} [n=0] The index of the argument to return.\n * @returns {Function} Returns the new pass-thru function.\n * @example\n *\n * var func = _.nthArg(1);\n * func('a', 'b', 'c', 'd');\n * // => 'b'\n *\n * var func = _.nthArg(-2);\n * func('a', 'b', 'c', 'd');\n * // => 'c'\n */\n function nthArg(n) {\n n = toInteger(n);\n return baseRest(function(args) {\n return baseNth(args, n);\n });\n }\n\n /**\n * Creates a function that invokes `iteratees` with the arguments it receives\n * and returns their results.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Util\n * @param {...(Function|Function[])} [iteratees=[_.identity]]\n * The iteratees to invoke.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var func = _.over([Math.max, Math.min]);\n *\n * func(1, 2, 3, 4);\n * // => [4, 1]\n */\n var over = createOver(arrayMap);\n\n /**\n * Creates a function that checks if **all** of the `predicates` return\n * truthy when invoked with the arguments it receives.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Util\n * @param {...(Function|Function[])} [predicates=[_.identity]]\n * The predicates to check.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var func = _.overEvery([Boolean, isFinite]);\n *\n * func('1');\n * // => true\n *\n * func(null);\n * // => false\n *\n * func(NaN);\n * // => false\n */\n var overEvery = createOver(arrayEvery);\n\n /**\n * Creates a function that checks if **any** of the `predicates` return\n * truthy when invoked with the arguments it receives.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Util\n * @param {...(Function|Function[])} [predicates=[_.identity]]\n * The predicates to check.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var func = _.overSome([Boolean, isFinite]);\n *\n * func('1');\n * // => true\n *\n * func(null);\n * // => true\n *\n * func(NaN);\n * // => false\n */\n var overSome = createOver(arraySome);\n\n /**\n * Creates a function that returns the value at `path` of a given object.\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Util\n * @param {Array|string} path The path of the property to get.\n * @returns {Function} Returns the new accessor function.\n * @example\n *\n * var objects = [\n * { 'a': { 'b': 2 } },\n * { 'a': { 'b': 1 } }\n * ];\n *\n * _.map(objects, _.property('a.b'));\n * // => [2, 1]\n *\n * _.map(_.sortBy(objects, _.property(['a', 'b'])), 'a.b');\n * // => [1, 2]\n */\n function property(path) {\n return isKey(path) ? baseProperty(toKey(path)) : basePropertyDeep(path);\n }\n\n /**\n * The opposite of `_.property`; this method creates a function that returns\n * the value at a given path of `object`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Util\n * @param {Object} object The object to query.\n * @returns {Function} Returns the new accessor function.\n * @example\n *\n * var array = [0, 1, 2],\n * object = { 'a': array, 'b': array, 'c': array };\n *\n * _.map(['a[2]', 'c[0]'], _.propertyOf(object));\n * // => [2, 0]\n *\n * _.map([['a', '2'], ['c', '0']], _.propertyOf(object));\n * // => [2, 0]\n */\n function propertyOf(object) {\n return function(path) {\n return object == null ? undefined : baseGet(object, path);\n };\n }\n\n /**\n * Creates an array of numbers (positive and/or negative) progressing from\n * `start` up to, but not including, `end`. A step of `-1` is used if a negative\n * `start` is specified without an `end` or `step`. If `end` is not specified,\n * it's set to `start` with `start` then set to `0`.\n *\n * **Note:** JavaScript follows the IEEE-754 standard for resolving\n * floating-point values which can produce unexpected results.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Util\n * @param {number} [start=0] The start of the range.\n * @param {number} end The end of the range.\n * @param {number} [step=1] The value to increment or decrement by.\n * @returns {Array} Returns the range of numbers.\n * @see _.inRange, _.rangeRight\n * @example\n *\n * _.range(4);\n * // => [0, 1, 2, 3]\n *\n * _.range(-4);\n * // => [0, -1, -2, -3]\n *\n * _.range(1, 5);\n * // => [1, 2, 3, 4]\n *\n * _.range(0, 20, 5);\n * // => [0, 5, 10, 15]\n *\n * _.range(0, -4, -1);\n * // => [0, -1, -2, -3]\n *\n * _.range(1, 4, 0);\n * // => [1, 1, 1]\n *\n * _.range(0);\n * // => []\n */\n var range = createRange();\n\n /**\n * This method is like `_.range` except that it populates values in\n * descending order.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Util\n * @param {number} [start=0] The start of the range.\n * @param {number} end The end of the range.\n * @param {number} [step=1] The value to increment or decrement by.\n * @returns {Array} Returns the range of numbers.\n * @see _.inRange, _.range\n * @example\n *\n * _.rangeRight(4);\n * // => [3, 2, 1, 0]\n *\n * _.rangeRight(-4);\n * // => [-3, -2, -1, 0]\n *\n * _.rangeRight(1, 5);\n * // => [4, 3, 2, 1]\n *\n * _.rangeRight(0, 20, 5);\n * // => [15, 10, 5, 0]\n *\n * _.rangeRight(0, -4, -1);\n * // => [-3, -2, -1, 0]\n *\n * _.rangeRight(1, 4, 0);\n * // => [1, 1, 1]\n *\n * _.rangeRight(0);\n * // => []\n */\n var rangeRight = createRange(true);\n\n /**\n * This method returns a new empty array.\n *\n * @static\n * @memberOf _\n * @since 4.13.0\n * @category Util\n * @returns {Array} Returns the new empty array.\n * @example\n *\n * var arrays = _.times(2, _.stubArray);\n *\n * console.log(arrays);\n * // => [[], []]\n *\n * console.log(arrays[0] === arrays[1]);\n * // => false\n */\n function stubArray() {\n return [];\n }\n\n /**\n * This method returns `false`.\n *\n * @static\n * @memberOf _\n * @since 4.13.0\n * @category Util\n * @returns {boolean} Returns `false`.\n * @example\n *\n * _.times(2, _.stubFalse);\n * // => [false, false]\n */\n function stubFalse() {\n return false;\n }\n\n /**\n * This method returns a new empty object.\n *\n * @static\n * @memberOf _\n * @since 4.13.0\n * @category Util\n * @returns {Object} Returns the new empty object.\n * @example\n *\n * var objects = _.times(2, _.stubObject);\n *\n * console.log(objects);\n * // => [{}, {}]\n *\n * console.log(objects[0] === objects[1]);\n * // => false\n */\n function stubObject() {\n return {};\n }\n\n /**\n * This method returns an empty string.\n *\n * @static\n * @memberOf _\n * @since 4.13.0\n * @category Util\n * @returns {string} Returns the empty string.\n * @example\n *\n * _.times(2, _.stubString);\n * // => ['', '']\n */\n function stubString() {\n return '';\n }\n\n /**\n * This method returns `true`.\n *\n * @static\n * @memberOf _\n * @since 4.13.0\n * @category Util\n * @returns {boolean} Returns `true`.\n * @example\n *\n * _.times(2, _.stubTrue);\n * // => [true, true]\n */\n function stubTrue() {\n return true;\n }\n\n /**\n * Invokes the iteratee `n` times, returning an array of the results of\n * each invocation. The iteratee is invoked with one argument; (index).\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Util\n * @param {number} n The number of times to invoke `iteratee`.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the array of results.\n * @example\n *\n * _.times(3, String);\n * // => ['0', '1', '2']\n *\n * _.times(4, _.constant(0));\n * // => [0, 0, 0, 0]\n */\n function times(n, iteratee) {\n n = toInteger(n);\n if (n < 1 || n > MAX_SAFE_INTEGER) {\n return [];\n }\n var index = MAX_ARRAY_LENGTH,\n length = nativeMin(n, MAX_ARRAY_LENGTH);\n\n iteratee = getIteratee(iteratee);\n n -= MAX_ARRAY_LENGTH;\n\n var result = baseTimes(length, iteratee);\n while (++index < n) {\n iteratee(index);\n }\n return result;\n }\n\n /**\n * Converts `value` to a property path array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Util\n * @param {*} value The value to convert.\n * @returns {Array} Returns the new property path array.\n * @example\n *\n * _.toPath('a.b.c');\n * // => ['a', 'b', 'c']\n *\n * _.toPath('a[0].b.c');\n * // => ['a', '0', 'b', 'c']\n */\n function toPath(value) {\n if (isArray(value)) {\n return arrayMap(value, toKey);\n }\n return isSymbol(value) ? [value] : copyArray(stringToPath(toString(value)));\n }\n\n /**\n * Generates a unique ID. If `prefix` is given, the ID is appended to it.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Util\n * @param {string} [prefix=''] The value to prefix the ID with.\n * @returns {string} Returns the unique ID.\n * @example\n *\n * _.uniqueId('contact_');\n * // => 'contact_104'\n *\n * _.uniqueId();\n * // => '105'\n */\n function uniqueId(prefix) {\n var id = ++idCounter;\n return toString(prefix) + id;\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Adds two numbers.\n *\n * @static\n * @memberOf _\n * @since 3.4.0\n * @category Math\n * @param {number} augend The first number in an addition.\n * @param {number} addend The second number in an addition.\n * @returns {number} Returns the total.\n * @example\n *\n * _.add(6, 4);\n * // => 10\n */\n var add = createMathOperation(function(augend, addend) {\n return augend + addend;\n }, 0);\n\n /**\n * Computes `number` rounded up to `precision`.\n *\n * @static\n * @memberOf _\n * @since 3.10.0\n * @category Math\n * @param {number} number The number to round up.\n * @param {number} [precision=0] The precision to round up to.\n * @returns {number} Returns the rounded up number.\n * @example\n *\n * _.ceil(4.006);\n * // => 5\n *\n * _.ceil(6.004, 2);\n * // => 6.01\n *\n * _.ceil(6040, -2);\n * // => 6100\n */\n var ceil = createRound('ceil');\n\n /**\n * Divide two numbers.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Math\n * @param {number} dividend The first number in a division.\n * @param {number} divisor The second number in a division.\n * @returns {number} Returns the quotient.\n * @example\n *\n * _.divide(6, 4);\n * // => 1.5\n */\n var divide = createMathOperation(function(dividend, divisor) {\n return dividend / divisor;\n }, 1);\n\n /**\n * Computes `number` rounded down to `precision`.\n *\n * @static\n * @memberOf _\n * @since 3.10.0\n * @category Math\n * @param {number} number The number to round down.\n * @param {number} [precision=0] The precision to round down to.\n * @returns {number} Returns the rounded down number.\n * @example\n *\n * _.floor(4.006);\n * // => 4\n *\n * _.floor(0.046, 2);\n * // => 0.04\n *\n * _.floor(4060, -2);\n * // => 4000\n */\n var floor = createRound('floor');\n\n /**\n * Computes the maximum value of `array`. If `array` is empty or falsey,\n * `undefined` is returned.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Math\n * @param {Array} array The array to iterate over.\n * @returns {*} Returns the maximum value.\n * @example\n *\n * _.max([4, 2, 8, 6]);\n * // => 8\n *\n * _.max([]);\n * // => undefined\n */\n function max(array) {\n return (array && array.length)\n ? baseExtremum(array, identity, baseGt)\n : undefined;\n }\n\n /**\n * This method is like `_.max` except that it accepts `iteratee` which is\n * invoked for each element in `array` to generate the criterion by which\n * the value is ranked. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Math\n * @param {Array} array The array to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {*} Returns the maximum value.\n * @example\n *\n * var objects = [{ 'n': 1 }, { 'n': 2 }];\n *\n * _.maxBy(objects, function(o) { return o.n; });\n * // => { 'n': 2 }\n *\n * // The `_.property` iteratee shorthand.\n * _.maxBy(objects, 'n');\n * // => { 'n': 2 }\n */\n function maxBy(array, iteratee) {\n return (array && array.length)\n ? baseExtremum(array, getIteratee(iteratee, 2), baseGt)\n : undefined;\n }\n\n /**\n * Computes the mean of the values in `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Math\n * @param {Array} array The array to iterate over.\n * @returns {number} Returns the mean.\n * @example\n *\n * _.mean([4, 2, 8, 6]);\n * // => 5\n */\n function mean(array) {\n return baseMean(array, identity);\n }\n\n /**\n * This method is like `_.mean` except that it accepts `iteratee` which is\n * invoked for each element in `array` to generate the value to be averaged.\n * The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Math\n * @param {Array} array The array to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the mean.\n * @example\n *\n * var objects = [{ 'n': 4 }, { 'n': 2 }, { 'n': 8 }, { 'n': 6 }];\n *\n * _.meanBy(objects, function(o) { return o.n; });\n * // => 5\n *\n * // The `_.property` iteratee shorthand.\n * _.meanBy(objects, 'n');\n * // => 5\n */\n function meanBy(array, iteratee) {\n return baseMean(array, getIteratee(iteratee, 2));\n }\n\n /**\n * Computes the minimum value of `array`. If `array` is empty or falsey,\n * `undefined` is returned.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Math\n * @param {Array} array The array to iterate over.\n * @returns {*} Returns the minimum value.\n * @example\n *\n * _.min([4, 2, 8, 6]);\n * // => 2\n *\n * _.min([]);\n * // => undefined\n */\n function min(array) {\n return (array && array.length)\n ? baseExtremum(array, identity, baseLt)\n : undefined;\n }\n\n /**\n * This method is like `_.min` except that it accepts `iteratee` which is\n * invoked for each element in `array` to generate the criterion by which\n * the value is ranked. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Math\n * @param {Array} array The array to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {*} Returns the minimum value.\n * @example\n *\n * var objects = [{ 'n': 1 }, { 'n': 2 }];\n *\n * _.minBy(objects, function(o) { return o.n; });\n * // => { 'n': 1 }\n *\n * // The `_.property` iteratee shorthand.\n * _.minBy(objects, 'n');\n * // => { 'n': 1 }\n */\n function minBy(array, iteratee) {\n return (array && array.length)\n ? baseExtremum(array, getIteratee(iteratee, 2), baseLt)\n : undefined;\n }\n\n /**\n * Multiply two numbers.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Math\n * @param {number} multiplier The first number in a multiplication.\n * @param {number} multiplicand The second number in a multiplication.\n * @returns {number} Returns the product.\n * @example\n *\n * _.multiply(6, 4);\n * // => 24\n */\n var multiply = createMathOperation(function(multiplier, multiplicand) {\n return multiplier * multiplicand;\n }, 1);\n\n /**\n * Computes `number` rounded to `precision`.\n *\n * @static\n * @memberOf _\n * @since 3.10.0\n * @category Math\n * @param {number} number The number to round.\n * @param {number} [precision=0] The precision to round to.\n * @returns {number} Returns the rounded number.\n * @example\n *\n * _.round(4.006);\n * // => 4\n *\n * _.round(4.006, 2);\n * // => 4.01\n *\n * _.round(4060, -2);\n * // => 4100\n */\n var round = createRound('round');\n\n /**\n * Subtract two numbers.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Math\n * @param {number} minuend The first number in a subtraction.\n * @param {number} subtrahend The second number in a subtraction.\n * @returns {number} Returns the difference.\n * @example\n *\n * _.subtract(6, 4);\n * // => 2\n */\n var subtract = createMathOperation(function(minuend, subtrahend) {\n return minuend - subtrahend;\n }, 0);\n\n /**\n * Computes the sum of the values in `array`.\n *\n * @static\n * @memberOf _\n * @since 3.4.0\n * @category Math\n * @param {Array} array The array to iterate over.\n * @returns {number} Returns the sum.\n * @example\n *\n * _.sum([4, 2, 8, 6]);\n * // => 20\n */\n function sum(array) {\n return (array && array.length)\n ? baseSum(array, identity)\n : 0;\n }\n\n /**\n * This method is like `_.sum` except that it accepts `iteratee` which is\n * invoked for each element in `array` to generate the value to be summed.\n * The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Math\n * @param {Array} array The array to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the sum.\n * @example\n *\n * var objects = [{ 'n': 4 }, { 'n': 2 }, { 'n': 8 }, { 'n': 6 }];\n *\n * _.sumBy(objects, function(o) { return o.n; });\n * // => 20\n *\n * // The `_.property` iteratee shorthand.\n * _.sumBy(objects, 'n');\n * // => 20\n */\n function sumBy(array, iteratee) {\n return (array && array.length)\n ? baseSum(array, getIteratee(iteratee, 2))\n : 0;\n }\n\n /*------------------------------------------------------------------------*/\n\n // Add methods that return wrapped values in chain sequences.\n lodash.after = after;\n lodash.ary = ary;\n lodash.assign = assign;\n lodash.assignIn = assignIn;\n lodash.assignInWith = assignInWith;\n lodash.assignWith = assignWith;\n lodash.at = at;\n lodash.before = before;\n lodash.bind = bind;\n lodash.bindAll = bindAll;\n lodash.bindKey = bindKey;\n lodash.castArray = castArray;\n lodash.chain = chain;\n lodash.chunk = chunk;\n lodash.compact = compact;\n lodash.concat = concat;\n lodash.cond = cond;\n lodash.conforms = conforms;\n lodash.constant = constant;\n lodash.countBy = countBy;\n lodash.create = create;\n lodash.curry = curry;\n lodash.curryRight = curryRight;\n lodash.debounce = debounce;\n lodash.defaults = defaults;\n lodash.defaultsDeep = defaultsDeep;\n lodash.defer = defer;\n lodash.delay = delay;\n lodash.difference = difference;\n lodash.differenceBy = differenceBy;\n lodash.differenceWith = differenceWith;\n lodash.drop = drop;\n lodash.dropRight = dropRight;\n lodash.dropRightWhile = dropRightWhile;\n lodash.dropWhile = dropWhile;\n lodash.fill = fill;\n lodash.filter = filter;\n lodash.flatMap = flatMap;\n lodash.flatMapDeep = flatMapDeep;\n lodash.flatMapDepth = flatMapDepth;\n lodash.flatten = flatten;\n lodash.flattenDeep = flattenDeep;\n lodash.flattenDepth = flattenDepth;\n lodash.flip = flip;\n lodash.flow = flow;\n lodash.flowRight = flowRight;\n lodash.fromPairs = fromPairs;\n lodash.functions = functions;\n lodash.functionsIn = functionsIn;\n lodash.groupBy = groupBy;\n lodash.initial = initial;\n lodash.intersection = intersection;\n lodash.intersectionBy = intersectionBy;\n lodash.intersectionWith = intersectionWith;\n lodash.invert = invert;\n lodash.invertBy = invertBy;\n lodash.invokeMap = invokeMap;\n lodash.iteratee = iteratee;\n lodash.keyBy = keyBy;\n lodash.keys = keys;\n lodash.keysIn = keysIn;\n lodash.map = map;\n lodash.mapKeys = mapKeys;\n lodash.mapValues = mapValues;\n lodash.matches = matches;\n lodash.matchesProperty = matchesProperty;\n lodash.memoize = memoize;\n lodash.merge = merge;\n lodash.mergeWith = mergeWith;\n lodash.method = method;\n lodash.methodOf = methodOf;\n lodash.mixin = mixin;\n lodash.negate = negate;\n lodash.nthArg = nthArg;\n lodash.omit = omit;\n lodash.omitBy = omitBy;\n lodash.once = once;\n lodash.orderBy = orderBy;\n lodash.over = over;\n lodash.overArgs = overArgs;\n lodash.overEvery = overEvery;\n lodash.overSome = overSome;\n lodash.partial = partial;\n lodash.partialRight = partialRight;\n lodash.partition = partition;\n lodash.pick = pick;\n lodash.pickBy = pickBy;\n lodash.property = property;\n lodash.propertyOf = propertyOf;\n lodash.pull = pull;\n lodash.pullAll = pullAll;\n lodash.pullAllBy = pullAllBy;\n lodash.pullAllWith = pullAllWith;\n lodash.pullAt = pullAt;\n lodash.range = range;\n lodash.rangeRight = rangeRight;\n lodash.rearg = rearg;\n lodash.reject = reject;\n lodash.remove = remove;\n lodash.rest = rest;\n lodash.reverse = reverse;\n lodash.sampleSize = sampleSize;\n lodash.set = set;\n lodash.setWith = setWith;\n lodash.shuffle = shuffle;\n lodash.slice = slice;\n lodash.sortBy = sortBy;\n lodash.sortedUniq = sortedUniq;\n lodash.sortedUniqBy = sortedUniqBy;\n lodash.split = split;\n lodash.spread = spread;\n lodash.tail = tail;\n lodash.take = take;\n lodash.takeRight = takeRight;\n lodash.takeRightWhile = takeRightWhile;\n lodash.takeWhile = takeWhile;\n lodash.tap = tap;\n lodash.throttle = throttle;\n lodash.thru = thru;\n lodash.toArray = toArray;\n lodash.toPairs = toPairs;\n lodash.toPairsIn = toPairsIn;\n lodash.toPath = toPath;\n lodash.toPlainObject = toPlainObject;\n lodash.transform = transform;\n lodash.unary = unary;\n lodash.union = union;\n lodash.unionBy = unionBy;\n lodash.unionWith = unionWith;\n lodash.uniq = uniq;\n lodash.uniqBy = uniqBy;\n lodash.uniqWith = uniqWith;\n lodash.unset = unset;\n lodash.unzip = unzip;\n lodash.unzipWith = unzipWith;\n lodash.update = update;\n lodash.updateWith = updateWith;\n lodash.values = values;\n lodash.valuesIn = valuesIn;\n lodash.without = without;\n lodash.words = words;\n lodash.wrap = wrap;\n lodash.xor = xor;\n lodash.xorBy = xorBy;\n lodash.xorWith = xorWith;\n lodash.zip = zip;\n lodash.zipObject = zipObject;\n lodash.zipObjectDeep = zipObjectDeep;\n lodash.zipWith = zipWith;\n\n // Add aliases.\n lodash.entries = toPairs;\n lodash.entriesIn = toPairsIn;\n lodash.extend = assignIn;\n lodash.extendWith = assignInWith;\n\n // Add methods to `lodash.prototype`.\n mixin(lodash, lodash);\n\n /*------------------------------------------------------------------------*/\n\n // Add methods that return unwrapped values in chain sequences.\n lodash.add = add;\n lodash.attempt = attempt;\n lodash.camelCase = camelCase;\n lodash.capitalize = capitalize;\n lodash.ceil = ceil;\n lodash.clamp = clamp;\n lodash.clone = clone;\n lodash.cloneDeep = cloneDeep;\n lodash.cloneDeepWith = cloneDeepWith;\n lodash.cloneWith = cloneWith;\n lodash.conformsTo = conformsTo;\n lodash.deburr = deburr;\n lodash.defaultTo = defaultTo;\n lodash.divide = divide;\n lodash.endsWith = endsWith;\n lodash.eq = eq;\n lodash.escape = escape;\n lodash.escapeRegExp = escapeRegExp;\n lodash.every = every;\n lodash.find = find;\n lodash.findIndex = findIndex;\n lodash.findKey = findKey;\n lodash.findLast = findLast;\n lodash.findLastIndex = findLastIndex;\n lodash.findLastKey = findLastKey;\n lodash.floor = floor;\n lodash.forEach = forEach;\n lodash.forEachRight = forEachRight;\n lodash.forIn = forIn;\n lodash.forInRight = forInRight;\n lodash.forOwn = forOwn;\n lodash.forOwnRight = forOwnRight;\n lodash.get = get;\n lodash.gt = gt;\n lodash.gte = gte;\n lodash.has = has;\n lodash.hasIn = hasIn;\n lodash.head = head;\n lodash.identity = identity;\n lodash.includes = includes;\n lodash.indexOf = indexOf;\n lodash.inRange = inRange;\n lodash.invoke = invoke;\n lodash.isArguments = isArguments;\n lodash.isArray = isArray;\n lodash.isArrayBuffer = isArrayBuffer;\n lodash.isArrayLike = isArrayLike;\n lodash.isArrayLikeObject = isArrayLikeObject;\n lodash.isBoolean = isBoolean;\n lodash.isBuffer = isBuffer;\n lodash.isDate = isDate;\n lodash.isElement = isElement;\n lodash.isEmpty = isEmpty;\n lodash.isEqual = isEqual;\n lodash.isEqualWith = isEqualWith;\n lodash.isError = isError;\n lodash.isFinite = isFinite;\n lodash.isFunction = isFunction;\n lodash.isInteger = isInteger;\n lodash.isLength = isLength;\n lodash.isMap = isMap;\n lodash.isMatch = isMatch;\n lodash.isMatchWith = isMatchWith;\n lodash.isNaN = isNaN;\n lodash.isNative = isNative;\n lodash.isNil = isNil;\n lodash.isNull = isNull;\n lodash.isNumber = isNumber;\n lodash.isObject = isObject;\n lodash.isObjectLike = isObjectLike;\n lodash.isPlainObject = isPlainObject;\n lodash.isRegExp = isRegExp;\n lodash.isSafeInteger = isSafeInteger;\n lodash.isSet = isSet;\n lodash.isString = isString;\n lodash.isSymbol = isSymbol;\n lodash.isTypedArray = isTypedArray;\n lodash.isUndefined = isUndefined;\n lodash.isWeakMap = isWeakMap;\n lodash.isWeakSet = isWeakSet;\n lodash.join = join;\n lodash.kebabCase = kebabCase;\n lodash.last = last;\n lodash.lastIndexOf = lastIndexOf;\n lodash.lowerCase = lowerCase;\n lodash.lowerFirst = lowerFirst;\n lodash.lt = lt;\n lodash.lte = lte;\n lodash.max = max;\n lodash.maxBy = maxBy;\n lodash.mean = mean;\n lodash.meanBy = meanBy;\n lodash.min = min;\n lodash.minBy = minBy;\n lodash.stubArray = stubArray;\n lodash.stubFalse = stubFalse;\n lodash.stubObject = stubObject;\n lodash.stubString = stubString;\n lodash.stubTrue = stubTrue;\n lodash.multiply = multiply;\n lodash.nth = nth;\n lodash.noConflict = noConflict;\n lodash.noop = noop;\n lodash.now = now;\n lodash.pad = pad;\n lodash.padEnd = padEnd;\n lodash.padStart = padStart;\n lodash.parseInt = parseInt;\n lodash.random = random;\n lodash.reduce = reduce;\n lodash.reduceRight = reduceRight;\n lodash.repeat = repeat;\n lodash.replace = replace;\n lodash.result = result;\n lodash.round = round;\n lodash.runInContext = runInContext;\n lodash.sample = sample;\n lodash.size = size;\n lodash.snakeCase = snakeCase;\n lodash.some = some;\n lodash.sortedIndex = sortedIndex;\n lodash.sortedIndexBy = sortedIndexBy;\n lodash.sortedIndexOf = sortedIndexOf;\n lodash.sortedLastIndex = sortedLastIndex;\n lodash.sortedLastIndexBy = sortedLastIndexBy;\n lodash.sortedLastIndexOf = sortedLastIndexOf;\n lodash.startCase = startCase;\n lodash.startsWith = startsWith;\n lodash.subtract = subtract;\n lodash.sum = sum;\n lodash.sumBy = sumBy;\n lodash.template = template;\n lodash.times = times;\n lodash.toFinite = toFinite;\n lodash.toInteger = toInteger;\n lodash.toLength = toLength;\n lodash.toLower = toLower;\n lodash.toNumber = toNumber;\n lodash.toSafeInteger = toSafeInteger;\n lodash.toString = toString;\n lodash.toUpper = toUpper;\n lodash.trim = trim;\n lodash.trimEnd = trimEnd;\n lodash.trimStart = trimStart;\n lodash.truncate = truncate;\n lodash.unescape = unescape;\n lodash.uniqueId = uniqueId;\n lodash.upperCase = upperCase;\n lodash.upperFirst = upperFirst;\n\n // Add aliases.\n lodash.each = forEach;\n lodash.eachRight = forEachRight;\n lodash.first = head;\n\n mixin(lodash, (function() {\n var source = {};\n baseForOwn(lodash, function(func, methodName) {\n if (!hasOwnProperty.call(lodash.prototype, methodName)) {\n source[methodName] = func;\n }\n });\n return source;\n }()), { 'chain': false });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * The semantic version number.\n *\n * @static\n * @memberOf _\n * @type {string}\n */\n lodash.VERSION = VERSION;\n\n // Assign default placeholders.\n arrayEach(['bind', 'bindKey', 'curry', 'curryRight', 'partial', 'partialRight'], function(methodName) {\n lodash[methodName].placeholder = lodash;\n });\n\n // Add `LazyWrapper` methods for `_.drop` and `_.take` variants.\n arrayEach(['drop', 'take'], function(methodName, index) {\n LazyWrapper.prototype[methodName] = function(n) {\n n = n === undefined ? 1 : nativeMax(toInteger(n), 0);\n\n var result = (this.__filtered__ && !index)\n ? new LazyWrapper(this)\n : this.clone();\n\n if (result.__filtered__) {\n result.__takeCount__ = nativeMin(n, result.__takeCount__);\n } else {\n result.__views__.push({\n 'size': nativeMin(n, MAX_ARRAY_LENGTH),\n 'type': methodName + (result.__dir__ < 0 ? 'Right' : '')\n });\n }\n return result;\n };\n\n LazyWrapper.prototype[methodName + 'Right'] = function(n) {\n return this.reverse()[methodName](n).reverse();\n };\n });\n\n // Add `LazyWrapper` methods that accept an `iteratee` value.\n arrayEach(['filter', 'map', 'takeWhile'], function(methodName, index) {\n var type = index + 1,\n isFilter = type == LAZY_FILTER_FLAG || type == LAZY_WHILE_FLAG;\n\n LazyWrapper.prototype[methodName] = function(iteratee) {\n var result = this.clone();\n result.__iteratees__.push({\n 'iteratee': getIteratee(iteratee, 3),\n 'type': type\n });\n result.__filtered__ = result.__filtered__ || isFilter;\n return result;\n };\n });\n\n // Add `LazyWrapper` methods for `_.head` and `_.last`.\n arrayEach(['head', 'last'], function(methodName, index) {\n var takeName = 'take' + (index ? 'Right' : '');\n\n LazyWrapper.prototype[methodName] = function() {\n return this[takeName](1).value()[0];\n };\n });\n\n // Add `LazyWrapper` methods for `_.initial` and `_.tail`.\n arrayEach(['initial', 'tail'], function(methodName, index) {\n var dropName = 'drop' + (index ? '' : 'Right');\n\n LazyWrapper.prototype[methodName] = function() {\n return this.__filtered__ ? new LazyWrapper(this) : this[dropName](1);\n };\n });\n\n LazyWrapper.prototype.compact = function() {\n return this.filter(identity);\n };\n\n LazyWrapper.prototype.find = function(predicate) {\n return this.filter(predicate).head();\n };\n\n LazyWrapper.prototype.findLast = function(predicate) {\n return this.reverse().find(predicate);\n };\n\n LazyWrapper.prototype.invokeMap = baseRest(function(path, args) {\n if (typeof path == 'function') {\n return new LazyWrapper(this);\n }\n return this.map(function(value) {\n return baseInvoke(value, path, args);\n });\n });\n\n LazyWrapper.prototype.reject = function(predicate) {\n return this.filter(negate(getIteratee(predicate)));\n };\n\n LazyWrapper.prototype.slice = function(start, end) {\n start = toInteger(start);\n\n var result = this;\n if (result.__filtered__ && (start > 0 || end < 0)) {\n return new LazyWrapper(result);\n }\n if (start < 0) {\n result = result.takeRight(-start);\n } else if (start) {\n result = result.drop(start);\n }\n if (end !== undefined) {\n end = toInteger(end);\n result = end < 0 ? result.dropRight(-end) : result.take(end - start);\n }\n return result;\n };\n\n LazyWrapper.prototype.takeRightWhile = function(predicate) {\n return this.reverse().takeWhile(predicate).reverse();\n };\n\n LazyWrapper.prototype.toArray = function() {\n return this.take(MAX_ARRAY_LENGTH);\n };\n\n // Add `LazyWrapper` methods to `lodash.prototype`.\n baseForOwn(LazyWrapper.prototype, function(func, methodName) {\n var checkIteratee = /^(?:filter|find|map|reject)|While$/.test(methodName),\n isTaker = /^(?:head|last)$/.test(methodName),\n lodashFunc = lodash[isTaker ? ('take' + (methodName == 'last' ? 'Right' : '')) : methodName],\n retUnwrapped = isTaker || /^find/.test(methodName);\n\n if (!lodashFunc) {\n return;\n }\n lodash.prototype[methodName] = function() {\n var value = this.__wrapped__,\n args = isTaker ? [1] : arguments,\n isLazy = value instanceof LazyWrapper,\n iteratee = args[0],\n useLazy = isLazy || isArray(value);\n\n var interceptor = function(value) {\n var result = lodashFunc.apply(lodash, arrayPush([value], args));\n return (isTaker && chainAll) ? result[0] : result;\n };\n\n if (useLazy && checkIteratee && typeof iteratee == 'function' && iteratee.length != 1) {\n // Avoid lazy use if the iteratee has a \"length\" value other than `1`.\n isLazy = useLazy = false;\n }\n var chainAll = this.__chain__,\n isHybrid = !!this.__actions__.length,\n isUnwrapped = retUnwrapped && !chainAll,\n onlyLazy = isLazy && !isHybrid;\n\n if (!retUnwrapped && useLazy) {\n value = onlyLazy ? value : new LazyWrapper(this);\n var result = func.apply(value, args);\n result.__actions__.push({ 'func': thru, 'args': [interceptor], 'thisArg': undefined });\n return new LodashWrapper(result, chainAll);\n }\n if (isUnwrapped && onlyLazy) {\n return func.apply(this, args);\n }\n result = this.thru(interceptor);\n return isUnwrapped ? (isTaker ? result.value()[0] : result.value()) : result;\n };\n });\n\n // Add `Array` methods to `lodash.prototype`.\n arrayEach(['pop', 'push', 'shift', 'sort', 'splice', 'unshift'], function(methodName) {\n var func = arrayProto[methodName],\n chainName = /^(?:push|sort|unshift)$/.test(methodName) ? 'tap' : 'thru',\n retUnwrapped = /^(?:pop|shift)$/.test(methodName);\n\n lodash.prototype[methodName] = function() {\n var args = arguments;\n if (retUnwrapped && !this.__chain__) {\n var value = this.value();\n return func.apply(isArray(value) ? value : [], args);\n }\n return this[chainName](function(value) {\n return func.apply(isArray(value) ? value : [], args);\n });\n };\n });\n\n // Map minified method names to their real names.\n baseForOwn(LazyWrapper.prototype, function(func, methodName) {\n var lodashFunc = lodash[methodName];\n if (lodashFunc) {\n var key = (lodashFunc.name + ''),\n names = realNames[key] || (realNames[key] = []);\n\n names.push({ 'name': methodName, 'func': lodashFunc });\n }\n });\n\n realNames[createHybrid(undefined, WRAP_BIND_KEY_FLAG).name] = [{\n 'name': 'wrapper',\n 'func': undefined\n }];\n\n // Add methods to `LazyWrapper`.\n LazyWrapper.prototype.clone = lazyClone;\n LazyWrapper.prototype.reverse = lazyReverse;\n LazyWrapper.prototype.value = lazyValue;\n\n // Add chain sequence methods to the `lodash` wrapper.\n lodash.prototype.at = wrapperAt;\n lodash.prototype.chain = wrapperChain;\n lodash.prototype.commit = wrapperCommit;\n lodash.prototype.next = wrapperNext;\n lodash.prototype.plant = wrapperPlant;\n lodash.prototype.reverse = wrapperReverse;\n lodash.prototype.toJSON = lodash.prototype.valueOf = lodash.prototype.value = wrapperValue;\n\n // Add lazy aliases.\n lodash.prototype.first = lodash.prototype.head;\n\n if (symIterator) {\n lodash.prototype[symIterator] = wrapperToIterator;\n }\n return lodash;\n });\n\n /*--------------------------------------------------------------------------*/\n\n // Export lodash.\n var _ = runInContext();\n\n // Some AMD build optimizers, like r.js, check for condition patterns like:\n if (true) {\n // Expose Lodash on the global object to prevent errors when Lodash is\n // loaded by a script tag in the presence of an AMD loader.\n // See http://requirejs.org/docs/errors.html#mismatch for more details.\n // Use `_.noConflict` to remove Lodash from the global object.\n root._ = _;\n\n // Define as an anonymous module so, through path mapping, it can be\n // referenced as the \"underscore\" module.\n !(__WEBPACK_AMD_DEFINE_RESULT__ = (function() {\n return _;\n }).call(exports, __webpack_require__, exports, module),\n\t\t\t\t__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));\n }\n // Check for `exports` after `define` in case a build optimizer adds it.\n else {}\n}.call(this));\n\n/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(/*! ./../../../../../../../usr/local/lib/node_modules/webpack/buildin/global.js */ \"../../../../../usr/local/lib/node_modules/webpack/buildin/global.js\"), __webpack_require__(/*! ./../../../../../../../usr/local/lib/node_modules/webpack/buildin/module.js */ \"../../../../../usr/local/lib/node_modules/webpack/buildin/module.js\")(module)))\n\n//# sourceURL=webpack:///./node_modules/lodash/lodash.js?");
/***/ }),
/***/ "./node_modules/pjax/index.js":
/*!************************************!*\
!*** ./node_modules/pjax/index.js ***!
\************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var clone = __webpack_require__(/*! ./lib/clone.js */ \"./node_modules/pjax/lib/clone.js\")\r\nvar executeScripts = __webpack_require__(/*! ./lib/execute-scripts.js */ \"./node_modules/pjax/lib/execute-scripts.js\")\r\nvar forEachEls = __webpack_require__(/*! ./lib/foreach-els.js */ \"./node_modules/pjax/lib/foreach-els.js\")\r\nvar switches = __webpack_require__(/*! ./lib/switches */ \"./node_modules/pjax/lib/switches.js\")\r\nvar newUid = __webpack_require__(/*! ./lib/uniqueid.js */ \"./node_modules/pjax/lib/uniqueid.js\")\r\n\r\nvar on = __webpack_require__(/*! ./lib/events/on.js */ \"./node_modules/pjax/lib/events/on.js\")\r\nvar trigger = __webpack_require__(/*! ./lib/events/trigger.js */ \"./node_modules/pjax/lib/events/trigger.js\")\r\n\r\nvar contains = __webpack_require__(/*! ./lib/util/contains.js */ \"./node_modules/pjax/lib/util/contains.js\")\r\nvar noop = __webpack_require__(/*! ./lib/util/noop */ \"./node_modules/pjax/lib/util/noop.js\")\r\n\r\nvar Pjax = function(options) {\r\n this.state = {\r\n numPendingSwitches: 0,\r\n href: null,\r\n options: null\r\n }\r\n\r\n var parseOptions = __webpack_require__(/*! ./lib/proto/parse-options.js */ \"./node_modules/pjax/lib/proto/parse-options.js\")\r\n parseOptions.call(this,options)\r\n this.log(\"Pjax options\", this.options)\r\n\r\n if (this.options.scrollRestoration && \"scrollRestoration\" in history) {\r\n history.scrollRestoration = \"manual\"\r\n }\r\n\r\n this.maxUid = this.lastUid = newUid()\r\n\r\n this.parseDOM(document)\r\n\r\n on(window, \"popstate\", function(st) {\r\n if (st.state) {\r\n var opt = clone(this.options)\r\n opt.url = st.state.url\r\n opt.title = st.state.title\r\n opt.history = false\r\n opt.requestOptions = {}\r\n opt.scrollPos = st.state.scrollPos\r\n if (st.state.uid < this.lastUid) {\r\n opt.backward = true\r\n }\r\n else {\r\n opt.forward = true\r\n }\r\n this.lastUid = st.state.uid\r\n\r\n // @todo implement history cache here, based on uid\r\n this.loadUrl(st.state.url, opt)\r\n }\r\n }.bind(this))\r\n }\r\n\r\nPjax.switches = switches\r\n\r\nPjax.prototype = {\r\n log: __webpack_require__(/*! ./lib/proto/log.js */ \"./node_modules/pjax/lib/proto/log.js\"),\r\n\r\n getElements: function(el) {\r\n return el.querySelectorAll(this.options.elements)\r\n },\r\n\r\n parseDOM: function(el) {\r\n var parseElement = __webpack_require__(/*! ./lib/proto/parse-element */ \"./node_modules/pjax/lib/proto/parse-element.js\")\r\n forEachEls(this.getElements(el), parseElement, this)\r\n },\r\n\r\n refresh: function(el) {\r\n this.parseDOM(el || document)\r\n },\r\n\r\n reload: function() {\r\n window.location.reload()\r\n },\r\n\r\n attachLink: __webpack_require__(/*! ./lib/proto/attach-link.js */ \"./node_modules/pjax/lib/proto/attach-link.js\"),\r\n\r\n attachForm: __webpack_require__(/*! ./lib/proto/attach-form.js */ \"./node_modules/pjax/lib/proto/attach-form.js\"),\r\n\r\n forEachSelectors: function(cb, context, DOMcontext) {\r\n return __webpack_require__(/*! ./lib/foreach-selectors.js */ \"./node_modules/pjax/lib/foreach-selectors.js\").bind(this)(this.options.selectors, cb, context, DOMcontext)\r\n },\r\n\r\n switchSelectors: function(selectors, fromEl, toEl, options) {\r\n return __webpack_require__(/*! ./lib/switches-selectors.js */ \"./node_modules/pjax/lib/switches-selectors.js\").bind(this)(this.options.switches, this.options.switchesOptions, selectors, fromEl, toEl, options)\r\n },\r\n\r\n latestChance: function(href) {\r\n window.location = href\r\n },\r\n\r\n onSwitch: function() {\r\n trigger(window, \"resize scroll\")\r\n\r\n this.state.numPendingSwitches--\r\n\r\n // debounce calls, so we only run this once after all switches are finished.\r\n if (this.state.numPendingSwitches === 0) {\r\n this.afterAllSwitches()\r\n }\r\n },\r\n\r\n loadContent: function(html, options) {\r\n var tmpEl = document.implementation.createHTMLDocument(\"pjax\")\r\n\r\n // parse HTML attributes to copy them\r\n // since we are forced to use documentElement.innerHTML (outerHTML can't be used for <html>)\r\n var htmlRegex = /<html[^>]+>/gi\r\n var htmlAttribsRegex = /\\s?[a-z:]+(?:\\=(?:\\'|\\\")[^\\'\\\">]+(?:\\'|\\\"))*/gi\r\n var matches = html.match(htmlRegex)\r\n if (matches && matches.length) {\r\n matches = matches[0].match(htmlAttribsRegex)\r\n if (matches.length) {\r\n matches.shift()\r\n matches.forEach(function(htmlAttrib) {\r\n var attr = htmlAttrib.trim().split(\"=\")\r\n if (attr.length === 1) {\r\n tmpEl.documentElement.setAttribute(attr[0], true)\r\n }\r\n else {\r\n tmpEl.documentElement.setAttribute(attr[0], attr[1].slice(1, -1))\r\n }\r\n })\r\n }\r\n }\r\n\r\n tmpEl.documentElement.innerHTML = html\r\n this.log(\"load content\", tmpEl.documentElement.attributes, tmpEl.documentElement.innerHTML.length)\r\n\r\n // Clear out any focused controls before inserting new page contents.\r\n if (document.activeElement && contains(this.options.selectors, document.activeElement)) {\r\n try {\r\n document.activeElement.blur()\r\n } catch (e) { }\r\n }\r\n\r\n this.switchSelectors(this.options.selectors, tmpEl, document, options)\r\n },\r\n\r\n abortRequest: __webpack_require__(/*! ./lib/abort-request.js */ \"./node_modules/pjax/lib/abort-request.js\"),\r\n\r\n doRequest: __webpack_require__(/*! ./lib/send-request.js */ \"./node_modules/pjax/lib/send-request.js\"),\r\n\r\n loadUrl: function(href, options) {\r\n this.log(\"load href\", href, options)\r\n\r\n // Abort any previous request\r\n this.abortRequest(this.request)\r\n\r\n trigger(document, \"pjax:send\", options)\r\n\r\n // Do the request\r\n options.requestOptions.timeout = this.options.timeout\r\n this.request = this.doRequest(href, options.requestOptions, function(html, request) {\r\n // Fail if unable to load HTML via AJAX\r\n if (html === false) {\r\n trigger(document, \"pjax:complete pjax:error\", options)\r\n\r\n return\r\n }\r\n\r\n // push scroll position to history\r\n var currentState = window.history.state || {}\r\n window.history.replaceState({\r\n url: currentState.url || window.location.href,\r\n title: currentState.title || document.title,\r\n uid: currentState.uid || newUid(),\r\n scrollPos: [document.documentElement.scrollLeft || document.body.scrollLeft,\r\n document.documentElement.scrollTop || document.body.scrollTop]\r\n },\r\n document.title, window.location)\r\n\r\n var oldHref = href\r\n if (request.responseURL) {\r\n if (href !== request.responseURL) {\r\n href = request.responseURL\r\n }\r\n }\r\n else if (request.getResponseHeader(\"X-PJAX-URL\")) {\r\n href = request.getResponseHeader(\"X-PJAX-URL\")\r\n }\r\n else if (request.getResponseHeader(\"X-XHR-Redirected-To\")) {\r\n href = request.getResponseHeader(\"X-XHR-Redirected-To\")\r\n }\r\n\r\n // Add back the hash if it was removed\r\n var a = document.createElement(\"a\")\r\n a.href = oldHref\r\n var oldHash = a.hash\r\n a.href = href\r\n if (oldHash && !a.hash) {\r\n a.hash = oldHash\r\n href = a.href\r\n }\r\n\r\n this.state.href = href\r\n this.state.options = clone(options)\r\n\r\n try {\r\n this.loadContent(html, options)\r\n }\r\n catch (e) {\r\n if (!this.options.debug) {\r\n if (console && console.error) {\r\n console.error(\"Pjax switch fail: \", e)\r\n }\r\n return this.latestChance(href)\r\n }\r\n else {\r\n throw e\r\n }\r\n }\r\n }.bind(this))\r\n },\r\n\r\n afterAllSwitches: function() {\r\n // FF bug: Won’t autofocus fields that are inserted via JS.\r\n // This behavior is incorrect. So if theres no current focus, autofocus\r\n // the last field.\r\n //\r\n // http://www.w3.org/html/wg/drafts/html/master/forms.html\r\n var autofocusEl = Array.prototype.slice.call(document.querySelectorAll(\"[autofocus]\")).pop()\r\n if (autofocusEl && document.activeElement !== autofocusEl) {\r\n autofocusEl.focus()\r\n }\r\n\r\n // execute scripts when DOM have been completely updated\r\n this.options.selectors.forEach(function(selector) {\r\n forEachEls(document.querySelectorAll(selector), function(el) {\r\n executeScripts(el)\r\n })\r\n })\r\n\r\n var state = this.state\r\n\r\n if (state.options.history) {\r\n if (!window.history.state) {\r\n this.lastUid = this.maxUid = newUid()\r\n window.history.replaceState({\r\n url: window.location.href,\r\n title: document.title,\r\n uid: this.maxUid,\r\n scrollPos: [0, 0]\r\n },\r\n document.title)\r\n }\r\n\r\n // Update browser history\r\n this.lastUid = this.maxUid = newUid()\r\n\r\n window.history.pushState({\r\n url: state.href,\r\n title: state.options.title,\r\n uid: this.maxUid,\r\n scrollPos: [0, 0]\r\n },\r\n state.options.title,\r\n state.href)\r\n }\r\n\r\n this.forEachSelectors(function(el) {\r\n this.parseDOM(el)\r\n }, this)\r\n\r\n // Fire Events\r\n trigger(document,\"pjax:complete pjax:success\", state.options)\r\n\r\n if (typeof state.options.analytics === \"function\") {\r\n state.options.analytics()\r\n }\r\n\r\n if (state.options.history) {\r\n // First parse url and check for hash to override scroll\r\n var a = document.createElement(\"a\")\r\n a.href = this.state.href\r\n if (a.hash) {\r\n var name = a.hash.slice(1)\r\n name = decodeURIComponent(name)\r\n\r\n var curtop = 0\r\n var target = document.getElementById(name) || document.getElementsByName(name)[0]\r\n if (target) {\r\n // http://stackoverflow.com/questions/8111094/cross-browser-javascript-function-to-find-actual-position-of-an-element-in-page\r\n if (target.offsetParent) {\r\n do {\r\n curtop += target.offsetTop\r\n\r\n target = target.offsetParent\r\n } while (target)\r\n }\r\n }\r\n window.scrollTo(0, curtop)\r\n }\r\n else if (state.options.scrollTo !== false) {\r\n // Scroll page to top on new page load\r\n if (state.options.scrollTo.length > 1) {\r\n window.scrollTo(state.options.scrollTo[0], state.options.scrollTo[1])\r\n }\r\n else {\r\n window.scrollTo(0, state.options.scrollTo)\r\n }\r\n }\r\n }\r\n else if (state.options.scrollRestoration && state.options.scrollPos) {\r\n window.scrollTo(state.options.scrollPos[0], state.options.scrollPos[1])\r\n }\r\n\r\n this.state = {\r\n numPendingSwitches: 0,\r\n href: null,\r\n options: null\r\n }\r\n }\r\n}\r\n\r\nPjax.isSupported = __webpack_require__(/*! ./lib/is-supported.js */ \"./node_modules/pjax/lib/is-supported.js\")\r\n\r\n// arguably could do `if( require(\"./lib/is-supported.js\")()) {` but that might be a little to simple\r\nif (Pjax.isSupported()) {\r\n module.exports = Pjax\r\n}\r\n// if there isn’t required browser functions, returning stupid api\r\nelse {\r\n var stupidPjax = noop\r\n for (var key in Pjax.prototype) {\r\n if (Pjax.prototype.hasOwnProperty(key) && typeof Pjax.prototype[key] === \"function\") {\r\n stupidPjax[key] = noop\r\n }\r\n }\r\n\r\n module.exports = stupidPjax\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/index.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/abort-request.js":
/*!************************************************!*\
!*** ./node_modules/pjax/lib/abort-request.js ***!
\************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var noop = __webpack_require__(/*! ./util/noop */ \"./node_modules/pjax/lib/util/noop.js\")\r\n\r\nmodule.exports = function(request) {\r\n if (request && request.readyState < 4) {\r\n request.onreadystatechange = noop\r\n request.abort()\r\n }\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/abort-request.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/clone.js":
/*!****************************************!*\
!*** ./node_modules/pjax/lib/clone.js ***!
\****************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("module.exports = function(obj) {\r\n if (null === obj || \"object\" !== typeof obj) {\r\n return obj\r\n }\r\n var copy = obj.constructor()\r\n for (var attr in obj) {\r\n if (obj.hasOwnProperty(attr)) {\r\n copy[attr] = obj[attr]\r\n }\r\n }\r\n return copy\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/clone.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/eval-script.js":
/*!**********************************************!*\
!*** ./node_modules/pjax/lib/eval-script.js ***!
\**********************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("module.exports = function(el) {\r\n var code = (el.text || el.textContent || el.innerHTML || \"\")\r\n var src = (el.src || \"\")\r\n var parent = el.parentNode || document.querySelector(\"head\") || document.documentElement\r\n var script = document.createElement(\"script\")\r\n\r\n if (code.match(\"document.write\")) {\r\n if (console && console.log) {\r\n console.log(\"Script contains document.write. Can’t be executed correctly. Code skipped \", el)\r\n }\r\n return false\r\n }\r\n\r\n script.type = \"text/javascript\"\r\n\r\n if (src !== \"\") {\r\n script.src = src\r\n script.async = false // force synchronous loading of peripheral JS\r\n }\r\n\r\n if (code !== \"\") {\r\n try {\r\n script.appendChild(document.createTextNode(code))\r\n }\r\n catch (e) {\r\n // old IEs have funky script nodes\r\n script.text = code\r\n }\r\n }\r\n\r\n // execute\r\n parent.appendChild(script)\r\n // avoid pollution only in head or body tags\r\n if ([\"head\", \"body\"].indexOf(parent.tagName.toLowerCase()) > 0) {\r\n parent.removeChild(script)\r\n }\r\n\r\n return true\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/eval-script.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/events/on.js":
/*!********************************************!*\
!*** ./node_modules/pjax/lib/events/on.js ***!
\********************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var forEachEls = __webpack_require__(/*! ../foreach-els */ \"./node_modules/pjax/lib/foreach-els.js\")\r\n\r\nmodule.exports = function(els, events, listener, useCapture) {\r\n events = (typeof events === \"string\" ? events.split(\" \") : events)\r\n\r\n events.forEach(function(e) {\r\n forEachEls(els, function(el) {\r\n el.addEventListener(e, listener, useCapture)\r\n })\r\n })\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/events/on.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/events/trigger.js":
/*!*************************************************!*\
!*** ./node_modules/pjax/lib/events/trigger.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var forEachEls = __webpack_require__(/*! ../foreach-els */ \"./node_modules/pjax/lib/foreach-els.js\")\r\n\r\nmodule.exports = function(els, events, opts) {\r\n events = (typeof events === \"string\" ? events.split(\" \") : events)\r\n\r\n events.forEach(function(e) {\r\n var event\r\n event = document.createEvent(\"HTMLEvents\")\r\n event.initEvent(e, true, true)\r\n event.eventName = e\r\n if (opts) {\r\n Object.keys(opts).forEach(function(key) {\r\n event[key] = opts[key]\r\n })\r\n }\r\n\r\n forEachEls(els, function(el) {\r\n var domFix = false\r\n if (!el.parentNode && el !== document && el !== window) {\r\n // THANK YOU IE (9/10/11)\r\n // dispatchEvent doesn't work if the element is not in the DOM\r\n domFix = true\r\n document.body.appendChild(el)\r\n }\r\n el.dispatchEvent(event)\r\n if (domFix) {\r\n el.parentNode.removeChild(el)\r\n }\r\n })\r\n })\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/events/trigger.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/execute-scripts.js":
/*!**************************************************!*\
!*** ./node_modules/pjax/lib/execute-scripts.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var forEachEls = __webpack_require__(/*! ./foreach-els */ \"./node_modules/pjax/lib/foreach-els.js\")\r\nvar evalScript = __webpack_require__(/*! ./eval-script */ \"./node_modules/pjax/lib/eval-script.js\")\r\n// Finds and executes scripts (used for newly added elements)\r\n// Needed since innerHTML does not run scripts\r\nmodule.exports = function(el) {\r\n if (el.tagName.toLowerCase() === \"script\") {\r\n evalScript(el)\r\n }\r\n\r\n forEachEls(el.querySelectorAll(\"script\"), function(script) {\r\n if (!script.type || script.type.toLowerCase() === \"text/javascript\") {\r\n if (script.parentNode) {\r\n script.parentNode.removeChild(script)\r\n }\r\n evalScript(script)\r\n }\r\n })\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/execute-scripts.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/foreach-els.js":
/*!**********************************************!*\
!*** ./node_modules/pjax/lib/foreach-els.js ***!
\**********************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("/* global HTMLCollection: true */\r\n\r\nmodule.exports = function(els, fn, context) {\r\n if (els instanceof HTMLCollection || els instanceof NodeList || els instanceof Array) {\r\n return Array.prototype.forEach.call(els, fn, context)\r\n }\r\n // assume simple DOM element\r\n return fn.call(context, els)\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/foreach-els.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/foreach-selectors.js":
/*!****************************************************!*\
!*** ./node_modules/pjax/lib/foreach-selectors.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var forEachEls = __webpack_require__(/*! ./foreach-els */ \"./node_modules/pjax/lib/foreach-els.js\")\r\n\r\nmodule.exports = function(selectors, cb, context, DOMcontext) {\r\n DOMcontext = DOMcontext || document\r\n selectors.forEach(function(selector) {\r\n forEachEls(DOMcontext.querySelectorAll(selector), cb, context)\r\n })\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/foreach-selectors.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/is-supported.js":
/*!***********************************************!*\
!*** ./node_modules/pjax/lib/is-supported.js ***!
\***********************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("module.exports = function() {\r\n // Borrowed wholesale from https://github.com/defunkt/jquery-pjax\r\n return window.history &&\r\n window.history.pushState &&\r\n window.history.replaceState &&\r\n // pushState isn’t reliable on iOS until 5.\r\n !navigator.userAgent.match(/((iPod|iPhone|iPad).+\\bOS\\s+[1-4]\\D|WebApps\\/.+CFNetwork)/)\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/is-supported.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/proto/attach-form.js":
/*!****************************************************!*\
!*** ./node_modules/pjax/lib/proto/attach-form.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var on = __webpack_require__(/*! ../events/on */ \"./node_modules/pjax/lib/events/on.js\")\r\nvar clone = __webpack_require__(/*! ../clone */ \"./node_modules/pjax/lib/clone.js\")\r\n\r\nvar attrClick = \"data-pjax-click-state\"\r\n\r\nvar formAction = function(el, event) {\r\n // Since loadUrl modifies options and we may add our own modifications below,\r\n // clone it so the changes don't persist\r\n var options = clone(this.options)\r\n\r\n // Initialize requestOptions\r\n options.requestOptions = {\r\n requestUrl: el.getAttribute(\"action\") || window.location.href,\r\n requestMethod: el.getAttribute(\"method\") || \"GET\"\r\n }\r\n\r\n // create a testable virtual link of the form action\r\n var virtLinkElement = document.createElement(\"a\")\r\n virtLinkElement.setAttribute(\"href\", options.requestOptions.requestUrl)\r\n\r\n // Ignore external links.\r\n if (virtLinkElement.protocol !== window.location.protocol || virtLinkElement.host !== window.location.host) {\r\n el.setAttribute(attrClick, \"external\")\r\n return\r\n }\r\n\r\n // Ignore click if we are on an anchor on the same page\r\n if (virtLinkElement.pathname === window.location.pathname && virtLinkElement.hash.length > 0) {\r\n el.setAttribute(attrClick, \"anchor-present\")\r\n return\r\n }\r\n\r\n // Ignore empty anchor \"foo.html#\"\r\n if (virtLinkElement.href === window.location.href.split(\"#\")[0] + \"#\") {\r\n el.setAttribute(attrClick, \"anchor-empty\")\r\n return\r\n }\r\n\r\n // if declared as a full reload, just normally submit the form\r\n if (options.currentUrlFullReload) {\r\n el.setAttribute(attrClick, \"reload\")\r\n return\r\n }\r\n\r\n event.preventDefault()\r\n\r\n var paramObject = []\r\n for (var elementKey in el.elements) {\r\n var element = el.elements[elementKey]\r\n // jscs:disable disallowImplicitTypeConversion\r\n if (!!element.name && element.attributes !== undefined && element.tagName.toLowerCase() !== \"button\") {\r\n // jscs:enable disallowImplicitTypeConversion\r\n if ((element.attributes.type !== \"checkbox\" && element.attributes.type !== \"radio\") || element.checked) {\r\n paramObject.push({name: encodeURIComponent(element.name), value: encodeURIComponent(element.value)})\r\n }\r\n }\r\n }\r\n\r\n // Creating a getString\r\n var paramsString = (paramObject.map(function(value) {return value.name + \"=\" + value.value})).join(\"&\")\r\n\r\n options.requestOptions.requestPayload = paramObject\r\n options.requestOptions.requestPayloadString = paramsString\r\n\r\n el.setAttribute(attrClick, \"submit\")\r\n\r\n options.triggerElement = el\r\n this.loadUrl(virtLinkElement.href, options)\r\n}\r\n\r\nvar isDefaultPrevented = function(event) {\r\n return event.defaultPrevented || event.returnValue === false\r\n}\r\n\r\nmodule.exports = function(el) {\r\n var that = this\r\n\r\n on(el, \"submit\", function(event) {\r\n if (isDefaultPrevented(event)) {\r\n return\r\n }\r\n\r\n formAction.call(that, el, event)\r\n })\r\n\r\n on(el, \"keyup\", function(event) {\r\n if (isDefaultPrevented(event)) {\r\n return\r\n }\r\n\r\n if (event.keyCode === 13) {\r\n formAction.call(that, el, event)\r\n }\r\n }.bind(this))\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/proto/attach-form.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/proto/attach-link.js":
/*!****************************************************!*\
!*** ./node_modules/pjax/lib/proto/attach-link.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var on = __webpack_require__(/*! ../events/on */ \"./node_modules/pjax/lib/events/on.js\")\r\nvar clone = __webpack_require__(/*! ../clone */ \"./node_modules/pjax/lib/clone.js\")\r\n\r\nvar attrClick = \"data-pjax-click-state\"\r\nvar attrKey = \"data-pjax-keyup-state\"\r\n\r\nvar linkAction = function(el, event) {\r\n // Since loadUrl modifies options and we may add our own modifications below,\r\n // clone it so the changes don't persist\r\n var options = clone(this.options)\r\n\r\n // Initialize requestOptions since loadUrl expects it to be an object\r\n options.requestOptions = {}\r\n\r\n // Don’t break browser special behavior on links (like page in new window)\r\n if (event.which > 1 || event.metaKey || event.ctrlKey || event.shiftKey || event.altKey) {\r\n el.setAttribute(attrClick, \"modifier\")\r\n return\r\n }\r\n\r\n // we do test on href now to prevent unexpected behavior if for some reason\r\n // user have href that can be dynamically updated\r\n\r\n // Ignore external links.\r\n if (el.protocol !== window.location.protocol || el.host !== window.location.host) {\r\n el.setAttribute(attrClick, \"external\")\r\n return\r\n }\r\n\r\n // Ignore click if we are on an anchor on the same page\r\n if (el.pathname === window.location.pathname && el.hash.length > 0) {\r\n el.setAttribute(attrClick, \"anchor-present\")\r\n return\r\n }\r\n\r\n // Ignore anchors on the same page (keep native behavior)\r\n if (el.hash && el.href.replace(el.hash, \"\") === window.location.href.replace(location.hash, \"\")) {\r\n el.setAttribute(attrClick, \"anchor\")\r\n return\r\n }\r\n\r\n // Ignore empty anchor \"foo.html#\"\r\n if (el.href === window.location.href.split(\"#\")[0] + \"#\") {\r\n el.setAttribute(attrClick, \"anchor-empty\")\r\n return\r\n }\r\n\r\n event.preventDefault()\r\n\r\n // don’t do \"nothing\" if user try to reload the page by clicking the same link twice\r\n if (\r\n this.options.currentUrlFullReload &&\r\n el.href === window.location.href.split(\"#\")[0]\r\n ) {\r\n el.setAttribute(attrClick, \"reload\")\r\n this.reload()\r\n return\r\n }\r\n\r\n el.setAttribute(attrClick, \"load\")\r\n\r\n options.triggerElement = el\r\n this.loadUrl(el.href, options)\r\n}\r\n\r\nvar isDefaultPrevented = function(event) {\r\n return event.defaultPrevented || event.returnValue === false\r\n}\r\n\r\nmodule.exports = function(el) {\r\n var that = this\r\n\r\n on(el, \"click\", function(event) {\r\n if (isDefaultPrevented(event)) {\r\n return\r\n }\r\n\r\n linkAction.call(that, el, event)\r\n })\r\n\r\n on(el, \"keyup\", function(event) {\r\n if (isDefaultPrevented(event)) {\r\n return\r\n }\r\n\r\n // Don’t break browser special behavior on links (like page in new window)\r\n if (event.which > 1 || event.metaKey || event.ctrlKey || event.shiftKey || event.altKey) {\r\n el.setAttribute(attrKey, \"modifier\")\r\n return\r\n }\r\n\r\n if (event.keyCode === 13) {\r\n linkAction.call(that, el, event)\r\n }\r\n }.bind(this))\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/proto/attach-link.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/proto/log.js":
/*!********************************************!*\
!*** ./node_modules/pjax/lib/proto/log.js ***!
\********************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("module.exports = function() {\r\n if (this.options.debug && console) {\r\n if (typeof console.log === \"function\") {\r\n console.log.apply(console, arguments)\r\n }\r\n // IE is weird\r\n else if (console.log) {\r\n console.log(arguments)\r\n }\r\n }\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/proto/log.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/proto/parse-element.js":
/*!******************************************************!*\
!*** ./node_modules/pjax/lib/proto/parse-element.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("module.exports = function(el) {\r\n switch (el.tagName.toLowerCase()) {\r\n case \"a\":\r\n // only attach link if el does not already have link attached\r\n if (!el.hasAttribute(\"data-pjax-click-state\")) {\r\n this.attachLink(el)\r\n }\r\n break\r\n\r\n case \"form\":\r\n // only attach link if el does not already have link attached\r\n if (!el.hasAttribute(\"data-pjax-click-state\")) {\r\n this.attachForm(el)\r\n }\r\n break\r\n\r\n default:\r\n throw \"Pjax can only be applied on <a> or <form> submit\"\r\n }\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/proto/parse-element.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/proto/parse-options.js":
/*!******************************************************!*\
!*** ./node_modules/pjax/lib/proto/parse-options.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("/* global _gaq: true, ga: true */\r\n\r\nvar defaultSwitches = __webpack_require__(/*! ../switches */ \"./node_modules/pjax/lib/switches.js\")\r\n\r\nmodule.exports = function(options) {\r\n options = options || {}\r\n options.elements = options.elements || \"a[href], form[action]\"\r\n options.selectors = options.selectors || [\"title\", \".js-Pjax\"]\r\n options.switches = options.switches || {}\r\n options.switchesOptions = options.switchesOptions || {}\r\n options.history = options.history || true\r\n options.analytics = (typeof options.analytics === \"function\" || options.analytics === false) ?\r\n options.analytics :\r\n function() {\r\n if (window._gaq) {\r\n _gaq.push([\"_trackPageview\"])\r\n }\r\n if (window.ga) {\r\n ga(\"send\", \"pageview\", {page: location.pathname, title: document.title})\r\n }\r\n }\r\n options.scrollTo = (typeof options.scrollTo === \"undefined\") ? 0 : options.scrollTo\r\n options.scrollRestoration = (typeof options.scrollRestoration !== \"undefined\") ? options.scrollRestoration : true\r\n options.cacheBust = (typeof options.cacheBust === \"undefined\") ? true : options.cacheBust\r\n options.debug = options.debug || false\r\n options.timeout = options.timeout || 0\r\n options.currentUrlFullReload = (typeof options.currentUrlFullReload === \"undefined\") ? false : options.currentUrlFullReload\r\n\r\n // We can’t replace body.outerHTML or head.outerHTML.\r\n // It creates a bug where a new body or head are created in the DOM.\r\n // If you set head.outerHTML, a new body tag is appended, so the DOM has 2 body nodes, and vice versa\r\n if (!options.switches.head) {\r\n options.switches.head = defaultSwitches.switchElementsAlt\r\n }\r\n if (!options.switches.body) {\r\n options.switches.body = defaultSwitches.switchElementsAlt\r\n }\r\n\r\n this.options = options\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/proto/parse-options.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/send-request.js":
/*!***********************************************!*\
!*** ./node_modules/pjax/lib/send-request.js ***!
\***********************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("module.exports = function(location, options, callback) {\r\n options = options || {}\r\n var requestMethod = options.requestMethod || \"GET\"\r\n var requestPayload = options.requestPayloadString || null\r\n var request = new XMLHttpRequest()\r\n\r\n request.onreadystatechange = function() {\r\n if (request.readyState === 4) {\r\n if (request.status === 200) {\r\n callback(request.responseText, request)\r\n }\r\n else {\r\n callback(null, request)\r\n }\r\n }\r\n }\r\n\r\n request.onerror = function(e) {\r\n console.log(e)\r\n callback(null, request)\r\n }\r\n\r\n request.ontimeout = function() {\r\n callback(null, request)\r\n }\r\n\r\n // Add a timestamp as part of the query string if cache busting is enabled\r\n if (this.options.cacheBust) {\r\n location += (!/[?&]/.test(location) ? \"?\" : \"&\") + new Date().getTime()\r\n }\r\n\r\n request.open(requestMethod.toUpperCase(), location, true)\r\n request.timeout = options.timeout\r\n request.setRequestHeader(\"X-Requested-With\", \"XMLHttpRequest\")\r\n request.setRequestHeader(\"X-PJAX\", \"true\")\r\n\r\n // Add the request payload if available\r\n if (options.requestPayloadString !== undefined && options.requestPayloadString !== \"\") {\r\n // Send the proper header information along with the request\r\n request.setRequestHeader(\"Content-type\", \"application/x-www-form-urlencoded\")\r\n }\r\n\r\n request.send(requestPayload)\r\n\r\n return request\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/send-request.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/switches-selectors.js":
/*!*****************************************************!*\
!*** ./node_modules/pjax/lib/switches-selectors.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var forEachEls = __webpack_require__(/*! ./foreach-els */ \"./node_modules/pjax/lib/foreach-els.js\")\r\n\r\nvar defaultSwitches = __webpack_require__(/*! ./switches */ \"./node_modules/pjax/lib/switches.js\")\r\n\r\nmodule.exports = function(switches, switchesOptions, selectors, fromEl, toEl, options) {\r\n var switchesQueue = []\r\n\r\n selectors.forEach(function(selector) {\r\n var newEls = fromEl.querySelectorAll(selector)\r\n var oldEls = toEl.querySelectorAll(selector)\r\n if (this.log) {\r\n this.log(\"Pjax switch\", selector, newEls, oldEls)\r\n }\r\n if (newEls.length !== oldEls.length) {\r\n throw \"DOM doesn’t look the same on new loaded page: ’\" + selector + \"’ - new \" + newEls.length + \", old \" + oldEls.length\r\n }\r\n\r\n forEachEls(newEls, function(newEl, i) {\r\n var oldEl = oldEls[i]\r\n if (this.log) {\r\n this.log(\"newEl\", newEl, \"oldEl\", oldEl)\r\n }\r\n\r\n var callback = (switches[selector]) ?\r\n switches[selector].bind(this, oldEl, newEl, options, switchesOptions[selector]) :\r\n defaultSwitches.outerHTML.bind(this, oldEl, newEl, options)\r\n\r\n switchesQueue.push(callback)\r\n }, this)\r\n }, this)\r\n\r\n this.state.numPendingSwitches = switchesQueue.length\r\n\r\n switchesQueue.forEach(function(queuedSwitch) {\r\n queuedSwitch()\r\n })\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/switches-selectors.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/switches.js":
/*!*******************************************!*\
!*** ./node_modules/pjax/lib/switches.js ***!
\*******************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var on = __webpack_require__(/*! ./events/on.js */ \"./node_modules/pjax/lib/events/on.js\")\r\n\r\nmodule.exports = {\r\n outerHTML: function(oldEl, newEl) {\r\n oldEl.outerHTML = newEl.outerHTML\r\n this.onSwitch()\r\n },\r\n\r\n innerHTML: function(oldEl, newEl) {\r\n oldEl.innerHTML = newEl.innerHTML\r\n oldEl.className = newEl.className\r\n this.onSwitch()\r\n },\r\n\r\n switchElementsAlt: function(oldEl, newEl) {\r\n oldEl.innerHTML = newEl.innerHTML\r\n\r\n // Copy attributes from the new element to the old one\r\n if (newEl.hasAttributes()) {\r\n var attrs = newEl.attributes\r\n for (var i = 0; i < attrs.length; i++) {\r\n oldEl.attributes.setNamedItem(attrs[i].cloneNode())\r\n }\r\n }\r\n\r\n this.onSwitch()\r\n },\r\n\r\n sideBySide: function(oldEl, newEl, options, switchOptions) {\r\n var forEach = Array.prototype.forEach\r\n var elsToRemove = []\r\n var elsToAdd = []\r\n var fragToAppend = document.createDocumentFragment()\r\n var animationEventNames = \"animationend webkitAnimationEnd MSAnimationEnd oanimationend\"\r\n var animatedElsNumber = 0\r\n var sexyAnimationEnd = function(e) {\r\n if (e.target !== e.currentTarget) {\r\n // end triggered by an animation on a child\r\n return\r\n }\r\n\r\n animatedElsNumber--\r\n if (animatedElsNumber <= 0 && elsToRemove) {\r\n elsToRemove.forEach(function(el) {\r\n // browsing quickly can make the el\r\n // already removed by last page update ?\r\n if (el.parentNode) {\r\n el.parentNode.removeChild(el)\r\n }\r\n })\r\n\r\n elsToAdd.forEach(function(el) {\r\n el.className = el.className.replace(el.getAttribute(\"data-pjax-classes\"), \"\")\r\n el.removeAttribute(\"data-pjax-classes\")\r\n })\r\n\r\n elsToAdd = null // free memory\r\n elsToRemove = null // free memory\r\n\r\n // this is to trigger some repaint (example: picturefill)\r\n this.onSwitch()\r\n }\r\n }.bind(this)\r\n\r\n switchOptions = switchOptions || {}\r\n\r\n forEach.call(oldEl.childNodes, function(el) {\r\n elsToRemove.push(el)\r\n if (el.classList && !el.classList.contains(\"js-Pjax-remove\")) {\r\n // for fast switch, clean element that just have been added, & not cleaned yet.\r\n if (el.hasAttribute(\"data-pjax-classes\")) {\r\n el.className = el.className.replace(el.getAttribute(\"data-pjax-classes\"), \"\")\r\n el.removeAttribute(\"data-pjax-classes\")\r\n }\r\n el.classList.add(\"js-Pjax-remove\")\r\n if (switchOptions.callbacks && switchOptions.callbacks.removeElement) {\r\n switchOptions.callbacks.removeElement(el)\r\n }\r\n if (switchOptions.classNames) {\r\n el.className += \" \" + switchOptions.classNames.remove + \" \" + (options.backward ? switchOptions.classNames.backward : switchOptions.classNames.forward)\r\n }\r\n animatedElsNumber++\r\n on(el, animationEventNames, sexyAnimationEnd, true)\r\n }\r\n })\r\n\r\n forEach.call(newEl.childNodes, function(el) {\r\n if (el.classList) {\r\n var addClasses = \"\"\r\n if (switchOptions.classNames) {\r\n addClasses = \" js-Pjax-add \" + switchOptions.classNames.add + \" \" + (options.backward ? switchOptions.classNames.forward : switchOptions.classNames.backward)\r\n }\r\n if (switchOptions.callbacks && switchOptions.callbacks.addElement) {\r\n switchOptions.callbacks.addElement(el)\r\n }\r\n el.className += addClasses\r\n el.setAttribute(\"data-pjax-classes\", addClasses)\r\n elsToAdd.push(el)\r\n fragToAppend.appendChild(el)\r\n animatedElsNumber++\r\n on(el, animationEventNames, sexyAnimationEnd, true)\r\n }\r\n })\r\n\r\n // pass all className of the parent\r\n oldEl.className = newEl.className\r\n oldEl.appendChild(fragToAppend)\r\n }\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/switches.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/uniqueid.js":
/*!*******************************************!*\
!*** ./node_modules/pjax/lib/uniqueid.js ***!
\*******************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("module.exports = (function() {\r\n var counter = 0\r\n return function() {\r\n var id = (\"pjax\" + (new Date().getTime())) + \"_\" + counter\r\n counter++\r\n return id\r\n }\r\n})()\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/uniqueid.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/util/contains.js":
/*!************************************************!*\
!*** ./node_modules/pjax/lib/util/contains.js ***!
\************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("module.exports = function contains(doc, selectors, el) {\r\n for (var i = 0; i < selectors.length; i++) {\r\n var selectedEls = doc.querySelectorAll(selectors[i])\r\n for (var j = 0; j < selectedEls.length; j++) {\r\n if (selectedEls[j].contains(el)) {\r\n return true\r\n }\r\n }\r\n }\r\n\r\n return false\r\n}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/util/contains.js?");
/***/ }),
/***/ "./node_modules/pjax/lib/util/noop.js":
/*!********************************************!*\
!*** ./node_modules/pjax/lib/util/noop.js ***!
\********************************************/
/*! no static exports found */
/***/ (function(module, exports) {
eval("module.exports = function() {}\r\n\n\n//# sourceURL=webpack:///./node_modules/pjax/lib/util/noop.js?");
/***/ }),
/***/ "./node_modules/popper.js/dist/esm/popper.js":
/*!***************************************************!*\
!*** ./node_modules/popper.js/dist/esm/popper.js ***!
\***************************************************/
/*! exports provided: default */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
eval("__webpack_require__.r(__webpack_exports__);\n/* WEBPACK VAR INJECTION */(function(global) {/**!\n * @fileOverview Kickass library to create and place poppers near their reference elements.\n * @version 1.14.1\n * @license\n * Copyright (c) 2016 Federico Zivolo and contributors\n *\n * Permission is hereby granted, free of charge, to any person obtaining a copy\n * of this software and associated documentation files (the \"Software\"), to deal\n * in the Software without restriction, including without limitation the rights\n * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell\n * copies of the Software, and to permit persons to whom the Software is\n * furnished to do so, subject to the following conditions:\n *\n * The above copyright notice and this permission notice shall be included in all\n * copies or substantial portions of the Software.\n *\n * THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\n * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\n * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\n * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\n * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE\n * SOFTWARE.\n */\nvar isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined';\nvar longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox'];\nvar timeoutDuration = 0;\nfor (var i = 0; i < longerTimeoutBrowsers.length; i += 1) {\n if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) {\n timeoutDuration = 1;\n break;\n }\n}\n\nfunction microtaskDebounce(fn) {\n var called = false;\n return function () {\n if (called) {\n return;\n }\n called = true;\n window.Promise.resolve().then(function () {\n called = false;\n fn();\n });\n };\n}\n\nfunction taskDebounce(fn) {\n var scheduled = false;\n return function () {\n if (!scheduled) {\n scheduled = true;\n setTimeout(function () {\n scheduled = false;\n fn();\n }, timeoutDuration);\n }\n };\n}\n\nvar supportsMicroTasks = isBrowser && window.Promise;\n\n/**\n* Create a debounced version of a method, that's asynchronously deferred\n* but called in the minimum time possible.\n*\n* @method\n* @memberof Popper.Utils\n* @argument {Function} fn\n* @returns {Function}\n*/\nvar debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce;\n\n/**\n * Check if the given variable is a function\n * @method\n * @memberof Popper.Utils\n * @argument {Any} functionToCheck - variable to check\n * @returns {Boolean} answer to: is a function?\n */\nfunction isFunction(functionToCheck) {\n var getType = {};\n return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]';\n}\n\n/**\n * Get CSS computed property of the given element\n * @method\n * @memberof Popper.Utils\n * @argument {Eement} element\n * @argument {String} property\n */\nfunction getStyleComputedProperty(element, property) {\n if (element.nodeType !== 1) {\n return [];\n }\n // NOTE: 1 DOM access here\n var css = getComputedStyle(element, null);\n return property ? css[property] : css;\n}\n\n/**\n * Returns the parentNode or the host of the element\n * @method\n * @memberof Popper.Utils\n * @argument {Element} element\n * @returns {Element} parent\n */\nfunction getParentNode(element) {\n if (element.nodeName === 'HTML') {\n return element;\n }\n return element.parentNode || element.host;\n}\n\n/**\n * Returns the scrolling parent of the given element\n * @method\n * @memberof Popper.Utils\n * @argument {Element} element\n * @returns {Element} scroll parent\n */\nfunction getScrollParent(element) {\n // Return body, `getScroll` will take care to get the correct `scrollTop` from it\n if (!element) {\n return document.body;\n }\n\n switch (element.nodeName) {\n case 'HTML':\n case 'BODY':\n return element.ownerDocument.body;\n case '#document':\n return element.body;\n }\n\n // Firefox want us to check `-x` and `-y` variations as well\n\n var _getStyleComputedProp = getStyleComputedProperty(element),\n overflow = _getStyleComputedProp.overflow,\n overflowX = _getStyleComputedProp.overflowX,\n overflowY = _getStyleComputedProp.overflowY;\n\n if (/(auto|scroll|overlay)/.test(overflow + overflowY + overflowX)) {\n return element;\n }\n\n return getScrollParent(getParentNode(element));\n}\n\n/**\n * Tells if you are running Internet Explorer\n * @method\n * @memberof Popper.Utils\n * @argument {number} version to check\n * @returns {Boolean} isIE\n */\nvar cache = {};\n\nvar isIE = function () {\n var version = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 'all';\n\n version = version.toString();\n if (cache.hasOwnProperty(version)) {\n return cache[version];\n }\n switch (version) {\n case '11':\n cache[version] = navigator.userAgent.indexOf('Trident') !== -1;\n break;\n case '10':\n cache[version] = navigator.appVersion.indexOf('MSIE 10') !== -1;\n break;\n case 'all':\n cache[version] = navigator.userAgent.indexOf('Trident') !== -1 || navigator.userAgent.indexOf('MSIE') !== -1;\n break;\n }\n\n //Set IE\n cache.all = cache.all || Object.keys(cache).some(function (key) {\n return cache[key];\n });\n return cache[version];\n};\n\n/**\n * Returns the offset parent of the given element\n * @method\n * @memberof Popper.Utils\n * @argument {Element} element\n * @returns {Element} offset parent\n */\nfunction getOffsetParent(element) {\n if (!element) {\n return document.documentElement;\n }\n\n var noOffsetParent = isIE(10) ? document.body : null;\n\n // NOTE: 1 DOM access here\n var offsetParent = element.offsetParent;\n // Skip hidden elements which don't have an offsetParent\n while (offsetParent === noOffsetParent && element.nextElementSibling) {\n offsetParent = (element = element.nextElementSibling).offsetParent;\n }\n\n var nodeName = offsetParent && offsetParent.nodeName;\n\n if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') {\n return element ? element.ownerDocument.documentElement : document.documentElement;\n }\n\n // .offsetParent will return the closest TD or TABLE in case\n // no offsetParent is present, I hate this job...\n if (['TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') {\n return getOffsetParent(offsetParent);\n }\n\n return offsetParent;\n}\n\nfunction isOffsetContainer(element) {\n var nodeName = element.nodeName;\n\n if (nodeName === 'BODY') {\n return false;\n }\n return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element;\n}\n\n/**\n * Finds the root node (document, shadowDOM root) of the given element\n * @method\n * @memberof Popper.Utils\n * @argument {Element} node\n * @returns {Element} root node\n */\nfunction getRoot(node) {\n if (node.parentNode !== null) {\n return getRoot(node.parentNode);\n }\n\n return node;\n}\n\n/**\n * Finds the offset parent common to the two provided nodes\n * @method\n * @memberof Popper.Utils\n * @argument {Element} element1\n * @argument {Element} element2\n * @returns {Element} common offset parent\n */\nfunction findCommonOffsetParent(element1, element2) {\n // This check is needed to avoid errors in case one of the elements isn't defined for any reason\n if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) {\n return document.documentElement;\n }\n\n // Here we make sure to give as \"start\" the element that comes first in the DOM\n var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING;\n var start = order ? element1 : element2;\n var end = order ? element2 : element1;\n\n // Get common ancestor container\n var range = document.createRange();\n range.setStart(start, 0);\n range.setEnd(end, 0);\n var commonAncestorContainer = range.commonAncestorContainer;\n\n // Both nodes are inside #document\n\n if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) {\n if (isOffsetContainer(commonAncestorContainer)) {\n return commonAncestorContainer;\n }\n\n return getOffsetParent(commonAncestorContainer);\n }\n\n // one of the nodes is inside shadowDOM, find which one\n var element1root = getRoot(element1);\n if (element1root.host) {\n return findCommonOffsetParent(element1root.host, element2);\n } else {\n return findCommonOffsetParent(element1, getRoot(element2).host);\n }\n}\n\n/**\n * Gets the scroll value of the given element in the given side (top and left)\n * @method\n * @memberof Popper.Utils\n * @argument {Element} element\n * @argument {String} side `top` or `left`\n * @returns {number} amount of scrolled pixels\n */\nfunction getScroll(element) {\n var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top';\n\n var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft';\n var nodeName = element.nodeName;\n\n if (nodeName === 'BODY' || nodeName === 'HTML') {\n var html = element.ownerDocument.documentElement;\n var scrollingElement = element.ownerDocument.scrollingElement || html;\n return scrollingElement[upperSide];\n }\n\n return element[upperSide];\n}\n\n/*\n * Sum or subtract the element scroll values (left and top) from a given rect object\n * @method\n * @memberof Popper.Utils\n * @param {Object} rect - Rect object you want to change\n * @param {HTMLElement} element - The element from the function reads the scroll values\n * @param {Boolean} subtract - set to true if you want to subtract the scroll values\n * @return {Object} rect - The modifier rect object\n */\nfunction includeScroll(rect, element) {\n var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;\n\n var scrollTop = getScroll(element, 'top');\n var scrollLeft = getScroll(element, 'left');\n var modifier = subtract ? -1 : 1;\n rect.top += scrollTop * modifier;\n rect.bottom += scrollTop * modifier;\n rect.left += scrollLeft * modifier;\n rect.right += scrollLeft * modifier;\n return rect;\n}\n\n/*\n * Helper to detect borders of a given element\n * @method\n * @memberof Popper.Utils\n * @param {CSSStyleDeclaration} styles\n * Result of `getStyleComputedProperty` on the given element\n * @param {String} axis - `x` or `y`\n * @return {number} borders - The borders size of the given axis\n */\n\nfunction getBordersSize(styles, axis) {\n var sideA = axis === 'x' ? 'Left' : 'Top';\n var sideB = sideA === 'Left' ? 'Right' : 'Bottom';\n\n return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10);\n}\n\nfunction getSize(axis, body, html, computedStyle) {\n return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE(10) ? html['offset' + axis] + computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')] + computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')] : 0);\n}\n\nfunction getWindowSizes() {\n var body = document.body;\n var html = document.documentElement;\n var computedStyle = isIE(10) && getComputedStyle(html);\n\n return {\n height: getSize('Height', body, html, computedStyle),\n width: getSize('Width', body, html, computedStyle)\n };\n}\n\nvar classCallCheck = function (instance, Constructor) {\n if (!(instance instanceof Constructor)) {\n throw new TypeError(\"Cannot call a class as a function\");\n }\n};\n\nvar createClass = function () {\n function defineProperties(target, props) {\n for (var i = 0; i < props.length; i++) {\n var descriptor = props[i];\n descriptor.enumerable = descriptor.enumerable || false;\n descriptor.configurable = true;\n if (\"value\" in descriptor) descriptor.writable = true;\n Object.defineProperty(target, descriptor.key, descriptor);\n }\n }\n\n return function (Constructor, protoProps, staticProps) {\n if (protoProps) defineProperties(Constructor.prototype, protoProps);\n if (staticProps) defineProperties(Constructor, staticProps);\n return Constructor;\n };\n}();\n\n\n\n\n\nvar defineProperty = function (obj, key, value) {\n if (key in obj) {\n Object.defineProperty(obj, key, {\n value: value,\n enumerable: true,\n configurable: true,\n writable: true\n });\n } else {\n obj[key] = value;\n }\n\n return obj;\n};\n\nvar _extends = Object.assign || function (target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i];\n\n for (var key in source) {\n if (Object.prototype.hasOwnProperty.call(source, key)) {\n target[key] = source[key];\n }\n }\n }\n\n return target;\n};\n\n/**\n * Given element offsets, generate an output similar to getBoundingClientRect\n * @method\n * @memberof Popper.Utils\n * @argument {Object} offsets\n * @returns {Object} ClientRect like output\n */\nfunction getClientRect(offsets) {\n return _extends({}, offsets, {\n right: offsets.left + offsets.width,\n bottom: offsets.top + offsets.height\n });\n}\n\n/**\n * Get bounding client rect of given element\n * @method\n * @memberof Popper.Utils\n * @param {HTMLElement} element\n * @return {Object} client rect\n */\nfunction getBoundingClientRect(element) {\n var rect = {};\n\n // IE10 10 FIX: Please, don't ask, the element isn't\n // considered in DOM in some circumstances...\n // This isn't reproducible in IE10 compatibility mode of IE11\n try {\n if (isIE(10)) {\n rect = element.getBoundingClientRect();\n var scrollTop = getScroll(element, 'top');\n var scrollLeft = getScroll(element, 'left');\n rect.top += scrollTop;\n rect.left += scrollLeft;\n rect.bottom += scrollTop;\n rect.right += scrollLeft;\n } else {\n rect = element.getBoundingClientRect();\n }\n } catch (e) {}\n\n var result = {\n left: rect.left,\n top: rect.top,\n width: rect.right - rect.left,\n height: rect.bottom - rect.top\n };\n\n // subtract scrollbar size from sizes\n var sizes = element.nodeName === 'HTML' ? getWindowSizes() : {};\n var width = sizes.width || element.clientWidth || result.right - result.left;\n var height = sizes.height || element.clientHeight || result.bottom - result.top;\n\n var horizScrollbar = element.offsetWidth - width;\n var vertScrollbar = element.offsetHeight - height;\n\n // if an hypothetical scrollbar is detected, we must be sure it's not a `border`\n // we make this check conditional for performance reasons\n if (horizScrollbar || vertScrollbar) {\n var styles = getStyleComputedProperty(element);\n horizScrollbar -= getBordersSize(styles, 'x');\n vertScrollbar -= getBordersSize(styles, 'y');\n\n result.width -= horizScrollbar;\n result.height -= vertScrollbar;\n }\n\n return getClientRect(result);\n}\n\nfunction getOffsetRectRelativeToArbitraryNode(children, parent) {\n var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;\n\n var isIE10 = isIE(10);\n var isHTML = parent.nodeName === 'HTML';\n var childrenRect = getBoundingClientRect(children);\n var parentRect = getBoundingClientRect(parent);\n var scrollParent = getScrollParent(children);\n\n var styles = getStyleComputedProperty(parent);\n var borderTopWidth = parseFloat(styles.borderTopWidth, 10);\n var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10);\n\n // In cases where the parent is fixed, we must ignore negative scroll in offset calc\n if (fixedPosition && parent.nodeName === 'HTML') {\n parentRect.top = Math.max(parentRect.top, 0);\n parentRect.left = Math.max(parentRect.left, 0);\n }\n var offsets = getClientRect({\n top: childrenRect.top - parentRect.top - borderTopWidth,\n left: childrenRect.left - parentRect.left - borderLeftWidth,\n width: childrenRect.width,\n height: childrenRect.height\n });\n offsets.marginTop = 0;\n offsets.marginLeft = 0;\n\n // Subtract margins of documentElement in case it's being used as parent\n // we do this only on HTML because it's the only element that behaves\n // differently when margins are applied to it. The margins are included in\n // the box of the documentElement, in the other cases not.\n if (!isIE10 && isHTML) {\n var marginTop = parseFloat(styles.marginTop, 10);\n var marginLeft = parseFloat(styles.marginLeft, 10);\n\n offsets.top -= borderTopWidth - marginTop;\n offsets.bottom -= borderTopWidth - marginTop;\n offsets.left -= borderLeftWidth - marginLeft;\n offsets.right -= borderLeftWidth - marginLeft;\n\n // Attach marginTop and marginLeft because in some circumstances we may need them\n offsets.marginTop = marginTop;\n offsets.marginLeft = marginLeft;\n }\n\n if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') {\n offsets = includeScroll(offsets, parent);\n }\n\n return offsets;\n}\n\nfunction getViewportOffsetRectRelativeToArtbitraryNode(element) {\n var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;\n\n var html = element.ownerDocument.documentElement;\n var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html);\n var width = Math.max(html.clientWidth, window.innerWidth || 0);\n var height = Math.max(html.clientHeight, window.innerHeight || 0);\n\n var scrollTop = !excludeScroll ? getScroll(html) : 0;\n var scrollLeft = !excludeScroll ? getScroll(html, 'left') : 0;\n\n var offset = {\n top: scrollTop - relativeOffset.top + relativeOffset.marginTop,\n left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft,\n width: width,\n height: height\n };\n\n return getClientRect(offset);\n}\n\n/**\n * Check if the given element is fixed or is inside a fixed parent\n * @method\n * @memberof Popper.Utils\n * @argument {Element} element\n * @argument {Element} customContainer\n * @returns {Boolean} answer to \"isFixed?\"\n */\nfunction isFixed(element) {\n var nodeName = element.nodeName;\n if (nodeName === 'BODY' || nodeName === 'HTML') {\n return false;\n }\n if (getStyleComputedProperty(element, 'position') === 'fixed') {\n return true;\n }\n return isFixed(getParentNode(element));\n}\n\n/**\n * Finds the first parent of an element that has a transformed property defined\n * @method\n * @memberof Popper.Utils\n * @argument {Element} element\n * @returns {Element} first transformed parent or documentElement\n */\n\nfunction getFixedPositionOffsetParent(element) {\n // This check is needed to avoid errors in case one of the elements isn't defined for any reason\n if (!element || !element.parentElement || isIE()) {\n return document.documentElement;\n }\n var el = element.parentElement;\n while (el && getStyleComputedProperty(el, 'transform') === 'none') {\n el = el.parentElement;\n }\n return el || document.documentElement;\n}\n\n/**\n * Computed the boundaries limits and return them\n * @method\n * @memberof Popper.Utils\n * @param {HTMLElement} popper\n * @param {HTMLElement} reference\n * @param {number} padding\n * @param {HTMLElement} boundariesElement - Element used to define the boundaries\n * @param {Boolean} fixedPosition - Is in fixed position mode\n * @returns {Object} Coordinates of the boundaries\n */\nfunction getBoundaries(popper, reference, padding, boundariesElement) {\n var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false;\n\n // NOTE: 1 DOM access here\n\n var boundaries = { top: 0, left: 0 };\n var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference);\n\n // Handle viewport case\n if (boundariesElement === 'viewport') {\n boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition);\n } else {\n // Handle other cases based on DOM element used as boundaries\n var boundariesNode = void 0;\n if (boundariesElement === 'scrollParent') {\n boundariesNode = getScrollParent(getParentNode(reference));\n if (boundariesNode.nodeName === 'BODY') {\n boundariesNode = popper.ownerDocument.documentElement;\n }\n } else if (boundariesElement === 'window') {\n boundariesNode = popper.ownerDocument.documentElement;\n } else {\n boundariesNode = boundariesElement;\n }\n\n var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition);\n\n // In case of HTML, we need a different computation\n if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) {\n var _getWindowSizes = getWindowSizes(),\n height = _getWindowSizes.height,\n width = _getWindowSizes.width;\n\n boundaries.top += offsets.top - offsets.marginTop;\n boundaries.bottom = height + offsets.top;\n boundaries.left += offsets.left - offsets.marginLeft;\n boundaries.right = width + offsets.left;\n } else {\n // for all the other DOM elements, this one is good\n boundaries = offsets;\n }\n }\n\n // Add paddings\n boundaries.left += padding;\n boundaries.top += padding;\n boundaries.right -= padding;\n boundaries.bottom -= padding;\n\n return boundaries;\n}\n\nfunction getArea(_ref) {\n var width = _ref.width,\n height = _ref.height;\n\n return width * height;\n}\n\n/**\n * Utility used to transform the `auto` placement to the placement with more\n * available space.\n * @method\n * @memberof Popper.Utils\n * @argument {Object} data - The data object generated by update method\n * @argument {Object} options - Modifiers configuration and options\n * @returns {Object} The data object, properly modified\n */\nfunction computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) {\n var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0;\n\n if (placement.indexOf('auto') === -1) {\n return placement;\n }\n\n var boundaries = getBoundaries(popper, reference, padding, boundariesElement);\n\n var rects = {\n top: {\n width: boundaries.width,\n height: refRect.top - boundaries.top\n },\n right: {\n width: boundaries.right - refRect.right,\n height: boundaries.height\n },\n bottom: {\n width: boundaries.width,\n height: boundaries.bottom - refRect.bottom\n },\n left: {\n width: refRect.left - boundaries.left,\n height: boundaries.height\n }\n };\n\n var sortedAreas = Object.keys(rects).map(function (key) {\n return _extends({\n key: key\n }, rects[key], {\n area: getArea(rects[key])\n });\n }).sort(function (a, b) {\n return b.area - a.area;\n });\n\n var filteredAreas = sortedAreas.filter(function (_ref2) {\n var width = _ref2.width,\n height = _ref2.height;\n return width >= popper.clientWidth && height >= popper.clientHeight;\n });\n\n var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key;\n\n var variation = placement.split('-')[1];\n\n return computedPlacement + (variation ? '-' + variation : '');\n}\n\n/**\n * Get offsets to the reference element\n * @method\n * @memberof Popper.Utils\n * @param {Object} state\n * @param {Element} popper - the popper element\n * @param {Element} reference - the reference element (the popper will be relative to this)\n * @param {Element} fixedPosition - is in fixed position mode\n * @returns {Object} An object containing the offsets which will be applied to the popper\n */\nfunction getReferenceOffsets(state, popper, reference) {\n var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null;\n\n var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference);\n return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition);\n}\n\n/**\n * Get the outer sizes of the given element (offset size + margins)\n * @method\n * @memberof Popper.Utils\n * @argument {Element} element\n * @returns {Object} object containing width and height properties\n */\nfunction getOuterSizes(element) {\n var styles = getComputedStyle(element);\n var x = parseFloat(styles.marginTop) + parseFloat(styles.marginBottom);\n var y = parseFloat(styles.marginLeft) + parseFloat(styles.marginRight);\n var result = {\n width: element.offsetWidth + y,\n height: element.offsetHeight + x\n };\n return result;\n}\n\n/**\n * Get the opposite placement of the given one\n * @method\n * @memberof Popper.Utils\n * @argument {String} placement\n * @returns {String} flipped placement\n */\nfunction getOppositePlacement(placement) {\n var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' };\n return placement.replace(/left|right|bottom|top/g, function (matched) {\n return hash[matched];\n });\n}\n\n/**\n * Get offsets to the popper\n * @method\n * @memberof Popper.Utils\n * @param {Object} position - CSS position the Popper will get applied\n * @param {HTMLElement} popper - the popper element\n * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this)\n * @param {String} placement - one of the valid placement options\n * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper\n */\nfunction getPopperOffsets(popper, referenceOffsets, placement) {\n placement = placement.split('-')[0];\n\n // Get popper node sizes\n var popperRect = getOuterSizes(popper);\n\n // Add position, width and height to our offsets object\n var popperOffsets = {\n width: popperRect.width,\n height: popperRect.height\n };\n\n // depending by the popper placement we have to compute its offsets slightly differently\n var isHoriz = ['right', 'left'].indexOf(placement) !== -1;\n var mainSide = isHoriz ? 'top' : 'left';\n var secondarySide = isHoriz ? 'left' : 'top';\n var measurement = isHoriz ? 'height' : 'width';\n var secondaryMeasurement = !isHoriz ? 'height' : 'width';\n\n popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2;\n if (placement === secondarySide) {\n popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement];\n } else {\n popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)];\n }\n\n return popperOffsets;\n}\n\n/**\n * Mimics the `find` method of Array\n * @method\n * @memberof Popper.Utils\n * @argument {Array} arr\n * @argument prop\n * @argument value\n * @returns index or -1\n */\nfunction find(arr, check) {\n // use native find if supported\n if (Array.prototype.find) {\n return arr.find(check);\n }\n\n // use `filter` to obtain the same behavior of `find`\n return arr.filter(check)[0];\n}\n\n/**\n * Return the index of the matching object\n * @method\n * @memberof Popper.Utils\n * @argument {Array} arr\n * @argument prop\n * @argument value\n * @returns index or -1\n */\nfunction findIndex(arr, prop, value) {\n // use native findIndex if supported\n if (Array.prototype.findIndex) {\n return arr.findIndex(function (cur) {\n return cur[prop] === value;\n });\n }\n\n // use `find` + `indexOf` if `findIndex` isn't supported\n var match = find(arr, function (obj) {\n return obj[prop] === value;\n });\n return arr.indexOf(match);\n}\n\n/**\n * Loop trough the list of modifiers and run them in order,\n * each of them will then edit the data object.\n * @method\n * @memberof Popper.Utils\n * @param {dataObject} data\n * @param {Array} modifiers\n * @param {String} ends - Optional modifier name used as stopper\n * @returns {dataObject}\n */\nfunction runModifiers(modifiers, data, ends) {\n var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends));\n\n modifiersToRun.forEach(function (modifier) {\n if (modifier['function']) {\n // eslint-disable-line dot-notation\n console.warn('`modifier.function` is deprecated, use `modifier.fn`!');\n }\n var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation\n if (modifier.enabled && isFunction(fn)) {\n // Add properties to offsets to make them a complete clientRect object\n // we do this before each modifier to make sure the previous one doesn't\n // mess with these values\n data.offsets.popper = getClientRect(data.offsets.popper);\n data.offsets.reference = getClientRect(data.offsets.reference);\n\n data = fn(data, modifier);\n }\n });\n\n return data;\n}\n\n/**\n * Updates the position of the popper, computing the new offsets and applying\n * the new style.<br />\n * Prefer `scheduleUpdate` over `update` because of performance reasons.\n * @method\n * @memberof Popper\n */\nfunction update() {\n // if popper is destroyed, don't perform any further update\n if (this.state.isDestroyed) {\n return;\n }\n\n var data = {\n instance: this,\n styles: {},\n arrowStyles: {},\n attributes: {},\n flipped: false,\n offsets: {}\n };\n\n // compute reference element offsets\n data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed);\n\n // compute auto placement, store placement inside the data object,\n // modifiers will be able to edit `placement` if needed\n // and refer to originalPlacement to know the original value\n data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding);\n\n // store the computed placement inside `originalPlacement`\n data.originalPlacement = data.placement;\n\n data.positionFixed = this.options.positionFixed;\n\n // compute the popper offsets\n data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement);\n data.offsets.popper.position = this.options.positionFixed ? 'fixed' : 'absolute';\n\n // run the modifiers\n data = runModifiers(this.modifiers, data);\n\n // the first `update` will call `onCreate` callback\n // the other ones will call `onUpdate` callback\n if (!this.state.isCreated) {\n this.state.isCreated = true;\n this.options.onCreate(data);\n } else {\n this.options.onUpdate(data);\n }\n}\n\n/**\n * Helper used to know if the given modifier is enabled.\n * @method\n * @memberof Popper.Utils\n * @returns {Boolean}\n */\nfunction isModifierEnabled(modifiers, modifierName) {\n return modifiers.some(function (_ref) {\n var name = _ref.name,\n enabled = _ref.enabled;\n return enabled && name === modifierName;\n });\n}\n\n/**\n * Get the prefixed supported property name\n * @method\n * @memberof Popper.Utils\n * @argument {String} property (camelCase)\n * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix)\n */\nfunction getSupportedPropertyName(property) {\n var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O'];\n var upperProp = property.charAt(0).toUpperCase() + property.slice(1);\n\n for (var i = 0; i < prefixes.length; i++) {\n var prefix = prefixes[i];\n var toCheck = prefix ? '' + prefix + upperProp : property;\n if (typeof document.body.style[toCheck] !== 'undefined') {\n return toCheck;\n }\n }\n return null;\n}\n\n/**\n * Destroy the popper\n * @method\n * @memberof Popper\n */\nfunction destroy() {\n this.state.isDestroyed = true;\n\n // touch DOM only if `applyStyle` modifier is enabled\n if (isModifierEnabled(this.modifiers, 'applyStyle')) {\n this.popper.removeAttribute('x-placement');\n this.popper.style.position = '';\n this.popper.style.top = '';\n this.popper.style.left = '';\n this.popper.style.right = '';\n this.popper.style.bottom = '';\n this.popper.style.willChange = '';\n this.popper.style[getSupportedPropertyName('transform')] = '';\n }\n\n this.disableEventListeners();\n\n // remove the popper if user explicity asked for the deletion on destroy\n // do not use `remove` because IE11 doesn't support it\n if (this.options.removeOnDestroy) {\n this.popper.parentNode.removeChild(this.popper);\n }\n return this;\n}\n\n/**\n * Get the window associated with the element\n * @argument {Element} element\n * @returns {Window}\n */\nfunction getWindow(element) {\n var ownerDocument = element.ownerDocument;\n return ownerDocument ? ownerDocument.defaultView : window;\n}\n\nfunction attachToScrollParents(scrollParent, event, callback, scrollParents) {\n var isBody = scrollParent.nodeName === 'BODY';\n var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent;\n target.addEventListener(event, callback, { passive: true });\n\n if (!isBody) {\n attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents);\n }\n scrollParents.push(target);\n}\n\n/**\n * Setup needed event listeners used to update the popper position\n * @method\n * @memberof Popper.Utils\n * @private\n */\nfunction setupEventListeners(reference, options, state, updateBound) {\n // Resize event listener on window\n state.updateBound = updateBound;\n getWindow(reference).addEventListener('resize', state.updateBound, { passive: true });\n\n // Scroll event listener on scroll parents\n var scrollElement = getScrollParent(reference);\n attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents);\n state.scrollElement = scrollElement;\n state.eventsEnabled = true;\n\n return state;\n}\n\n/**\n * It will add resize/scroll events and start recalculating\n * position of the popper element when they are triggered.\n * @method\n * @memberof Popper\n */\nfunction enableEventListeners() {\n if (!this.state.eventsEnabled) {\n this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate);\n }\n}\n\n/**\n * Remove event listeners used to update the popper position\n * @method\n * @memberof Popper.Utils\n * @private\n */\nfunction removeEventListeners(reference, state) {\n // Remove resize event listener on window\n getWindow(reference).removeEventListener('resize', state.updateBound);\n\n // Remove scroll event listener on scroll parents\n state.scrollParents.forEach(function (target) {\n target.removeEventListener('scroll', state.updateBound);\n });\n\n // Reset state\n state.updateBound = null;\n state.scrollParents = [];\n state.scrollElement = null;\n state.eventsEnabled = false;\n return state;\n}\n\n/**\n * It will remove resize/scroll events and won't recalculate popper position\n * when they are triggered. It also won't trigger onUpdate callback anymore,\n * unless you call `update` method manually.\n * @method\n * @memberof Popper\n */\nfunction disableEventListeners() {\n if (this.state.eventsEnabled) {\n cancelAnimationFrame(this.scheduleUpdate);\n this.state = removeEventListeners(this.reference, this.state);\n }\n}\n\n/**\n * Tells if a given input is a number\n * @method\n * @memberof Popper.Utils\n * @param {*} input to check\n * @return {Boolean}\n */\nfunction isNumeric(n) {\n return n !== '' && !isNaN(parseFloat(n)) && isFinite(n);\n}\n\n/**\n * Set the style to the given popper\n * @method\n * @memberof Popper.Utils\n * @argument {Element} element - Element to apply the style to\n * @argument {Object} styles\n * Object with a list of properties and values which will be applied to the element\n */\nfunction setStyles(element, styles) {\n Object.keys(styles).forEach(function (prop) {\n var unit = '';\n // add unit if the value is numeric and is one of the following\n if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) {\n unit = 'px';\n }\n element.style[prop] = styles[prop] + unit;\n });\n}\n\n/**\n * Set the attributes to the given popper\n * @method\n * @memberof Popper.Utils\n * @argument {Element} element - Element to apply the attributes to\n * @argument {Object} styles\n * Object with a list of properties and values which will be applied to the element\n */\nfunction setAttributes(element, attributes) {\n Object.keys(attributes).forEach(function (prop) {\n var value = attributes[prop];\n if (value !== false) {\n element.setAttribute(prop, attributes[prop]);\n } else {\n element.removeAttribute(prop);\n }\n });\n}\n\n/**\n * @function\n * @memberof Modifiers\n * @argument {Object} data - The data object generated by `update` method\n * @argument {Object} data.styles - List of style properties - values to apply to popper element\n * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element\n * @argument {Object} options - Modifiers configuration and options\n * @returns {Object} The same data object\n */\nfunction applyStyle(data) {\n // any property present in `data.styles` will be applied to the popper,\n // in this way we can make the 3rd party modifiers add custom styles to it\n // Be aware, modifiers could override the properties defined in the previous\n // lines of this modifier!\n setStyles(data.instance.popper, data.styles);\n\n // any property present in `data.attributes` will be applied to the popper,\n // they will be set as HTML attributes of the element\n setAttributes(data.instance.popper, data.attributes);\n\n // if arrowElement is defined and arrowStyles has some properties\n if (data.arrowElement && Object.keys(data.arrowStyles).length) {\n setStyles(data.arrowElement, data.arrowStyles);\n }\n\n return data;\n}\n\n/**\n * Set the x-placement attribute before everything else because it could be used\n * to add margins to the popper margins needs to be calculated to get the\n * correct popper offsets.\n * @method\n * @memberof Popper.modifiers\n * @param {HTMLElement} reference - The reference element used to position the popper\n * @param {HTMLElement} popper - The HTML element used as popper\n * @param {Object} options - Popper.js options\n */\nfunction applyStyleOnLoad(reference, popper, options, modifierOptions, state) {\n // compute reference element offsets\n var referenceOffsets = getReferenceOffsets(state, popper, reference, options.positionFixed);\n\n // compute auto placement, store placement inside the data object,\n // modifiers will be able to edit `placement` if needed\n // and refer to originalPlacement to know the original value\n var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding);\n\n popper.setAttribute('x-placement', placement);\n\n // Apply `position` to popper before anything else because\n // without the position applied we can't guarantee correct computations\n setStyles(popper, { position: options.positionFixed ? 'fixed' : 'absolute' });\n\n return options;\n}\n\n/**\n * @function\n * @memberof Modifiers\n * @argument {Object} data - The data object generated by `update` method\n * @argument {Object} options - Modifiers configuration and options\n * @returns {Object} The data object, properly modified\n */\nfunction computeStyle(data, options) {\n var x = options.x,\n y = options.y;\n var popper = data.offsets.popper;\n\n // Remove this legacy support in Popper.js v2\n\n var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) {\n return modifier.name === 'applyStyle';\n }).gpuAcceleration;\n if (legacyGpuAccelerationOption !== undefined) {\n console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!');\n }\n var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration;\n\n var offsetParent = getOffsetParent(data.instance.popper);\n var offsetParentRect = getBoundingClientRect(offsetParent);\n\n // Styles\n var styles = {\n position: popper.position\n };\n\n // floor sides to avoid blurry text\n var offsets = {\n left: Math.floor(popper.left),\n top: Math.floor(popper.top),\n bottom: Math.floor(popper.bottom),\n right: Math.floor(popper.right)\n };\n\n var sideA = x === 'bottom' ? 'top' : 'bottom';\n var sideB = y === 'right' ? 'left' : 'right';\n\n // if gpuAcceleration is set to `true` and transform is supported,\n // we use `translate3d` to apply the position to the popper we\n // automatically use the supported prefixed version if needed\n var prefixedProperty = getSupportedPropertyName('transform');\n\n // now, let's make a step back and look at this code closely (wtf?)\n // If the content of the popper grows once it's been positioned, it\n // may happen that the popper gets misplaced because of the new content\n // overflowing its reference element\n // To avoid this problem, we provide two options (x and y), which allow\n // the consumer to define the offset origin.\n // If we position a popper on top of a reference element, we can set\n // `x` to `top` to make the popper grow towards its top instead of\n // its bottom.\n var left = void 0,\n top = void 0;\n if (sideA === 'bottom') {\n top = -offsetParentRect.height + offsets.bottom;\n } else {\n top = offsets.top;\n }\n if (sideB === 'right') {\n left = -offsetParentRect.width + offsets.right;\n } else {\n left = offsets.left;\n }\n if (gpuAcceleration && prefixedProperty) {\n styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)';\n styles[sideA] = 0;\n styles[sideB] = 0;\n styles.willChange = 'transform';\n } else {\n // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties\n var invertTop = sideA === 'bottom' ? -1 : 1;\n var invertLeft = sideB === 'right' ? -1 : 1;\n styles[sideA] = top * invertTop;\n styles[sideB] = left * invertLeft;\n styles.willChange = sideA + ', ' + sideB;\n }\n\n // Attributes\n var attributes = {\n 'x-placement': data.placement\n };\n\n // Update `data` attributes, styles and arrowStyles\n data.attributes = _extends({}, attributes, data.attributes);\n data.styles = _extends({}, styles, data.styles);\n data.arrowStyles = _extends({}, data.offsets.arrow, data.arrowStyles);\n\n return data;\n}\n\n/**\n * Helper used to know if the given modifier depends from another one.<br />\n * It checks if the needed modifier is listed and enabled.\n * @method\n * @memberof Popper.Utils\n * @param {Array} modifiers - list of modifiers\n * @param {String} requestingName - name of requesting modifier\n * @param {String} requestedName - name of requested modifier\n * @returns {Boolean}\n */\nfunction isModifierRequired(modifiers, requestingName, requestedName) {\n var requesting = find(modifiers, function (_ref) {\n var name = _ref.name;\n return name === requestingName;\n });\n\n var isRequired = !!requesting && modifiers.some(function (modifier) {\n return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order;\n });\n\n if (!isRequired) {\n var _requesting = '`' + requestingName + '`';\n var requested = '`' + requestedName + '`';\n console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!');\n }\n return isRequired;\n}\n\n/**\n * @function\n * @memberof Modifiers\n * @argument {Object} data - The data object generated by update method\n * @argument {Object} options - Modifiers configuration and options\n * @returns {Object} The data object, properly modified\n */\nfunction arrow(data, options) {\n var _data$offsets$arrow;\n\n // arrow depends on keepTogether in order to work\n if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) {\n return data;\n }\n\n var arrowElement = options.element;\n\n // if arrowElement is a string, suppose it's a CSS selector\n if (typeof arrowElement === 'string') {\n arrowElement = data.instance.popper.querySelector(arrowElement);\n\n // if arrowElement is not found, don't run the modifier\n if (!arrowElement) {\n return data;\n }\n } else {\n // if the arrowElement isn't a query selector we must check that the\n // provided DOM node is child of its popper node\n if (!data.instance.popper.contains(arrowElement)) {\n console.warn('WARNING: `arrow.element` must be child of its popper element!');\n return data;\n }\n }\n\n var placement = data.placement.split('-')[0];\n var _data$offsets = data.offsets,\n popper = _data$offsets.popper,\n reference = _data$offsets.reference;\n\n var isVertical = ['left', 'right'].indexOf(placement) !== -1;\n\n var len = isVertical ? 'height' : 'width';\n var sideCapitalized = isVertical ? 'Top' : 'Left';\n var side = sideCapitalized.toLowerCase();\n var altSide = isVertical ? 'left' : 'top';\n var opSide = isVertical ? 'bottom' : 'right';\n var arrowElementSize = getOuterSizes(arrowElement)[len];\n\n //\n // extends keepTogether behavior making sure the popper and its\n // reference have enough pixels in conjuction\n //\n\n // top/left side\n if (reference[opSide] - arrowElementSize < popper[side]) {\n data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize);\n }\n // bottom/right side\n if (reference[side] + arrowElementSize > popper[opSide]) {\n data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide];\n }\n data.offsets.popper = getClientRect(data.offsets.popper);\n\n // compute center of the popper\n var center = reference[side] + reference[len] / 2 - arrowElementSize / 2;\n\n // Compute the sideValue using the updated popper offsets\n // take popper margin in account because we don't have this info available\n var css = getStyleComputedProperty(data.instance.popper);\n var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10);\n var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10);\n var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide;\n\n // prevent arrowElement from being placed not contiguously to its popper\n sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0);\n\n data.arrowElement = arrowElement;\n data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow);\n\n return data;\n}\n\n/**\n * Get the opposite placement variation of the given one\n * @method\n * @memberof Popper.Utils\n * @argument {String} placement variation\n * @returns {String} flipped placement variation\n */\nfunction getOppositeVariation(variation) {\n if (variation === 'end') {\n return 'start';\n } else if (variation === 'start') {\n return 'end';\n }\n return variation;\n}\n\n/**\n * List of accepted placements to use as values of the `placement` option.<br />\n * Valid placements are:\n * - `auto`\n * - `top`\n * - `right`\n * - `bottom`\n * - `left`\n *\n * Each placement can have a variation from this list:\n * - `-start`\n * - `-end`\n *\n * Variations are interpreted easily if you think of them as the left to right\n * written languages. Horizontally (`top` and `bottom`), `start` is left and `end`\n * is right.<br />\n * Vertically (`left` and `right`), `start` is top and `end` is bottom.\n *\n * Some valid examples are:\n * - `top-end` (on top of reference, right aligned)\n * - `right-start` (on right of reference, top aligned)\n * - `bottom` (on bottom, centered)\n * - `auto-right` (on the side with more space available, alignment depends by placement)\n *\n * @static\n * @type {Array}\n * @enum {String}\n * @readonly\n * @method placements\n * @memberof Popper\n */\nvar placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start'];\n\n// Get rid of `auto` `auto-start` and `auto-end`\nvar validPlacements = placements.slice(3);\n\n/**\n * Given an initial placement, returns all the subsequent placements\n * clockwise (or counter-clockwise).\n *\n * @method\n * @memberof Popper.Utils\n * @argument {String} placement - A valid placement (it accepts variations)\n * @argument {Boolean} counter - Set to true to walk the placements counterclockwise\n * @returns {Array} placements including their variations\n */\nfunction clockwise(placement) {\n var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;\n\n var index = validPlacements.indexOf(placement);\n var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index));\n return counter ? arr.reverse() : arr;\n}\n\nvar BEHAVIORS = {\n FLIP: 'flip',\n CLOCKWISE: 'clockwise',\n COUNTERCLOCKWISE: 'counterclockwise'\n};\n\n/**\n * @function\n * @memberof Modifiers\n * @argument {Object} data - The data object generated by update method\n * @argument {Object} options - Modifiers configuration and options\n * @returns {Object} The data object, properly modified\n */\nfunction flip(data, options) {\n // if `inner` modifier is enabled, we can't use the `flip` modifier\n if (isModifierEnabled(data.instance.modifiers, 'inner')) {\n return data;\n }\n\n if (data.flipped && data.placement === data.originalPlacement) {\n // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides\n return data;\n }\n\n var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement, data.positionFixed);\n\n var placement = data.placement.split('-')[0];\n var placementOpposite = getOppositePlacement(placement);\n var variation = data.placement.split('-')[1] || '';\n\n var flipOrder = [];\n\n switch (options.behavior) {\n case BEHAVIORS.FLIP:\n flipOrder = [placement, placementOpposite];\n break;\n case BEHAVIORS.CLOCKWISE:\n flipOrder = clockwise(placement);\n break;\n case BEHAVIORS.COUNTERCLOCKWISE:\n flipOrder = clockwise(placement, true);\n break;\n default:\n flipOrder = options.behavior;\n }\n\n flipOrder.forEach(function (step, index) {\n if (placement !== step || flipOrder.length === index + 1) {\n return data;\n }\n\n placement = data.placement.split('-')[0];\n placementOpposite = getOppositePlacement(placement);\n\n var popperOffsets = data.offsets.popper;\n var refOffsets = data.offsets.reference;\n\n // using floor because the reference offsets may contain decimals we are not going to consider here\n var floor = Math.floor;\n var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom);\n\n var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left);\n var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right);\n var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top);\n var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom);\n\n var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom;\n\n // flip the variation if required\n var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;\n var flippedVariation = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom);\n\n if (overlapsRef || overflowsBoundaries || flippedVariation) {\n // this boolean to detect any flip loop\n data.flipped = true;\n\n if (overlapsRef || overflowsBoundaries) {\n placement = flipOrder[index + 1];\n }\n\n if (flippedVariation) {\n variation = getOppositeVariation(variation);\n }\n\n data.placement = placement + (variation ? '-' + variation : '');\n\n // this object contains `position`, we want to preserve it along with\n // any additional property we may add in the future\n data.offsets.popper = _extends({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement));\n\n data = runModifiers(data.instance.modifiers, data, 'flip');\n }\n });\n return data;\n}\n\n/**\n * @function\n * @memberof Modifiers\n * @argument {Object} data - The data object generated by update method\n * @argument {Object} options - Modifiers configuration and options\n * @returns {Object} The data object, properly modified\n */\nfunction keepTogether(data) {\n var _data$offsets = data.offsets,\n popper = _data$offsets.popper,\n reference = _data$offsets.reference;\n\n var placement = data.placement.split('-')[0];\n var floor = Math.floor;\n var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;\n var side = isVertical ? 'right' : 'bottom';\n var opSide = isVertical ? 'left' : 'top';\n var measurement = isVertical ? 'width' : 'height';\n\n if (popper[side] < floor(reference[opSide])) {\n data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement];\n }\n if (popper[opSide] > floor(reference[side])) {\n data.offsets.popper[opSide] = floor(reference[side]);\n }\n\n return data;\n}\n\n/**\n * Converts a string containing value + unit into a px value number\n * @function\n * @memberof {modifiers~offset}\n * @private\n * @argument {String} str - Value + unit string\n * @argument {String} measurement - `height` or `width`\n * @argument {Object} popperOffsets\n * @argument {Object} referenceOffsets\n * @returns {Number|String}\n * Value in pixels, or original string if no values were extracted\n */\nfunction toValue(str, measurement, popperOffsets, referenceOffsets) {\n // separate value from unit\n var split = str.match(/((?:\\-|\\+)?\\d*\\.?\\d*)(.*)/);\n var value = +split[1];\n var unit = split[2];\n\n // If it's not a number it's an operator, I guess\n if (!value) {\n return str;\n }\n\n if (unit.indexOf('%') === 0) {\n var element = void 0;\n switch (unit) {\n case '%p':\n element = popperOffsets;\n break;\n case '%':\n case '%r':\n default:\n element = referenceOffsets;\n }\n\n var rect = getClientRect(element);\n return rect[measurement] / 100 * value;\n } else if (unit === 'vh' || unit === 'vw') {\n // if is a vh or vw, we calculate the size based on the viewport\n var size = void 0;\n if (unit === 'vh') {\n size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0);\n } else {\n size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0);\n }\n return size / 100 * value;\n } else {\n // if is an explicit pixel unit, we get rid of the unit and keep the value\n // if is an implicit unit, it's px, and we return just the value\n return value;\n }\n}\n\n/**\n * Parse an `offset` string to extrapolate `x` and `y` numeric offsets.\n * @function\n * @memberof {modifiers~offset}\n * @private\n * @argument {String} offset\n * @argument {Object} popperOffsets\n * @argument {Object} referenceOffsets\n * @argument {String} basePlacement\n * @returns {Array} a two cells array with x and y offsets in numbers\n */\nfunction parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) {\n var offsets = [0, 0];\n\n // Use height if placement is left or right and index is 0 otherwise use width\n // in this way the first offset will use an axis and the second one\n // will use the other one\n var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1;\n\n // Split the offset string to obtain a list of values and operands\n // The regex addresses values with the plus or minus sign in front (+10, -20, etc)\n var fragments = offset.split(/(\\+|\\-)/).map(function (frag) {\n return frag.trim();\n });\n\n // Detect if the offset string contains a pair of values or a single one\n // they could be separated by comma or space\n var divider = fragments.indexOf(find(fragments, function (frag) {\n return frag.search(/,|\\s/) !== -1;\n }));\n\n if (fragments[divider] && fragments[divider].indexOf(',') === -1) {\n console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.');\n }\n\n // If divider is found, we divide the list of values and operands to divide\n // them by ofset X and Y.\n var splitRegex = /\\s*,\\s*|\\s+/;\n var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments];\n\n // Convert the values with units to absolute pixels to allow our computations\n ops = ops.map(function (op, index) {\n // Most of the units rely on the orientation of the popper\n var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width';\n var mergeWithPrevious = false;\n return op\n // This aggregates any `+` or `-` sign that aren't considered operators\n // e.g.: 10 + +5 => [10, +, +5]\n .reduce(function (a, b) {\n if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) {\n a[a.length - 1] = b;\n mergeWithPrevious = true;\n return a;\n } else if (mergeWithPrevious) {\n a[a.length - 1] += b;\n mergeWithPrevious = false;\n return a;\n } else {\n return a.concat(b);\n }\n }, [])\n // Here we convert the string values into number values (in px)\n .map(function (str) {\n return toValue(str, measurement, popperOffsets, referenceOffsets);\n });\n });\n\n // Loop trough the offsets arrays and execute the operations\n ops.forEach(function (op, index) {\n op.forEach(function (frag, index2) {\n if (isNumeric(frag)) {\n offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1);\n }\n });\n });\n return offsets;\n}\n\n/**\n * @function\n * @memberof Modifiers\n * @argument {Object} data - The data object generated by update method\n * @argument {Object} options - Modifiers configuration and options\n * @argument {Number|String} options.offset=0\n * The offset value as described in the modifier description\n * @returns {Object} The data object, properly modified\n */\nfunction offset(data, _ref) {\n var offset = _ref.offset;\n var placement = data.placement,\n _data$offsets = data.offsets,\n popper = _data$offsets.popper,\n reference = _data$offsets.reference;\n\n var basePlacement = placement.split('-')[0];\n\n var offsets = void 0;\n if (isNumeric(+offset)) {\n offsets = [+offset, 0];\n } else {\n offsets = parseOffset(offset, popper, reference, basePlacement);\n }\n\n if (basePlacement === 'left') {\n popper.top += offsets[0];\n popper.left -= offsets[1];\n } else if (basePlacement === 'right') {\n popper.top += offsets[0];\n popper.left += offsets[1];\n } else if (basePlacement === 'top') {\n popper.left += offsets[0];\n popper.top -= offsets[1];\n } else if (basePlacement === 'bottom') {\n popper.left += offsets[0];\n popper.top += offsets[1];\n }\n\n data.popper = popper;\n return data;\n}\n\n/**\n * @function\n * @memberof Modifiers\n * @argument {Object} data - The data object generated by `update` method\n * @argument {Object} options - Modifiers configuration and options\n * @returns {Object} The data object, properly modified\n */\nfunction preventOverflow(data, options) {\n var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper);\n\n // If offsetParent is the reference element, we really want to\n // go one step up and use the next offsetParent as reference to\n // avoid to make this modifier completely useless and look like broken\n if (data.instance.reference === boundariesElement) {\n boundariesElement = getOffsetParent(boundariesElement);\n }\n\n var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement, data.positionFixed);\n options.boundaries = boundaries;\n\n var order = options.priority;\n var popper = data.offsets.popper;\n\n var check = {\n primary: function primary(placement) {\n var value = popper[placement];\n if (popper[placement] < boundaries[placement] && !options.escapeWithReference) {\n value = Math.max(popper[placement], boundaries[placement]);\n }\n return defineProperty({}, placement, value);\n },\n secondary: function secondary(placement) {\n var mainSide = placement === 'right' ? 'left' : 'top';\n var value = popper[mainSide];\n if (popper[placement] > boundaries[placement] && !options.escapeWithReference) {\n value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height));\n }\n return defineProperty({}, mainSide, value);\n }\n };\n\n order.forEach(function (placement) {\n var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary';\n popper = _extends({}, popper, check[side](placement));\n });\n\n data.offsets.popper = popper;\n\n return data;\n}\n\n/**\n * @function\n * @memberof Modifiers\n * @argument {Object} data - The data object generated by `update` method\n * @argument {Object} options - Modifiers configuration and options\n * @returns {Object} The data object, properly modified\n */\nfunction shift(data) {\n var placement = data.placement;\n var basePlacement = placement.split('-')[0];\n var shiftvariation = placement.split('-')[1];\n\n // if shift shiftvariation is specified, run the modifier\n if (shiftvariation) {\n var _data$offsets = data.offsets,\n reference = _data$offsets.reference,\n popper = _data$offsets.popper;\n\n var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1;\n var side = isVertical ? 'left' : 'top';\n var measurement = isVertical ? 'width' : 'height';\n\n var shiftOffsets = {\n start: defineProperty({}, side, reference[side]),\n end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement])\n };\n\n data.offsets.popper = _extends({}, popper, shiftOffsets[shiftvariation]);\n }\n\n return data;\n}\n\n/**\n * @function\n * @memberof Modifiers\n * @argument {Object} data - The data object generated by update method\n * @argument {Object} options - Modifiers configuration and options\n * @returns {Object} The data object, properly modified\n */\nfunction hide(data) {\n if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) {\n return data;\n }\n\n var refRect = data.offsets.reference;\n var bound = find(data.instance.modifiers, function (modifier) {\n return modifier.name === 'preventOverflow';\n }).boundaries;\n\n if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) {\n // Avoid unnecessary DOM access if visibility hasn't changed\n if (data.hide === true) {\n return data;\n }\n\n data.hide = true;\n data.attributes['x-out-of-boundaries'] = '';\n } else {\n // Avoid unnecessary DOM access if visibility hasn't changed\n if (data.hide === false) {\n return data;\n }\n\n data.hide = false;\n data.attributes['x-out-of-boundaries'] = false;\n }\n\n return data;\n}\n\n/**\n * @function\n * @memberof Modifiers\n * @argument {Object} data - The data object generated by `update` method\n * @argument {Object} options - Modifiers configuration and options\n * @returns {Object} The data object, properly modified\n */\nfunction inner(data) {\n var placement = data.placement;\n var basePlacement = placement.split('-')[0];\n var _data$offsets = data.offsets,\n popper = _data$offsets.popper,\n reference = _data$offsets.reference;\n\n var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1;\n\n var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1;\n\n popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0);\n\n data.placement = getOppositePlacement(placement);\n data.offsets.popper = getClientRect(popper);\n\n return data;\n}\n\n/**\n * Modifier function, each modifier can have a function of this type assigned\n * to its `fn` property.<br />\n * These functions will be called on each update, this means that you must\n * make sure they are performant enough to avoid performance bottlenecks.\n *\n * @function ModifierFn\n * @argument {dataObject} data - The data object generated by `update` method\n * @argument {Object} options - Modifiers configuration and options\n * @returns {dataObject} The data object, properly modified\n */\n\n/**\n * Modifiers are plugins used to alter the behavior of your poppers.<br />\n * Popper.js uses a set of 9 modifiers to provide all the basic functionalities\n * needed by the library.\n *\n * Usually you don't want to override the `order`, `fn` and `onLoad` props.\n * All the other properties are configurations that could be tweaked.\n * @namespace modifiers\n */\nvar modifiers = {\n /**\n * Modifier used to shift the popper on the start or end of its reference\n * element.<br />\n * It will read the variation of the `placement` property.<br />\n * It can be one either `-end` or `-start`.\n * @memberof modifiers\n * @inner\n */\n shift: {\n /** @prop {number} order=100 - Index used to define the order of execution */\n order: 100,\n /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */\n enabled: true,\n /** @prop {ModifierFn} */\n fn: shift\n },\n\n /**\n * The `offset` modifier can shift your popper on both its axis.\n *\n * It accepts the following units:\n * - `px` or unitless, interpreted as pixels\n * - `%` or `%r`, percentage relative to the length of the reference element\n * - `%p`, percentage relative to the length of the popper element\n * - `vw`, CSS viewport width unit\n * - `vh`, CSS viewport height unit\n *\n * For length is intended the main axis relative to the placement of the popper.<br />\n * This means that if the placement is `top` or `bottom`, the length will be the\n * `width`. In case of `left` or `right`, it will be the height.\n *\n * You can provide a single value (as `Number` or `String`), or a pair of values\n * as `String` divided by a comma or one (or more) white spaces.<br />\n * The latter is a deprecated method because it leads to confusion and will be\n * removed in v2.<br />\n * Additionally, it accepts additions and subtractions between different units.\n * Note that multiplications and divisions aren't supported.\n *\n * Valid examples are:\n * ```\n * 10\n * '10%'\n * '10, 10'\n * '10%, 10'\n * '10 + 10%'\n * '10 - 5vh + 3%'\n * '-10px + 5vh, 5px - 6%'\n * ```\n * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap\n * > with their reference element, unfortunately, you will have to disable the `flip` modifier.\n * > More on this [reading this issue](https://github.com/FezVrasta/popper.js/issues/373)\n *\n * @memberof modifiers\n * @inner\n */\n offset: {\n /** @prop {number} order=200 - Index used to define the order of execution */\n order: 200,\n /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */\n enabled: true,\n /** @prop {ModifierFn} */\n fn: offset,\n /** @prop {Number|String} offset=0\n * The offset value as described in the modifier description\n */\n offset: 0\n },\n\n /**\n * Modifier used to prevent the popper from being positioned outside the boundary.\n *\n * An scenario exists where the reference itself is not within the boundaries.<br />\n * We can say it has \"escaped the boundaries\" — or just \"escaped\".<br />\n * In this case we need to decide whether the popper should either:\n *\n * - detach from the reference and remain \"trapped\" in the boundaries, or\n * - if it should ignore the boundary and \"escape with its reference\"\n *\n * When `escapeWithReference` is set to`true` and reference is completely\n * outside its boundaries, the popper will overflow (or completely leave)\n * the boundaries in order to remain attached to the edge of the reference.\n *\n * @memberof modifiers\n * @inner\n */\n preventOverflow: {\n /** @prop {number} order=300 - Index used to define the order of execution */\n order: 300,\n /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */\n enabled: true,\n /** @prop {ModifierFn} */\n fn: preventOverflow,\n /**\n * @prop {Array} [priority=['left','right','top','bottom']]\n * Popper will try to prevent overflow following these priorities by default,\n * then, it could overflow on the left and on top of the `boundariesElement`\n */\n priority: ['left', 'right', 'top', 'bottom'],\n /**\n * @prop {number} padding=5\n * Amount of pixel used to define a minimum distance between the boundaries\n * and the popper this makes sure the popper has always a little padding\n * between the edges of its container\n */\n padding: 5,\n /**\n * @prop {String|HTMLElement} boundariesElement='scrollParent'\n * Boundaries used by the modifier, can be `scrollParent`, `window`,\n * `viewport` or any DOM element.\n */\n boundariesElement: 'scrollParent'\n },\n\n /**\n * Modifier used to make sure the reference and its popper stay near eachothers\n * without leaving any gap between the two. Expecially useful when the arrow is\n * enabled and you want to assure it to point to its reference element.\n * It cares only about the first axis, you can still have poppers with margin\n * between the popper and its reference element.\n * @memberof modifiers\n * @inner\n */\n keepTogether: {\n /** @prop {number} order=400 - Index used to define the order of execution */\n order: 400,\n /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */\n enabled: true,\n /** @prop {ModifierFn} */\n fn: keepTogether\n },\n\n /**\n * This modifier is used to move the `arrowElement` of the popper to make\n * sure it is positioned between the reference element and its popper element.\n * It will read the outer size of the `arrowElement` node to detect how many\n * pixels of conjuction are needed.\n *\n * It has no effect if no `arrowElement` is provided.\n * @memberof modifiers\n * @inner\n */\n arrow: {\n /** @prop {number} order=500 - Index used to define the order of execution */\n order: 500,\n /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */\n enabled: true,\n /** @prop {ModifierFn} */\n fn: arrow,\n /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */\n element: '[x-arrow]'\n },\n\n /**\n * Modifier used to flip the popper's placement when it starts to overlap its\n * reference element.\n *\n * Requires the `preventOverflow` modifier before it in order to work.\n *\n * **NOTE:** this modifier will interrupt the current update cycle and will\n * restart it if it detects the need to flip the placement.\n * @memberof modifiers\n * @inner\n */\n flip: {\n /** @prop {number} order=600 - Index used to define the order of execution */\n order: 600,\n /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */\n enabled: true,\n /** @prop {ModifierFn} */\n fn: flip,\n /**\n * @prop {String|Array} behavior='flip'\n * The behavior used to change the popper's placement. It can be one of\n * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid\n * placements (with optional variations).\n */\n behavior: 'flip',\n /**\n * @prop {number} padding=5\n * The popper will flip if it hits the edges of the `boundariesElement`\n */\n padding: 5,\n /**\n * @prop {String|HTMLElement} boundariesElement='viewport'\n * The element which will define the boundaries of the popper position,\n * the popper will never be placed outside of the defined boundaries\n * (except if keepTogether is enabled)\n */\n boundariesElement: 'viewport'\n },\n\n /**\n * Modifier used to make the popper flow toward the inner of the reference element.\n * By default, when this modifier is disabled, the popper will be placed outside\n * the reference element.\n * @memberof modifiers\n * @inner\n */\n inner: {\n /** @prop {number} order=700 - Index used to define the order of execution */\n order: 700,\n /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */\n enabled: false,\n /** @prop {ModifierFn} */\n fn: inner\n },\n\n /**\n * Modifier used to hide the popper when its reference element is outside of the\n * popper boundaries. It will set a `x-out-of-boundaries` attribute which can\n * be used to hide with a CSS selector the popper when its reference is\n * out of boundaries.\n *\n * Requires the `preventOverflow` modifier before it in order to work.\n * @memberof modifiers\n * @inner\n */\n hide: {\n /** @prop {number} order=800 - Index used to define the order of execution */\n order: 800,\n /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */\n enabled: true,\n /** @prop {ModifierFn} */\n fn: hide\n },\n\n /**\n * Computes the style that will be applied to the popper element to gets\n * properly positioned.\n *\n * Note that this modifier will not touch the DOM, it just prepares the styles\n * so that `applyStyle` modifier can apply it. This separation is useful\n * in case you need to replace `applyStyle` with a custom implementation.\n *\n * This modifier has `850` as `order` value to maintain backward compatibility\n * with previous versions of Popper.js. Expect the modifiers ordering method\n * to change in future major versions of the library.\n *\n * @memberof modifiers\n * @inner\n */\n computeStyle: {\n /** @prop {number} order=850 - Index used to define the order of execution */\n order: 850,\n /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */\n enabled: true,\n /** @prop {ModifierFn} */\n fn: computeStyle,\n /**\n * @prop {Boolean} gpuAcceleration=true\n * If true, it uses the CSS 3d transformation to position the popper.\n * Otherwise, it will use the `top` and `left` properties.\n */\n gpuAcceleration: true,\n /**\n * @prop {string} [x='bottom']\n * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin.\n * Change this if your popper should grow in a direction different from `bottom`\n */\n x: 'bottom',\n /**\n * @prop {string} [x='left']\n * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin.\n * Change this if your popper should grow in a direction different from `right`\n */\n y: 'right'\n },\n\n /**\n * Applies the computed styles to the popper element.\n *\n * All the DOM manipulations are limited to this modifier. This is useful in case\n * you want to integrate Popper.js inside a framework or view library and you\n * want to delegate all the DOM manipulations to it.\n *\n * Note that if you disable this modifier, you must make sure the popper element\n * has its position set to `absolute` before Popper.js can do its work!\n *\n * Just disable this modifier and define you own to achieve the desired effect.\n *\n * @memberof modifiers\n * @inner\n */\n applyStyle: {\n /** @prop {number} order=900 - Index used to define the order of execution */\n order: 900,\n /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */\n enabled: true,\n /** @prop {ModifierFn} */\n fn: applyStyle,\n /** @prop {Function} */\n onLoad: applyStyleOnLoad,\n /**\n * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier\n * @prop {Boolean} gpuAcceleration=true\n * If true, it uses the CSS 3d transformation to position the popper.\n * Otherwise, it will use the `top` and `left` properties.\n */\n gpuAcceleration: undefined\n }\n};\n\n/**\n * The `dataObject` is an object containing all the informations used by Popper.js\n * this object get passed to modifiers and to the `onCreate` and `onUpdate` callbacks.\n * @name dataObject\n * @property {Object} data.instance The Popper.js instance\n * @property {String} data.placement Placement applied to popper\n * @property {String} data.originalPlacement Placement originally defined on init\n * @property {Boolean} data.flipped True if popper has been flipped by flip modifier\n * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper.\n * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier\n * @property {Object} data.styles Any CSS property defined here will be applied to the popper, it expects the JavaScript nomenclature (eg. `marginBottom`)\n * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow, it expects the JavaScript nomenclature (eg. `marginBottom`)\n * @property {Object} data.boundaries Offsets of the popper boundaries\n * @property {Object} data.offsets The measurements of popper, reference and arrow elements.\n * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values\n * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values\n * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0\n */\n\n/**\n * Default options provided to Popper.js constructor.<br />\n * These can be overriden using the `options` argument of Popper.js.<br />\n * To override an option, simply pass as 3rd argument an object with the same\n * structure of this object, example:\n * ```\n * new Popper(ref, pop, {\n * modifiers: {\n * preventOverflow: { enabled: false }\n * }\n * })\n * ```\n * @type {Object}\n * @static\n * @memberof Popper\n */\nvar Defaults = {\n /**\n * Popper's placement\n * @prop {Popper.placements} placement='bottom'\n */\n placement: 'bottom',\n\n /**\n * Set this to true if you want popper to position it self in 'fixed' mode\n * @prop {Boolean} positionFixed=false\n */\n positionFixed: false,\n\n /**\n * Whether events (resize, scroll) are initially enabled\n * @prop {Boolean} eventsEnabled=true\n */\n eventsEnabled: true,\n\n /**\n * Set to true if you want to automatically remove the popper when\n * you call the `destroy` method.\n * @prop {Boolean} removeOnDestroy=false\n */\n removeOnDestroy: false,\n\n /**\n * Callback called when the popper is created.<br />\n * By default, is set to no-op.<br />\n * Access Popper.js instance with `data.instance`.\n * @prop {onCreate}\n */\n onCreate: function onCreate() {},\n\n /**\n * Callback called when the popper is updated, this callback is not called\n * on the initialization/creation of the popper, but only on subsequent\n * updates.<br />\n * By default, is set to no-op.<br />\n * Access Popper.js instance with `data.instance`.\n * @prop {onUpdate}\n */\n onUpdate: function onUpdate() {},\n\n /**\n * List of modifiers used to modify the offsets before they are applied to the popper.\n * They provide most of the functionalities of Popper.js\n * @prop {modifiers}\n */\n modifiers: modifiers\n};\n\n/**\n * @callback onCreate\n * @param {dataObject} data\n */\n\n/**\n * @callback onUpdate\n * @param {dataObject} data\n */\n\n// Utils\n// Methods\nvar Popper = function () {\n /**\n * Create a new Popper.js instance\n * @class Popper\n * @param {HTMLElement|referenceObject} reference - The reference element used to position the popper\n * @param {HTMLElement} popper - The HTML element used as popper.\n * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults)\n * @return {Object} instance - The generated Popper.js instance\n */\n function Popper(reference, popper) {\n var _this = this;\n\n var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};\n classCallCheck(this, Popper);\n\n this.scheduleUpdate = function () {\n return requestAnimationFrame(_this.update);\n };\n\n // make update() debounced, so that it only runs at most once-per-tick\n this.update = debounce(this.update.bind(this));\n\n // with {} we create a new object with the options inside it\n this.options = _extends({}, Popper.Defaults, options);\n\n // init state\n this.state = {\n isDestroyed: false,\n isCreated: false,\n scrollParents: []\n };\n\n // get reference and popper elements (allow jQuery wrappers)\n this.reference = reference && reference.jquery ? reference[0] : reference;\n this.popper = popper && popper.jquery ? popper[0] : popper;\n\n // Deep merge modifiers options\n this.options.modifiers = {};\n Object.keys(_extends({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) {\n _this.options.modifiers[name] = _extends({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {});\n });\n\n // Refactoring modifiers' list (Object => Array)\n this.modifiers = Object.keys(this.options.modifiers).map(function (name) {\n return _extends({\n name: name\n }, _this.options.modifiers[name]);\n })\n // sort the modifiers by order\n .sort(function (a, b) {\n return a.order - b.order;\n });\n\n // modifiers have the ability to execute arbitrary code when Popper.js get inited\n // such code is executed in the same order of its modifier\n // they could add new properties to their options configuration\n // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`!\n this.modifiers.forEach(function (modifierOptions) {\n if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) {\n modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state);\n }\n });\n\n // fire the first update to position the popper in the right place\n this.update();\n\n var eventsEnabled = this.options.eventsEnabled;\n if (eventsEnabled) {\n // setup event listeners, they will take care of update the position in specific situations\n this.enableEventListeners();\n }\n\n this.state.eventsEnabled = eventsEnabled;\n }\n\n // We can't use class properties because they don't get listed in the\n // class prototype and break stuff like Sinon stubs\n\n\n createClass(Popper, [{\n key: 'update',\n value: function update$$1() {\n return update.call(this);\n }\n }, {\n key: 'destroy',\n value: function destroy$$1() {\n return destroy.call(this);\n }\n }, {\n key: 'enableEventListeners',\n value: function enableEventListeners$$1() {\n return enableEventListeners.call(this);\n }\n }, {\n key: 'disableEventListeners',\n value: function disableEventListeners$$1() {\n return disableEventListeners.call(this);\n }\n\n /**\n * Schedule an update, it will run on the next UI update available\n * @method scheduleUpdate\n * @memberof Popper\n */\n\n\n /**\n * Collection of utilities useful when writing custom modifiers.\n * Starting from version 1.7, this method is available only if you\n * include `popper-utils.js` before `popper.js`.\n *\n * **DEPRECATION**: This way to access PopperUtils is deprecated\n * and will be removed in v2! Use the PopperUtils module directly instead.\n * Due to the high instability of the methods contained in Utils, we can't\n * guarantee them to follow semver. Use them at your own risk!\n * @static\n * @private\n * @type {Object}\n * @deprecated since version 1.8\n * @member Utils\n * @memberof Popper\n */\n\n }]);\n return Popper;\n}();\n\n/**\n * The `referenceObject` is an object that provides an interface compatible with Popper.js\n * and lets you use it as replacement of a real DOM node.<br />\n * You can use this method to position a popper relatively to a set of coordinates\n * in case you don't have a DOM node to use as reference.\n *\n * ```\n * new Popper(referenceObject, popperNode);\n * ```\n *\n * NB: This feature isn't supported in Internet Explorer 10\n * @name referenceObject\n * @property {Function} data.getBoundingClientRect\n * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method.\n * @property {number} data.clientWidth\n * An ES6 getter that will return the width of the virtual reference element.\n * @property {number} data.clientHeight\n * An ES6 getter that will return the height of the virtual reference element.\n */\n\n\nPopper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils;\nPopper.placements = placements;\nPopper.Defaults = Defaults;\n\n/* harmony default export */ __webpack_exports__[\"default\"] = (Popper);\n//# sourceMappingURL=popper.js.map\n\n/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(/*! ./../../../../../../../../../usr/local/lib/node_modules/webpack/buildin/global.js */ \"../../../../../usr/local/lib/node_modules/webpack/buildin/global.js\")))\n\n//# sourceURL=webpack:///./node_modules/popper.js/dist/esm/popper.js?");
/***/ }),
/***/ "./node_modules/select2/dist/js/select2.js":
/*!*************************************************!*\
!*** ./node_modules/select2/dist/js/select2.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("var __WEBPACK_AMD_DEFINE_FACTORY__, __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;var require;var require;/*!\n * Select2 4.0.5\n * https://select2.github.io\n *\n * Released under the MIT license\n * https://github.com/select2/select2/blob/master/LICENSE.md\n */\n(function (factory) {\n if (true) {\n // AMD. Register as an anonymous module.\n !(__WEBPACK_AMD_DEFINE_ARRAY__ = [__webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\")], __WEBPACK_AMD_DEFINE_FACTORY__ = (factory),\n\t\t\t\t__WEBPACK_AMD_DEFINE_RESULT__ = (typeof __WEBPACK_AMD_DEFINE_FACTORY__ === 'function' ?\n\t\t\t\t(__WEBPACK_AMD_DEFINE_FACTORY__.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__)) : __WEBPACK_AMD_DEFINE_FACTORY__),\n\t\t\t\t__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));\n } else {}\n} (function (jQuery) {\n // This is needed so we can catch the AMD loader configuration and use it\n // The inner file should be wrapped (by `banner.start.js`) in a function that\n // returns the AMD loader references.\n var S2 =(function () {\n // Restore the Select2 AMD loader so it can be used\n // Needed mostly in the language files, where the loader is not inserted\n if (jQuery && jQuery.fn && jQuery.fn.select2 && jQuery.fn.select2.amd) {\n var S2 = jQuery.fn.select2.amd;\n }\nvar S2;(function () { if (!S2 || !S2.requirejs) {\nif (!S2) { S2 = {}; } else { require = S2; }\n/**\n * @license almond 0.3.3 Copyright jQuery Foundation and other contributors.\n * Released under MIT license, http://github.com/requirejs/almond/LICENSE\n */\n//Going sloppy to avoid 'use strict' string cost, but strict practices should\n//be followed.\n/*global setTimeout: false */\n\nvar requirejs, require, define;\n(function (undef) {\n var main, req, makeMap, handlers,\n defined = {},\n waiting = {},\n config = {},\n defining = {},\n hasOwn = Object.prototype.hasOwnProperty,\n aps = [].slice,\n jsSuffixRegExp = /\\.js$/;\n\n function hasProp(obj, prop) {\n return hasOwn.call(obj, prop);\n }\n\n /**\n * Given a relative module name, like ./something, normalize it to\n * a real name that can be mapped to a path.\n * @param {String} name the relative name\n * @param {String} baseName a real name that the name arg is relative\n * to.\n * @returns {String} normalized name\n */\n function normalize(name, baseName) {\n var nameParts, nameSegment, mapValue, foundMap, lastIndex,\n foundI, foundStarMap, starI, i, j, part, normalizedBaseParts,\n baseParts = baseName && baseName.split(\"/\"),\n map = config.map,\n starMap = (map && map['*']) || {};\n\n //Adjust any relative paths.\n if (name) {\n name = name.split('/');\n lastIndex = name.length - 1;\n\n // If wanting node ID compatibility, strip .js from end\n // of IDs. Have to do this here, and not in nameToUrl\n // because node allows either .js or non .js to map\n // to same file.\n if (config.nodeIdCompat && jsSuffixRegExp.test(name[lastIndex])) {\n name[lastIndex] = name[lastIndex].replace(jsSuffixRegExp, '');\n }\n\n // Starts with a '.' so need the baseName\n if (name[0].charAt(0) === '.' && baseParts) {\n //Convert baseName to array, and lop off the last part,\n //so that . matches that 'directory' and not name of the baseName's\n //module. For instance, baseName of 'one/two/three', maps to\n //'one/two/three.js', but we want the directory, 'one/two' for\n //this normalization.\n normalizedBaseParts = baseParts.slice(0, baseParts.length - 1);\n name = normalizedBaseParts.concat(name);\n }\n\n //start trimDots\n for (i = 0; i < name.length; i++) {\n part = name[i];\n if (part === '.') {\n name.splice(i, 1);\n i -= 1;\n } else if (part === '..') {\n // If at the start, or previous value is still ..,\n // keep them so that when converted to a path it may\n // still work when converted to a path, even though\n // as an ID it is less than ideal. In larger point\n // releases, may be better to just kick out an error.\n if (i === 0 || (i === 1 && name[2] === '..') || name[i - 1] === '..') {\n continue;\n } else if (i > 0) {\n name.splice(i - 1, 2);\n i -= 2;\n }\n }\n }\n //end trimDots\n\n name = name.join('/');\n }\n\n //Apply map config if available.\n if ((baseParts || starMap) && map) {\n nameParts = name.split('/');\n\n for (i = nameParts.length; i > 0; i -= 1) {\n nameSegment = nameParts.slice(0, i).join(\"/\");\n\n if (baseParts) {\n //Find the longest baseName segment match in the config.\n //So, do joins on the biggest to smallest lengths of baseParts.\n for (j = baseParts.length; j > 0; j -= 1) {\n mapValue = map[baseParts.slice(0, j).join('/')];\n\n //baseName segment has config, find if it has one for\n //this name.\n if (mapValue) {\n mapValue = mapValue[nameSegment];\n if (mapValue) {\n //Match, update name to the new value.\n foundMap = mapValue;\n foundI = i;\n break;\n }\n }\n }\n }\n\n if (foundMap) {\n break;\n }\n\n //Check for a star map match, but just hold on to it,\n //if there is a shorter segment match later in a matching\n //config, then favor over this star map.\n if (!foundStarMap && starMap && starMap[nameSegment]) {\n foundStarMap = starMap[nameSegment];\n starI = i;\n }\n }\n\n if (!foundMap && foundStarMap) {\n foundMap = foundStarMap;\n foundI = starI;\n }\n\n if (foundMap) {\n nameParts.splice(0, foundI, foundMap);\n name = nameParts.join('/');\n }\n }\n\n return name;\n }\n\n function makeRequire(relName, forceSync) {\n return function () {\n //A version of a require function that passes a moduleName\n //value for items that may need to\n //look up paths relative to the moduleName\n var args = aps.call(arguments, 0);\n\n //If first arg is not require('string'), and there is only\n //one arg, it is the array form without a callback. Insert\n //a null so that the following concat is correct.\n if (typeof args[0] !== 'string' && args.length === 1) {\n args.push(null);\n }\n return req.apply(undef, args.concat([relName, forceSync]));\n };\n }\n\n function makeNormalize(relName) {\n return function (name) {\n return normalize(name, relName);\n };\n }\n\n function makeLoad(depName) {\n return function (value) {\n defined[depName] = value;\n };\n }\n\n function callDep(name) {\n if (hasProp(waiting, name)) {\n var args = waiting[name];\n delete waiting[name];\n defining[name] = true;\n main.apply(undef, args);\n }\n\n if (!hasProp(defined, name) && !hasProp(defining, name)) {\n throw new Error('No ' + name);\n }\n return defined[name];\n }\n\n //Turns a plugin!resource to [plugin, resource]\n //with the plugin being undefined if the name\n //did not have a plugin prefix.\n function splitPrefix(name) {\n var prefix,\n index = name ? name.indexOf('!') : -1;\n if (index > -1) {\n prefix = name.substring(0, index);\n name = name.substring(index + 1, name.length);\n }\n return [prefix, name];\n }\n\n //Creates a parts array for a relName where first part is plugin ID,\n //second part is resource ID. Assumes relName has already been normalized.\n function makeRelParts(relName) {\n return relName ? splitPrefix(relName) : [];\n }\n\n /**\n * Makes a name map, normalizing the name, and using a plugin\n * for normalization if necessary. Grabs a ref to plugin\n * too, as an optimization.\n */\n makeMap = function (name, relParts) {\n var plugin,\n parts = splitPrefix(name),\n prefix = parts[0],\n relResourceName = relParts[1];\n\n name = parts[1];\n\n if (prefix) {\n prefix = normalize(prefix, relResourceName);\n plugin = callDep(prefix);\n }\n\n //Normalize according\n if (prefix) {\n if (plugin && plugin.normalize) {\n name = plugin.normalize(name, makeNormalize(relResourceName));\n } else {\n name = normalize(name, relResourceName);\n }\n } else {\n name = normalize(name, relResourceName);\n parts = splitPrefix(name);\n prefix = parts[0];\n name = parts[1];\n if (prefix) {\n plugin = callDep(prefix);\n }\n }\n\n //Using ridiculous property names for space reasons\n return {\n f: prefix ? prefix + '!' + name : name, //fullName\n n: name,\n pr: prefix,\n p: plugin\n };\n };\n\n function makeConfig(name) {\n return function () {\n return (config && config.config && config.config[name]) || {};\n };\n }\n\n handlers = {\n require: function (name) {\n return makeRequire(name);\n },\n exports: function (name) {\n var e = defined[name];\n if (typeof e !== 'undefined') {\n return e;\n } else {\n return (defined[name] = {});\n }\n },\n module: function (name) {\n return {\n id: name,\n uri: '',\n exports: defined[name],\n config: makeConfig(name)\n };\n }\n };\n\n main = function (name, deps, callback, relName) {\n var cjsModule, depName, ret, map, i, relParts,\n args = [],\n callbackType = typeof callback,\n usingExports;\n\n //Use name if no relName\n relName = relName || name;\n relParts = makeRelParts(relName);\n\n //Call the callback to define the module, if necessary.\n if (callbackType === 'undefined' || callbackType === 'function') {\n //Pull out the defined dependencies and pass the ordered\n //values to the callback.\n //Default to [require, exports, module] if no deps\n deps = !deps.length && callback.length ? ['require', 'exports', 'module'] : deps;\n for (i = 0; i < deps.length; i += 1) {\n map = makeMap(deps[i], relParts);\n depName = map.f;\n\n //Fast path CommonJS standard dependencies.\n if (depName === \"require\") {\n args[i] = handlers.require(name);\n } else if (depName === \"exports\") {\n //CommonJS module spec 1.1\n args[i] = handlers.exports(name);\n usingExports = true;\n } else if (depName === \"module\") {\n //CommonJS module spec 1.1\n cjsModule = args[i] = handlers.module(name);\n } else if (hasProp(defined, depName) ||\n hasProp(waiting, depName) ||\n hasProp(defining, depName)) {\n args[i] = callDep(depName);\n } else if (map.p) {\n map.p.load(map.n, makeRequire(relName, true), makeLoad(depName), {});\n args[i] = defined[depName];\n } else {\n throw new Error(name + ' missing ' + depName);\n }\n }\n\n ret = callback ? callback.apply(defined[name], args) : undefined;\n\n if (name) {\n //If setting exports via \"module\" is in play,\n //favor that over return value and exports. After that,\n //favor a non-undefined return value over exports use.\n if (cjsModule && cjsModule.exports !== undef &&\n cjsModule.exports !== defined[name]) {\n defined[name] = cjsModule.exports;\n } else if (ret !== undef || !usingExports) {\n //Use the return value from the function.\n defined[name] = ret;\n }\n }\n } else if (name) {\n //May just be an object definition for the module. Only\n //worry about defining if have a module name.\n defined[name] = callback;\n }\n };\n\n requirejs = require = req = function (deps, callback, relName, forceSync, alt) {\n if (typeof deps === \"string\") {\n if (handlers[deps]) {\n //callback in this case is really relName\n return handlers[deps](callback);\n }\n //Just return the module wanted. In this scenario, the\n //deps arg is the module name, and second arg (if passed)\n //is just the relName.\n //Normalize module name, if it contains . or ..\n return callDep(makeMap(deps, makeRelParts(callback)).f);\n } else if (!deps.splice) {\n //deps is a config object, not an array.\n config = deps;\n if (config.deps) {\n req(config.deps, config.callback);\n }\n if (!callback) {\n return;\n }\n\n if (callback.splice) {\n //callback is an array, which means it is a dependency list.\n //Adjust args if there are dependencies\n deps = callback;\n callback = relName;\n relName = null;\n } else {\n deps = undef;\n }\n }\n\n //Support require(['a'])\n callback = callback || function () {};\n\n //If relName is a function, it is an errback handler,\n //so remove it.\n if (typeof relName === 'function') {\n relName = forceSync;\n forceSync = alt;\n }\n\n //Simulate async callback;\n if (forceSync) {\n main(undef, deps, callback, relName);\n } else {\n //Using a non-zero value because of concern for what old browsers\n //do, and latest browsers \"upgrade\" to 4 if lower value is used:\n //http://www.whatwg.org/specs/web-apps/current-work/multipage/timers.html#dom-windowtimers-settimeout:\n //If want a value immediately, use require('id') instead -- something\n //that works in almond on the global level, but not guaranteed and\n //unlikely to work in other AMD implementations.\n setTimeout(function () {\n main(undef, deps, callback, relName);\n }, 4);\n }\n\n return req;\n };\n\n /**\n * Just drops the config on the floor, but returns req in case\n * the config return value is used.\n */\n req.config = function (cfg) {\n return req(cfg);\n };\n\n /**\n * Expose module registry for debugging and tooling\n */\n requirejs._defined = defined;\n\n define = function (name, deps, callback) {\n if (typeof name !== 'string') {\n throw new Error('See almond README: incorrect module build, no module name');\n }\n\n //This module may not have dependencies\n if (!deps.splice) {\n //deps is not an array, so probably means\n //an object literal or factory function for\n //the value. Adjust args.\n callback = deps;\n deps = [];\n }\n\n if (!hasProp(defined, name) && !hasProp(waiting, name)) {\n waiting[name] = [name, deps, callback];\n }\n };\n\n define.amd = {\n jQuery: true\n };\n}());\n\nS2.requirejs = requirejs;S2.require = require;S2.define = define;\n}\n}());\nS2.define(\"almond\", function(){});\n\n/* global jQuery:false, $:false */\nS2.define('jquery',[],function () {\n var _$ = jQuery || $;\n\n if (_$ == null && console && console.error) {\n console.error(\n 'Select2: An instance of jQuery or a jQuery-compatible library was not ' +\n 'found. Make sure that you are including jQuery before Select2 on your ' +\n 'web page.'\n );\n }\n\n return _$;\n});\n\nS2.define('select2/utils',[\n 'jquery'\n], function ($) {\n var Utils = {};\n\n Utils.Extend = function (ChildClass, SuperClass) {\n var __hasProp = {}.hasOwnProperty;\n\n function BaseConstructor () {\n this.constructor = ChildClass;\n }\n\n for (var key in SuperClass) {\n if (__hasProp.call(SuperClass, key)) {\n ChildClass[key] = SuperClass[key];\n }\n }\n\n BaseConstructor.prototype = SuperClass.prototype;\n ChildClass.prototype = new BaseConstructor();\n ChildClass.__super__ = SuperClass.prototype;\n\n return ChildClass;\n };\n\n function getMethods (theClass) {\n var proto = theClass.prototype;\n\n var methods = [];\n\n for (var methodName in proto) {\n var m = proto[methodName];\n\n if (typeof m !== 'function') {\n continue;\n }\n\n if (methodName === 'constructor') {\n continue;\n }\n\n methods.push(methodName);\n }\n\n return methods;\n }\n\n Utils.Decorate = function (SuperClass, DecoratorClass) {\n var decoratedMethods = getMethods(DecoratorClass);\n var superMethods = getMethods(SuperClass);\n\n function DecoratedClass () {\n var unshift = Array.prototype.unshift;\n\n var argCount = DecoratorClass.prototype.constructor.length;\n\n var calledConstructor = SuperClass.prototype.constructor;\n\n if (argCount > 0) {\n unshift.call(arguments, SuperClass.prototype.constructor);\n\n calledConstructor = DecoratorClass.prototype.constructor;\n }\n\n calledConstructor.apply(this, arguments);\n }\n\n DecoratorClass.displayName = SuperClass.displayName;\n\n function ctr () {\n this.constructor = DecoratedClass;\n }\n\n DecoratedClass.prototype = new ctr();\n\n for (var m = 0; m < superMethods.length; m++) {\n var superMethod = superMethods[m];\n\n DecoratedClass.prototype[superMethod] =\n SuperClass.prototype[superMethod];\n }\n\n var calledMethod = function (methodName) {\n // Stub out the original method if it's not decorating an actual method\n var originalMethod = function () {};\n\n if (methodName in DecoratedClass.prototype) {\n originalMethod = DecoratedClass.prototype[methodName];\n }\n\n var decoratedMethod = DecoratorClass.prototype[methodName];\n\n return function () {\n var unshift = Array.prototype.unshift;\n\n unshift.call(arguments, originalMethod);\n\n return decoratedMethod.apply(this, arguments);\n };\n };\n\n for (var d = 0; d < decoratedMethods.length; d++) {\n var decoratedMethod = decoratedMethods[d];\n\n DecoratedClass.prototype[decoratedMethod] = calledMethod(decoratedMethod);\n }\n\n return DecoratedClass;\n };\n\n var Observable = function () {\n this.listeners = {};\n };\n\n Observable.prototype.on = function (event, callback) {\n this.listeners = this.listeners || {};\n\n if (event in this.listeners) {\n this.listeners[event].push(callback);\n } else {\n this.listeners[event] = [callback];\n }\n };\n\n Observable.prototype.trigger = function (event) {\n var slice = Array.prototype.slice;\n var params = slice.call(arguments, 1);\n\n this.listeners = this.listeners || {};\n\n // Params should always come in as an array\n if (params == null) {\n params = [];\n }\n\n // If there are no arguments to the event, use a temporary object\n if (params.length === 0) {\n params.push({});\n }\n\n // Set the `_type` of the first object to the event\n params[0]._type = event;\n\n if (event in this.listeners) {\n this.invoke(this.listeners[event], slice.call(arguments, 1));\n }\n\n if ('*' in this.listeners) {\n this.invoke(this.listeners['*'], arguments);\n }\n };\n\n Observable.prototype.invoke = function (listeners, params) {\n for (var i = 0, len = listeners.length; i < len; i++) {\n listeners[i].apply(this, params);\n }\n };\n\n Utils.Observable = Observable;\n\n Utils.generateChars = function (length) {\n var chars = '';\n\n for (var i = 0; i < length; i++) {\n var randomChar = Math.floor(Math.random() * 36);\n chars += randomChar.toString(36);\n }\n\n return chars;\n };\n\n Utils.bind = function (func, context) {\n return function () {\n func.apply(context, arguments);\n };\n };\n\n Utils._convertData = function (data) {\n for (var originalKey in data) {\n var keys = originalKey.split('-');\n\n var dataLevel = data;\n\n if (keys.length === 1) {\n continue;\n }\n\n for (var k = 0; k < keys.length; k++) {\n var key = keys[k];\n\n // Lowercase the first letter\n // By default, dash-separated becomes camelCase\n key = key.substring(0, 1).toLowerCase() + key.substring(1);\n\n if (!(key in dataLevel)) {\n dataLevel[key] = {};\n }\n\n if (k == keys.length - 1) {\n dataLevel[key] = data[originalKey];\n }\n\n dataLevel = dataLevel[key];\n }\n\n delete data[originalKey];\n }\n\n return data;\n };\n\n Utils.hasScroll = function (index, el) {\n // Adapted from the function created by @ShadowScripter\n // and adapted by @BillBarry on the Stack Exchange Code Review website.\n // The original code can be found at\n // http://codereview.stackexchange.com/q/13338\n // and was designed to be used with the Sizzle selector engine.\n\n var $el = $(el);\n var overflowX = el.style.overflowX;\n var overflowY = el.style.overflowY;\n\n //Check both x and y declarations\n if (overflowX === overflowY &&\n (overflowY === 'hidden' || overflowY === 'visible')) {\n return false;\n }\n\n if (overflowX === 'scroll' || overflowY === 'scroll') {\n return true;\n }\n\n return ($el.innerHeight() < el.scrollHeight ||\n $el.innerWidth() < el.scrollWidth);\n };\n\n Utils.escapeMarkup = function (markup) {\n var replaceMap = {\n '\\\\': '&#92;',\n '&': '&amp;',\n '<': '&lt;',\n '>': '&gt;',\n '\"': '&quot;',\n '\\'': '&#39;',\n '/': '&#47;'\n };\n\n // Do not try to escape the markup if it's not a string\n if (typeof markup !== 'string') {\n return markup;\n }\n\n return String(markup).replace(/[&<>\"'\\/\\\\]/g, function (match) {\n return replaceMap[match];\n });\n };\n\n // Append an array of jQuery nodes to a given element.\n Utils.appendMany = function ($element, $nodes) {\n // jQuery 1.7.x does not support $.fn.append() with an array\n // Fall back to a jQuery object collection using $.fn.add()\n if ($.fn.jquery.substr(0, 3) === '1.7') {\n var $jqNodes = $();\n\n $.map($nodes, function (node) {\n $jqNodes = $jqNodes.add(node);\n });\n\n $nodes = $jqNodes;\n }\n\n $element.append($nodes);\n };\n\n return Utils;\n});\n\nS2.define('select2/results',[\n 'jquery',\n './utils'\n], function ($, Utils) {\n function Results ($element, options, dataAdapter) {\n this.$element = $element;\n this.data = dataAdapter;\n this.options = options;\n\n Results.__super__.constructor.call(this);\n }\n\n Utils.Extend(Results, Utils.Observable);\n\n Results.prototype.render = function () {\n var $results = $(\n '<ul class=\"select2-results__options\" role=\"tree\"></ul>'\n );\n\n if (this.options.get('multiple')) {\n $results.attr('aria-multiselectable', 'true');\n }\n\n this.$results = $results;\n\n return $results;\n };\n\n Results.prototype.clear = function () {\n this.$results.empty();\n };\n\n Results.prototype.displayMessage = function (params) {\n var escapeMarkup = this.options.get('escapeMarkup');\n\n this.clear();\n this.hideLoading();\n\n var $message = $(\n '<li role=\"treeitem\" aria-live=\"assertive\"' +\n ' class=\"select2-results__option\"></li>'\n );\n\n var message = this.options.get('translations').get(params.message);\n\n $message.append(\n escapeMarkup(\n message(params.args)\n )\n );\n\n $message[0].className += ' select2-results__message';\n\n this.$results.append($message);\n };\n\n Results.prototype.hideMessages = function () {\n this.$results.find('.select2-results__message').remove();\n };\n\n Results.prototype.append = function (data) {\n this.hideLoading();\n\n var $options = [];\n\n if (data.results == null || data.results.length === 0) {\n if (this.$results.children().length === 0) {\n this.trigger('results:message', {\n message: 'noResults'\n });\n }\n\n return;\n }\n\n data.results = this.sort(data.results);\n\n for (var d = 0; d < data.results.length; d++) {\n var item = data.results[d];\n\n var $option = this.option(item);\n\n $options.push($option);\n }\n\n this.$results.append($options);\n };\n\n Results.prototype.position = function ($results, $dropdown) {\n var $resultsContainer = $dropdown.find('.select2-results');\n $resultsContainer.append($results);\n };\n\n Results.prototype.sort = function (data) {\n var sorter = this.options.get('sorter');\n\n return sorter(data);\n };\n\n Results.prototype.highlightFirstItem = function () {\n var $options = this.$results\n .find('.select2-results__option[aria-selected]');\n\n var $selected = $options.filter('[aria-selected=true]');\n\n // Check if there are any selected options\n if ($selected.length > 0) {\n // If there are selected options, highlight the first\n $selected.first().trigger('mouseenter');\n } else {\n // If there are no selected options, highlight the first option\n // in the dropdown\n $options.first().trigger('mouseenter');\n }\n\n this.ensureHighlightVisible();\n };\n\n Results.prototype.setClasses = function () {\n var self = this;\n\n this.data.current(function (selected) {\n var selectedIds = $.map(selected, function (s) {\n return s.id.toString();\n });\n\n var $options = self.$results\n .find('.select2-results__option[aria-selected]');\n\n $options.each(function () {\n var $option = $(this);\n\n var item = $.data(this, 'data');\n\n // id needs to be converted to a string when comparing\n var id = '' + item.id;\n\n if ((item.element != null && item.element.selected) ||\n (item.element == null && $.inArray(id, selectedIds) > -1)) {\n $option.attr('aria-selected', 'true');\n } else {\n $option.attr('aria-selected', 'false');\n }\n });\n\n });\n };\n\n Results.prototype.showLoading = function (params) {\n this.hideLoading();\n\n var loadingMore = this.options.get('translations').get('searching');\n\n var loading = {\n disabled: true,\n loading: true,\n text: loadingMore(params)\n };\n var $loading = this.option(loading);\n $loading.className += ' loading-results';\n\n this.$results.prepend($loading);\n };\n\n Results.prototype.hideLoading = function () {\n this.$results.find('.loading-results').remove();\n };\n\n Results.prototype.option = function (data) {\n var option = document.createElement('li');\n option.className = 'select2-results__option';\n\n var attrs = {\n 'role': 'treeitem',\n 'aria-selected': 'false'\n };\n\n if (data.disabled) {\n delete attrs['aria-selected'];\n attrs['aria-disabled'] = 'true';\n }\n\n if (data.id == null) {\n delete attrs['aria-selected'];\n }\n\n if (data._resultId != null) {\n option.id = data._resultId;\n }\n\n if (data.title) {\n option.title = data.title;\n }\n\n if (data.children) {\n attrs.role = 'group';\n attrs['aria-label'] = data.text;\n delete attrs['aria-selected'];\n }\n\n for (var attr in attrs) {\n var val = attrs[attr];\n\n option.setAttribute(attr, val);\n }\n\n if (data.children) {\n var $option = $(option);\n\n var label = document.createElement('strong');\n label.className = 'select2-results__group';\n\n var $label = $(label);\n this.template(data, label);\n\n var $children = [];\n\n for (var c = 0; c < data.children.length; c++) {\n var child = data.children[c];\n\n var $child = this.option(child);\n\n $children.push($child);\n }\n\n var $childrenContainer = $('<ul></ul>', {\n 'class': 'select2-results__options select2-results__options--nested'\n });\n\n $childrenContainer.append($children);\n\n $option.append(label);\n $option.append($childrenContainer);\n } else {\n this.template(data, option);\n }\n\n $.data(option, 'data', data);\n\n return option;\n };\n\n Results.prototype.bind = function (container, $container) {\n var self = this;\n\n var id = container.id + '-results';\n\n this.$results.attr('id', id);\n\n container.on('results:all', function (params) {\n self.clear();\n self.append(params.data);\n\n if (container.isOpen()) {\n self.setClasses();\n self.highlightFirstItem();\n }\n });\n\n container.on('results:append', function (params) {\n self.append(params.data);\n\n if (container.isOpen()) {\n self.setClasses();\n }\n });\n\n container.on('query', function (params) {\n self.hideMessages();\n self.showLoading(params);\n });\n\n container.on('select', function () {\n if (!container.isOpen()) {\n return;\n }\n\n self.setClasses();\n self.highlightFirstItem();\n });\n\n container.on('unselect', function () {\n if (!container.isOpen()) {\n return;\n }\n\n self.setClasses();\n self.highlightFirstItem();\n });\n\n container.on('open', function () {\n // When the dropdown is open, aria-expended=\"true\"\n self.$results.attr('aria-expanded', 'true');\n self.$results.attr('aria-hidden', 'false');\n\n self.setClasses();\n self.ensureHighlightVisible();\n });\n\n container.on('close', function () {\n // When the dropdown is closed, aria-expended=\"false\"\n self.$results.attr('aria-expanded', 'false');\n self.$results.attr('aria-hidden', 'true');\n self.$results.removeAttr('aria-activedescendant');\n });\n\n container.on('results:toggle', function () {\n var $highlighted = self.getHighlightedResults();\n\n if ($highlighted.length === 0) {\n return;\n }\n\n $highlighted.trigger('mouseup');\n });\n\n container.on('results:select', function () {\n var $highlighted = self.getHighlightedResults();\n\n if ($highlighted.length === 0) {\n return;\n }\n\n var data = $highlighted.data('data');\n\n if ($highlighted.attr('aria-selected') == 'true') {\n self.trigger('close', {});\n } else {\n self.trigger('select', {\n data: data\n });\n }\n });\n\n container.on('results:previous', function () {\n var $highlighted = self.getHighlightedResults();\n\n var $options = self.$results.find('[aria-selected]');\n\n var currentIndex = $options.index($highlighted);\n\n // If we are already at te top, don't move further\n if (currentIndex === 0) {\n return;\n }\n\n var nextIndex = currentIndex - 1;\n\n // If none are highlighted, highlight the first\n if ($highlighted.length === 0) {\n nextIndex = 0;\n }\n\n var $next = $options.eq(nextIndex);\n\n $next.trigger('mouseenter');\n\n var currentOffset = self.$results.offset().top;\n var nextTop = $next.offset().top;\n var nextOffset = self.$results.scrollTop() + (nextTop - currentOffset);\n\n if (nextIndex === 0) {\n self.$results.scrollTop(0);\n } else if (nextTop - currentOffset < 0) {\n self.$results.scrollTop(nextOffset);\n }\n });\n\n container.on('results:next', function () {\n var $highlighted = self.getHighlightedResults();\n\n var $options = self.$results.find('[aria-selected]');\n\n var currentIndex = $options.index($highlighted);\n\n var nextIndex = currentIndex + 1;\n\n // If we are at the last option, stay there\n if (nextIndex >= $options.length) {\n return;\n }\n\n var $next = $options.eq(nextIndex);\n\n $next.trigger('mouseenter');\n\n var currentOffset = self.$results.offset().top +\n self.$results.outerHeight(false);\n var nextBottom = $next.offset().top + $next.outerHeight(false);\n var nextOffset = self.$results.scrollTop() + nextBottom - currentOffset;\n\n if (nextIndex === 0) {\n self.$results.scrollTop(0);\n } else if (nextBottom > currentOffset) {\n self.$results.scrollTop(nextOffset);\n }\n });\n\n container.on('results:focus', function (params) {\n params.element.addClass('select2-results__option--highlighted');\n });\n\n container.on('results:message', function (params) {\n self.displayMessage(params);\n });\n\n if ($.fn.mousewheel) {\n this.$results.on('mousewheel', function (e) {\n var top = self.$results.scrollTop();\n\n var bottom = self.$results.get(0).scrollHeight - top + e.deltaY;\n\n var isAtTop = e.deltaY > 0 && top - e.deltaY <= 0;\n var isAtBottom = e.deltaY < 0 && bottom <= self.$results.height();\n\n if (isAtTop) {\n self.$results.scrollTop(0);\n\n e.preventDefault();\n e.stopPropagation();\n } else if (isAtBottom) {\n self.$results.scrollTop(\n self.$results.get(0).scrollHeight - self.$results.height()\n );\n\n e.preventDefault();\n e.stopPropagation();\n }\n });\n }\n\n this.$results.on('mouseup', '.select2-results__option[aria-selected]',\n function (evt) {\n var $this = $(this);\n\n var data = $this.data('data');\n\n if ($this.attr('aria-selected') === 'true') {\n if (self.options.get('multiple')) {\n self.trigger('unselect', {\n originalEvent: evt,\n data: data\n });\n } else {\n self.trigger('close', {});\n }\n\n return;\n }\n\n self.trigger('select', {\n originalEvent: evt,\n data: data\n });\n });\n\n this.$results.on('mouseenter', '.select2-results__option[aria-selected]',\n function (evt) {\n var data = $(this).data('data');\n\n self.getHighlightedResults()\n .removeClass('select2-results__option--highlighted');\n\n self.trigger('results:focus', {\n data: data,\n element: $(this)\n });\n });\n };\n\n Results.prototype.getHighlightedResults = function () {\n var $highlighted = this.$results\n .find('.select2-results__option--highlighted');\n\n return $highlighted;\n };\n\n Results.prototype.destroy = function () {\n this.$results.remove();\n };\n\n Results.prototype.ensureHighlightVisible = function () {\n var $highlighted = this.getHighlightedResults();\n\n if ($highlighted.length === 0) {\n return;\n }\n\n var $options = this.$results.find('[aria-selected]');\n\n var currentIndex = $options.index($highlighted);\n\n var currentOffset = this.$results.offset().top;\n var nextTop = $highlighted.offset().top;\n var nextOffset = this.$results.scrollTop() + (nextTop - currentOffset);\n\n var offsetDelta = nextTop - currentOffset;\n nextOffset -= $highlighted.outerHeight(false) * 2;\n\n if (currentIndex <= 2) {\n this.$results.scrollTop(0);\n } else if (offsetDelta > this.$results.outerHeight() || offsetDelta < 0) {\n this.$results.scrollTop(nextOffset);\n }\n };\n\n Results.prototype.template = function (result, container) {\n var template = this.options.get('templateResult');\n var escapeMarkup = this.options.get('escapeMarkup');\n\n var content = template(result, container);\n\n if (content == null) {\n container.style.display = 'none';\n } else if (typeof content === 'string') {\n container.innerHTML = escapeMarkup(content);\n } else {\n $(container).append(content);\n }\n };\n\n return Results;\n});\n\nS2.define('select2/keys',[\n\n], function () {\n var KEYS = {\n BACKSPACE: 8,\n TAB: 9,\n ENTER: 13,\n SHIFT: 16,\n CTRL: 17,\n ALT: 18,\n ESC: 27,\n SPACE: 32,\n PAGE_UP: 33,\n PAGE_DOWN: 34,\n END: 35,\n HOME: 36,\n LEFT: 37,\n UP: 38,\n RIGHT: 39,\n DOWN: 40,\n DELETE: 46\n };\n\n return KEYS;\n});\n\nS2.define('select2/selection/base',[\n 'jquery',\n '../utils',\n '../keys'\n], function ($, Utils, KEYS) {\n function BaseSelection ($element, options) {\n this.$element = $element;\n this.options = options;\n\n BaseSelection.__super__.constructor.call(this);\n }\n\n Utils.Extend(BaseSelection, Utils.Observable);\n\n BaseSelection.prototype.render = function () {\n var $selection = $(\n '<span class=\"select2-selection\" role=\"combobox\" ' +\n ' aria-haspopup=\"true\" aria-expanded=\"false\">' +\n '</span>'\n );\n\n this._tabindex = 0;\n\n if (this.$element.data('old-tabindex') != null) {\n this._tabindex = this.$element.data('old-tabindex');\n } else if (this.$element.attr('tabindex') != null) {\n this._tabindex = this.$element.attr('tabindex');\n }\n\n $selection.attr('title', this.$element.attr('title'));\n $selection.attr('tabindex', this._tabindex);\n\n this.$selection = $selection;\n\n return $selection;\n };\n\n BaseSelection.prototype.bind = function (container, $container) {\n var self = this;\n\n var id = container.id + '-container';\n var resultsId = container.id + '-results';\n\n this.container = container;\n\n this.$selection.on('focus', function (evt) {\n self.trigger('focus', evt);\n });\n\n this.$selection.on('blur', function (evt) {\n self._handleBlur(evt);\n });\n\n this.$selection.on('keydown', function (evt) {\n self.trigger('keypress', evt);\n\n if (evt.which === KEYS.SPACE) {\n evt.preventDefault();\n }\n });\n\n container.on('results:focus', function (params) {\n self.$selection.attr('aria-activedescendant', params.data._resultId);\n });\n\n container.on('selection:update', function (params) {\n self.update(params.data);\n });\n\n container.on('open', function () {\n // When the dropdown is open, aria-expanded=\"true\"\n self.$selection.attr('aria-expanded', 'true');\n self.$selection.attr('aria-owns', resultsId);\n\n self._attachCloseHandler(container);\n });\n\n container.on('close', function () {\n // When the dropdown is closed, aria-expanded=\"false\"\n self.$selection.attr('aria-expanded', 'false');\n self.$selection.removeAttr('aria-activedescendant');\n self.$selection.removeAttr('aria-owns');\n\n self.$selection.focus();\n\n self._detachCloseHandler(container);\n });\n\n container.on('enable', function () {\n self.$selection.attr('tabindex', self._tabindex);\n });\n\n container.on('disable', function () {\n self.$selection.attr('tabindex', '-1');\n });\n };\n\n BaseSelection.prototype._handleBlur = function (evt) {\n var self = this;\n\n // This needs to be delayed as the active element is the body when the tab\n // key is pressed, possibly along with others.\n window.setTimeout(function () {\n // Don't trigger `blur` if the focus is still in the selection\n if (\n (document.activeElement == self.$selection[0]) ||\n ($.contains(self.$selection[0], document.activeElement))\n ) {\n return;\n }\n\n self.trigger('blur', evt);\n }, 1);\n };\n\n BaseSelection.prototype._attachCloseHandler = function (container) {\n var self = this;\n\n $(document.body).on('mousedown.select2.' + container.id, function (e) {\n var $target = $(e.target);\n\n var $select = $target.closest('.select2');\n\n var $all = $('.select2.select2-container--open');\n\n $all.each(function () {\n var $this = $(this);\n\n if (this == $select[0]) {\n return;\n }\n\n var $element = $this.data('element');\n\n $element.select2('close');\n });\n });\n };\n\n BaseSelection.prototype._detachCloseHandler = function (container) {\n $(document.body).off('mousedown.select2.' + container.id);\n };\n\n BaseSelection.prototype.position = function ($selection, $container) {\n var $selectionContainer = $container.find('.selection');\n $selectionContainer.append($selection);\n };\n\n BaseSelection.prototype.destroy = function () {\n this._detachCloseHandler(this.container);\n };\n\n BaseSelection.prototype.update = function (data) {\n throw new Error('The `update` method must be defined in child classes.');\n };\n\n return BaseSelection;\n});\n\nS2.define('select2/selection/single',[\n 'jquery',\n './base',\n '../utils',\n '../keys'\n], function ($, BaseSelection, Utils, KEYS) {\n function SingleSelection () {\n SingleSelection.__super__.constructor.apply(this, arguments);\n }\n\n Utils.Extend(SingleSelection, BaseSelection);\n\n SingleSelection.prototype.render = function () {\n var $selection = SingleSelection.__super__.render.call(this);\n\n $selection.addClass('select2-selection--single');\n\n $selection.html(\n '<span class=\"select2-selection__rendered\"></span>' +\n '<span class=\"select2-selection__arrow\" role=\"presentation\">' +\n '<b role=\"presentation\"></b>' +\n '</span>'\n );\n\n return $selection;\n };\n\n SingleSelection.prototype.bind = function (container, $container) {\n var self = this;\n\n SingleSelection.__super__.bind.apply(this, arguments);\n\n var id = container.id + '-container';\n\n this.$selection.find('.select2-selection__rendered').attr('id', id);\n this.$selection.attr('aria-labelledby', id);\n\n this.$selection.on('mousedown', function (evt) {\n // Only respond to left clicks\n if (evt.which !== 1) {\n return;\n }\n\n self.trigger('toggle', {\n originalEvent: evt\n });\n });\n\n this.$selection.on('focus', function (evt) {\n // User focuses on the container\n });\n\n this.$selection.on('blur', function (evt) {\n // User exits the container\n });\n\n container.on('focus', function (evt) {\n if (!container.isOpen()) {\n self.$selection.focus();\n }\n });\n\n container.on('selection:update', function (params) {\n self.update(params.data);\n });\n };\n\n SingleSelection.prototype.clear = function () {\n this.$selection.find('.select2-selection__rendered').empty();\n };\n\n SingleSelection.prototype.display = function (data, container) {\n var template = this.options.get('templateSelection');\n var escapeMarkup = this.options.get('escapeMarkup');\n\n return escapeMarkup(template(data, container));\n };\n\n SingleSelection.prototype.selectionContainer = function () {\n return $('<span></span>');\n };\n\n SingleSelection.prototype.update = function (data) {\n if (data.length === 0) {\n this.clear();\n return;\n }\n\n var selection = data[0];\n\n var $rendered = this.$selection.find('.select2-selection__rendered');\n var formatted = this.display(selection, $rendered);\n\n $rendered.empty().append(formatted);\n $rendered.prop('title', selection.title || selection.text);\n };\n\n return SingleSelection;\n});\n\nS2.define('select2/selection/multiple',[\n 'jquery',\n './base',\n '../utils'\n], function ($, BaseSelection, Utils) {\n function MultipleSelection ($element, options) {\n MultipleSelection.__super__.constructor.apply(this, arguments);\n }\n\n Utils.Extend(MultipleSelection, BaseSelection);\n\n MultipleSelection.prototype.render = function () {\n var $selection = MultipleSelection.__super__.render.call(this);\n\n $selection.addClass('select2-selection--multiple');\n\n $selection.html(\n '<ul class=\"select2-selection__rendered\"></ul>'\n );\n\n return $selection;\n };\n\n MultipleSelection.prototype.bind = function (container, $container) {\n var self = this;\n\n MultipleSelection.__super__.bind.apply(this, arguments);\n\n this.$selection.on('click', function (evt) {\n self.trigger('toggle', {\n originalEvent: evt\n });\n });\n\n this.$selection.on(\n 'click',\n '.select2-selection__choice__remove',\n function (evt) {\n // Ignore the event if it is disabled\n if (self.options.get('disabled')) {\n return;\n }\n\n var $remove = $(this);\n var $selection = $remove.parent();\n\n var data = $selection.data('data');\n\n self.trigger('unselect', {\n originalEvent: evt,\n data: data\n });\n }\n );\n };\n\n MultipleSelection.prototype.clear = function () {\n this.$selection.find('.select2-selection__rendered').empty();\n };\n\n MultipleSelection.prototype.display = function (data, container) {\n var template = this.options.get('templateSelection');\n var escapeMarkup = this.options.get('escapeMarkup');\n\n return escapeMarkup(template(data, container));\n };\n\n MultipleSelection.prototype.selectionContainer = function () {\n var $container = $(\n '<li class=\"select2-selection__choice\">' +\n '<span class=\"select2-selection__choice__remove\" role=\"presentation\">' +\n '&times;' +\n '</span>' +\n '</li>'\n );\n\n return $container;\n };\n\n MultipleSelection.prototype.update = function (data) {\n this.clear();\n\n if (data.length === 0) {\n return;\n }\n\n var $selections = [];\n\n for (var d = 0; d < data.length; d++) {\n var selection = data[d];\n\n var $selection = this.selectionContainer();\n var formatted = this.display(selection, $selection);\n\n $selection.append(formatted);\n $selection.prop('title', selection.title || selection.text);\n\n $selection.data('data', selection);\n\n $selections.push($selection);\n }\n\n var $rendered = this.$selection.find('.select2-selection__rendered');\n\n Utils.appendMany($rendered, $selections);\n };\n\n return MultipleSelection;\n});\n\nS2.define('select2/selection/placeholder',[\n '../utils'\n], function (Utils) {\n function Placeholder (decorated, $element, options) {\n this.placeholder = this.normalizePlaceholder(options.get('placeholder'));\n\n decorated.call(this, $element, options);\n }\n\n Placeholder.prototype.normalizePlaceholder = function (_, placeholder) {\n if (typeof placeholder === 'string') {\n placeholder = {\n id: '',\n text: placeholder\n };\n }\n\n return placeholder;\n };\n\n Placeholder.prototype.createPlaceholder = function (decorated, placeholder) {\n var $placeholder = this.selectionContainer();\n\n $placeholder.html(this.display(placeholder));\n $placeholder.addClass('select2-selection__placeholder')\n .removeClass('select2-selection__choice');\n\n return $placeholder;\n };\n\n Placeholder.prototype.update = function (decorated, data) {\n var singlePlaceholder = (\n data.length == 1 && data[0].id != this.placeholder.id\n );\n var multipleSelections = data.length > 1;\n\n if (multipleSelections || singlePlaceholder) {\n return decorated.call(this, data);\n }\n\n this.clear();\n\n var $placeholder = this.createPlaceholder(this.placeholder);\n\n this.$selection.find('.select2-selection__rendered').append($placeholder);\n };\n\n return Placeholder;\n});\n\nS2.define('select2/selection/allowClear',[\n 'jquery',\n '../keys'\n], function ($, KEYS) {\n function AllowClear () { }\n\n AllowClear.prototype.bind = function (decorated, container, $container) {\n var self = this;\n\n decorated.call(this, container, $container);\n\n if (this.placeholder == null) {\n if (this.options.get('debug') && window.console && console.error) {\n console.error(\n 'Select2: The `allowClear` option should be used in combination ' +\n 'with the `placeholder` option.'\n );\n }\n }\n\n this.$selection.on('mousedown', '.select2-selection__clear',\n function (evt) {\n self._handleClear(evt);\n });\n\n container.on('keypress', function (evt) {\n self._handleKeyboardClear(evt, container);\n });\n };\n\n AllowClear.prototype._handleClear = function (_, evt) {\n // Ignore the event if it is disabled\n if (this.options.get('disabled')) {\n return;\n }\n\n var $clear = this.$selection.find('.select2-selection__clear');\n\n // Ignore the event if nothing has been selected\n if ($clear.length === 0) {\n return;\n }\n\n evt.stopPropagation();\n\n var data = $clear.data('data');\n\n for (var d = 0; d < data.length; d++) {\n var unselectData = {\n data: data[d]\n };\n\n // Trigger the `unselect` event, so people can prevent it from being\n // cleared.\n this.trigger('unselect', unselectData);\n\n // If the event was prevented, don't clear it out.\n if (unselectData.prevented) {\n return;\n }\n }\n\n this.$element.val(this.placeholder.id).trigger('change');\n\n this.trigger('toggle', {});\n };\n\n AllowClear.prototype._handleKeyboardClear = function (_, evt, container) {\n if (container.isOpen()) {\n return;\n }\n\n if (evt.which == KEYS.DELETE || evt.which == KEYS.BACKSPACE) {\n this._handleClear(evt);\n }\n };\n\n AllowClear.prototype.update = function (decorated, data) {\n decorated.call(this, data);\n\n if (this.$selection.find('.select2-selection__placeholder').length > 0 ||\n data.length === 0) {\n return;\n }\n\n var $remove = $(\n '<span class=\"select2-selection__clear\">' +\n '&times;' +\n '</span>'\n );\n $remove.data('data', data);\n\n this.$selection.find('.select2-selection__rendered').prepend($remove);\n };\n\n return AllowClear;\n});\n\nS2.define('select2/selection/search',[\n 'jquery',\n '../utils',\n '../keys'\n], function ($, Utils, KEYS) {\n function Search (decorated, $element, options) {\n decorated.call(this, $element, options);\n }\n\n Search.prototype.render = function (decorated) {\n var $search = $(\n '<li class=\"select2-search select2-search--inline\">' +\n '<input class=\"select2-search__field\" type=\"search\" tabindex=\"-1\"' +\n ' autocomplete=\"off\" autocorrect=\"off\" autocapitalize=\"none\"' +\n ' spellcheck=\"false\" role=\"textbox\" aria-autocomplete=\"list\" />' +\n '</li>'\n );\n\n this.$searchContainer = $search;\n this.$search = $search.find('input');\n\n var $rendered = decorated.call(this);\n\n this._transferTabIndex();\n\n return $rendered;\n };\n\n Search.prototype.bind = function (decorated, container, $container) {\n var self = this;\n\n decorated.call(this, container, $container);\n\n container.on('open', function () {\n self.$search.trigger('focus');\n });\n\n container.on('close', function () {\n self.$search.val('');\n self.$search.removeAttr('aria-activedescendant');\n self.$search.trigger('focus');\n });\n\n container.on('enable', function () {\n self.$search.prop('disabled', false);\n\n self._transferTabIndex();\n });\n\n container.on('disable', function () {\n self.$search.prop('disabled', true);\n });\n\n container.on('focus', function (evt) {\n self.$search.trigger('focus');\n });\n\n container.on('results:focus', function (params) {\n self.$search.attr('aria-activedescendant', params.id);\n });\n\n this.$selection.on('focusin', '.select2-search--inline', function (evt) {\n self.trigger('focus', evt);\n });\n\n this.$selection.on('focusout', '.select2-search--inline', function (evt) {\n self._handleBlur(evt);\n });\n\n this.$selection.on('keydown', '.select2-search--inline', function (evt) {\n evt.stopPropagation();\n\n self.trigger('keypress', evt);\n\n self._keyUpPrevented = evt.isDefaultPrevented();\n\n var key = evt.which;\n\n if (key === KEYS.BACKSPACE && self.$search.val() === '') {\n var $previousChoice = self.$searchContainer\n .prev('.select2-selection__choice');\n\n if ($previousChoice.length > 0) {\n var item = $previousChoice.data('data');\n\n self.searchRemoveChoice(item);\n\n evt.preventDefault();\n }\n }\n });\n\n // Try to detect the IE version should the `documentMode` property that\n // is stored on the document. This is only implemented in IE and is\n // slightly cleaner than doing a user agent check.\n // This property is not available in Edge, but Edge also doesn't have\n // this bug.\n var msie = document.documentMode;\n var disableInputEvents = msie && msie <= 11;\n\n // Workaround for browsers which do not support the `input` event\n // This will prevent double-triggering of events for browsers which support\n // both the `keyup` and `input` events.\n this.$selection.on(\n 'input.searchcheck',\n '.select2-search--inline',\n function (evt) {\n // IE will trigger the `input` event when a placeholder is used on a\n // search box. To get around this issue, we are forced to ignore all\n // `input` events in IE and keep using `keyup`.\n if (disableInputEvents) {\n self.$selection.off('input.search input.searchcheck');\n return;\n }\n\n // Unbind the duplicated `keyup` event\n self.$selection.off('keyup.search');\n }\n );\n\n this.$selection.on(\n 'keyup.search input.search',\n '.select2-search--inline',\n function (evt) {\n // IE will trigger the `input` event when a placeholder is used on a\n // search box. To get around this issue, we are forced to ignore all\n // `input` events in IE and keep using `keyup`.\n if (disableInputEvents && evt.type === 'input') {\n self.$selection.off('input.search input.searchcheck');\n return;\n }\n\n var key = evt.which;\n\n // We can freely ignore events from modifier keys\n if (key == KEYS.SHIFT || key == KEYS.CTRL || key == KEYS.ALT) {\n return;\n }\n\n // Tabbing will be handled during the `keydown` phase\n if (key == KEYS.TAB) {\n return;\n }\n\n self.handleSearch(evt);\n }\n );\n };\n\n /**\n * This method will transfer the tabindex attribute from the rendered\n * selection to the search box. This allows for the search box to be used as\n * the primary focus instead of the selection container.\n *\n * @private\n */\n Search.prototype._transferTabIndex = function (decorated) {\n this.$search.attr('tabindex', this.$selection.attr('tabindex'));\n this.$selection.attr('tabindex', '-1');\n };\n\n Search.prototype.createPlaceholder = function (decorated, placeholder) {\n this.$search.attr('placeholder', placeholder.text);\n };\n\n Search.prototype.update = function (decorated, data) {\n var searchHadFocus = this.$search[0] == document.activeElement;\n\n this.$search.attr('placeholder', '');\n\n decorated.call(this, data);\n\n this.$selection.find('.select2-selection__rendered')\n .append(this.$searchContainer);\n\n this.resizeSearch();\n if (searchHadFocus) {\n this.$search.focus();\n }\n };\n\n Search.prototype.handleSearch = function () {\n this.resizeSearch();\n\n if (!this._keyUpPrevented) {\n var input = this.$search.val();\n\n this.trigger('query', {\n term: input\n });\n }\n\n this._keyUpPrevented = false;\n };\n\n Search.prototype.searchRemoveChoice = function (decorated, item) {\n this.trigger('unselect', {\n data: item\n });\n\n this.$search.val(item.text);\n this.handleSearch();\n };\n\n Search.prototype.resizeSearch = function () {\n this.$search.css('width', '25px');\n\n var width = '';\n\n if (this.$search.attr('placeholder') !== '') {\n width = this.$selection.find('.select2-selection__rendered').innerWidth();\n } else {\n var minimumWidth = this.$search.val().length + 1;\n\n width = (minimumWidth * 0.75) + 'em';\n }\n\n this.$search.css('width', width);\n };\n\n return Search;\n});\n\nS2.define('select2/selection/eventRelay',[\n 'jquery'\n], function ($) {\n function EventRelay () { }\n\n EventRelay.prototype.bind = function (decorated, container, $container) {\n var self = this;\n var relayEvents = [\n 'open', 'opening',\n 'close', 'closing',\n 'select', 'selecting',\n 'unselect', 'unselecting'\n ];\n\n var preventableEvents = ['opening', 'closing', 'selecting', 'unselecting'];\n\n decorated.call(this, container, $container);\n\n container.on('*', function (name, params) {\n // Ignore events that should not be relayed\n if ($.inArray(name, relayEvents) === -1) {\n return;\n }\n\n // The parameters should always be an object\n params = params || {};\n\n // Generate the jQuery event for the Select2 event\n var evt = $.Event('select2:' + name, {\n params: params\n });\n\n self.$element.trigger(evt);\n\n // Only handle preventable events if it was one\n if ($.inArray(name, preventableEvents) === -1) {\n return;\n }\n\n params.prevented = evt.isDefaultPrevented();\n });\n };\n\n return EventRelay;\n});\n\nS2.define('select2/translation',[\n 'jquery',\n 'require'\n], function ($, require) {\n function Translation (dict) {\n this.dict = dict || {};\n }\n\n Translation.prototype.all = function () {\n return this.dict;\n };\n\n Translation.prototype.get = function (key) {\n return this.dict[key];\n };\n\n Translation.prototype.extend = function (translation) {\n this.dict = $.extend({}, translation.all(), this.dict);\n };\n\n // Static functions\n\n Translation._cache = {};\n\n Translation.loadPath = function (path) {\n if (!(path in Translation._cache)) {\n var translations = require(path);\n\n Translation._cache[path] = translations;\n }\n\n return new Translation(Translation._cache[path]);\n };\n\n return Translation;\n});\n\nS2.define('select2/diacritics',[\n\n], function () {\n var diacritics = {\n '\\u24B6': 'A',\n '\\uFF21': 'A',\n '\\u00C0': 'A',\n '\\u00C1': 'A',\n '\\u00C2': 'A',\n '\\u1EA6': 'A',\n '\\u1EA4': 'A',\n '\\u1EAA': 'A',\n '\\u1EA8': 'A',\n '\\u00C3': 'A',\n '\\u0100': 'A',\n '\\u0102': 'A',\n '\\u1EB0': 'A',\n '\\u1EAE': 'A',\n '\\u1EB4': 'A',\n '\\u1EB2': 'A',\n '\\u0226': 'A',\n '\\u01E0': 'A',\n '\\u00C4': 'A',\n '\\u01DE': 'A',\n '\\u1EA2': 'A',\n '\\u00C5': 'A',\n '\\u01FA': 'A',\n '\\u01CD': 'A',\n '\\u0200': 'A',\n '\\u0202': 'A',\n '\\u1EA0': 'A',\n '\\u1EAC': 'A',\n '\\u1EB6': 'A',\n '\\u1E00': 'A',\n '\\u0104': 'A',\n '\\u023A': 'A',\n '\\u2C6F': 'A',\n '\\uA732': 'AA',\n '\\u00C6': 'AE',\n '\\u01FC': 'AE',\n '\\u01E2': 'AE',\n '\\uA734': 'AO',\n '\\uA736': 'AU',\n '\\uA738': 'AV',\n '\\uA73A': 'AV',\n '\\uA73C': 'AY',\n '\\u24B7': 'B',\n '\\uFF22': 'B',\n '\\u1E02': 'B',\n '\\u1E04': 'B',\n '\\u1E06': 'B',\n '\\u0243': 'B',\n '\\u0182': 'B',\n '\\u0181': 'B',\n '\\u24B8': 'C',\n '\\uFF23': 'C',\n '\\u0106': 'C',\n '\\u0108': 'C',\n '\\u010A': 'C',\n '\\u010C': 'C',\n '\\u00C7': 'C',\n '\\u1E08': 'C',\n '\\u0187': 'C',\n '\\u023B': 'C',\n '\\uA73E': 'C',\n '\\u24B9': 'D',\n '\\uFF24': 'D',\n '\\u1E0A': 'D',\n '\\u010E': 'D',\n '\\u1E0C': 'D',\n '\\u1E10': 'D',\n '\\u1E12': 'D',\n '\\u1E0E': 'D',\n '\\u0110': 'D',\n '\\u018B': 'D',\n '\\u018A': 'D',\n '\\u0189': 'D',\n '\\uA779': 'D',\n '\\u01F1': 'DZ',\n '\\u01C4': 'DZ',\n '\\u01F2': 'Dz',\n '\\u01C5': 'Dz',\n '\\u24BA': 'E',\n '\\uFF25': 'E',\n '\\u00C8': 'E',\n '\\u00C9': 'E',\n '\\u00CA': 'E',\n '\\u1EC0': 'E',\n '\\u1EBE': 'E',\n '\\u1EC4': 'E',\n '\\u1EC2': 'E',\n '\\u1EBC': 'E',\n '\\u0112': 'E',\n '\\u1E14': 'E',\n '\\u1E16': 'E',\n '\\u0114': 'E',\n '\\u0116': 'E',\n '\\u00CB': 'E',\n '\\u1EBA': 'E',\n '\\u011A': 'E',\n '\\u0204': 'E',\n '\\u0206': 'E',\n '\\u1EB8': 'E',\n '\\u1EC6': 'E',\n '\\u0228': 'E',\n '\\u1E1C': 'E',\n '\\u0118': 'E',\n '\\u1E18': 'E',\n '\\u1E1A': 'E',\n '\\u0190': 'E',\n '\\u018E': 'E',\n '\\u24BB': 'F',\n '\\uFF26': 'F',\n '\\u1E1E': 'F',\n '\\u0191': 'F',\n '\\uA77B': 'F',\n '\\u24BC': 'G',\n '\\uFF27': 'G',\n '\\u01F4': 'G',\n '\\u011C': 'G',\n '\\u1E20': 'G',\n '\\u011E': 'G',\n '\\u0120': 'G',\n '\\u01E6': 'G',\n '\\u0122': 'G',\n '\\u01E4': 'G',\n '\\u0193': 'G',\n '\\uA7A0': 'G',\n '\\uA77D': 'G',\n '\\uA77E': 'G',\n '\\u24BD': 'H',\n '\\uFF28': 'H',\n '\\u0124': 'H',\n '\\u1E22': 'H',\n '\\u1E26': 'H',\n '\\u021E': 'H',\n '\\u1E24': 'H',\n '\\u1E28': 'H',\n '\\u1E2A': 'H',\n '\\u0126': 'H',\n '\\u2C67': 'H',\n '\\u2C75': 'H',\n '\\uA78D': 'H',\n '\\u24BE': 'I',\n '\\uFF29': 'I',\n '\\u00CC': 'I',\n '\\u00CD': 'I',\n '\\u00CE': 'I',\n '\\u0128': 'I',\n '\\u012A': 'I',\n '\\u012C': 'I',\n '\\u0130': 'I',\n '\\u00CF': 'I',\n '\\u1E2E': 'I',\n '\\u1EC8': 'I',\n '\\u01CF': 'I',\n '\\u0208': 'I',\n '\\u020A': 'I',\n '\\u1ECA': 'I',\n '\\u012E': 'I',\n '\\u1E2C': 'I',\n '\\u0197': 'I',\n '\\u24BF': 'J',\n '\\uFF2A': 'J',\n '\\u0134': 'J',\n '\\u0248': 'J',\n '\\u24C0': 'K',\n '\\uFF2B': 'K',\n '\\u1E30': 'K',\n '\\u01E8': 'K',\n '\\u1E32': 'K',\n '\\u0136': 'K',\n '\\u1E34': 'K',\n '\\u0198': 'K',\n '\\u2C69': 'K',\n '\\uA740': 'K',\n '\\uA742': 'K',\n '\\uA744': 'K',\n '\\uA7A2': 'K',\n '\\u24C1': 'L',\n '\\uFF2C': 'L',\n '\\u013F': 'L',\n '\\u0139': 'L',\n '\\u013D': 'L',\n '\\u1E36': 'L',\n '\\u1E38': 'L',\n '\\u013B': 'L',\n '\\u1E3C': 'L',\n '\\u1E3A': 'L',\n '\\u0141': 'L',\n '\\u023D': 'L',\n '\\u2C62': 'L',\n '\\u2C60': 'L',\n '\\uA748': 'L',\n '\\uA746': 'L',\n '\\uA780': 'L',\n '\\u01C7': 'LJ',\n '\\u01C8': 'Lj',\n '\\u24C2': 'M',\n '\\uFF2D': 'M',\n '\\u1E3E': 'M',\n '\\u1E40': 'M',\n '\\u1E42': 'M',\n '\\u2C6E': 'M',\n '\\u019C': 'M',\n '\\u24C3': 'N',\n '\\uFF2E': 'N',\n '\\u01F8': 'N',\n '\\u0143': 'N',\n '\\u00D1': 'N',\n '\\u1E44': 'N',\n '\\u0147': 'N',\n '\\u1E46': 'N',\n '\\u0145': 'N',\n '\\u1E4A': 'N',\n '\\u1E48': 'N',\n '\\u0220': 'N',\n '\\u019D': 'N',\n '\\uA790': 'N',\n '\\uA7A4': 'N',\n '\\u01CA': 'NJ',\n '\\u01CB': 'Nj',\n '\\u24C4': 'O',\n '\\uFF2F': 'O',\n '\\u00D2': 'O',\n '\\u00D3': 'O',\n '\\u00D4': 'O',\n '\\u1ED2': 'O',\n '\\u1ED0': 'O',\n '\\u1ED6': 'O',\n '\\u1ED4': 'O',\n '\\u00D5': 'O',\n '\\u1E4C': 'O',\n '\\u022C': 'O',\n '\\u1E4E': 'O',\n '\\u014C': 'O',\n '\\u1E50': 'O',\n '\\u1E52': 'O',\n '\\u014E': 'O',\n '\\u022E': 'O',\n '\\u0230': 'O',\n '\\u00D6': 'O',\n '\\u022A': 'O',\n '\\u1ECE': 'O',\n '\\u0150': 'O',\n '\\u01D1': 'O',\n '\\u020C': 'O',\n '\\u020E': 'O',\n '\\u01A0': 'O',\n '\\u1EDC': 'O',\n '\\u1EDA': 'O',\n '\\u1EE0': 'O',\n '\\u1EDE': 'O',\n '\\u1EE2': 'O',\n '\\u1ECC': 'O',\n '\\u1ED8': 'O',\n '\\u01EA': 'O',\n '\\u01EC': 'O',\n '\\u00D8': 'O',\n '\\u01FE': 'O',\n '\\u0186': 'O',\n '\\u019F': 'O',\n '\\uA74A': 'O',\n '\\uA74C': 'O',\n '\\u01A2': 'OI',\n '\\uA74E': 'OO',\n '\\u0222': 'OU',\n '\\u24C5': 'P',\n '\\uFF30': 'P',\n '\\u1E54': 'P',\n '\\u1E56': 'P',\n '\\u01A4': 'P',\n '\\u2C63': 'P',\n '\\uA750': 'P',\n '\\uA752': 'P',\n '\\uA754': 'P',\n '\\u24C6': 'Q',\n '\\uFF31': 'Q',\n '\\uA756': 'Q',\n '\\uA758': 'Q',\n '\\u024A': 'Q',\n '\\u24C7': 'R',\n '\\uFF32': 'R',\n '\\u0154': 'R',\n '\\u1E58': 'R',\n '\\u0158': 'R',\n '\\u0210': 'R',\n '\\u0212': 'R',\n '\\u1E5A': 'R',\n '\\u1E5C': 'R',\n '\\u0156': 'R',\n '\\u1E5E': 'R',\n '\\u024C': 'R',\n '\\u2C64': 'R',\n '\\uA75A': 'R',\n '\\uA7A6': 'R',\n '\\uA782': 'R',\n '\\u24C8': 'S',\n '\\uFF33': 'S',\n '\\u1E9E': 'S',\n '\\u015A': 'S',\n '\\u1E64': 'S',\n '\\u015C': 'S',\n '\\u1E60': 'S',\n '\\u0160': 'S',\n '\\u1E66': 'S',\n '\\u1E62': 'S',\n '\\u1E68': 'S',\n '\\u0218': 'S',\n '\\u015E': 'S',\n '\\u2C7E': 'S',\n '\\uA7A8': 'S',\n '\\uA784': 'S',\n '\\u24C9': 'T',\n '\\uFF34': 'T',\n '\\u1E6A': 'T',\n '\\u0164': 'T',\n '\\u1E6C': 'T',\n '\\u021A': 'T',\n '\\u0162': 'T',\n '\\u1E70': 'T',\n '\\u1E6E': 'T',\n '\\u0166': 'T',\n '\\u01AC': 'T',\n '\\u01AE': 'T',\n '\\u023E': 'T',\n '\\uA786': 'T',\n '\\uA728': 'TZ',\n '\\u24CA': 'U',\n '\\uFF35': 'U',\n '\\u00D9': 'U',\n '\\u00DA': 'U',\n '\\u00DB': 'U',\n '\\u0168': 'U',\n '\\u1E78': 'U',\n '\\u016A': 'U',\n '\\u1E7A': 'U',\n '\\u016C': 'U',\n '\\u00DC': 'U',\n '\\u01DB': 'U',\n '\\u01D7': 'U',\n '\\u01D5': 'U',\n '\\u01D9': 'U',\n '\\u1EE6': 'U',\n '\\u016E': 'U',\n '\\u0170': 'U',\n '\\u01D3': 'U',\n '\\u0214': 'U',\n '\\u0216': 'U',\n '\\u01AF': 'U',\n '\\u1EEA': 'U',\n '\\u1EE8': 'U',\n '\\u1EEE': 'U',\n '\\u1EEC': 'U',\n '\\u1EF0': 'U',\n '\\u1EE4': 'U',\n '\\u1E72': 'U',\n '\\u0172': 'U',\n '\\u1E76': 'U',\n '\\u1E74': 'U',\n '\\u0244': 'U',\n '\\u24CB': 'V',\n '\\uFF36': 'V',\n '\\u1E7C': 'V',\n '\\u1E7E': 'V',\n '\\u01B2': 'V',\n '\\uA75E': 'V',\n '\\u0245': 'V',\n '\\uA760': 'VY',\n '\\u24CC': 'W',\n '\\uFF37': 'W',\n '\\u1E80': 'W',\n '\\u1E82': 'W',\n '\\u0174': 'W',\n '\\u1E86': 'W',\n '\\u1E84': 'W',\n '\\u1E88': 'W',\n '\\u2C72': 'W',\n '\\u24CD': 'X',\n '\\uFF38': 'X',\n '\\u1E8A': 'X',\n '\\u1E8C': 'X',\n '\\u24CE': 'Y',\n '\\uFF39': 'Y',\n '\\u1EF2': 'Y',\n '\\u00DD': 'Y',\n '\\u0176': 'Y',\n '\\u1EF8': 'Y',\n '\\u0232': 'Y',\n '\\u1E8E': 'Y',\n '\\u0178': 'Y',\n '\\u1EF6': 'Y',\n '\\u1EF4': 'Y',\n '\\u01B3': 'Y',\n '\\u024E': 'Y',\n '\\u1EFE': 'Y',\n '\\u24CF': 'Z',\n '\\uFF3A': 'Z',\n '\\u0179': 'Z',\n '\\u1E90': 'Z',\n '\\u017B': 'Z',\n '\\u017D': 'Z',\n '\\u1E92': 'Z',\n '\\u1E94': 'Z',\n '\\u01B5': 'Z',\n '\\u0224': 'Z',\n '\\u2C7F': 'Z',\n '\\u2C6B': 'Z',\n '\\uA762': 'Z',\n '\\u24D0': 'a',\n '\\uFF41': 'a',\n '\\u1E9A': 'a',\n '\\u00E0': 'a',\n '\\u00E1': 'a',\n '\\u00E2': 'a',\n '\\u1EA7': 'a',\n '\\u1EA5': 'a',\n '\\u1EAB': 'a',\n '\\u1EA9': 'a',\n '\\u00E3': 'a',\n '\\u0101': 'a',\n '\\u0103': 'a',\n '\\u1EB1': 'a',\n '\\u1EAF': 'a',\n '\\u1EB5': 'a',\n '\\u1EB3': 'a',\n '\\u0227': 'a',\n '\\u01E1': 'a',\n '\\u00E4': 'a',\n '\\u01DF': 'a',\n '\\u1EA3': 'a',\n '\\u00E5': 'a',\n '\\u01FB': 'a',\n '\\u01CE': 'a',\n '\\u0201': 'a',\n '\\u0203': 'a',\n '\\u1EA1': 'a',\n '\\u1EAD': 'a',\n '\\u1EB7': 'a',\n '\\u1E01': 'a',\n '\\u0105': 'a',\n '\\u2C65': 'a',\n '\\u0250': 'a',\n '\\uA733': 'aa',\n '\\u00E6': 'ae',\n '\\u01FD': 'ae',\n '\\u01E3': 'ae',\n '\\uA735': 'ao',\n '\\uA737': 'au',\n '\\uA739': 'av',\n '\\uA73B': 'av',\n '\\uA73D': 'ay',\n '\\u24D1': 'b',\n '\\uFF42': 'b',\n '\\u1E03': 'b',\n '\\u1E05': 'b',\n '\\u1E07': 'b',\n '\\u0180': 'b',\n '\\u0183': 'b',\n '\\u0253': 'b',\n '\\u24D2': 'c',\n '\\uFF43': 'c',\n '\\u0107': 'c',\n '\\u0109': 'c',\n '\\u010B': 'c',\n '\\u010D': 'c',\n '\\u00E7': 'c',\n '\\u1E09': 'c',\n '\\u0188': 'c',\n '\\u023C': 'c',\n '\\uA73F': 'c',\n '\\u2184': 'c',\n '\\u24D3': 'd',\n '\\uFF44': 'd',\n '\\u1E0B': 'd',\n '\\u010F': 'd',\n '\\u1E0D': 'd',\n '\\u1E11': 'd',\n '\\u1E13': 'd',\n '\\u1E0F': 'd',\n '\\u0111': 'd',\n '\\u018C': 'd',\n '\\u0256': 'd',\n '\\u0257': 'd',\n '\\uA77A': 'd',\n '\\u01F3': 'dz',\n '\\u01C6': 'dz',\n '\\u24D4': 'e',\n '\\uFF45': 'e',\n '\\u00E8': 'e',\n '\\u00E9': 'e',\n '\\u00EA': 'e',\n '\\u1EC1': 'e',\n '\\u1EBF': 'e',\n '\\u1EC5': 'e',\n '\\u1EC3': 'e',\n '\\u1EBD': 'e',\n '\\u0113': 'e',\n '\\u1E15': 'e',\n '\\u1E17': 'e',\n '\\u0115': 'e',\n '\\u0117': 'e',\n '\\u00EB': 'e',\n '\\u1EBB': 'e',\n '\\u011B': 'e',\n '\\u0205': 'e',\n '\\u0207': 'e',\n '\\u1EB9': 'e',\n '\\u1EC7': 'e',\n '\\u0229': 'e',\n '\\u1E1D': 'e',\n '\\u0119': 'e',\n '\\u1E19': 'e',\n '\\u1E1B': 'e',\n '\\u0247': 'e',\n '\\u025B': 'e',\n '\\u01DD': 'e',\n '\\u24D5': 'f',\n '\\uFF46': 'f',\n '\\u1E1F': 'f',\n '\\u0192': 'f',\n '\\uA77C': 'f',\n '\\u24D6': 'g',\n '\\uFF47': 'g',\n '\\u01F5': 'g',\n '\\u011D': 'g',\n '\\u1E21': 'g',\n '\\u011F': 'g',\n '\\u0121': 'g',\n '\\u01E7': 'g',\n '\\u0123': 'g',\n '\\u01E5': 'g',\n '\\u0260': 'g',\n '\\uA7A1': 'g',\n '\\u1D79': 'g',\n '\\uA77F': 'g',\n '\\u24D7': 'h',\n '\\uFF48': 'h',\n '\\u0125': 'h',\n '\\u1E23': 'h',\n '\\u1E27': 'h',\n '\\u021F': 'h',\n '\\u1E25': 'h',\n '\\u1E29': 'h',\n '\\u1E2B': 'h',\n '\\u1E96': 'h',\n '\\u0127': 'h',\n '\\u2C68': 'h',\n '\\u2C76': 'h',\n '\\u0265': 'h',\n '\\u0195': 'hv',\n '\\u24D8': 'i',\n '\\uFF49': 'i',\n '\\u00EC': 'i',\n '\\u00ED': 'i',\n '\\u00EE': 'i',\n '\\u0129': 'i',\n '\\u012B': 'i',\n '\\u012D': 'i',\n '\\u00EF': 'i',\n '\\u1E2F': 'i',\n '\\u1EC9': 'i',\n '\\u01D0': 'i',\n '\\u0209': 'i',\n '\\u020B': 'i',\n '\\u1ECB': 'i',\n '\\u012F': 'i',\n '\\u1E2D': 'i',\n '\\u0268': 'i',\n '\\u0131': 'i',\n '\\u24D9': 'j',\n '\\uFF4A': 'j',\n '\\u0135': 'j',\n '\\u01F0': 'j',\n '\\u0249': 'j',\n '\\u24DA': 'k',\n '\\uFF4B': 'k',\n '\\u1E31': 'k',\n '\\u01E9': 'k',\n '\\u1E33': 'k',\n '\\u0137': 'k',\n '\\u1E35': 'k',\n '\\u0199': 'k',\n '\\u2C6A': 'k',\n '\\uA741': 'k',\n '\\uA743': 'k',\n '\\uA745': 'k',\n '\\uA7A3': 'k',\n '\\u24DB': 'l',\n '\\uFF4C': 'l',\n '\\u0140': 'l',\n '\\u013A': 'l',\n '\\u013E': 'l',\n '\\u1E37': 'l',\n '\\u1E39': 'l',\n '\\u013C': 'l',\n '\\u1E3D': 'l',\n '\\u1E3B': 'l',\n '\\u017F': 'l',\n '\\u0142': 'l',\n '\\u019A': 'l',\n '\\u026B': 'l',\n '\\u2C61': 'l',\n '\\uA749': 'l',\n '\\uA781': 'l',\n '\\uA747': 'l',\n '\\u01C9': 'lj',\n '\\u24DC': 'm',\n '\\uFF4D': 'm',\n '\\u1E3F': 'm',\n '\\u1E41': 'm',\n '\\u1E43': 'm',\n '\\u0271': 'm',\n '\\u026F': 'm',\n '\\u24DD': 'n',\n '\\uFF4E': 'n',\n '\\u01F9': 'n',\n '\\u0144': 'n',\n '\\u00F1': 'n',\n '\\u1E45': 'n',\n '\\u0148': 'n',\n '\\u1E47': 'n',\n '\\u0146': 'n',\n '\\u1E4B': 'n',\n '\\u1E49': 'n',\n '\\u019E': 'n',\n '\\u0272': 'n',\n '\\u0149': 'n',\n '\\uA791': 'n',\n '\\uA7A5': 'n',\n '\\u01CC': 'nj',\n '\\u24DE': 'o',\n '\\uFF4F': 'o',\n '\\u00F2': 'o',\n '\\u00F3': 'o',\n '\\u00F4': 'o',\n '\\u1ED3': 'o',\n '\\u1ED1': 'o',\n '\\u1ED7': 'o',\n '\\u1ED5': 'o',\n '\\u00F5': 'o',\n '\\u1E4D': 'o',\n '\\u022D': 'o',\n '\\u1E4F': 'o',\n '\\u014D': 'o',\n '\\u1E51': 'o',\n '\\u1E53': 'o',\n '\\u014F': 'o',\n '\\u022F': 'o',\n '\\u0231': 'o',\n '\\u00F6': 'o',\n '\\u022B': 'o',\n '\\u1ECF': 'o',\n '\\u0151': 'o',\n '\\u01D2': 'o',\n '\\u020D': 'o',\n '\\u020F': 'o',\n '\\u01A1': 'o',\n '\\u1EDD': 'o',\n '\\u1EDB': 'o',\n '\\u1EE1': 'o',\n '\\u1EDF': 'o',\n '\\u1EE3': 'o',\n '\\u1ECD': 'o',\n '\\u1ED9': 'o',\n '\\u01EB': 'o',\n '\\u01ED': 'o',\n '\\u00F8': 'o',\n '\\u01FF': 'o',\n '\\u0254': 'o',\n '\\uA74B': 'o',\n '\\uA74D': 'o',\n '\\u0275': 'o',\n '\\u01A3': 'oi',\n '\\u0223': 'ou',\n '\\uA74F': 'oo',\n '\\u24DF': 'p',\n '\\uFF50': 'p',\n '\\u1E55': 'p',\n '\\u1E57': 'p',\n '\\u01A5': 'p',\n '\\u1D7D': 'p',\n '\\uA751': 'p',\n '\\uA753': 'p',\n '\\uA755': 'p',\n '\\u24E0': 'q',\n '\\uFF51': 'q',\n '\\u024B': 'q',\n '\\uA757': 'q',\n '\\uA759': 'q',\n '\\u24E1': 'r',\n '\\uFF52': 'r',\n '\\u0155': 'r',\n '\\u1E59': 'r',\n '\\u0159': 'r',\n '\\u0211': 'r',\n '\\u0213': 'r',\n '\\u1E5B': 'r',\n '\\u1E5D': 'r',\n '\\u0157': 'r',\n '\\u1E5F': 'r',\n '\\u024D': 'r',\n '\\u027D': 'r',\n '\\uA75B': 'r',\n '\\uA7A7': 'r',\n '\\uA783': 'r',\n '\\u24E2': 's',\n '\\uFF53': 's',\n '\\u00DF': 's',\n '\\u015B': 's',\n '\\u1E65': 's',\n '\\u015D': 's',\n '\\u1E61': 's',\n '\\u0161': 's',\n '\\u1E67': 's',\n '\\u1E63': 's',\n '\\u1E69': 's',\n '\\u0219': 's',\n '\\u015F': 's',\n '\\u023F': 's',\n '\\uA7A9': 's',\n '\\uA785': 's',\n '\\u1E9B': 's',\n '\\u24E3': 't',\n '\\uFF54': 't',\n '\\u1E6B': 't',\n '\\u1E97': 't',\n '\\u0165': 't',\n '\\u1E6D': 't',\n '\\u021B': 't',\n '\\u0163': 't',\n '\\u1E71': 't',\n '\\u1E6F': 't',\n '\\u0167': 't',\n '\\u01AD': 't',\n '\\u0288': 't',\n '\\u2C66': 't',\n '\\uA787': 't',\n '\\uA729': 'tz',\n '\\u24E4': 'u',\n '\\uFF55': 'u',\n '\\u00F9': 'u',\n '\\u00FA': 'u',\n '\\u00FB': 'u',\n '\\u0169': 'u',\n '\\u1E79': 'u',\n '\\u016B': 'u',\n '\\u1E7B': 'u',\n '\\u016D': 'u',\n '\\u00FC': 'u',\n '\\u01DC': 'u',\n '\\u01D8': 'u',\n '\\u01D6': 'u',\n '\\u01DA': 'u',\n '\\u1EE7': 'u',\n '\\u016F': 'u',\n '\\u0171': 'u',\n '\\u01D4': 'u',\n '\\u0215': 'u',\n '\\u0217': 'u',\n '\\u01B0': 'u',\n '\\u1EEB': 'u',\n '\\u1EE9': 'u',\n '\\u1EEF': 'u',\n '\\u1EED': 'u',\n '\\u1EF1': 'u',\n '\\u1EE5': 'u',\n '\\u1E73': 'u',\n '\\u0173': 'u',\n '\\u1E77': 'u',\n '\\u1E75': 'u',\n '\\u0289': 'u',\n '\\u24E5': 'v',\n '\\uFF56': 'v',\n '\\u1E7D': 'v',\n '\\u1E7F': 'v',\n '\\u028B': 'v',\n '\\uA75F': 'v',\n '\\u028C': 'v',\n '\\uA761': 'vy',\n '\\u24E6': 'w',\n '\\uFF57': 'w',\n '\\u1E81': 'w',\n '\\u1E83': 'w',\n '\\u0175': 'w',\n '\\u1E87': 'w',\n '\\u1E85': 'w',\n '\\u1E98': 'w',\n '\\u1E89': 'w',\n '\\u2C73': 'w',\n '\\u24E7': 'x',\n '\\uFF58': 'x',\n '\\u1E8B': 'x',\n '\\u1E8D': 'x',\n '\\u24E8': 'y',\n '\\uFF59': 'y',\n '\\u1EF3': 'y',\n '\\u00FD': 'y',\n '\\u0177': 'y',\n '\\u1EF9': 'y',\n '\\u0233': 'y',\n '\\u1E8F': 'y',\n '\\u00FF': 'y',\n '\\u1EF7': 'y',\n '\\u1E99': 'y',\n '\\u1EF5': 'y',\n '\\u01B4': 'y',\n '\\u024F': 'y',\n '\\u1EFF': 'y',\n '\\u24E9': 'z',\n '\\uFF5A': 'z',\n '\\u017A': 'z',\n '\\u1E91': 'z',\n '\\u017C': 'z',\n '\\u017E': 'z',\n '\\u1E93': 'z',\n '\\u1E95': 'z',\n '\\u01B6': 'z',\n '\\u0225': 'z',\n '\\u0240': 'z',\n '\\u2C6C': 'z',\n '\\uA763': 'z',\n '\\u0386': '\\u0391',\n '\\u0388': '\\u0395',\n '\\u0389': '\\u0397',\n '\\u038A': '\\u0399',\n '\\u03AA': '\\u0399',\n '\\u038C': '\\u039F',\n '\\u038E': '\\u03A5',\n '\\u03AB': '\\u03A5',\n '\\u038F': '\\u03A9',\n '\\u03AC': '\\u03B1',\n '\\u03AD': '\\u03B5',\n '\\u03AE': '\\u03B7',\n '\\u03AF': '\\u03B9',\n '\\u03CA': '\\u03B9',\n '\\u0390': '\\u03B9',\n '\\u03CC': '\\u03BF',\n '\\u03CD': '\\u03C5',\n '\\u03CB': '\\u03C5',\n '\\u03B0': '\\u03C5',\n '\\u03C9': '\\u03C9',\n '\\u03C2': '\\u03C3'\n };\n\n return diacritics;\n});\n\nS2.define('select2/data/base',[\n '../utils'\n], function (Utils) {\n function BaseAdapter ($element, options) {\n BaseAdapter.__super__.constructor.call(this);\n }\n\n Utils.Extend(BaseAdapter, Utils.Observable);\n\n BaseAdapter.prototype.current = function (callback) {\n throw new Error('The `current` method must be defined in child classes.');\n };\n\n BaseAdapter.prototype.query = function (params, callback) {\n throw new Error('The `query` method must be defined in child classes.');\n };\n\n BaseAdapter.prototype.bind = function (container, $container) {\n // Can be implemented in subclasses\n };\n\n BaseAdapter.prototype.destroy = function () {\n // Can be implemented in subclasses\n };\n\n BaseAdapter.prototype.generateResultId = function (container, data) {\n var id = container.id + '-result-';\n\n id += Utils.generateChars(4);\n\n if (data.id != null) {\n id += '-' + data.id.toString();\n } else {\n id += '-' + Utils.generateChars(4);\n }\n return id;\n };\n\n return BaseAdapter;\n});\n\nS2.define('select2/data/select',[\n './base',\n '../utils',\n 'jquery'\n], function (BaseAdapter, Utils, $) {\n function SelectAdapter ($element, options) {\n this.$element = $element;\n this.options = options;\n\n SelectAdapter.__super__.constructor.call(this);\n }\n\n Utils.Extend(SelectAdapter, BaseAdapter);\n\n SelectAdapter.prototype.current = function (callback) {\n var data = [];\n var self = this;\n\n this.$element.find(':selected').each(function () {\n var $option = $(this);\n\n var option = self.item($option);\n\n data.push(option);\n });\n\n callback(data);\n };\n\n SelectAdapter.prototype.select = function (data) {\n var self = this;\n\n data.selected = true;\n\n // If data.element is a DOM node, use it instead\n if ($(data.element).is('option')) {\n data.element.selected = true;\n\n this.$element.trigger('change');\n\n return;\n }\n\n if (this.$element.prop('multiple')) {\n this.current(function (currentData) {\n var val = [];\n\n data = [data];\n data.push.apply(data, currentData);\n\n for (var d = 0; d < data.length; d++) {\n var id = data[d].id;\n\n if ($.inArray(id, val) === -1) {\n val.push(id);\n }\n }\n\n self.$element.val(val);\n self.$element.trigger('change');\n });\n } else {\n var val = data.id;\n\n this.$element.val(val);\n this.$element.trigger('change');\n }\n };\n\n SelectAdapter.prototype.unselect = function (data) {\n var self = this;\n\n if (!this.$element.prop('multiple')) {\n return;\n }\n\n data.selected = false;\n\n if ($(data.element).is('option')) {\n data.element.selected = false;\n\n this.$element.trigger('change');\n\n return;\n }\n\n this.current(function (currentData) {\n var val = [];\n\n for (var d = 0; d < currentData.length; d++) {\n var id = currentData[d].id;\n\n if (id !== data.id && $.inArray(id, val) === -1) {\n val.push(id);\n }\n }\n\n self.$element.val(val);\n\n self.$element.trigger('change');\n });\n };\n\n SelectAdapter.prototype.bind = function (container, $container) {\n var self = this;\n\n this.container = container;\n\n container.on('select', function (params) {\n self.select(params.data);\n });\n\n container.on('unselect', function (params) {\n self.unselect(params.data);\n });\n };\n\n SelectAdapter.prototype.destroy = function () {\n // Remove anything added to child elements\n this.$element.find('*').each(function () {\n // Remove any custom data set by Select2\n $.removeData(this, 'data');\n });\n };\n\n SelectAdapter.prototype.query = function (params, callback) {\n var data = [];\n var self = this;\n\n var $options = this.$element.children();\n\n $options.each(function () {\n var $option = $(this);\n\n if (!$option.is('option') && !$option.is('optgroup')) {\n return;\n }\n\n var option = self.item($option);\n\n var matches = self.matches(params, option);\n\n if (matches !== null) {\n data.push(matches);\n }\n });\n\n callback({\n results: data\n });\n };\n\n SelectAdapter.prototype.addOptions = function ($options) {\n Utils.appendMany(this.$element, $options);\n };\n\n SelectAdapter.prototype.option = function (data) {\n var option;\n\n if (data.children) {\n option = document.createElement('optgroup');\n option.label = data.text;\n } else {\n option = document.createElement('option');\n\n if (option.textContent !== undefined) {\n option.textContent = data.text;\n } else {\n option.innerText = data.text;\n }\n }\n\n if (data.id !== undefined) {\n option.value = data.id;\n }\n\n if (data.disabled) {\n option.disabled = true;\n }\n\n if (data.selected) {\n option.selected = true;\n }\n\n if (data.title) {\n option.title = data.title;\n }\n\n var $option = $(option);\n\n var normalizedData = this._normalizeItem(data);\n normalizedData.element = option;\n\n // Override the option's data with the combined data\n $.data(option, 'data', normalizedData);\n\n return $option;\n };\n\n SelectAdapter.prototype.item = function ($option) {\n var data = {};\n\n data = $.data($option[0], 'data');\n\n if (data != null) {\n return data;\n }\n\n if ($option.is('option')) {\n data = {\n id: $option.val(),\n text: $option.text(),\n disabled: $option.prop('disabled'),\n selected: $option.prop('selected'),\n title: $option.prop('title')\n };\n } else if ($option.is('optgroup')) {\n data = {\n text: $option.prop('label'),\n children: [],\n title: $option.prop('title')\n };\n\n var $children = $option.children('option');\n var children = [];\n\n for (var c = 0; c < $children.length; c++) {\n var $child = $($children[c]);\n\n var child = this.item($child);\n\n children.push(child);\n }\n\n data.children = children;\n }\n\n data = this._normalizeItem(data);\n data.element = $option[0];\n\n $.data($option[0], 'data', data);\n\n return data;\n };\n\n SelectAdapter.prototype._normalizeItem = function (item) {\n if (!$.isPlainObject(item)) {\n item = {\n id: item,\n text: item\n };\n }\n\n item = $.extend({}, {\n text: ''\n }, item);\n\n var defaults = {\n selected: false,\n disabled: false\n };\n\n if (item.id != null) {\n item.id = item.id.toString();\n }\n\n if (item.text != null) {\n item.text = item.text.toString();\n }\n\n if (item._resultId == null && item.id && this.container != null) {\n item._resultId = this.generateResultId(this.container, item);\n }\n\n return $.extend({}, defaults, item);\n };\n\n SelectAdapter.prototype.matches = function (params, data) {\n var matcher = this.options.get('matcher');\n\n return matcher(params, data);\n };\n\n return SelectAdapter;\n});\n\nS2.define('select2/data/array',[\n './select',\n '../utils',\n 'jquery'\n], function (SelectAdapter, Utils, $) {\n function ArrayAdapter ($element, options) {\n var data = options.get('data') || [];\n\n ArrayAdapter.__super__.constructor.call(this, $element, options);\n\n this.addOptions(this.convertToOptions(data));\n }\n\n Utils.Extend(ArrayAdapter, SelectAdapter);\n\n ArrayAdapter.prototype.select = function (data) {\n var $option = this.$element.find('option').filter(function (i, elm) {\n return elm.value == data.id.toString();\n });\n\n if ($option.length === 0) {\n $option = this.option(data);\n\n this.addOptions($option);\n }\n\n ArrayAdapter.__super__.select.call(this, data);\n };\n\n ArrayAdapter.prototype.convertToOptions = function (data) {\n var self = this;\n\n var $existing = this.$element.find('option');\n var existingIds = $existing.map(function () {\n return self.item($(this)).id;\n }).get();\n\n var $options = [];\n\n // Filter out all items except for the one passed in the argument\n function onlyItem (item) {\n return function () {\n return $(this).val() == item.id;\n };\n }\n\n for (var d = 0; d < data.length; d++) {\n var item = this._normalizeItem(data[d]);\n\n // Skip items which were pre-loaded, only merge the data\n if ($.inArray(item.id, existingIds) >= 0) {\n var $existingOption = $existing.filter(onlyItem(item));\n\n var existingData = this.item($existingOption);\n var newData = $.extend(true, {}, item, existingData);\n\n var $newOption = this.option(newData);\n\n $existingOption.replaceWith($newOption);\n\n continue;\n }\n\n var $option = this.option(item);\n\n if (item.children) {\n var $children = this.convertToOptions(item.children);\n\n Utils.appendMany($option, $children);\n }\n\n $options.push($option);\n }\n\n return $options;\n };\n\n return ArrayAdapter;\n});\n\nS2.define('select2/data/ajax',[\n './array',\n '../utils',\n 'jquery'\n], function (ArrayAdapter, Utils, $) {\n function AjaxAdapter ($element, options) {\n this.ajaxOptions = this._applyDefaults(options.get('ajax'));\n\n if (this.ajaxOptions.processResults != null) {\n this.processResults = this.ajaxOptions.processResults;\n }\n\n AjaxAdapter.__super__.constructor.call(this, $element, options);\n }\n\n Utils.Extend(AjaxAdapter, ArrayAdapter);\n\n AjaxAdapter.prototype._applyDefaults = function (options) {\n var defaults = {\n data: function (params) {\n return $.extend({}, params, {\n q: params.term\n });\n },\n transport: function (params, success, failure) {\n var $request = $.ajax(params);\n\n $request.then(success);\n $request.fail(failure);\n\n return $request;\n }\n };\n\n return $.extend({}, defaults, options, true);\n };\n\n AjaxAdapter.prototype.processResults = function (results) {\n return results;\n };\n\n AjaxAdapter.prototype.query = function (params, callback) {\n var matches = [];\n var self = this;\n\n if (this._request != null) {\n // JSONP requests cannot always be aborted\n if ($.isFunction(this._request.abort)) {\n this._request.abort();\n }\n\n this._request = null;\n }\n\n var options = $.extend({\n type: 'GET'\n }, this.ajaxOptions);\n\n if (typeof options.url === 'function') {\n options.url = options.url.call(this.$element, params);\n }\n\n if (typeof options.data === 'function') {\n options.data = options.data.call(this.$element, params);\n }\n\n function request () {\n var $request = options.transport(options, function (data) {\n var results = self.processResults(data, params);\n\n if (self.options.get('debug') && window.console && console.error) {\n // Check to make sure that the response included a `results` key.\n if (!results || !results.results || !$.isArray(results.results)) {\n console.error(\n 'Select2: The AJAX results did not return an array in the ' +\n '`results` key of the response.'\n );\n }\n }\n\n callback(results);\n }, function () {\n // Attempt to detect if a request was aborted\n // Only works if the transport exposes a status property\n if ($request.status && $request.status === '0') {\n return;\n }\n\n self.trigger('results:message', {\n message: 'errorLoading'\n });\n });\n\n self._request = $request;\n }\n\n if (this.ajaxOptions.delay && params.term != null) {\n if (this._queryTimeout) {\n window.clearTimeout(this._queryTimeout);\n }\n\n this._queryTimeout = window.setTimeout(request, this.ajaxOptions.delay);\n } else {\n request();\n }\n };\n\n return AjaxAdapter;\n});\n\nS2.define('select2/data/tags',[\n 'jquery'\n], function ($) {\n function Tags (decorated, $element, options) {\n var tags = options.get('tags');\n\n var createTag = options.get('createTag');\n\n if (createTag !== undefined) {\n this.createTag = createTag;\n }\n\n var insertTag = options.get('insertTag');\n\n if (insertTag !== undefined) {\n this.insertTag = insertTag;\n }\n\n decorated.call(this, $element, options);\n\n if ($.isArray(tags)) {\n for (var t = 0; t < tags.length; t++) {\n var tag = tags[t];\n var item = this._normalizeItem(tag);\n\n var $option = this.option(item);\n\n this.$element.append($option);\n }\n }\n }\n\n Tags.prototype.query = function (decorated, params, callback) {\n var self = this;\n\n this._removeOldTags();\n\n if (params.term == null || params.page != null) {\n decorated.call(this, params, callback);\n return;\n }\n\n function wrapper (obj, child) {\n var data = obj.results;\n\n for (var i = 0; i < data.length; i++) {\n var option = data[i];\n\n var checkChildren = (\n option.children != null &&\n !wrapper({\n results: option.children\n }, true)\n );\n\n var optionText = (option.text || '').toUpperCase();\n var paramsTerm = (params.term || '').toUpperCase();\n\n var checkText = optionText === paramsTerm;\n\n if (checkText || checkChildren) {\n if (child) {\n return false;\n }\n\n obj.data = data;\n callback(obj);\n\n return;\n }\n }\n\n if (child) {\n return true;\n }\n\n var tag = self.createTag(params);\n\n if (tag != null) {\n var $option = self.option(tag);\n $option.attr('data-select2-tag', true);\n\n self.addOptions([$option]);\n\n self.insertTag(data, tag);\n }\n\n obj.results = data;\n\n callback(obj);\n }\n\n decorated.call(this, params, wrapper);\n };\n\n Tags.prototype.createTag = function (decorated, params) {\n var term = $.trim(params.term);\n\n if (term === '') {\n return null;\n }\n\n return {\n id: term,\n text: term\n };\n };\n\n Tags.prototype.insertTag = function (_, data, tag) {\n data.unshift(tag);\n };\n\n Tags.prototype._removeOldTags = function (_) {\n var tag = this._lastTag;\n\n var $options = this.$element.find('option[data-select2-tag]');\n\n $options.each(function () {\n if (this.selected) {\n return;\n }\n\n $(this).remove();\n });\n };\n\n return Tags;\n});\n\nS2.define('select2/data/tokenizer',[\n 'jquery'\n], function ($) {\n function Tokenizer (decorated, $element, options) {\n var tokenizer = options.get('tokenizer');\n\n if (tokenizer !== undefined) {\n this.tokenizer = tokenizer;\n }\n\n decorated.call(this, $element, options);\n }\n\n Tokenizer.prototype.bind = function (decorated, container, $container) {\n decorated.call(this, container, $container);\n\n this.$search = container.dropdown.$search || container.selection.$search ||\n $container.find('.select2-search__field');\n };\n\n Tokenizer.prototype.query = function (decorated, params, callback) {\n var self = this;\n\n function createAndSelect (data) {\n // Normalize the data object so we can use it for checks\n var item = self._normalizeItem(data);\n\n // Check if the data object already exists as a tag\n // Select it if it doesn't\n var $existingOptions = self.$element.find('option').filter(function () {\n return $(this).val() === item.id;\n });\n\n // If an existing option wasn't found for it, create the option\n if (!$existingOptions.length) {\n var $option = self.option(item);\n $option.attr('data-select2-tag', true);\n\n self._removeOldTags();\n self.addOptions([$option]);\n }\n\n // Select the item, now that we know there is an option for it\n select(item);\n }\n\n function select (data) {\n self.trigger('select', {\n data: data\n });\n }\n\n params.term = params.term || '';\n\n var tokenData = this.tokenizer(params, this.options, createAndSelect);\n\n if (tokenData.term !== params.term) {\n // Replace the search term if we have the search box\n if (this.$search.length) {\n this.$search.val(tokenData.term);\n this.$search.focus();\n }\n\n params.term = tokenData.term;\n }\n\n decorated.call(this, params, callback);\n };\n\n Tokenizer.prototype.tokenizer = function (_, params, options, callback) {\n var separators = options.get('tokenSeparators') || [];\n var term = params.term;\n var i = 0;\n\n var createTag = this.createTag || function (params) {\n return {\n id: params.term,\n text: params.term\n };\n };\n\n while (i < term.length) {\n var termChar = term[i];\n\n if ($.inArray(termChar, separators) === -1) {\n i++;\n\n continue;\n }\n\n var part = term.substr(0, i);\n var partParams = $.extend({}, params, {\n term: part\n });\n\n var data = createTag(partParams);\n\n if (data == null) {\n i++;\n continue;\n }\n\n callback(data);\n\n // Reset the term to not include the tokenized portion\n term = term.substr(i + 1) || '';\n i = 0;\n }\n\n return {\n term: term\n };\n };\n\n return Tokenizer;\n});\n\nS2.define('select2/data/minimumInputLength',[\n\n], function () {\n function MinimumInputLength (decorated, $e, options) {\n this.minimumInputLength = options.get('minimumInputLength');\n\n decorated.call(this, $e, options);\n }\n\n MinimumInputLength.prototype.query = function (decorated, params, callback) {\n params.term = params.term || '';\n\n if (params.term.length < this.minimumInputLength) {\n this.trigger('results:message', {\n message: 'inputTooShort',\n args: {\n minimum: this.minimumInputLength,\n input: params.term,\n params: params\n }\n });\n\n return;\n }\n\n decorated.call(this, params, callback);\n };\n\n return MinimumInputLength;\n});\n\nS2.define('select2/data/maximumInputLength',[\n\n], function () {\n function MaximumInputLength (decorated, $e, options) {\n this.maximumInputLength = options.get('maximumInputLength');\n\n decorated.call(this, $e, options);\n }\n\n MaximumInputLength.prototype.query = function (decorated, params, callback) {\n params.term = params.term || '';\n\n if (this.maximumInputLength > 0 &&\n params.term.length > this.maximumInputLength) {\n this.trigger('results:message', {\n message: 'inputTooLong',\n args: {\n maximum: this.maximumInputLength,\n input: params.term,\n params: params\n }\n });\n\n return;\n }\n\n decorated.call(this, params, callback);\n };\n\n return MaximumInputLength;\n});\n\nS2.define('select2/data/maximumSelectionLength',[\n\n], function (){\n function MaximumSelectionLength (decorated, $e, options) {\n this.maximumSelectionLength = options.get('maximumSelectionLength');\n\n decorated.call(this, $e, options);\n }\n\n MaximumSelectionLength.prototype.query =\n function (decorated, params, callback) {\n var self = this;\n\n this.current(function (currentData) {\n var count = currentData != null ? currentData.length : 0;\n if (self.maximumSelectionLength > 0 &&\n count >= self.maximumSelectionLength) {\n self.trigger('results:message', {\n message: 'maximumSelected',\n args: {\n maximum: self.maximumSelectionLength\n }\n });\n return;\n }\n decorated.call(self, params, callback);\n });\n };\n\n return MaximumSelectionLength;\n});\n\nS2.define('select2/dropdown',[\n 'jquery',\n './utils'\n], function ($, Utils) {\n function Dropdown ($element, options) {\n this.$element = $element;\n this.options = options;\n\n Dropdown.__super__.constructor.call(this);\n }\n\n Utils.Extend(Dropdown, Utils.Observable);\n\n Dropdown.prototype.render = function () {\n var $dropdown = $(\n '<span class=\"select2-dropdown\">' +\n '<span class=\"select2-results\"></span>' +\n '</span>'\n );\n\n $dropdown.attr('dir', this.options.get('dir'));\n\n this.$dropdown = $dropdown;\n\n return $dropdown;\n };\n\n Dropdown.prototype.bind = function () {\n // Should be implemented in subclasses\n };\n\n Dropdown.prototype.position = function ($dropdown, $container) {\n // Should be implmented in subclasses\n };\n\n Dropdown.prototype.destroy = function () {\n // Remove the dropdown from the DOM\n this.$dropdown.remove();\n };\n\n return Dropdown;\n});\n\nS2.define('select2/dropdown/search',[\n 'jquery',\n '../utils'\n], function ($, Utils) {\n function Search () { }\n\n Search.prototype.render = function (decorated) {\n var $rendered = decorated.call(this);\n\n var $search = $(\n '<span class=\"select2-search select2-search--dropdown\">' +\n '<input class=\"select2-search__field\" type=\"search\" tabindex=\"-1\"' +\n ' autocomplete=\"off\" autocorrect=\"off\" autocapitalize=\"none\"' +\n ' spellcheck=\"false\" role=\"textbox\" />' +\n '</span>'\n );\n\n this.$searchContainer = $search;\n this.$search = $search.find('input');\n\n $rendered.prepend($search);\n\n return $rendered;\n };\n\n Search.prototype.bind = function (decorated, container, $container) {\n var self = this;\n\n decorated.call(this, container, $container);\n\n this.$search.on('keydown', function (evt) {\n self.trigger('keypress', evt);\n\n self._keyUpPrevented = evt.isDefaultPrevented();\n });\n\n // Workaround for browsers which do not support the `input` event\n // This will prevent double-triggering of events for browsers which support\n // both the `keyup` and `input` events.\n this.$search.on('input', function (evt) {\n // Unbind the duplicated `keyup` event\n $(this).off('keyup');\n });\n\n this.$search.on('keyup input', function (evt) {\n self.handleSearch(evt);\n });\n\n container.on('open', function () {\n self.$search.attr('tabindex', 0);\n\n self.$search.focus();\n\n window.setTimeout(function () {\n self.$search.focus();\n }, 0);\n });\n\n container.on('close', function () {\n self.$search.attr('tabindex', -1);\n\n self.$search.val('');\n });\n\n container.on('focus', function () {\n if (!container.isOpen()) {\n self.$search.focus();\n }\n });\n\n container.on('results:all', function (params) {\n if (params.query.term == null || params.query.term === '') {\n var showSearch = self.showSearch(params);\n\n if (showSearch) {\n self.$searchContainer.removeClass('select2-search--hide');\n } else {\n self.$searchContainer.addClass('select2-search--hide');\n }\n }\n });\n };\n\n Search.prototype.handleSearch = function (evt) {\n if (!this._keyUpPrevented) {\n var input = this.$search.val();\n\n this.trigger('query', {\n term: input\n });\n }\n\n this._keyUpPrevented = false;\n };\n\n Search.prototype.showSearch = function (_, params) {\n return true;\n };\n\n return Search;\n});\n\nS2.define('select2/dropdown/hidePlaceholder',[\n\n], function () {\n function HidePlaceholder (decorated, $element, options, dataAdapter) {\n this.placeholder = this.normalizePlaceholder(options.get('placeholder'));\n\n decorated.call(this, $element, options, dataAdapter);\n }\n\n HidePlaceholder.prototype.append = function (decorated, data) {\n data.results = this.removePlaceholder(data.results);\n\n decorated.call(this, data);\n };\n\n HidePlaceholder.prototype.normalizePlaceholder = function (_, placeholder) {\n if (typeof placeholder === 'string') {\n placeholder = {\n id: '',\n text: placeholder\n };\n }\n\n return placeholder;\n };\n\n HidePlaceholder.prototype.removePlaceholder = function (_, data) {\n var modifiedData = data.slice(0);\n\n for (var d = data.length - 1; d >= 0; d--) {\n var item = data[d];\n\n if (this.placeholder.id === item.id) {\n modifiedData.splice(d, 1);\n }\n }\n\n return modifiedData;\n };\n\n return HidePlaceholder;\n});\n\nS2.define('select2/dropdown/infiniteScroll',[\n 'jquery'\n], function ($) {\n function InfiniteScroll (decorated, $element, options, dataAdapter) {\n this.lastParams = {};\n\n decorated.call(this, $element, options, dataAdapter);\n\n this.$loadingMore = this.createLoadingMore();\n this.loading = false;\n }\n\n InfiniteScroll.prototype.append = function (decorated, data) {\n this.$loadingMore.remove();\n this.loading = false;\n\n decorated.call(this, data);\n\n if (this.showLoadingMore(data)) {\n this.$results.append(this.$loadingMore);\n }\n };\n\n InfiniteScroll.prototype.bind = function (decorated, container, $container) {\n var self = this;\n\n decorated.call(this, container, $container);\n\n container.on('query', function (params) {\n self.lastParams = params;\n self.loading = true;\n });\n\n container.on('query:append', function (params) {\n self.lastParams = params;\n self.loading = true;\n });\n\n this.$results.on('scroll', function () {\n var isLoadMoreVisible = $.contains(\n document.documentElement,\n self.$loadingMore[0]\n );\n\n if (self.loading || !isLoadMoreVisible) {\n return;\n }\n\n var currentOffset = self.$results.offset().top +\n self.$results.outerHeight(false);\n var loadingMoreOffset = self.$loadingMore.offset().top +\n self.$loadingMore.outerHeight(false);\n\n if (currentOffset + 50 >= loadingMoreOffset) {\n self.loadMore();\n }\n });\n };\n\n InfiniteScroll.prototype.loadMore = function () {\n this.loading = true;\n\n var params = $.extend({}, {page: 1}, this.lastParams);\n\n params.page++;\n\n this.trigger('query:append', params);\n };\n\n InfiniteScroll.prototype.showLoadingMore = function (_, data) {\n return data.pagination && data.pagination.more;\n };\n\n InfiniteScroll.prototype.createLoadingMore = function () {\n var $option = $(\n '<li ' +\n 'class=\"select2-results__option select2-results__option--load-more\"' +\n 'role=\"treeitem\" aria-disabled=\"true\"></li>'\n );\n\n var message = this.options.get('translations').get('loadingMore');\n\n $option.html(message(this.lastParams));\n\n return $option;\n };\n\n return InfiniteScroll;\n});\n\nS2.define('select2/dropdown/attachBody',[\n 'jquery',\n '../utils'\n], function ($, Utils) {\n function AttachBody (decorated, $element, options) {\n this.$dropdownParent = options.get('dropdownParent') || $(document.body);\n\n decorated.call(this, $element, options);\n }\n\n AttachBody.prototype.bind = function (decorated, container, $container) {\n var self = this;\n\n var setupResultsEvents = false;\n\n decorated.call(this, container, $container);\n\n container.on('open', function () {\n self._showDropdown();\n self._attachPositioningHandler(container);\n\n if (!setupResultsEvents) {\n setupResultsEvents = true;\n\n container.on('results:all', function () {\n self._positionDropdown();\n self._resizeDropdown();\n });\n\n container.on('results:append', function () {\n self._positionDropdown();\n self._resizeDropdown();\n });\n }\n });\n\n container.on('close', function () {\n self._hideDropdown();\n self._detachPositioningHandler(container);\n });\n\n this.$dropdownContainer.on('mousedown', function (evt) {\n evt.stopPropagation();\n });\n };\n\n AttachBody.prototype.destroy = function (decorated) {\n decorated.call(this);\n\n this.$dropdownContainer.remove();\n };\n\n AttachBody.prototype.position = function (decorated, $dropdown, $container) {\n // Clone all of the container classes\n $dropdown.attr('class', $container.attr('class'));\n\n $dropdown.removeClass('select2');\n $dropdown.addClass('select2-container--open');\n\n $dropdown.css({\n position: 'absolute',\n top: -999999\n });\n\n this.$container = $container;\n };\n\n AttachBody.prototype.render = function (decorated) {\n var $container = $('<span></span>');\n\n var $dropdown = decorated.call(this);\n $container.append($dropdown);\n\n this.$dropdownContainer = $container;\n\n return $container;\n };\n\n AttachBody.prototype._hideDropdown = function (decorated) {\n this.$dropdownContainer.detach();\n };\n\n AttachBody.prototype._attachPositioningHandler =\n function (decorated, container) {\n var self = this;\n\n var scrollEvent = 'scroll.select2.' + container.id;\n var resizeEvent = 'resize.select2.' + container.id;\n var orientationEvent = 'orientationchange.select2.' + container.id;\n\n var $watchers = this.$container.parents().filter(Utils.hasScroll);\n $watchers.each(function () {\n $(this).data('select2-scroll-position', {\n x: $(this).scrollLeft(),\n y: $(this).scrollTop()\n });\n });\n\n $watchers.on(scrollEvent, function (ev) {\n var position = $(this).data('select2-scroll-position');\n $(this).scrollTop(position.y);\n });\n\n $(window).on(scrollEvent + ' ' + resizeEvent + ' ' + orientationEvent,\n function (e) {\n self._positionDropdown();\n self._resizeDropdown();\n });\n };\n\n AttachBody.prototype._detachPositioningHandler =\n function (decorated, container) {\n var scrollEvent = 'scroll.select2.' + container.id;\n var resizeEvent = 'resize.select2.' + container.id;\n var orientationEvent = 'orientationchange.select2.' + container.id;\n\n var $watchers = this.$container.parents().filter(Utils.hasScroll);\n $watchers.off(scrollEvent);\n\n $(window).off(scrollEvent + ' ' + resizeEvent + ' ' + orientationEvent);\n };\n\n AttachBody.prototype._positionDropdown = function () {\n var $window = $(window);\n\n var isCurrentlyAbove = this.$dropdown.hasClass('select2-dropdown--above');\n var isCurrentlyBelow = this.$dropdown.hasClass('select2-dropdown--below');\n\n var newDirection = null;\n\n var offset = this.$container.offset();\n\n offset.bottom = offset.top + this.$container.outerHeight(false);\n\n var container = {\n height: this.$container.outerHeight(false)\n };\n\n container.top = offset.top;\n container.bottom = offset.top + container.height;\n\n var dropdown = {\n height: this.$dropdown.outerHeight(false)\n };\n\n var viewport = {\n top: $window.scrollTop(),\n bottom: $window.scrollTop() + $window.height()\n };\n\n var enoughRoomAbove = viewport.top < (offset.top - dropdown.height);\n var enoughRoomBelow = viewport.bottom > (offset.bottom + dropdown.height);\n\n var css = {\n left: offset.left,\n top: container.bottom\n };\n\n // Determine what the parent element is to use for calciulating the offset\n var $offsetParent = this.$dropdownParent;\n\n // For statically positoned elements, we need to get the element\n // that is determining the offset\n if ($offsetParent.css('position') === 'static') {\n $offsetParent = $offsetParent.offsetParent();\n }\n\n var parentOffset = $offsetParent.offset();\n\n css.top -= parentOffset.top;\n css.left -= parentOffset.left;\n\n if (!isCurrentlyAbove && !isCurrentlyBelow) {\n newDirection = 'below';\n }\n\n if (!enoughRoomBelow && enoughRoomAbove && !isCurrentlyAbove) {\n newDirection = 'above';\n } else if (!enoughRoomAbove && enoughRoomBelow && isCurrentlyAbove) {\n newDirection = 'below';\n }\n\n if (newDirection == 'above' ||\n (isCurrentlyAbove && newDirection !== 'below')) {\n css.top = container.top - parentOffset.top - dropdown.height;\n }\n\n if (newDirection != null) {\n this.$dropdown\n .removeClass('select2-dropdown--below select2-dropdown--above')\n .addClass('select2-dropdown--' + newDirection);\n this.$container\n .removeClass('select2-container--below select2-container--above')\n .addClass('select2-container--' + newDirection);\n }\n\n this.$dropdownContainer.css(css);\n };\n\n AttachBody.prototype._resizeDropdown = function () {\n var css = {\n width: this.$container.outerWidth(false) + 'px'\n };\n\n if (this.options.get('dropdownAutoWidth')) {\n css.minWidth = css.width;\n css.position = 'relative';\n css.width = 'auto';\n }\n\n this.$dropdown.css(css);\n };\n\n AttachBody.prototype._showDropdown = function (decorated) {\n this.$dropdownContainer.appendTo(this.$dropdownParent);\n\n this._positionDropdown();\n this._resizeDropdown();\n };\n\n return AttachBody;\n});\n\nS2.define('select2/dropdown/minimumResultsForSearch',[\n\n], function () {\n function countResults (data) {\n var count = 0;\n\n for (var d = 0; d < data.length; d++) {\n var item = data[d];\n\n if (item.children) {\n count += countResults(item.children);\n } else {\n count++;\n }\n }\n\n return count;\n }\n\n function MinimumResultsForSearch (decorated, $element, options, dataAdapter) {\n this.minimumResultsForSearch = options.get('minimumResultsForSearch');\n\n if (this.minimumResultsForSearch < 0) {\n this.minimumResultsForSearch = Infinity;\n }\n\n decorated.call(this, $element, options, dataAdapter);\n }\n\n MinimumResultsForSearch.prototype.showSearch = function (decorated, params) {\n if (countResults(params.data.results) < this.minimumResultsForSearch) {\n return false;\n }\n\n return decorated.call(this, params);\n };\n\n return MinimumResultsForSearch;\n});\n\nS2.define('select2/dropdown/selectOnClose',[\n\n], function () {\n function SelectOnClose () { }\n\n SelectOnClose.prototype.bind = function (decorated, container, $container) {\n var self = this;\n\n decorated.call(this, container, $container);\n\n container.on('close', function (params) {\n self._handleSelectOnClose(params);\n });\n };\n\n SelectOnClose.prototype._handleSelectOnClose = function (_, params) {\n if (params && params.originalSelect2Event != null) {\n var event = params.originalSelect2Event;\n\n // Don't select an item if the close event was triggered from a select or\n // unselect event\n if (event._type === 'select' || event._type === 'unselect') {\n return;\n }\n }\n\n var $highlightedResults = this.getHighlightedResults();\n\n // Only select highlighted results\n if ($highlightedResults.length < 1) {\n return;\n }\n\n var data = $highlightedResults.data('data');\n\n // Don't re-select already selected resulte\n if (\n (data.element != null && data.element.selected) ||\n (data.element == null && data.selected)\n ) {\n return;\n }\n\n this.trigger('select', {\n data: data\n });\n };\n\n return SelectOnClose;\n});\n\nS2.define('select2/dropdown/closeOnSelect',[\n\n], function () {\n function CloseOnSelect () { }\n\n CloseOnSelect.prototype.bind = function (decorated, container, $container) {\n var self = this;\n\n decorated.call(this, container, $container);\n\n container.on('select', function (evt) {\n self._selectTriggered(evt);\n });\n\n container.on('unselect', function (evt) {\n self._selectTriggered(evt);\n });\n };\n\n CloseOnSelect.prototype._selectTriggered = function (_, evt) {\n var originalEvent = evt.originalEvent;\n\n // Don't close if the control key is being held\n if (originalEvent && originalEvent.ctrlKey) {\n return;\n }\n\n this.trigger('close', {\n originalEvent: originalEvent,\n originalSelect2Event: evt\n });\n };\n\n return CloseOnSelect;\n});\n\nS2.define('select2/i18n/en',[],function () {\n // English\n return {\n errorLoading: function () {\n return 'The results could not be loaded.';\n },\n inputTooLong: function (args) {\n var overChars = args.input.length - args.maximum;\n\n var message = 'Please delete ' + overChars + ' character';\n\n if (overChars != 1) {\n message += 's';\n }\n\n return message;\n },\n inputTooShort: function (args) {\n var remainingChars = args.minimum - args.input.length;\n\n var message = 'Please enter ' + remainingChars + ' or more characters';\n\n return message;\n },\n loadingMore: function () {\n return 'Loading more results…';\n },\n maximumSelected: function (args) {\n var message = 'You can only select ' + args.maximum + ' item';\n\n if (args.maximum != 1) {\n message += 's';\n }\n\n return message;\n },\n noResults: function () {\n return 'No results found';\n },\n searching: function () {\n return 'Searching…';\n }\n };\n});\n\nS2.define('select2/defaults',[\n 'jquery',\n 'require',\n\n './results',\n\n './selection/single',\n './selection/multiple',\n './selection/placeholder',\n './selection/allowClear',\n './selection/search',\n './selection/eventRelay',\n\n './utils',\n './translation',\n './diacritics',\n\n './data/select',\n './data/array',\n './data/ajax',\n './data/tags',\n './data/tokenizer',\n './data/minimumInputLength',\n './data/maximumInputLength',\n './data/maximumSelectionLength',\n\n './dropdown',\n './dropdown/search',\n './dropdown/hidePlaceholder',\n './dropdown/infiniteScroll',\n './dropdown/attachBody',\n './dropdown/minimumResultsForSearch',\n './dropdown/selectOnClose',\n './dropdown/closeOnSelect',\n\n './i18n/en'\n], function ($, require,\n\n ResultsList,\n\n SingleSelection, MultipleSelection, Placeholder, AllowClear,\n SelectionSearch, EventRelay,\n\n Utils, Translation, DIACRITICS,\n\n SelectData, ArrayData, AjaxData, Tags, Tokenizer,\n MinimumInputLength, MaximumInputLength, MaximumSelectionLength,\n\n Dropdown, DropdownSearch, HidePlaceholder, InfiniteScroll,\n AttachBody, MinimumResultsForSearch, SelectOnClose, CloseOnSelect,\n\n EnglishTranslation) {\n function Defaults () {\n this.reset();\n }\n\n Defaults.prototype.apply = function (options) {\n options = $.extend(true, {}, this.defaults, options);\n\n if (options.dataAdapter == null) {\n if (options.ajax != null) {\n options.dataAdapter = AjaxData;\n } else if (options.data != null) {\n options.dataAdapter = ArrayData;\n } else {\n options.dataAdapter = SelectData;\n }\n\n if (options.minimumInputLength > 0) {\n options.dataAdapter = Utils.Decorate(\n options.dataAdapter,\n MinimumInputLength\n );\n }\n\n if (options.maximumInputLength > 0) {\n options.dataAdapter = Utils.Decorate(\n options.dataAdapter,\n MaximumInputLength\n );\n }\n\n if (options.maximumSelectionLength > 0) {\n options.dataAdapter = Utils.Decorate(\n options.dataAdapter,\n MaximumSelectionLength\n );\n }\n\n if (options.tags) {\n options.dataAdapter = Utils.Decorate(options.dataAdapter, Tags);\n }\n\n if (options.tokenSeparators != null || options.tokenizer != null) {\n options.dataAdapter = Utils.Decorate(\n options.dataAdapter,\n Tokenizer\n );\n }\n\n if (options.query != null) {\n var Query = require(options.amdBase + 'compat/query');\n\n options.dataAdapter = Utils.Decorate(\n options.dataAdapter,\n Query\n );\n }\n\n if (options.initSelection != null) {\n var InitSelection = require(options.amdBase + 'compat/initSelection');\n\n options.dataAdapter = Utils.Decorate(\n options.dataAdapter,\n InitSelection\n );\n }\n }\n\n if (options.resultsAdapter == null) {\n options.resultsAdapter = ResultsList;\n\n if (options.ajax != null) {\n options.resultsAdapter = Utils.Decorate(\n options.resultsAdapter,\n InfiniteScroll\n );\n }\n\n if (options.placeholder != null) {\n options.resultsAdapter = Utils.Decorate(\n options.resultsAdapter,\n HidePlaceholder\n );\n }\n\n if (options.selectOnClose) {\n options.resultsAdapter = Utils.Decorate(\n options.resultsAdapter,\n SelectOnClose\n );\n }\n }\n\n if (options.dropdownAdapter == null) {\n if (options.multiple) {\n options.dropdownAdapter = Dropdown;\n } else {\n var SearchableDropdown = Utils.Decorate(Dropdown, DropdownSearch);\n\n options.dropdownAdapter = SearchableDropdown;\n }\n\n if (options.minimumResultsForSearch !== 0) {\n options.dropdownAdapter = Utils.Decorate(\n options.dropdownAdapter,\n MinimumResultsForSearch\n );\n }\n\n if (options.closeOnSelect) {\n options.dropdownAdapter = Utils.Decorate(\n options.dropdownAdapter,\n CloseOnSelect\n );\n }\n\n if (\n options.dropdownCssClass != null ||\n options.dropdownCss != null ||\n options.adaptDropdownCssClass != null\n ) {\n var DropdownCSS = require(options.amdBase + 'compat/dropdownCss');\n\n options.dropdownAdapter = Utils.Decorate(\n options.dropdownAdapter,\n DropdownCSS\n );\n }\n\n options.dropdownAdapter = Utils.Decorate(\n options.dropdownAdapter,\n AttachBody\n );\n }\n\n if (options.selectionAdapter == null) {\n if (options.multiple) {\n options.selectionAdapter = MultipleSelection;\n } else {\n options.selectionAdapter = SingleSelection;\n }\n\n // Add the placeholder mixin if a placeholder was specified\n if (options.placeholder != null) {\n options.selectionAdapter = Utils.Decorate(\n options.selectionAdapter,\n Placeholder\n );\n }\n\n if (options.allowClear) {\n options.selectionAdapter = Utils.Decorate(\n options.selectionAdapter,\n AllowClear\n );\n }\n\n if (options.multiple) {\n options.selectionAdapter = Utils.Decorate(\n options.selectionAdapter,\n SelectionSearch\n );\n }\n\n if (\n options.containerCssClass != null ||\n options.containerCss != null ||\n options.adaptContainerCssClass != null\n ) {\n var ContainerCSS = require(options.amdBase + 'compat/containerCss');\n\n options.selectionAdapter = Utils.Decorate(\n options.selectionAdapter,\n ContainerCSS\n );\n }\n\n options.selectionAdapter = Utils.Decorate(\n options.selectionAdapter,\n EventRelay\n );\n }\n\n if (typeof options.language === 'string') {\n // Check if the language is specified with a region\n if (options.language.indexOf('-') > 0) {\n // Extract the region information if it is included\n var languageParts = options.language.split('-');\n var baseLanguage = languageParts[0];\n\n options.language = [options.language, baseLanguage];\n } else {\n options.language = [options.language];\n }\n }\n\n if ($.isArray(options.language)) {\n var languages = new Translation();\n options.language.push('en');\n\n var languageNames = options.language;\n\n for (var l = 0; l < languageNames.length; l++) {\n var name = languageNames[l];\n var language = {};\n\n try {\n // Try to load it with the original name\n language = Translation.loadPath(name);\n } catch (e) {\n try {\n // If we couldn't load it, check if it wasn't the full path\n name = this.defaults.amdLanguageBase + name;\n language = Translation.loadPath(name);\n } catch (ex) {\n // The translation could not be loaded at all. Sometimes this is\n // because of a configuration problem, other times this can be\n // because of how Select2 helps load all possible translation files.\n if (options.debug && window.console && console.warn) {\n console.warn(\n 'Select2: The language file for \"' + name + '\" could not be ' +\n 'automatically loaded. A fallback will be used instead.'\n );\n }\n\n continue;\n }\n }\n\n languages.extend(language);\n }\n\n options.translations = languages;\n } else {\n var baseTranslation = Translation.loadPath(\n this.defaults.amdLanguageBase + 'en'\n );\n var customTranslation = new Translation(options.language);\n\n customTranslation.extend(baseTranslation);\n\n options.translations = customTranslation;\n }\n\n return options;\n };\n\n Defaults.prototype.reset = function () {\n function stripDiacritics (text) {\n // Used 'uni range + named function' from http://jsperf.com/diacritics/18\n function match(a) {\n return DIACRITICS[a] || a;\n }\n\n return text.replace(/[^\\u0000-\\u007E]/g, match);\n }\n\n function matcher (params, data) {\n // Always return the object if there is nothing to compare\n if ($.trim(params.term) === '') {\n return data;\n }\n\n // Do a recursive check for options with children\n if (data.children && data.children.length > 0) {\n // Clone the data object if there are children\n // This is required as we modify the object to remove any non-matches\n var match = $.extend(true, {}, data);\n\n // Check each child of the option\n for (var c = data.children.length - 1; c >= 0; c--) {\n var child = data.children[c];\n\n var matches = matcher(params, child);\n\n // If there wasn't a match, remove the object in the array\n if (matches == null) {\n match.children.splice(c, 1);\n }\n }\n\n // If any children matched, return the new object\n if (match.children.length > 0) {\n return match;\n }\n\n // If there were no matching children, check just the plain object\n return matcher(params, match);\n }\n\n var original = stripDiacritics(data.text).toUpperCase();\n var term = stripDiacritics(params.term).toUpperCase();\n\n // Check if the text contains the term\n if (original.indexOf(term) > -1) {\n return data;\n }\n\n // If it doesn't contain the term, don't return anything\n return null;\n }\n\n this.defaults = {\n amdBase: './',\n amdLanguageBase: './i18n/',\n closeOnSelect: true,\n debug: false,\n dropdownAutoWidth: false,\n escapeMarkup: Utils.escapeMarkup,\n language: EnglishTranslation,\n matcher: matcher,\n minimumInputLength: 0,\n maximumInputLength: 0,\n maximumSelectionLength: 0,\n minimumResultsForSearch: 0,\n selectOnClose: false,\n sorter: function (data) {\n return data;\n },\n templateResult: function (result) {\n return result.text;\n },\n templateSelection: function (selection) {\n return selection.text;\n },\n theme: 'default',\n width: 'resolve'\n };\n };\n\n Defaults.prototype.set = function (key, value) {\n var camelKey = $.camelCase(key);\n\n var data = {};\n data[camelKey] = value;\n\n var convertedData = Utils._convertData(data);\n\n $.extend(this.defaults, convertedData);\n };\n\n var defaults = new Defaults();\n\n return defaults;\n});\n\nS2.define('select2/options',[\n 'require',\n 'jquery',\n './defaults',\n './utils'\n], function (require, $, Defaults, Utils) {\n function Options (options, $element) {\n this.options = options;\n\n if ($element != null) {\n this.fromElement($element);\n }\n\n this.options = Defaults.apply(this.options);\n\n if ($element && $element.is('input')) {\n var InputCompat = require(this.get('amdBase') + 'compat/inputData');\n\n this.options.dataAdapter = Utils.Decorate(\n this.options.dataAdapter,\n InputCompat\n );\n }\n }\n\n Options.prototype.fromElement = function ($e) {\n var excludedData = ['select2'];\n\n if (this.options.multiple == null) {\n this.options.multiple = $e.prop('multiple');\n }\n\n if (this.options.disabled == null) {\n this.options.disabled = $e.prop('disabled');\n }\n\n if (this.options.language == null) {\n if ($e.prop('lang')) {\n this.options.language = $e.prop('lang').toLowerCase();\n } else if ($e.closest('[lang]').prop('lang')) {\n this.options.language = $e.closest('[lang]').prop('lang');\n }\n }\n\n if (this.options.dir == null) {\n if ($e.prop('dir')) {\n this.options.dir = $e.prop('dir');\n } else if ($e.closest('[dir]').prop('dir')) {\n this.options.dir = $e.closest('[dir]').prop('dir');\n } else {\n this.options.dir = 'ltr';\n }\n }\n\n $e.prop('disabled', this.options.disabled);\n $e.prop('multiple', this.options.multiple);\n\n if ($e.data('select2Tags')) {\n if (this.options.debug && window.console && console.warn) {\n console.warn(\n 'Select2: The `data-select2-tags` attribute has been changed to ' +\n 'use the `data-data` and `data-tags=\"true\"` attributes and will be ' +\n 'removed in future versions of Select2.'\n );\n }\n\n $e.data('data', $e.data('select2Tags'));\n $e.data('tags', true);\n }\n\n if ($e.data('ajaxUrl')) {\n if (this.options.debug && window.console && console.warn) {\n console.warn(\n 'Select2: The `data-ajax-url` attribute has been changed to ' +\n '`data-ajax--url` and support for the old attribute will be removed' +\n ' in future versions of Select2.'\n );\n }\n\n $e.attr('ajax--url', $e.data('ajaxUrl'));\n $e.data('ajax--url', $e.data('ajaxUrl'));\n }\n\n var dataset = {};\n\n // Prefer the element's `dataset` attribute if it exists\n // jQuery 1.x does not correctly handle data attributes with multiple dashes\n if ($.fn.jquery && $.fn.jquery.substr(0, 2) == '1.' && $e[0].dataset) {\n dataset = $.extend(true, {}, $e[0].dataset, $e.data());\n } else {\n dataset = $e.data();\n }\n\n var data = $.extend(true, {}, dataset);\n\n data = Utils._convertData(data);\n\n for (var key in data) {\n if ($.inArray(key, excludedData) > -1) {\n continue;\n }\n\n if ($.isPlainObject(this.options[key])) {\n $.extend(this.options[key], data[key]);\n } else {\n this.options[key] = data[key];\n }\n }\n\n return this;\n };\n\n Options.prototype.get = function (key) {\n return this.options[key];\n };\n\n Options.prototype.set = function (key, val) {\n this.options[key] = val;\n };\n\n return Options;\n});\n\nS2.define('select2/core',[\n 'jquery',\n './options',\n './utils',\n './keys'\n], function ($, Options, Utils, KEYS) {\n var Select2 = function ($element, options) {\n if ($element.data('select2') != null) {\n $element.data('select2').destroy();\n }\n\n this.$element = $element;\n\n this.id = this._generateId($element);\n\n options = options || {};\n\n this.options = new Options(options, $element);\n\n Select2.__super__.constructor.call(this);\n\n // Set up the tabindex\n\n var tabindex = $element.attr('tabindex') || 0;\n $element.data('old-tabindex', tabindex);\n $element.attr('tabindex', '-1');\n\n // Set up containers and adapters\n\n var DataAdapter = this.options.get('dataAdapter');\n this.dataAdapter = new DataAdapter($element, this.options);\n\n var $container = this.render();\n\n this._placeContainer($container);\n\n var SelectionAdapter = this.options.get('selectionAdapter');\n this.selection = new SelectionAdapter($element, this.options);\n this.$selection = this.selection.render();\n\n this.selection.position(this.$selection, $container);\n\n var DropdownAdapter = this.options.get('dropdownAdapter');\n this.dropdown = new DropdownAdapter($element, this.options);\n this.$dropdown = this.dropdown.render();\n\n this.dropdown.position(this.$dropdown, $container);\n\n var ResultsAdapter = this.options.get('resultsAdapter');\n this.results = new ResultsAdapter($element, this.options, this.dataAdapter);\n this.$results = this.results.render();\n\n this.results.position(this.$results, this.$dropdown);\n\n // Bind events\n\n var self = this;\n\n // Bind the container to all of the adapters\n this._bindAdapters();\n\n // Register any DOM event handlers\n this._registerDomEvents();\n\n // Register any internal event handlers\n this._registerDataEvents();\n this._registerSelectionEvents();\n this._registerDropdownEvents();\n this._registerResultsEvents();\n this._registerEvents();\n\n // Set the initial state\n this.dataAdapter.current(function (initialData) {\n self.trigger('selection:update', {\n data: initialData\n });\n });\n\n // Hide the original select\n $element.addClass('select2-hidden-accessible');\n $element.attr('aria-hidden', 'true');\n\n // Synchronize any monitored attributes\n this._syncAttributes();\n\n $element.data('select2', this);\n };\n\n Utils.Extend(Select2, Utils.Observable);\n\n Select2.prototype._generateId = function ($element) {\n var id = '';\n\n if ($element.attr('id') != null) {\n id = $element.attr('id');\n } else if ($element.attr('name') != null) {\n id = $element.attr('name') + '-' + Utils.generateChars(2);\n } else {\n id = Utils.generateChars(4);\n }\n\n id = id.replace(/(:|\\.|\\[|\\]|,)/g, '');\n id = 'select2-' + id;\n\n return id;\n };\n\n Select2.prototype._placeContainer = function ($container) {\n $container.insertAfter(this.$element);\n\n var width = this._resolveWidth(this.$element, this.options.get('width'));\n\n if (width != null) {\n $container.css('width', width);\n }\n };\n\n Select2.prototype._resolveWidth = function ($element, method) {\n var WIDTH = /^width:(([-+]?([0-9]*\\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i;\n\n if (method == 'resolve') {\n var styleWidth = this._resolveWidth($element, 'style');\n\n if (styleWidth != null) {\n return styleWidth;\n }\n\n return this._resolveWidth($element, 'element');\n }\n\n if (method == 'element') {\n var elementWidth = $element.outerWidth(false);\n\n if (elementWidth <= 0) {\n return 'auto';\n }\n\n return elementWidth + 'px';\n }\n\n if (method == 'style') {\n var style = $element.attr('style');\n\n if (typeof(style) !== 'string') {\n return null;\n }\n\n var attrs = style.split(';');\n\n for (var i = 0, l = attrs.length; i < l; i = i + 1) {\n var attr = attrs[i].replace(/\\s/g, '');\n var matches = attr.match(WIDTH);\n\n if (matches !== null && matches.length >= 1) {\n return matches[1];\n }\n }\n\n return null;\n }\n\n return method;\n };\n\n Select2.prototype._bindAdapters = function () {\n this.dataAdapter.bind(this, this.$container);\n this.selection.bind(this, this.$container);\n\n this.dropdown.bind(this, this.$container);\n this.results.bind(this, this.$container);\n };\n\n Select2.prototype._registerDomEvents = function () {\n var self = this;\n\n this.$element.on('change.select2', function () {\n self.dataAdapter.current(function (data) {\n self.trigger('selection:update', {\n data: data\n });\n });\n });\n\n this.$element.on('focus.select2', function (evt) {\n self.trigger('focus', evt);\n });\n\n this._syncA = Utils.bind(this._syncAttributes, this);\n this._syncS = Utils.bind(this._syncSubtree, this);\n\n if (this.$element[0].attachEvent) {\n this.$element[0].attachEvent('onpropertychange', this._syncA);\n }\n\n var observer = window.MutationObserver ||\n window.WebKitMutationObserver ||\n window.MozMutationObserver\n ;\n\n if (observer != null) {\n this._observer = new observer(function (mutations) {\n $.each(mutations, self._syncA);\n $.each(mutations, self._syncS);\n });\n this._observer.observe(this.$element[0], {\n attributes: true,\n childList: true,\n subtree: false\n });\n } else if (this.$element[0].addEventListener) {\n this.$element[0].addEventListener(\n 'DOMAttrModified',\n self._syncA,\n false\n );\n this.$element[0].addEventListener(\n 'DOMNodeInserted',\n self._syncS,\n false\n );\n this.$element[0].addEventListener(\n 'DOMNodeRemoved',\n self._syncS,\n false\n );\n }\n };\n\n Select2.prototype._registerDataEvents = function () {\n var self = this;\n\n this.dataAdapter.on('*', function (name, params) {\n self.trigger(name, params);\n });\n };\n\n Select2.prototype._registerSelectionEvents = function () {\n var self = this;\n var nonRelayEvents = ['toggle', 'focus'];\n\n this.selection.on('toggle', function () {\n self.toggleDropdown();\n });\n\n this.selection.on('focus', function (params) {\n self.focus(params);\n });\n\n this.selection.on('*', function (name, params) {\n if ($.inArray(name, nonRelayEvents) !== -1) {\n return;\n }\n\n self.trigger(name, params);\n });\n };\n\n Select2.prototype._registerDropdownEvents = function () {\n var self = this;\n\n this.dropdown.on('*', function (name, params) {\n self.trigger(name, params);\n });\n };\n\n Select2.prototype._registerResultsEvents = function () {\n var self = this;\n\n this.results.on('*', function (name, params) {\n self.trigger(name, params);\n });\n };\n\n Select2.prototype._registerEvents = function () {\n var self = this;\n\n this.on('open', function () {\n self.$container.addClass('select2-container--open');\n });\n\n this.on('close', function () {\n self.$container.removeClass('select2-container--open');\n });\n\n this.on('enable', function () {\n self.$container.removeClass('select2-container--disabled');\n });\n\n this.on('disable', function () {\n self.$container.addClass('select2-container--disabled');\n });\n\n this.on('blur', function () {\n self.$container.removeClass('select2-container--focus');\n });\n\n this.on('query', function (params) {\n if (!self.isOpen()) {\n self.trigger('open', {});\n }\n\n this.dataAdapter.query(params, function (data) {\n self.trigger('results:all', {\n data: data,\n query: params\n });\n });\n });\n\n this.on('query:append', function (params) {\n this.dataAdapter.query(params, function (data) {\n self.trigger('results:append', {\n data: data,\n query: params\n });\n });\n });\n\n this.on('keypress', function (evt) {\n var key = evt.which;\n\n if (self.isOpen()) {\n if (key === KEYS.ESC || key === KEYS.TAB ||\n (key === KEYS.UP && evt.altKey)) {\n self.close();\n\n evt.preventDefault();\n } else if (key === KEYS.ENTER) {\n self.trigger('results:select', {});\n\n evt.preventDefault();\n } else if ((key === KEYS.SPACE && evt.ctrlKey)) {\n self.trigger('results:toggle', {});\n\n evt.preventDefault();\n } else if (key === KEYS.UP) {\n self.trigger('results:previous', {});\n\n evt.preventDefault();\n } else if (key === KEYS.DOWN) {\n self.trigger('results:next', {});\n\n evt.preventDefault();\n }\n } else {\n if (key === KEYS.ENTER || key === KEYS.SPACE ||\n (key === KEYS.DOWN && evt.altKey)) {\n self.open();\n\n evt.preventDefault();\n }\n }\n });\n };\n\n Select2.prototype._syncAttributes = function () {\n this.options.set('disabled', this.$element.prop('disabled'));\n\n if (this.options.get('disabled')) {\n if (this.isOpen()) {\n this.close();\n }\n\n this.trigger('disable', {});\n } else {\n this.trigger('enable', {});\n }\n };\n\n Select2.prototype._syncSubtree = function (evt, mutations) {\n var changed = false;\n var self = this;\n\n // Ignore any mutation events raised for elements that aren't options or\n // optgroups. This handles the case when the select element is destroyed\n if (\n evt && evt.target && (\n evt.target.nodeName !== 'OPTION' && evt.target.nodeName !== 'OPTGROUP'\n )\n ) {\n return;\n }\n\n if (!mutations) {\n // If mutation events aren't supported, then we can only assume that the\n // change affected the selections\n changed = true;\n } else if (mutations.addedNodes && mutations.addedNodes.length > 0) {\n for (var n = 0; n < mutations.addedNodes.length; n++) {\n var node = mutations.addedNodes[n];\n\n if (node.selected) {\n changed = true;\n }\n }\n } else if (mutations.removedNodes && mutations.removedNodes.length > 0) {\n changed = true;\n }\n\n // Only re-pull the data if we think there is a change\n if (changed) {\n this.dataAdapter.current(function (currentData) {\n self.trigger('selection:update', {\n data: currentData\n });\n });\n }\n };\n\n /**\n * Override the trigger method to automatically trigger pre-events when\n * there are events that can be prevented.\n */\n Select2.prototype.trigger = function (name, args) {\n var actualTrigger = Select2.__super__.trigger;\n var preTriggerMap = {\n 'open': 'opening',\n 'close': 'closing',\n 'select': 'selecting',\n 'unselect': 'unselecting'\n };\n\n if (args === undefined) {\n args = {};\n }\n\n if (name in preTriggerMap) {\n var preTriggerName = preTriggerMap[name];\n var preTriggerArgs = {\n prevented: false,\n name: name,\n args: args\n };\n\n actualTrigger.call(this, preTriggerName, preTriggerArgs);\n\n if (preTriggerArgs.prevented) {\n args.prevented = true;\n\n return;\n }\n }\n\n actualTrigger.call(this, name, args);\n };\n\n Select2.prototype.toggleDropdown = function () {\n if (this.options.get('disabled')) {\n return;\n }\n\n if (this.isOpen()) {\n this.close();\n } else {\n this.open();\n }\n };\n\n Select2.prototype.open = function () {\n if (this.isOpen()) {\n return;\n }\n\n this.trigger('query', {});\n };\n\n Select2.prototype.close = function () {\n if (!this.isOpen()) {\n return;\n }\n\n this.trigger('close', {});\n };\n\n Select2.prototype.isOpen = function () {\n return this.$container.hasClass('select2-container--open');\n };\n\n Select2.prototype.hasFocus = function () {\n return this.$container.hasClass('select2-container--focus');\n };\n\n Select2.prototype.focus = function (data) {\n // No need to re-trigger focus events if we are already focused\n if (this.hasFocus()) {\n return;\n }\n\n this.$container.addClass('select2-container--focus');\n this.trigger('focus', {});\n };\n\n Select2.prototype.enable = function (args) {\n if (this.options.get('debug') && window.console && console.warn) {\n console.warn(\n 'Select2: The `select2(\"enable\")` method has been deprecated and will' +\n ' be removed in later Select2 versions. Use $element.prop(\"disabled\")' +\n ' instead.'\n );\n }\n\n if (args == null || args.length === 0) {\n args = [true];\n }\n\n var disabled = !args[0];\n\n this.$element.prop('disabled', disabled);\n };\n\n Select2.prototype.data = function () {\n if (this.options.get('debug') &&\n arguments.length > 0 && window.console && console.warn) {\n console.warn(\n 'Select2: Data can no longer be set using `select2(\"data\")`. You ' +\n 'should consider setting the value instead using `$element.val()`.'\n );\n }\n\n var data = [];\n\n this.dataAdapter.current(function (currentData) {\n data = currentData;\n });\n\n return data;\n };\n\n Select2.prototype.val = function (args) {\n if (this.options.get('debug') && window.console && console.warn) {\n console.warn(\n 'Select2: The `select2(\"val\")` method has been deprecated and will be' +\n ' removed in later Select2 versions. Use $element.val() instead.'\n );\n }\n\n if (args == null || args.length === 0) {\n return this.$element.val();\n }\n\n var newVal = args[0];\n\n if ($.isArray(newVal)) {\n newVal = $.map(newVal, function (obj) {\n return obj.toString();\n });\n }\n\n this.$element.val(newVal).trigger('change');\n };\n\n Select2.prototype.destroy = function () {\n this.$container.remove();\n\n if (this.$element[0].detachEvent) {\n this.$element[0].detachEvent('onpropertychange', this._syncA);\n }\n\n if (this._observer != null) {\n this._observer.disconnect();\n this._observer = null;\n } else if (this.$element[0].removeEventListener) {\n this.$element[0]\n .removeEventListener('DOMAttrModified', this._syncA, false);\n this.$element[0]\n .removeEventListener('DOMNodeInserted', this._syncS, false);\n this.$element[0]\n .removeEventListener('DOMNodeRemoved', this._syncS, false);\n }\n\n this._syncA = null;\n this._syncS = null;\n\n this.$element.off('.select2');\n this.$element.attr('tabindex', this.$element.data('old-tabindex'));\n\n this.$element.removeClass('select2-hidden-accessible');\n this.$element.attr('aria-hidden', 'false');\n this.$element.removeData('select2');\n\n this.dataAdapter.destroy();\n this.selection.destroy();\n this.dropdown.destroy();\n this.results.destroy();\n\n this.dataAdapter = null;\n this.selection = null;\n this.dropdown = null;\n this.results = null;\n };\n\n Select2.prototype.render = function () {\n var $container = $(\n '<span class=\"select2 select2-container\">' +\n '<span class=\"selection\"></span>' +\n '<span class=\"dropdown-wrapper\" aria-hidden=\"true\"></span>' +\n '</span>'\n );\n\n $container.attr('dir', this.options.get('dir'));\n\n this.$container = $container;\n\n this.$container.addClass('select2-container--' + this.options.get('theme'));\n\n $container.data('element', this.$element);\n\n return $container;\n };\n\n return Select2;\n});\n\nS2.define('jquery-mousewheel',[\n 'jquery'\n], function ($) {\n // Used to shim jQuery.mousewheel for non-full builds.\n return $;\n});\n\nS2.define('jquery.select2',[\n 'jquery',\n 'jquery-mousewheel',\n\n './select2/core',\n './select2/defaults'\n], function ($, _, Select2, Defaults) {\n if ($.fn.select2 == null) {\n // All methods that should return the element\n var thisMethods = ['open', 'close', 'destroy'];\n\n $.fn.select2 = function (options) {\n options = options || {};\n\n if (typeof options === 'object') {\n this.each(function () {\n var instanceOptions = $.extend(true, {}, options);\n\n var instance = new Select2($(this), instanceOptions);\n });\n\n return this;\n } else if (typeof options === 'string') {\n var ret;\n var args = Array.prototype.slice.call(arguments, 1);\n\n this.each(function () {\n var instance = $(this).data('select2');\n\n if (instance == null && window.console && console.error) {\n console.error(\n 'The select2(\\'' + options + '\\') method was called on an ' +\n 'element that is not using Select2.'\n );\n }\n\n ret = instance[options].apply(instance, args);\n });\n\n // Check if we should be returning `this`\n if ($.inArray(options, thisMethods) > -1) {\n return this;\n }\n\n return ret;\n } else {\n throw new Error('Invalid arguments for Select2: ' + options);\n }\n };\n }\n\n if ($.fn.select2.defaults == null) {\n $.fn.select2.defaults = Defaults;\n }\n\n return Select2;\n});\n\n // Return the AMD loader configuration so it can be used outside of this file\n return {\n define: S2.define,\n require: S2.require\n };\n}());\n\n // Autoload the jQuery bindings\n // We know that all of the modules exist above this, so we're safe\n var select2 = S2.require('jquery.select2');\n\n // Hold the AMD module references on the jQuery function that was just loaded\n // This allows Select2 to use the internal loader outside of this file, such\n // as in the language files.\n jQuery.fn.select2.amd = S2;\n\n // Return the Select2 instance for anyone who is importing it.\n return select2;\n}));\n\n\n//# sourceURL=webpack:///./node_modules/select2/dist/js/select2.js?");
/***/ }),
/***/ "./resources/js/admin/app.js":
/*!***********************************!*\
!*** ./resources/js/admin/app.js ***!
\***********************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("/**\n * Admin stuff needed\n */\n\n__webpack_require__(/*! ./../bootstrap */ \"./resources/js/bootstrap.js\");\n\n// Import the mapping function\nwindow.phpvms.map = __webpack_require__(/*! ../maps/index */ \"./resources/js/maps/index.js\");\n\n\n//# sourceURL=webpack:///./resources/js/admin/app.js?");
/***/ }),
/***/ "./resources/js/bootstrap.js":
/*!***********************************!*\
!*** ./resources/js/bootstrap.js ***!
\***********************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
eval("/**\n * Bootstrap any Javascript libraries required\n */\n\nwindow._ = __webpack_require__(/*! lodash */ \"./node_modules/lodash/lodash.js\")\nwindow.Popper = __webpack_require__(/*! popper.js */ \"./node_modules/popper.js/dist/esm/popper.js\").default\nwindow.$ = window.jquery = __webpack_require__(/*! jquery */ \"./node_modules/jquery/dist/jquery.js\")\nwindow.select2 = __webpack_require__(/*! select2 */ \"./node_modules/select2/dist/js/select2.js\")\nwindow.pjax = __webpack_require__(/*! pjax */ \"./node_modules/pjax/index.js\")\nwindow.axios = __webpack_require__(/*! axios */ \"./node_modules/axios/index.js\")\n\n/**\n * Container for phpVMS specific functions\n */\nwindow.phpvms = {}\n\n/**\n * Configure Axios with both the csrf token and the API key\n */\nwindow.axios.defaults.headers.common['X-Requested-With'] = 'XMLHttpRequest'\nconst token = document.head.querySelector('meta[name=\"csrf-token\"]')\n\nif (token) {\n window.axios.defaults.headers.common['X-CSRF-TOKEN'] = token.content\n window.jquery.ajaxSetup({\n 'X-CSRF-TOKEN': token.content\n })\n} else {\n console.error('CSRF token not found: https://laravel.com/docs/csrf#csrf-x-csrf-token')\n}\n\nconst api_key = document.head.querySelector('meta[name=\"api-key\"]')\nif (api_key) {\n window.axios.defaults.headers.common['x-api-key'] = api_key.content\n window.PHPVMS_USER_API_KEY = api_key.content\n} else {\n window.PHPVMS_USER_API_KEY = false\n console.error('API Key not found!')\n}\n\n\n//# sourceURL=webpack:///./resources/js/bootstrap.js?");
/***/ }),
/***/ "./resources/js/maps/airspace_map.js":
/*!*******************************************!*\
!*** ./resources/js/maps/airspace_map.js ***!
\*******************************************/
/*! exports provided: default */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
eval("__webpack_require__.r(__webpack_exports__);\n/* harmony import */ var _base_map__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./base_map */ \"./resources/js/maps/base_map.js\");\nconst _ = __webpack_require__(/*! lodash */ \"./node_modules/lodash/lodash.js\")\nconst leaflet = __webpack_require__(/*! leaflet */ \"./node_modules/leaflet/dist/leaflet-src.js\")\n\n\n\n/**\n * Render a map with the airspace, etc around a given set of coords\n * e.g, the airport map\n * @param opts\n */\n/* harmony default export */ __webpack_exports__[\"default\"] = ((opts) => {\n opts = _.defaults(opts, {\n render_elem: 'map',\n overlay_elem: '',\n lat: 0,\n lon: 0,\n zoom: 12,\n layers: [],\n set_marker: false,\n })\n\n let map = Object(_base_map__WEBPACK_IMPORTED_MODULE_0__[\"default\"])(opts)\n const coords = [opts.lat, opts.lon]\n console.log('Applying coords', coords)\n\n map.setView(coords, opts.zoom)\n if (opts.set_marker === true) {\n leaflet.marker(coords).addTo(map)\n }\n\n return map\n});\n\n\n//# sourceURL=webpack:///./resources/js/maps/airspace_map.js?");
/***/ }),
/***/ "./resources/js/maps/base_map.js":
/*!***************************************!*\
!*** ./resources/js/maps/base_map.js ***!
\***************************************/
/*! exports provided: default */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
eval("__webpack_require__.r(__webpack_exports__);\nconst _ = __webpack_require__(/*! lodash/lodash */ \"./node_modules/lodash/lodash.js\");\nconst leaflet = __webpack_require__(/*! leaflet */ \"./node_modules/leaflet/dist/leaflet-src.js\");\n\n/* harmony default export */ __webpack_exports__[\"default\"] = ((opts) => {\n\n opts = _.defaults(opts, {\n render_elem: 'map',\n center: [29.98139, -95.33374],\n zoom: 5,\n maxZoom: 10,\n layers: [],\n set_marker: false,\n });\n\n let feature_groups = [];\n /*var openaip_airspace_labels = new leaflet.TileLayer.WMS(\n \"http://{s}.tile.maps.openaip.net/geowebcache/service/wms\", {\n maxZoom: 14,\n minZoom: 12,\n layers: 'openaip_approved_airspaces_labels',\n tileSize: 1024,\n detectRetina: true,\n subdomains: '12',\n format: 'image/png',\n transparent: true\n });\n\n openaip_airspace_labels.addTo(map);*/\n\n const opencyclemap_phys_osm = new leaflet.TileLayer(\n 'http://{s}.tile.thunderforest.com/landscape/{z}/{x}/{y}.png?apikey=f09a38fa87514de4890fc96e7fe8ecb1', {\n maxZoom: 14,\n minZoom: 4,\n format: 'image/png',\n transparent: true\n })\n\n feature_groups.push(opencyclemap_phys_osm)\n\n /*const openaip_cached_basemap = new leaflet.TileLayer(\"http://{s}.tile.maps.openaip.net/geowebcache/service/tms/1.0.0/openaip_basemap@EPSG%3A900913@png/{z}/{x}/{y}.png\", {\n maxZoom: 14,\n minZoom: 4,\n tms: true,\n detectRetina: true,\n subdomains: '12',\n format: 'image/png',\n transparent: true\n });\n\n feature_groups.push(openaip_cached_basemap);\n */\n\n const openaip_basemap_phys_osm = leaflet.featureGroup(feature_groups)\n\n let map = leaflet.map('map', {\n layers: [openaip_basemap_phys_osm],\n center: opts.center,\n zoom: opts.zoom,\n scrollWheelZoom: false,\n })\n\n const attrib = leaflet.control.attribution({position: 'bottomleft'})\n attrib.addAttribution('<a href=\"https://www.thunderforest.com\" target=\"_blank\" style=\"\">Thunderforest</a>')\n attrib.addAttribution('<a href=\"https://www.openaip.net\" target=\"_blank\" style=\"\">openAIP</a>')\n attrib.addAttribution('<a href=\"https://www.openstreetmap.org/copyright\" target=\"_blank\" style=\"\">OpenStreetMap</a> contributors')\n attrib.addAttribution('<a href=\"https://www.openweathermap.org\" target=\"_blank\" style=\"\">OpenWeatherMap</a>')\n\n attrib.addTo(map)\n\n return map\n});\n\n\n//# sourceURL=webpack:///./resources/js/maps/base_map.js?");
/***/ }),
/***/ "./resources/js/maps/config.js":
/*!*************************************!*\
!*** ./resources/js/maps/config.js ***!
\*************************************/
/*! exports provided: PLAN_ROUTE_COLOR, ACTUAL_ROUTE_COLOR */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
eval("__webpack_require__.r(__webpack_exports__);\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"PLAN_ROUTE_COLOR\", function() { return PLAN_ROUTE_COLOR; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"ACTUAL_ROUTE_COLOR\", function() { return ACTUAL_ROUTE_COLOR; });\nlet\n PLAN_ROUTE_COLOR = '#36b123',\n ACTUAL_ROUTE_COLOR = '#172aea'\n\n\n//# sourceURL=webpack:///./resources/js/maps/config.js?");
/***/ }),
/***/ "./resources/js/maps/index.js":
/*!************************************!*\
!*** ./resources/js/maps/index.js ***!
\************************************/
/*! exports provided: render_airspace_map, render_live_map, render_route_map */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
eval("__webpack_require__.r(__webpack_exports__);\n/* harmony import */ var _airspace_map__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./airspace_map */ \"./resources/js/maps/airspace_map.js\");\n/* harmony reexport (safe) */ __webpack_require__.d(__webpack_exports__, \"render_airspace_map\", function() { return _airspace_map__WEBPACK_IMPORTED_MODULE_0__[\"default\"]; });\n\n/* harmony import */ var _live_map__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ./live_map */ \"./resources/js/maps/live_map.js\");\n/* harmony reexport (safe) */ __webpack_require__.d(__webpack_exports__, \"render_live_map\", function() { return _live_map__WEBPACK_IMPORTED_MODULE_1__[\"default\"]; });\n\n/* harmony import */ var _route_map__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! ./route_map */ \"./resources/js/maps/route_map.js\");\n/* harmony reexport (safe) */ __webpack_require__.d(__webpack_exports__, \"render_route_map\", function() { return _route_map__WEBPACK_IMPORTED_MODULE_2__[\"default\"]; });\n\n/**\n * All of the functionality required for maps\n */\n\nwindow.L = __webpack_require__(/*! leaflet */ \"./node_modules/leaflet/dist/leaflet-src.js\")\n__webpack_require__(/*! Leaflet.Geodesic */ \"./node_modules/Leaflet.Geodesic/Leaflet.Geodesic.js\")\n__webpack_require__(/*! leaflet-rotatedmarker */ \"./node_modules/leaflet-rotatedmarker/leaflet.rotatedMarker.js\")\n\n\n\n\n\n\n\n\n//# sourceURL=webpack:///./resources/js/maps/index.js?");
/***/ }),
/***/ "./resources/js/maps/live_map.js":
/*!***************************************!*\
!*** ./resources/js/maps/live_map.js ***!
\***************************************/
/*! exports provided: default */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
eval("__webpack_require__.r(__webpack_exports__);\n/* harmony import */ var _base_map__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./base_map */ \"./resources/js/maps/base_map.js\");\n/* harmony import */ var _config__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ./config */ \"./resources/js/maps/config.js\");\nconst _ = __webpack_require__(/*! lodash */ \"./node_modules/lodash/lodash.js\")\nconst leaflet = __webpack_require__(/*! leaflet */ \"./node_modules/leaflet/dist/leaflet-src.js\")\n\n\n\n\n/**\n * Render the live map\n * @param opts\n * @private\n */\n/* harmony default export */ __webpack_exports__[\"default\"] = ((opts) => {\n\n opts = _.defaults(opts, {\n update_uri: '/api/acars',\n pirep_uri: '/api/pireps/{id}/acars',\n positions: null,\n render_elem: 'map',\n aircraft_icon: '/assets/img/acars/aircraft.png',\n })\n\n const map = Object(_base_map__WEBPACK_IMPORTED_MODULE_0__[\"default\"])(opts)\n const aircraftIcon = leaflet.icon({\n iconUrl: opts.aircraft_icon,\n iconSize: [42, 42],\n iconAnchor: [21, 21],\n })\n\n let layerFlights = null\n let layerSelFlight = null\n let layerSelFlightFeature = null\n let layerSelFlightLayer = null\n\n /**\n * When a flight is clicked on, show the path, etc for that flight\n * @param feature\n * @param layer\n */\n const onFlightClick = (feature, layer) => {\n\n const uri = opts.pirep_uri.replace('{id}', feature.properties.pirep_id)\n\n const flight_route = $.ajax({\n url: uri,\n dataType: 'json',\n error: console.log\n })\n\n $.when(flight_route).done((routeJson) => {\n if (layerSelFlight !== null) {\n map.removeLayer(layerSelFlight)\n }\n\n layerSelFlight = leaflet.geodesic([], {\n weight: 7,\n opacity: 0.9,\n color: _config__WEBPACK_IMPORTED_MODULE_1__[\"ACTUAL_ROUTE_COLOR\"],\n wrap: false,\n }).addTo(map)\n\n layerSelFlight.geoJson(routeJson.line)\n\n layerSelFlightFeature = feature\n layerSelFlightLayer = layer\n //map.fitBounds(layerSelFlight.getBounds());\n })\n }\n\n const updateMap = () => {\n\n console.log('reloading flights from acars...')\n\n /**\n * AJAX UPDATE\n */\n\n let flights = $.ajax({\n url: opts.update_uri,\n dataType: 'json',\n error: console.log\n })\n\n $.when(flights).done(function (flightGeoJson) {\n\n if (layerFlights !== null) {\n layerFlights.clearLayers()\n }\n\n layerFlights = leaflet.geoJSON(flightGeoJson, {\n onEachFeature: (feature, layer) => {\n\n layer.on({\n click: (e) => {\n onFlightClick(feature, layer)\n }\n })\n\n let popup_html = ''\n if (feature.properties && feature.properties.popup) {\n popup_html += feature.properties.popup\n }\n\n layer.bindPopup(popup_html)\n },\n pointToLayer: function (feature, latlon) {\n return leaflet.marker(latlon, {\n icon: aircraftIcon,\n rotationAngle: feature.properties.heading\n })\n }\n })\n\n layerFlights.addTo(map)\n\n if (layerSelFlight !== null) {\n onFlightClick(layerSelFlightFeature, layerSelFlightLayer)\n }\n })\n }\n\n updateMap()\n setInterval(updateMap, 10000)\n});\n\n\n//# sourceURL=webpack:///./resources/js/maps/live_map.js?");
/***/ }),
/***/ "./resources/js/maps/route_map.js":
/*!****************************************!*\
!*** ./resources/js/maps/route_map.js ***!
\****************************************/
/*! exports provided: onFeaturePointClick, pointToLayer, default */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
eval("__webpack_require__.r(__webpack_exports__);\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"onFeaturePointClick\", function() { return onFeaturePointClick; });\n/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, \"pointToLayer\", function() { return pointToLayer; });\n/* harmony import */ var _base_map__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./base_map */ \"./resources/js/maps/base_map.js\");\n/* harmony import */ var _config__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ./config */ \"./resources/js/maps/config.js\");\nconst _ = __webpack_require__(/*! lodash */ \"./node_modules/lodash/lodash.js\")\nconst leaflet = __webpack_require__(/*! leaflet */ \"./node_modules/leaflet/dist/leaflet-src.js\")\n\n\n\n\n/**\n * Show some popup text when a feature is clicked on\n * @param feature\n * @param layer\n */\nconst onFeaturePointClick = (feature, layer) => {\n let popup_html = ''\n if (feature.properties && feature.properties.popup) {\n popup_html += feature.properties.popup\n }\n\n layer.bindPopup(popup_html)\n}\n\n/**\n * Show each point as a marker\n * @param feature\n * @param latlng\n * @returns {*}\n */\nconst pointToLayer = (feature, latlng) => {\n return leaflet.circleMarker(latlng, {\n radius: 12,\n fillColor: '#ff7800',\n color: '#000',\n weight: 1,\n opacity: 1,\n fillOpacity: 0.8\n })\n}\n\n/**\n *\n * @param opts\n * @private\n */\n/* harmony default export */ __webpack_exports__[\"default\"] = ((opts) => {\n\n opts = _.defaults(opts, {\n route_points: null,\n planned_route_line: null,\n actual_route_points: null,\n actual_route_line: null,\n render_elem: 'map',\n })\n\n console.log(opts)\n\n let map = Object(_base_map__WEBPACK_IMPORTED_MODULE_0__[\"default\"])(opts)\n\n let geodesicLayer = leaflet.geodesic([], {\n weight: 7,\n opacity: 0.9,\n color: _config__WEBPACK_IMPORTED_MODULE_1__[\"PLAN_ROUTE_COLOR\"],\n steps: 50,\n wrap: false,\n }).addTo(map)\n\n geodesicLayer.geoJson(opts.planned_route_line)\n\n try {\n map.fitBounds(geodesicLayer.getBounds())\n } catch (e) {\n console.log(e)\n }\n\n // Draw the route points after\n if (opts.route_points !== null) {\n let route_points = leaflet.geoJSON(opts.route_points, {\n onEachFeature: onFeaturePointClick,\n pointToLayer: pointToLayer,\n style: {\n 'color': _config__WEBPACK_IMPORTED_MODULE_1__[\"PLAN_ROUTE_COLOR\"],\n 'weight': 5,\n 'opacity': 0.65,\n },\n })\n\n route_points.addTo(map)\n }\n\n /**\n * draw the actual route\n */\n\n if (opts.actual_route_line !== null && opts.actual_route_line.features.length > 0) {\n let geodesicLayer = leaflet.geodesic([], {\n weight: 7,\n opacity: 0.9,\n color: _config__WEBPACK_IMPORTED_MODULE_1__[\"ACTUAL_ROUTE_COLOR\"],\n steps: 50,\n wrap: false,\n }).addTo(map)\n\n geodesicLayer.geoJson(opts.actual_route_line)\n\n try {\n map.fitBounds(geodesicLayer.getBounds())\n } catch (e) {\n console.log(e)\n }\n }\n\n if (opts.actual_route_points !== null && opts.actual_route_points.features.length > 0) {\n let route_points = leaflet.geoJSON(opts.actual_route_points, {\n onEachFeature: onFeaturePointClick,\n pointToLayer: pointToLayer,\n style: {\n 'color': _config__WEBPACK_IMPORTED_MODULE_1__[\"ACTUAL_ROUTE_COLOR\"],\n 'weight': 5,\n 'opacity': 0.65,\n },\n })\n\n route_points.addTo(map)\n }\n});\n\n\n//# sourceURL=webpack:///./resources/js/maps/route_map.js?");
/***/ })
/******/ });
Reference in New Issue View Git Blame Copy Permalink